|
Category: flavor and fragrance agents
US / EU / FDA / JECFA / FEMA / FLAVIS / Scholar / Patent Information:
Physical Properties:
| Appearance: | colorless to pale yellow clear liquid (est) |
| Food Chemicals Codex Listed: | Yes |
| Specific Gravity: | 0.89800 to 0.92200 @ 25.00 °C.
|
| Pounds per Gallon - (est).: | 7.472 to 7.672
|
| Specific Gravity: | 0.89300 to 0.91600 @ 20.00 °C.
|
| Pounds per Gallon - est.: | 7.439 to 7.631
|
| Refractive Index: | 1.46600 to 1.47000 @ 20.00 °C.
|
| Boiling Point: | 175.00 to 176.00 °C. @ 760.00 mm Hg
|
| Saponification Value: | 1.50
|
| Vapor Pressure: | 2.000000 mmHg @ 20.00 °C. |
| Flash Point: | 114.00 °F. TCC ( 45.56 °C. )
|
| Shelf Life: | 24.00 month(s) or longer if stored properly. |
| Storage: | store in cool, dry place in tightly sealed containers, protected from heat and light. |
| Soluble in: |
| | ethyl alcohol, 1 to 10 vol. of 80% alcohol | | | paraffin oil | | | water, 1186 mg/L @ 25 °C (est) |
| Insoluble in: |
| | water |
| Stability: |
| | bath foam | | | cream | | | hair spray | | | lotion | | | non-discoloring in most media | | | shampoo | | | soap |
Organoleptic Properties:
| |
| Odor Type: herbal |
| |
| Odor Strength: | medium , recommend smelling in a 10.00 % solution or less |
| |
| Substantivity: | 4 hour(s) at 100.00 % |
| |
| | herbal camphoreous woody aromatic minty balsamic medicinal phenolic |
Odor Description: at 10.00 % in dipropylene glycol. | herbal camphoreous woody aromatic minty balsamic medicinal phenolic Luebke, William tgsc, (1989) |
| |
| |
| Flavor Type: herbal |
| |
| | herbal camphoreous minty aromatic woody balsamic medicinal phenolic |
Taste Description:
| herbal camphoreous minty aromatic woody balsamic medicinal phenolic Luebke, William tgsc, (1989) |
| |
| Odor and/or flavor descriptions from others (if found). |
| |
| Takasago |
| Rosemary Sureste TICO |
| Odor Description: | Herbal, camphoraceous, eucalyptus, woody Used in soap/technical products. Also serves as an ingredient in rubefacients and liniments. Used in spice and seasoning applications. |
| |
| Moellhausen |
| ROSEMARY EO SPAIN |
| Odor Description: | fresh, herbaceous, balsamic, eucalyptol |
| Taste Description: | aromatic, fresh, camphoraceous |
| |
| Robertet |
| Rosemary Colorless Spain |
| Odor Description: | The final liquid orange-yellow extract is developing the aromatic, woody, balsamic and very natural typical odor of the plant, without the camphor connotation in the background Rosmarinus officinalis is first processed through volatile solvents and then codistilled on thriethyl citrate. |
| |
| |
Cosmetic Information:
Suppliers:
| Albert Vieille SAS |
| Rosemary Essential oil Spain
Odor: medicinal Use: Rosemary is an elegant, very leafy shrub that grows about a meter high. The erect branches are covered with dark-green, needle-shaped leaves with a silvery underside. They emit a powerful, bracing, very aromatic smell when crushed. The plant's small flowers are pale-blue to lilac in color with tiny purple dots on the insides. The flowering branches are sickle-harvested in the wild. Rosemary flowers throughout the year, but the most intense blooming periods are spring and autumn. The cut plants are then left to dry in the shade for a day or two prior to distillation. Rosemary has two different chemotypes: the Spanish camphor chemotype and the cineole chemotype from Morocco and Tunisia. The Spanish chemotype exudes a potent, medicinal, camphoraceous fragrance with herbaceous and green notes. |
| Harvest Calendar |
| Berjé |
| Rosemary Oil Spanish
|
| Media |
| Bontoux |
| ROSEMARY SPAIN ESSENTIAL OIL
|
| Camden-Grey Essential Oils |
| Rosemary essential oil, Bulk
Odor: characteristic Use: Might antidote homeopathic remedies. Clears the head and aids memory, good for mental strain. Helps ease gout and tired, overworked muscles, tired or weak legs and circulatory problems of extremities, as well as cold feet. Since it stimulates blood circulation, it is a good remedy for low blood pressure. It is an excellent tonic for the liver and gall bladder. Said to help lower high blood sugar. Used in shampoo and hair treatments, it helps stimulate blood circulation to the scalp; thus, it is being beneficial for promoting hair growth. |
| Camden-Grey Essential Oils |
| Rosemary essential oil
Odor: characteristic Use: Rosemary EO has a strong, clear, penetrating, camphoraceous and herbaceous aroma. It is said to be analgesic, antidepressant, antirheumatic, antiseptic, antispasmodic, astringent, cicatrisant, digestive, diuretic, hypertensive and rubefacient. This EO may not be suitable for people with epilepsy or high blood pressure. Avoid in pregnancy since it is an emmenagogue. |
| Charkit Chemical |
| ROSEMARY OIL SPANISH TYPE
|
| Elixens America |
| Rosemary Oil (Camphor) Spain
Certified Organic |
| Ernesto Ventós |
| ROSEMARY OIL, SPAIN
Odor: STRONG, FRESH, WOODY, HERBACEOUS |
| Esencias Martínez Lozano |
| Rosemary - Camphor Type Oil Organic
|
| Esencias Martínez Lozano |
| Rosemary - Camphor Type Oil
|
| Excellentia International |
| Rosemary Oil Spanish Type
|
| Garcia Palomo Essences |
| Rosemary Oil Spain
|
| George Uhe Company |
| Rosemary Oil Spain
Available in FCC |
| Indukern F&F |
| ROSEMARY OIL BIO SPAIN
Odor: CHARACTERISTIC, CAMPHORATED, WILD |
| Indukern F&F |
| ROSEMARY OIL SPAIN
Odor: AROMATIC, BALSAMIC, CAMPHORATED |
| Kanta Enterprises |
| Rosemary Spain Oil
|
| Lluch Essence |
| ROSEMARY SPAIN OIL
|
| Lluch Essence |
| ROSEMARY SPAIN ORGANIC ESS. OIL
|
| Moellhausen |
| ROSEMARY EO SPAIN
|
| Moellhausen |
| ROSEMARY EO SPAIN
Odor: fresh, herbaceous, balsamic, eucalyptol Flavor: aromatic, fresh, camphoraceous |
| Penta International |
| ROSEMARY OIL SPANISH
|
| Phoenix Aromas & Essential Oils |
| Rosemary Oil Spanish
|
| Quimdis |
| Rosemary Oil Spain
|
| Robertet |
| Rosemary Colorless Spain
Odor: The final liquid orange-yellow extract is developing the aromatic, woody, balsamic and very natural typical odor of the plant, without the camphor connotation in the background Use: Rosmarinus officinalis is first processed through volatile solvents and then codistilled on thriethyl citrate. |
| Seasons and Harvest / Crop calendar |
| The John D. Walsh Company |
| Rosemary Oil, Spanish
|
| The Lebermuth Company |
| Rosemary Spanish
Odor: Camphor, woody balsam, herbal, minty |
| Spring/Summer 2022 Fragrance Trends |
| The Lebermuth Company |
| Rosemary Verbenone Organic Oil
Odor: Rosemary |
| The Lermond Company |
| ROSEMARY OIL, SPANISH N&A
|
| The Lermond Company |
| ROSEMARY OIL, SPANISH P&N - AV
|
| The Perfumers Apprentice |
| Rosemary (Spain) J.Steele
|
| The Perfumery |
| Rosemary oil, ct. camphor, Spain
Odor: characteristic Use: This variety of Rosemary oil has a high camphor content making the aroma more camphoraceous and fresh along with the herbal, balsamic character of Rosemary. This is a very fresh, affordable alternative to other Rosemary oils. It blends well with Bergamot, Cedarwood, Eucalyptus, Fir, Frankincense, and Tea Tree. |
| Ultra International |
| Rosemary Oil Spain
|
| Crop Calendar |
| Ungerer & Company |
| Rosemary Oil FCC
|
| Vigon International |
| ROSEMARY OIL SPANISH 100% PURE
|
| Zanos |
| Rosemary Oil
|
Safety Information:
| European information : |
| Most important hazard(s): | | Xn - Harmful. |
R 10 - Flammable. R 22 - Harmful if swallowed. R 36/38 - Irritating to skin and eyes. R 43 - May cause sensitisation by skin contact. R 50/53 - Very toxic to aquatic organisms, may cause long-term adverse effects in the aquatic environment. R 65 - Harmful: may cause lung damage if swallowed. R 68 - Possible risk of irreversible effects. S 02 - Keep out of the reach of children. S 16 - Keep away from sources of ignition - No Smoking. S 24 - Avoid contact with skin. S 26 - In case of contact with eyes, rinse immediately with plenty of water and seek medical advice. S 36/37/39 - Wear suitable clothing, gloves and eye/face protection. S 61 - Avoid release to the environment. Refer to special instructions/safety data sheet. S 62 - If swallowed, do not induce vomiting: seek medical advice immediately and show this container or label.
|
| |
| Hazards identification |
| |
| Classification of the substance or mixture |
| GHS Classification in accordance with 29 CFR 1910 (OSHA HCS) |
| None found. |
| GHS Label elements, including precautionary statements |
| |
| Pictogram | |
| |
| Hazard statement(s) |
| None found. |
| Precautionary statement(s) |
| None found. |
| Oral/Parenteral Toxicity: |
oral-rat LD50 5000 mg/kg Food and Cosmetics Toxicology. Vol. 12, Pg. 977, 1974.
|
| Dermal Toxicity: |
skin-rabbit LD50 > 10000 mg/kg Food and Cosmetics Toxicology. Vol. 12, Pg. 977, 1974.
|
| Inhalation Toxicity: |
|
Not determined
|
Safety in Use Information:
| Category: | flavor and fragrance agents |
| RIFM Fragrance Material Safety Assessment: Search |
| IFRA Code of Practice Notification of the 49th Amendment to the IFRA Code of Practice |
| Recommendation for rosemary oil spain usage levels up to: | | | 10.0000 % in the fragrance concentrate.
|
| |
| Use levels for FEMA GRAS flavoring substances on which the FEMA Expert Panel based its judgments that the substances are generally recognized as safe (GRAS). |
| The Expert Panel also publishes separate extensive reviews of scientific information on all FEMA GRAS flavoring substances and can be found at FEMA Flavor Ingredient Library |
| publication number: 3 |
| Click here to view publication 3 |
| | average usual ppm | average maximum ppm |
| baked goods: | - | 6.30000 |
| beverages(nonalcoholic): | - | 3.60000 |
| beverages(alcoholic): | - | - |
| breakfast cereal: | - | - |
| cheese: | - | - |
| chewing gum: | - | - |
| condiments / relishes: | - | 2.90000 |
| confectionery froastings: | - | - |
| egg products: | - | - |
| fats / oils: | - | - |
| fish products: | - | - |
| frozen dairy: | 0.50000 | 4.00000 |
| fruit ices: | 0.50000 | 4.00000 |
| gelatins / puddings: | - | - |
| granulated sugar: | - | - |
| gravies: | - | - |
| hard candy: | - | 7.50000 |
| imitation dairy: | - | - |
| instant coffee / tea: | - | - |
| jams / jellies: | - | - |
| meat products: | - | 40.00000 |
| milk products: | - | - |
| nut products: | - | - |
| other grains: | - | - |
| poultry: | - | - |
| processed fruits: | - | - |
| processed vegetables: | - | - |
| reconstituted vegetables: | - | - |
| seasonings / flavors: | - | - |
| snack foods: | - | - |
| soft candy: | - | - |
| soups: | - | - |
| sugar substitutes: | - | - |
| sweet sauces: | - | - |
Safety References:
References:
| | rosmarinus officinalis l. leaf oil |
| Canada Domestic Sub. List: | 8000-25-7 |
| Pubchem (sid): | 135307489 |
Other Information:
Potential Blenders and core components note
| |
| For Odor |
| No odor group found for these |
| | eremophila mitchelli wood oil australia | FR |
| | rose distillates | FL/FR |
| aldehydic |
| | adoxal (Givaudan) | FL/FR |
| 6,7,8- | decen-1-ol | FR |
| 9- | decenal | FL/FR |
| | geranyl oxyacetaldehyde | FR |
| | intreleven aldehyde (IFF) | FR |
| | nonanal (aldehyde C-9) | FL/FR |
| | nonanal diethyl acetal | FL/FR |
| 10- | undecenal (aldehyde C-11 undecylenic) | FL/FR |
| | undecenal mixture (aldehyde C-11 mixed) | FL/FR |
| animal |
| para- | cresyl phenyl acetate | FL/FR |
| aromatic |
| | aromatic woody citrus floral fragrance | FR |
| | damascone carboxylate | FR |
| balsamic |
| | amyris wood oil | FL/FR |
| | balsam fir oleoresin | FL/FR |
| siam | benzoin resin | FL/FR |
| siam | benzoin resinoid | FL/FR |
| | benzophenone | FR |
| laevo- | borneol | FL/FR |
| dextro,laevo- | borneol | FL/FR |
| dextro,laevo-iso | borneol | FL/FR |
| laevo- | bornyl acetate | FL/FR |
| iso | bornyl acetate | FL/FR |
| iso | bornyl formate | FL/FR |
| iso | bornyl isobutyrate | FL/FR |
| iso | bornyl methyl ether | FL/FR |
| iso | bornyl propionate | FL/FR |
| | brachyleana hutchinsii wood oil | FR |
| | callitropsis araucarioides wood oil | FR |
| | cinnamyl cinnamate | FL/FR |
| | cistus leaf oil | FR |
| | conifer acetate | FR |
| | copaiba balsam oil | FL/FR |
| | copaifera reticulata extract | FL/FR |
| | croton glabellus bark extract | FL/FR |
| | fir balsam absolute (abies balsamea) | FR |
| | fir needle oil canada | FL/FR |
| | fir needle oil terpeneless canada | FL/FR |
| | geranyl benzoate | FL/FR |
| | geranyl cinnamate | FR |
| | guaiyl butyrate | FR |
| | gurjun balsam | FR |
| | hemlock western oil (tsuga heterophylla) canada | FR |
| | juniper absolute | FL/FR |
| | juniper berry absolute | FL/FR |
| | juniper berry oil CO2 extract | FL/FR |
| | methyl hydrogenated rosinate | FR |
| | myrrh absolute | FL/FR |
| | myrrh gum | FL/FR |
| | myrrh oil | FL/FR |
| | myrrh resin | FL/FR |
| | myrrh resinoid | FR |
| | opoponax absolute (balsamodendron kafal) | FL/FR |
| | opoponax absolute (commiphora erythraea var. glabrescens engle) | FL/FR |
| | opoponax resinoid (commiphora erythraea var. glabrescens engle) | FR |
| | peru balsam absolute | FL/FR |
| | phenethyl cinnamate | FL/FR |
| scotch | pine wood/needles resinoid | FR |
| | pistacia lentiscus gum water | FR |
| | sclareol | FL/FR |
| | styrax speciality | FR |
| | terpinyl butyrate | FL/FR |
| | tolu balsam resin | FL/FR |
| | valeriana wallichii root oil | FR |
| camphoreous |
| dextro- | bornyl acetate | |
| | bornyl ethyl ether | |
| | camphor tree bark oil | FL/FR |
| 2,6- | dimethyl-3-oxatricyclo(4.2.1.0*2,4*)nonane | FR |
| laevo- | fenchone | FL/FR |
| | herbal ethanone | FR |
| chocolate |
| iso | amyl phenyl acetate | FL/FR |
| | cocoa pentenal | FL/FR |
| 1,3,3,4,5,6- | hexamethyl(2.2.2)bicyclooct-5-en-2-ol | |
| citrus |
| | abronia fragrance | FR |
| | bergamot oil | FL/FR |
| | bergamot oil bergaptene reduced italy | FL/FR |
| | citronella fragrance | FR |
| | citronella oil ceylon | FL/FR |
| | citronella oil ceylon replacer | FR |
| | citronella oil java | FR |
| | citronella oil java replacer | FR |
| | citronitrile (Symrise) | FR |
| | dipentene | FL/FR |
| | lemon balm fragrance | FR |
| | melissa oil replacer | FR |
| | myrcenyl acetate | FL/FR |
| lemon scented | tea tree oil | FR |
| earthy |
| | bornyl methyl ether | |
| | dibenzyl ether | FL/FR |
| (-)-alpha- | fenchol | FL/FR |
| | methyl undecylenate | FL/FR |
| ethereal |
| | ethyl formate | FL/FR |
| fatty |
| 2- | decen-1-ol | FL/FR |
| (E)-2- | decen-1-ol | FL/FR |
| 2- | decenal | FL/FR |
| | decyl oxyacetaldehyde | FR |
| | methyl 10-undecenoate | FL/FR |
| iso | octanol | FR |
| fir needle |
| | abies amabilis oil canada | FR |
| floral |
| | acetaldehyde dibutyl acetal | FL/FR |
| | achillea millefolium herb oil CO2 extract | FL/FR |
| | aeolanthus graveolens oil | FR |
| alpha- | amyl cinnamaldehyde | FL/FR |
| iso | amyl geranate | FR |
| iso | amyl undecylenate | FL/FR |
| mountain | ash blossom fragrance | FR |
| | azalea fragrance | FR |
| | benzoinett specialty | FR |
| | benzyl alcohol | FL/FR |
| | benzyl phenyl acetate | FL/FR |
| | blue mist fragrance | FR |
| | bois de rose fragrance | FR |
| | bois de rose oil brazil | FL/FR |
| | bois de rose oil peru | FL/FR |
| | bois de rose oil replacer | FR |
| | butyl nonanoate | FL/FR |
| | cananga oil | FL/FR |
| | cananga oil china | FL/FR |
| | cassis buteneone | FR |
| | cassis oxime 10% | FR |
| | cherry blossom fragrance | FR |
| | citronellal | FL/FR |
| | citronellal diisotridecyl acetal | FR |
| | citronellol | FL/FR |
| laevo- | citronellol | FL/FR |
| (R)-(+)-beta- | citronellol | FL/FR |
| | citronellyl acetate | FL/FR |
| (S)- | citronellyl acetate | FL/FR |
| | citronellyl acetone | FL/FR |
| | citronellyl anthranilate | FL/FR |
| | citronellyl benzoate | FL/FR |
| | citronellyl ethoxalate | FR |
| | citronellyl ethyl ether | FR |
| | citronellyl formate | FL/FR |
| | citronellyl hexanoate | FL/FR |
| | citronellyl isovalerate | FL/FR |
| | citronellyl phenyl acetate | FL/FR |
| | citronellyl propionate | FL/FR |
| (E)- | citronellyl tiglate | FL/FR |
| | citronellyl valerate | FL/FR |
| | citrus propanol | FR |
| 2-para- | cresyl ethanol | FL/FR |
| para- | cresyl phenyl ether | |
| iso | cyclodimethyl octanol | FR |
| 3- | cyclohexene-1-carboxylic acid, 2,6,6-trimethyl-, methyl ester | FR |
| | cyclohexyl ethyl acetate | FL/FR |
| | cyclohexyl ethyl alcohol | FL/FR |
| 4-(1- | cyclopenten-1-yl)-1-butanol | |
| | cymbopogon validus leaf oil | FR |
| | dahlia fragrance | FR |
| | damascate | FR |
| beta- | damascenone | FL/FR |
| gamma- | damascone | FR |
| (Z)-alpha- | damascone | FL/FR |
| delta- | damascone | FL/FR |
| 2- | decalinol | FR |
| 9- | decen-1-ol | FL/FR |
| (Z)-4- | decen-1-yl acetate | FL/FR |
| | dewy propionate | FR |
| | dihydrocarvyl acetate | FL/FR |
| | dihydrocitronellyl ethyl ether | FR |
| | dihydroisojasmonate methyl ester | FR |
| | dihydromyrcene | FR |
| | dihydrorose oxide | FR |
| | dimethyl benzyl carbinol | FL/FR |
| | dimethyl benzyl carbinyl acetate | FL/FR |
| | dimethyl octanol | FL/FR |
| 3,6- | dimethyl-3-octanol | FL/FR |
| | ethyl hydrocinnamate | FL/FR |
| | ethyl linalyl acetate | FR |
| | ethyl phenoxyacetate | FR |
| | ethyl phenyl acetate | FL/FR |
| | ethyl safranate | FR |
| | eucalyptus macarthurii oil | FR |
| | farnesol | FL/FR |
| | farnesyl acetate | FL/FR |
| | floral pyran | FR |
| | floral undecenone | FR |
| | genet concrete | FR |
| | geraniol | FL/FR |
| | geranium nitrile | FR |
| | geranium oil africa | FL/FR |
| | geranium oil bourbon | FL/FR |
| | geranium oil bourbon replacer | FR |
| | geranium oil china | FL/FR |
| | geranium oil egypt | FL/FR |
| | geranium oil egypt fractions | FR |
| | geranium oil morocco | FL/FR |
| | geranium oil replacer | FR |
| | geranium oil terpeneless | FL/FR |
| | geranium petiole oil india | FL/FR |
| | geranium rose oil | FL/FR |
| | geranium rose-scented oil cuba | FR |
| | geranium specialty | FR |
| | geranyl acetate | FL/FR |
| | geranyl acetone | FL/FR |
| (E)- | geranyl acetone | FL/FR |
| | geranyl anthranilate | FR |
| | geranyl formate | FL/FR |
| | geranyl hexanoate | FL/FR |
| | geranyl isobutyrate | FL/FR |
| (E)- | geranyl linalool | FL/FR |
| | geranyl nonanoate | CS |
| | geranyl phenyl acetate | FL/FR |
| | geranyl propionate | FL/FR |
| | geranyl valerate | FL/FR |
| | glycoacetal | FR |
| | hancornia specialty | FR |
| | hawthorn ethanol | FR |
| | heptanal cyclic trimethylene acetal | |
| | heptyl nonanoate | FL/FR |
| | heptyl propionate | FL/FR |
| | hibiscus fragrance | FR |
| | ho leaf oil | FR |
| | ho wood oil | FR |
| | hovenia specialty | FR |
| | hyacinth acetals | FL/FR |
| | hyacinth fragrance | FR |
| | hyacinth specialty | FR |
| | hydroxycitronellal dimethyl acetal | FL/FR |
| | hydroxycitronellol | FL/FR |
| beta- | ionol | FL/FR |
| | japan flowers fragrance | FR |
| | kiwi blossom fragrance | FR |
| | linalool oxide (furanoid) | FL/FR |
| | linalool terpenes | FR |
| | linalyl acetate terpenes | FR |
| | linalyl phenyl acetate | FL/FR |
| | linalyl propionate | FL/FR |
| southern | magnolia leaf oil fractions | FR |
| (3- | methoxy-2-methyl propyl) benzene | FR |
| ortho- | methoxybenzyl ethyl ether | FR |
| | methyl citronellate | FL/FR |
| 2- | methyl octanal | FL/FR |
| | methyl trans-3-oxo-2-pentyl cyclopentane carboxylate | FR |
| | mimusops elengi flower oil | FR |
| | muguet butanol | FR |
| | muguet carbinol | FL/FR |
| | muguet ethanol | FR |
| | musk acetate | FR |
| | narcissus acetate | FL/FR |
| | neryl acetate | FL/FR |
| | neryl benzoate | FL/FR |
| | neryl ethyl ether | FR |
| | neryl formate | FL/FR |
| | neryl isovalerate | FL/FR |
| | neryl phenyl acetate | FR |
| | nonanal / methyl anthranilate schiff's base | FR |
| | nonanol | FL/FR |
| | nonyl heptanoate | |
| | nonyl nonanoate | |
| | nonyl octanoate | FL/FR |
| | octyl isovalerate | FL/FR |
| bitter | orangeflower absolute morocco | FL/FR |
| | orchid fragrance | FR |
| | orchid specialty | FR |
| 2- | pentyl cyclopentanone | FR |
| | peony alcohol | FR |
| | peony fragrance | FR |
| | phenethyl acetate | FL/FR |
| | phenethyl alcohol | FL/FR |
| beta- | phenethyl angelate | |
| | phenethyl anthranilate | FL/FR |
| | phenethyl benzoate | FL/FR |
| | phenethyl formate | FL/FR |
| | phenethyl heptanoate | FL/FR |
| | phenethyl isobutyrate | FL/FR |
| | phenethyl isovalerate | FL/FR |
| | phenethyl lactate | FL/FR |
| | phenethyl phenyl acetate | FL/FR |
| | phenethyl propionate | FL/FR |
| | phenethyl salicylate | FL/FR |
| 2- | phenethyl valerate | FL/FR |
| | phenoxyethanol | FL/FR |
| | phenyl acetaldehyde digeranyl acetal | FR |
| | phenyl acetaldehyde diisobutyl acetal | FL/FR |
| | phenyl amyl alcohol | FL/FR |
| | phenyl glycol phenyl acetate | |
| 3- | phenyl propionic acid | FL/FR |
| | phenyl propyl phenyl acetate | FR |
| | plum blossom fragrance | FR |
| | plum damascone | FR |
| | pomarose | FR |
| | primrose fragrance | FR |
| | privet blossom fragrance | FR |
| iso | propyl phenyl acetate | FL/FR |
| | rhodinol | FL/FR |
| | rhodinol substitues | FL/FR |
| | rhodinyl acetate | FL/FR |
| | rhodinyl acetate substitutes | FL/FR |
| | rhodinyl benzoate | FR |
| | rhodinyl butyrate | FL/FR |
| | rhodinyl formate | FL/FR |
| | rhodinyl isobutyrate | FL/FR |
| | rhodinyl propionate | FL/FR |
| | rosa alba flower oil CO2 extract | FR |
| | rosa damascena flower oil | FL/FR |
| | rosa damascena flower oil CO2 extract | FL/FR |
| | rosa odorata flower oil | FR |
| | rose absolute | FL/FR |
| | rose absolute (rosa centifolia) | FL/FR |
| | rose absolute (rosa centifolia) morocco | FL/FR |
| | rose absolute (rosa damascena) bulgaria | FL/FR |
| | rose absolute (rosa damascena) turkey | FL/FR |
| | rose absolute pentanol | FR |
| | rose absolute replacer | FR |
| | rose acetate | FR |
| | rose blossom pentanol | FR |
| | rose butanoate | FL/FR |
| | rose carbonate | FR |
| | rose carboxylate | FR |
| | rose concrete (rosa centifolia) | FR |
| | rose concrete (rosa damascena) | FR |
| | rose d'orient fragrance | FR |
| | rose fragrance | FR |
| white | rose fragrance | FR |
| tea | rose fragrance | FR |
| | rose geranium fragrance | FR |
| | rose oil (rosa centifolia) egypt | FL/FR |
| | rose oil (rosa damascena) bulgaria | FL/FR |
| | rose oil (rosa damascena) iran | FL/FR |
| | rose oil (rosa damascena) russia | FL/FR |
| | rose oil (rosa damascena) turkey | FL/FR |
| | rose oil replacer | FR |
| laevo- | rose oxide | FL/FR |
| | rose petal acetate | FR |
| | rose petal fragrance | FR |
| | rose pyran | FR |
| white | rose specialty | FR |
| | rose specialty | FR |
| red | rose specialty | FR |
| | rose undecene | FR |
| | styralyl propionate | FL/FR |
| | tetrahydrogeraniol | FR |
| (S)-2,5,6- | trimethyl-2-heptanol | |
| 2- | undecen-1-ol | FL/FR |
| (E)-2- | undecen-1-ol | FL/FR |
| | windsor soap fragrance | FR |
| fresh |
| | decyl vinyl ether | FR |
| 10- | undecen-1-yl acetate | FL/FR |
| fruity |
| | allyl isononylate | FR |
| 3- | allyl oxy-1,4-dimethyl bicyclo(3.2.1)octane | FR |
| | apricot isobutyrate | FR |
| 6- | benzyl-2,6-dimethyl-2-cyclohexen-1-one | |
| | butyl propionate | FL/FR |
| meta- | cresyl phenyl ether | |
| (E)-beta- | damascenone | FL/FR |
| beta- | damascone | FL/FR |
| (E)-beta- | damascone | FL/FR |
| (E)-alpha- | damascone | FL/FR |
| | decen-1-yl cyclopentanone | FL/FR |
| | decyl butyrate | FL/FR |
| | ethyl citronellate | FL/FR |
| | ethyl para-methyl-beta-phenyl glycidate | FR |
| (E,Z)-6- | ethyl-5,7-dimethyl-2,5-octadien-4-one | FR |
| | fruity butanate | FR |
| | geranyl 2-methyl butyrate | FL/FR |
| | geranyl acetoacetate | FL/FR |
| | geranyl butyrate | FL/FR |
| | geranyl methyl tiglate | |
| cis- | green acetate | FR |
| | methyl bicycloheptenyl methyloxirane carboxylate | FR |
| | octyl formate | FL/FR |
| | phenoxyethyl propionate | FL/FR |
| | plum crotonate | FR |
| | plum damascone (high alpha) | FR |
| (E,E)- | pomarose | FR |
| | propyl angelate | |
| | strawberry glycidate 2 | FL/FR |
| 1,3,3,5- | tetramethyl-7 and 8-acetyl bicyclo(2.2.2)oct-5-ene | |
| | thesaron (Takasago) | FR |
| green |
| iso | amyl 3-(2-furan) propionate | FL/FR |
| | benzhydrol | FR |
| | biphenyl | |
| | chrysanthemum oxide | FL/FR |
| | cucumber rose melon fragrance | FR |
| iso | decanal | FL/FR |
| 2,6- | dimethyl octanal | FL/FR |
| 1,5- | dimethyl-3-isopropyl-2-oxabicyclo(2.2.2)octane | |
| 3,7- | dimethyl-6-octenoic acid | FL/FR |
| | diphenyl oxide | FL/FR |
| alpha- | elemol | FL/FR |
| | galbanum oleoresin | FL/FR |
| | galbanum resinoid | FL/FR |
| | geranium absolute | FL/FR |
| | green ether | FL/FR |
| 2- | heptyl tetrahydrofuran | FR |
| (Z)-3- | hexen-1-yl phenyl acetate | FL/FR |
| | hexyl phenyl acetate | FL/FR |
| | magnolia flower oil | FL/FR |
| | magnolia leaf oil | FL/FR |
| [(4E,4Z)-5- | methoxy-3-methyl-4-penten-1-yl] benzene | FR |
| | octanal dimethyl acetal | FL/FR |
| | perilla alcohol | FL/FR |
| | phenethyl acetal | FR |
| | phenethyl isopropyl ether | FR |
| | phenethyl oxyacetaldehyde | FR |
| | phenethyl tiglate | FL/FR |
| | phenoxyethyl isobutyrate | FL/FR |
| | phenyl acetaldehyde dimethyl acetal | FL/FR |
| | phenyl hexyl acetate | FR |
| | rosa damascena leaf absolute | FR |
| | rose leaf absolute (rosa centifolia) | FL/FR |
| | valerian rhizome oil CO2 extract china | FL/FR |
| herbal |
| 1- | allyl-2,2,7,7-tetramethyl cycloheptanol | FR |
| | alpine bouquet fragrance | FR |
| | anethum graveolens herb oil | FL/FR |
| | apium graveolens seed oil | FL/FR |
| | artemisia vestita wall. leaf oil | FR |
| | barosma betulina leaf oil | FL/FR |
| | cajuput oil replacer | FR |
| | calendula officinalis flower oil CO2 extract | FR |
| | cananga fruit oil | FR |
| | canarium luzonicum gum | FL/FR |
| | carum carvi fruit oil | FL/FR |
| | celery seed oil replacer | FR |
| | celery specialty | FR |
| | chamomile absolute | FL/FR |
| | chamomile oil morocco | FR |
| | chamomile valerate | FR |
| 1,8- | cineole | FL/FR |
| iso | dihydrolavandulol | FR |
| | dimethyl cyclormol (IFF) | FR |
| 2,10- | epoxypinane | FR |
| | eucalyptus globulus oil | FL/FR |
| | eucalyptus oil replacer | FR |
| | eucalyptus radiata leaf/stem oil | FR |
| | geranic oxide | FL/FR |
| | geranium concrete | FL/FR |
| | geranium cyclohexane | FR |
| | geranyl octanoate | FL/FR |
| | herbal dioxane | FR |
| | herbal undecanol | FR |
| | hyssopus officinalis extract | FL/FR |
| | hyssopus officinalis leaf tincture | FL/FR |
| | juniparome (Takasago) | FR |
| | laurel bark oil | |
| | laurel stem oil | |
| | laurus nobilis leaf oil | FL/FR |
| | lavandin absolute | FL/FR |
| | lavandin absolute decolorized | FL/FR |
| | lavandin concrete | FL/FR |
| | lavandula stoechas oil | FR |
| spike | lavender absolute | FL/FR |
| | lavender absolute france | FL/FR |
| spike | lavender oil | FL/FR |
| spike | lavender oil replacer | FR |
| spike | lavender oil spain | FL/FR |
| | linalyl formate | FL/FR |
| | marigold pot flower oil | FL/FR |
| | melaleuca leucadendron cajaputi oil | FL/FR |
| | melaleuca leucadendron var. cajuputi leaf oil | FL/FR |
| laevo- | menthyl isobutyrate | |
| laevo- | menthyl propionate | FL/FR |
| | methyl cyclogeranate (Firmenich) | FR |
| | myrtenol | FL/FR |
| | niaouli oil | FR |
| 3- | octyl acetate | FL/FR |
| | origanum oil | FL/FR |
| | origanum oil greece | FL/FR |
| laevo- | perillaldehyde | FL/FR |
| beta- | pinene | FL/FR |
| D-(+)-alpha- | pinene | FL/FR |
| alpha- | pinene | FL/FR |
| | pinocarveol | FL/FR |
| | romanal | FR |
| | rose oil (rosa centifolia) morocco | FL/FR |
| | rosemary absolute | FL/FR |
| | rosemary concrete | FR |
| | rosemary essence | FL/FR |
| | rosemary fragrance | FR |
| | rosemary leaf | CS |
| | rosemary oil | FL/FR |
| | rosemary oil africa | FL/FR |
| | rosemary oil china | FL/FR |
| | rosemary oil CO2 extract | FL/FR |
| | rosemary oil corsica | FL/FR |
| | rosemary oil egypt | FL/FR |
| | rosemary oil france | FL/FR |
| | rosemary oil morocco | FL/FR |
| | rosemary oil replacer | FR |
| | rosemary oil terpeneless | FL/FR |
| | rosemary oil tunisia | FL/FR |
| | rosemary oil turkey | FL/FR |
| | rosemary oleoresin | FL/FR |
| | rosemary specialty | FR |
| | rosemary stem oil | FR |
| | rosmarinus officinalis distillates | FR |
| | rosmarinus officinalis extract | FL/FR |
| | rosmarinus officinalis leaf extract | FL/FR |
| | rosmarinus officinalis leaf water | FR |
| | rosmarinus officinalis tincture | FL/FR |
| | sabinene hydrate | FL/FR |
| | safranal | FL/FR |
| | sage absolute spain | FL/FR |
| green | tea leaf absolute | FL/FR |
| | theaspirane | FL/FR |
| white | thyme oil | FL/FR |
| 4,4,6- | trimethyl-2-phenyl-1,3-dioxane | FR |
| | valerian rhizome oil | FL/FR |
| | valerian rhizome oil china | FL/FR |
| honey |
| | allyl phenyl acetate | FL/FR |
| | butyl phenyl acetate | FL/FR |
| | phenethyl furoate | FL/FR |
| | propyl phenyl acetate | FL/FR |
| mentholic |
| laevo- | menthol | FL/FR |
| laevo- | menthyl acetate | FL/FR |
| | peppermint cyclohexanone | FL/FR |
| minty |
| | agathosma crenulata leaf oil | FL/FR |
| | artemisia deserti krasch. oil iran | FR |
| | betula lenta bark oil america | FL/FR |
| | dihydrocarveol | FL/FR |
| (R)-(+)- | menthofuran | |
| (-)- | menthone | FL/FR |
| | pennyroyal oil | FL/FR |
| 5- and 6-iso | propyl-1,3,3-trimethyl bicyclo(2.2.2)-5,7-octadien-2-one | |
| nutty |
| | sesame absolute | FL/FR |
| | sesame absolute CO2 extract | FL/FR |
| pine |
| | abies sibirica needle extract | FR |
| white | pine bark oil | FL/FR |
| | pine specialty | FR |
| | trimethyl-3-cyclopentenyl acetonitrile | FR |
| powdery |
| para- | anisyl alcohol | FL/FR |
| | dibenzyl ketone | FL/FR |
| smoky |
| | boswellia serrata wood tar oil | FR |
| spicy |
| alpha- | amyl cinnamyl alcohol | FL/FR |
| | cananga leaf oil | FR |
| | carvacrol | FL/FR |
| | cinnamomum culilawan bark oil | FR |
| | cinnamon bark oil (cinnamomum zeylanicum) india | FL/FR |
| | cinnamon leaf oil ceylon | FL/FR |
| | cinnamyl acetate | FL/FR |
| | clove bud absolute | FL/FR |
| | clove bud oil | FL/FR |
| | clove fragrance | FR |
| | clove leaf oil | FL/FR |
| | clove stem oil | FL/FR |
| | elemi oil fractions | FR |
| | elettaria cardamomum seed oil | FL/FR |
| | elettaria cardamomum seed oil guatemala | FL/FR |
| iso | eugenyl phenyl acetate | FL/FR |
| | ginger fragrance | FR |
| | ginger root oil china | FL/FR |
| | ginger root oil replacer | FR |
| | ginger specialty | FR |
| | gingergrass oil | FR |
| | laurel leaf oil replacer | FR |
| | maja fragrance | FR |
| | myrcene | FR |
| | myristica fragrans fruit extract | FL/FR |
| | myristica fragrans seed tincture | FL/FR |
| | myristicin | FR |
| | nutmeg absolute | FL/FR |
| | nutmeg oleoresin | FL/FR |
| | origanum majorana oil CO2 extract | FL/FR |
| | pepper hexanone | FR |
| | pepper tree berry oil | FL/FR |
| white | sassafras oil | FL/FR |
| | sugandha kokila berry oil | FR |
| terpenic |
| | elemi resinoid | FL/FR |
| | hinoki oil replacer | FR |
| | pine needle oil dwarf | FL/FR |
| | turpentine oil | FL/FR |
| thujonic |
| | cedarleaf oil terpeneless | FR |
| | sage oil (salvia lavandulifolia vahl.) spain | FL/FR |
| | sage oil cuba | FL/FR |
| | sage oil dalmatian | FL/FR |
| | sage oil england | FL/FR |
| | sage oil france | FL/FR |
| | sage oil germany | FL/FR |
| | sage oil reunion | FL/FR |
| | sage oil sardinia | FL/FR |
| tobacco |
| | honey absolute | FL/FR |
| tonka |
| | tonka undecanone | FR |
| tropical |
| beta- | cyclocitral | FL/FR |
| waxy |
| (Z)-5- | decen-1-ol | |
| (E)-5- | decen-1-ol | |
| | dihydrocitronellyl acetate | FL/FR |
| (E)- | geranyl oxyacetaldehyde | FR |
| | geranyl undecylenate | FR |
| | octanol | FL/FR |
| 1- | undecanol | FL/FR |
| (E)-2- | undecen-1-yl acetate | FR |
| | waxy acetate | FR |
| winey |
| | butyl angelate | FL/FR |
| woody |
| | agarwood oil | FR |
| | agarwood oil (aetoxylon sympetalum) | FR |
| | agarwood oil CO2 extract | FR |
| | agarwood specialty | FR |
| | bulnesia sarmienti extract | FR |
| 2-tert- | butyl cyclohexanone | FR |
| | callitris columellaris wood oil australia | FR |
| | cedarwood oil texas fractions | FR |
| | cedarwood oil western red | FR |
| | cistus twig/leaf absolute | FR |
| | convolvulus scoparius wood oil | FR |
| | copaiba balsam | FL/FR |
| (E+Z)-4,8- | dimethyl-3,7-nonadien-2-ol | FL/FR |
| (E)- | ethyl geranate | FR |
| | guaiacwood oil | FL/FR |
| alpha- | guaiene | FL/FR |
| | gurjun balsam oil | FR |
| 1,2,3,3,4,5,6- | heptamethyl bicyclo(2.2.2)oct-5-en-2-ol | |
| | hinoki root oil | FR |
| (1R,4S)-1- | hydroxy-1,4-dimethyl spiro(4.6)undecan-2-one | |
| | juniper berry oil terpenes | FR |
| | kaempferia galanga rhizome oil | FL/FR |
| | labdanum ethanone | FR |
| | longifolene | FL/FR |
| (-)- | myrtenol | |
| iso | pinocarveol | |
| laevo- | pinocarveol | |
| | sandal cyclohexanol | FR |
| (R)- | sandal hexanol | FR |
| | sandal hexanol | FR |
| | sandalwood oil | FL/FR |
| | sandalwood oil CO2 extract | FL/FR |
| | sandalwood oil west australia | FL/FR |
| | sandalwood oil west australia (santalum spicatum) | FR |
| | santall | FR |
| | santalum paniculatum wood oil | FR |
| | santalyl butyrate | FL/FR |
| | siam wood oil | FR |
| 2,6,10,10- | tetramethyl-1-oxa-spiro[4.5]dec-3-ene-6-ol | |
| 1,3,3,5- | tetramethyl-7 and 8-cyanobicyclo(2.2.2)oct-5-ene | |
| | vetiver oil bourbon | FL/FR |
| | vetiver oil brazil | FL/FR |
| | vetiver oil china | FL/FR |
| | vetiver oil haiti | FL/FR |
| | vetiver oil india | FL/FR |
| | vetiverol | FL/FR |
| (Z)- | woody amylene | FR |
| |
| For Flavor |
| |
| No flavor group found for these |
| | acetaldehyde dibutyl acetal | FL/FR |
| 1- | acetyl cyclohexyl acetate | FL |
| | achillea millefolium herb oil CO2 extract | FL/FR |
| iso | amyl undecylenate | FL/FR |
| | balsam fir oleoresin | FL/FR |
| 6- | benzyl-2,6-dimethyl-2-cyclohexen-1-one | |
| dextro,laevo- | borneol | FL/FR |
| dextro- | bornyl acetate | |
| iso | bornyl methyl ether | FL/FR |
| | butyl angelate | FL/FR |
| | butyl nonanoate | FL/FR |
| (R)-(+)-beta- | citronellol | FL/FR |
| | citronellyl acetone | FL/FR |
| | citronellyl benzoate | FL/FR |
| | citronellyl isovalerate | FL/FR |
| | citronellyl valerate | FL/FR |
| 2-para- | cresyl ethanol | FL/FR |
| | croton glabellus bark extract | FL/FR |
| 4-(1- | cyclopenten-1-yl)-1-butanol | |
| (E)-beta- | damascenone | FL/FR |
| (Z)-alpha- | damascone | FL/FR |
| iso | decanal | FL/FR |
| (Z)-5- | decen-1-ol | |
| (E)-2- | decen-1-ol | FL/FR |
| (E)-5- | decen-1-ol | |
| (Z)-4- | decen-1-yl acetate | FL/FR |
| 9- | decenal | FL/FR |
| | dihydrocitronellyl acetate | FL/FR |
| (E+Z)-4,8- | dimethyl-3,7-nonadien-2-ol | FL/FR |
| | dipentene | FL/FR |
| alpha- | elemol | FL/FR |
| | ethyl hydrocinnamate | FL/FR |
| | fir needle oil canada | FL/FR |
| | geranyl 2-methyl butyrate | FL/FR |
| | geranyl benzoate | FL/FR |
| (E)- | geranyl linalool | FL/FR |
| | geranyl octanoate | FL/FR |
| | geranyl valerate | FL/FR |
| alpha- | guaiene | FL/FR |
| 1,2,3,3,4,5,6- | heptamethyl bicyclo(2.2.2)oct-5-en-2-ol | |
| | heptanal cyclic trimethylene acetal | |
| 3- | heptyl acetate | FL |
| | heptyl nonanoate | FL/FR |
| 1,3,3,4,5,6- | hexamethyl(2.2.2)bicyclooct-5-en-2-ol | |
| (1R,4S)-1- | hydroxy-1,4-dimethyl spiro(4.6)undecan-2-one | |
| | juniper absolute | FL/FR |
| | laurel bark oil | |
| | laurel stem oil | |
| | lavandin absolute decolorized | FL/FR |
| | linalool oxide (furanoid) | FL/FR |
| | linalyl phenyl acetate | FL/FR |
| | magnolia flower oil | FL/FR |
| | magnolia leaf oil | FL/FR |
| | marigold pot flower oil | FL/FR |
| | melaleuca leucadendron var. cajuputi leaf oil | FL/FR |
| (R)-(+)- | menthofuran | |
| laevo- | menthyl isobutyrate | |
| laevo- | menthyl propionate | FL/FR |
| 2- | methyl octanal | FL/FR |
| | neryl benzoate | FL/FR |
| | nonanal diethyl acetal | FL/FR |
| | nonyl heptanoate | |
| | nonyl nonanoate | |
| | nonyl octanoate | FL/FR |
| | octyl isovalerate | FL/FR |
| beta- | phenethyl angelate | |
| | phenethyl furoate | FL/FR |
| | phenethyl heptanoate | FL/FR |
| | phenethyl lactate | FL/FR |
| 2- | phenethyl valerate | FL/FR |
| | phenoxyethanol | FL/FR |
| | phenyl amyl alcohol | FL/FR |
| | phenyl glycol phenyl acetate | |
| 3- | phenyl propionic acid | FL/FR |
| (Z,Z)- | photocitral A | FL |
| white | pine bark oil | FL/FR |
| D-(+)-alpha- | pinene | FL/FR |
| laevo- | pinocarveol | |
| iso | pinocarveol | |
| | propyl angelate | |
| 5- and 6-iso | propyl-1,3,3-trimethyl bicyclo(2.2.2)-5,7-octadien-2-one | |
| | rhodinyl acetate substitutes | FL/FR |
| | sandalwood oil west australia | FL/FR |
| | santalyl butyrate | FL/FR |
| white | sassafras oil | FL/FR |
| 2,6,10,10- | tetramethyl-1-oxa-spiro[4.5]dec-3-ene-6-ol | |
| 1,3,3,5- | tetramethyl-7 and 8-acetyl bicyclo(2.2.2)oct-5-ene | |
| 1,3,3,5- | tetramethyl-7 and 8-cyanobicyclo(2.2.2)oct-5-ene | |
| (S)-2,5,6- | trimethyl-2-heptanol | |
| | turpentine oil | FL/FR |
| (E)-2- | undecen-1-ol | FL/FR |
| 2- | undecen-1-ol | FL/FR |
| | undecenal mixture (aldehyde C-11 mixed) | FL/FR |
|
| iso | amyl 3-(2-furan) propionate | FL/FR |
| beta- | damascone | FL/FR |
| aldehydic |
| | nonanal (aldehyde C-9) | FL/FR |
| 1- | undecanol | FL/FR |
| aromatic |
| | hyacinth acetals | FL/FR |
| laevo- | perillaldehyde | FL/FR |
| balsamic |
| siam | benzoin resin | FL/FR |
| siam | benzoin resinoid | FL/FR |
| laevo- | bornyl acetate | FL/FR |
| iso | bornyl isobutyrate | FL/FR |
| iso | bornyl propionate | FL/FR |
| | copaiba balsam oil | FL/FR |
| | copaifera reticulata extract | FL/FR |
| | fir needle oil terpeneless canada | FL/FR |
| | juniper berry absolute | FL/FR |
| | juniper berry oil CO2 extract | FL/FR |
| | myrrh absolute | FL/FR |
| | myrrh gum | FL/FR |
| | myrrh oil | FL/FR |
| | myrrh resin | FL/FR |
| | opoponax absolute (balsamodendron kafal) | FL/FR |
| | opoponax absolute (commiphora erythraea var. glabrescens engle) | FL/FR |
| | peru balsam absolute | FL/FR |
| | phenethyl cinnamate | FL/FR |
| | tolu balsam resin | FL/FR |
| berry |
| | rhodinol substitues | FL/FR |
| bitter |
| | dibenzyl ketone | FL/FR |
| camphoreous |
| dextro,laevo-iso | borneol | FL/FR |
| laevo- | borneol | FL/FR |
| | bornyl ethyl ether | |
| | camphor tree bark oil | FL/FR |
| (-)-alpha- | fenchol | FL/FR |
| laevo- | fenchone | FL/FR |
| | geranic oxide | FL/FR |
| | kaempferia galanga rhizome oil | FL/FR |
| | pinocarveol | FL/FR |
| | rosemary oil tunisia | FL/FR |
| citrus |
| | bergamot flavor | FL |
| | bergamot oil | FL/FR |
| | bergamot oil bergaptene reduced italy | FL/FR |
| | citronella oil ceylon | FL/FR |
| 1,5- | dimethyl-3-isopropyl-2-oxabicyclo(2.2.2)octane | |
| | myrcenyl acetate | FL/FR |
| | styralyl propionate | FL/FR |
| cooling |
| spike | lavender oil | FL/FR |
| laevo- | menthol | FL/FR |
| iso | menthol | FL |
| | sabinene hydrate | FL/FR |
| | theaspirane | FL/FR |
| | WS-3 | FL |
| dusty |
| | ethyl citronellate | FL/FR |
| ethereal |
| | ethyl formate | FL/FR |
| fatty |
| 2- | decenal | FL/FR |
| | dimethyl octanol | FL/FR |
| 10- | undecenal (aldehyde C-11 undecylenic) | FL/FR |
| floral |
| iso | amyl phenyl acetate | FL/FR |
| | biphenyl | |
| | bois de rose oil brazil | FL/FR |
| | bois de rose oil peru | FL/FR |
| | cananga oil | FL/FR |
| | cananga oil china | FL/FR |
| | citronellal | FL/FR |
| | citronellol | FL/FR |
| laevo- | citronellol | FL/FR |
| | citronellyl acetate | FL/FR |
| (S)- | citronellyl acetate | FL/FR |
| | citronellyl hexanoate | FL/FR |
| | citronellyl phenyl acetate | FL/FR |
| | citronellyl propionate | FL/FR |
| | cocoa pentenal | FL/FR |
| | dihydrocarvyl acetate | FL/FR |
| | dimethyl benzyl carbinyl acetate | FL/FR |
| 3,7- | dimethyl-6-octenoic acid | FL/FR |
| | farnesol | FL/FR |
| | farnesyl acetate | FL/FR |
| | geraniol | FL/FR |
| | geranium oil africa | FL/FR |
| | geranium oil bourbon | FL/FR |
| | geranium oil china | FL/FR |
| | geranium oil egypt | FL/FR |
| | geranium oil morocco | FL/FR |
| | geranium oil terpeneless | FL/FR |
| | geranium petiole oil india | FL/FR |
| | geranium rose oil | FL/FR |
| | geranyl acetone | FL/FR |
| (E)- | geranyl acetone | FL/FR |
| | geranyl isobutyrate | FL/FR |
| | geranyl phenyl acetate | FL/FR |
| beta- | ionol | FL/FR |
| | methyl citronellate | FL/FR |
| | muguet carbinol | FL/FR |
| | neryl acetate | FL/FR |
| | orange blossom flavor | FL |
| bitter | orangeflower absolute morocco | FL/FR |
| | phenethyl alcohol | FL/FR |
| | phenethyl anthranilate | FL/FR |
| | phenethyl benzoate | FL/FR |
| | phenethyl propionate | FL/FR |
| | rhodinol | FL/FR |
| | rhodinyl acetate | FL/FR |
| | rhodinyl butyrate | FL/FR |
| | rhodinyl isobutyrate | FL/FR |
| | rosa damascena flower oil | FL/FR |
| | rosa damascena flower oil CO2 extract | FL/FR |
| | rose absolute | FL/FR |
| | rose absolute (rosa centifolia) | FL/FR |
| | rose absolute (rosa centifolia) morocco | FL/FR |
| | rose absolute (rosa damascena) bulgaria | FL/FR |
| | rose absolute (rosa damascena) turkey | FL/FR |
| | rose distillates | FL/FR |
| | rose flavor | FL |
| | rose oil (rosa centifolia) egypt | FL/FR |
| | rose oil (rosa damascena) bulgaria | FL/FR |
| | rose oil (rosa damascena) iran | FL/FR |
| | rose oil (rosa damascena) russia | FL/FR |
| | rose oil (rosa damascena) turkey | FL/FR |
| laevo- | rose oxide | FL/FR |
| | terpinyl butyrate | FL/FR |
| fruity |
| para- | anisyl alcohol | FL/FR |
| | benzyl alcohol | FL/FR |
| | butyl propionate | FL/FR |
| | citronellyl anthranilate | FL/FR |
| | citronellyl formate | FL/FR |
| para- | cresyl phenyl ether | |
| (E)-alpha- | damascone | FL/FR |
| (E)-beta- | damascone | FL/FR |
| | decen-1-yl cyclopentanone | FL/FR |
| | decyl butyrate | FL/FR |
| | dibenzyl ether | FL/FR |
| | geranyl butyrate | FL/FR |
| | geranyl hexanoate | FL/FR |
| | geranyl methyl tiglate | |
| | heptyl propionate | FL/FR |
| | hexyl phenyl acetate | FL/FR |
| | neryl formate | FL/FR |
| | neryl isovalerate | FL/FR |
| | phenethyl isovalerate | FL/FR |
| | rhodinyl formate | FL/FR |
| | rhodinyl propionate | FL/FR |
| | rose butanoate | FL/FR |
| | strawberry glycidate 2 | FL/FR |
| | valerian rhizome oil | FL/FR |
| | valerian rhizome oil china | FL/FR |
| | valerian rhizome oil CO2 extract china | FL/FR |
| greasy |
| 10- | undecen-1-yl acetate | FL/FR |
| green |
| | canarium luzonicum gum | FL/FR |
| | chrysanthemum oxide | FL/FR |
| (E)- | citronellyl tiglate | FL/FR |
| | cyclohexyl ethyl acetate | FL/FR |
| | cyclohexyl ethyl alcohol | FL/FR |
| | dihydrocarveol | FL/FR |
| 2,6- | dimethyl octanal | FL/FR |
| | diphenyl oxide | FL/FR |
| | elemi resinoid | FL/FR |
| | galbanum oleoresin | FL/FR |
| | galbanum resinoid | FL/FR |
| | geranium absolute | FL/FR |
| | geranyl acetate | FL/FR |
| | geranyl formate | FL/FR |
| | green ether | FL/FR |
| (Z)-3- | hexen-1-yl phenyl acetate | FL/FR |
| | narcissus acetate | FL/FR |
| | octanal dimethyl acetal | FL/FR |
| 3- | octyl acetate | FL/FR |
| | octyl formate | FL/FR |
| | phenethyl formate | FL/FR |
| | phenethyl tiglate | FL/FR |
| | phenoxyethyl isobutyrate | FL/FR |
| | phenyl acetaldehyde diisobutyl acetal | FL/FR |
| | phenyl acetaldehyde dimethyl acetal | FL/FR |
| | rose leaf absolute (rosa centifolia) | FL/FR |
| herbal |
| | anethum graveolens herb oil | FL/FR |
| | apium graveolens seed oil | FL/FR |
| | barosma betulina leaf oil | FL/FR |
| | bornyl methyl ether | |
| | cardamom distillates | FL |
| | cardamom flavor | FL |
| | carum carvi fruit oil | FL/FR |
| | celery flavor | FL |
| | celery seed oil distillates | FL |
| | chamomile absolute | FL/FR |
| | dill flavor | FL |
| 3,6- | dimethyl-3-octanol | FL/FR |
| | eucalyptus flavor | FL |
| | eucalyptus globulus oil | FL/FR |
| | geranium concrete | FL/FR |
| | hyssopus officinalis extract | FL/FR |
| | hyssopus officinalis leaf tincture | FL/FR |
| | laurus nobilis leaf oil | FL/FR |
| | lavandin absolute | FL/FR |
| | lavandin concrete | FL/FR |
| spike | lavender absolute | FL/FR |
| | lavender absolute france | FL/FR |
| spike | lavender oil spain | FL/FR |
| | linalyl formate | FL/FR |
| | linalyl propionate | FL/FR |
| | melaleuca leucadendron cajaputi oil | FL/FR |
| | origanum majorana oil CO2 extract | FL/FR |
| | origanum oil | FL/FR |
| | origanum oil greece | FL/FR |
| | rose oil (rosa centifolia) morocco | FL/FR |
| | rosemary absolute | FL/FR |
| | rosemary essence | FL/FR |
| | rosemary flavor | FL |
| | rosemary oil | FL/FR |
| | rosemary oil africa | FL/FR |
| | rosemary oil china | FL/FR |
| | rosemary oil CO2 extract | FL/FR |
| | rosemary oil corsica | FL/FR |
| | rosemary oil egypt | FL/FR |
| | rosemary oil france | FL/FR |
| | rosemary oil morocco | FL/FR |
| | rosemary oil terpeneless | FL/FR |
| | rosemary oil turkey | FL/FR |
| | rosemary oleoresin | FL/FR |
| | rosmarinus officinalis extract | FL/FR |
| | rosmarinus officinalis leaf extract | FL/FR |
| | rosmarinus officinalis tincture | FL/FR |
| | sage absolute spain | FL/FR |
| | sage oil (salvia lavandulifolia vahl.) spain | FL/FR |
| white | thyme oil | FL/FR |
| honey |
| | allyl phenyl acetate | FL/FR |
| | benzyl phenyl acetate | FL/FR |
| | butyl phenyl acetate | FL/FR |
| | ethyl phenyl acetate | FL/FR |
| | honey absolute | FL/FR |
| | phenethyl acetate | FL/FR |
| | phenethyl isobutyrate | FL/FR |
| | phenethyl phenyl acetate | FL/FR |
| | propyl phenyl acetate | FL/FR |
| iso | propyl phenyl acetate | FL/FR |
| huckleberry |
| meta- | cresyl phenyl ether | |
| medicinal |
| | dimethyl benzyl carbinol | FL/FR |
| | phenethyl salicylate | FL/FR |
| mentholic |
| | peppermint cyclohexanone | FL/FR |
| minty |
| | agathosma crenulata leaf oil | FL/FR |
| | betula lenta bark oil america | FL/FR |
| 1,8- | cineole | FL/FR |
| (-)- | menthone | FL/FR |
| laevo- | menthyl acetate | FL/FR |
| | myrtenol | FL/FR |
| (-)- | myrtenol | |
| | pennyroyal oil | FL/FR |
| musty |
| | geranyl acetoacetate | FL/FR |
| nutty |
| | sesame absolute | FL/FR |
| | sesame absolute CO2 extract | FL/FR |
| phenolic |
| para- | cresyl phenyl acetate | FL/FR |
| pine |
| | pine needle oil dwarf | FL/FR |
| beta- | pinene | FL/FR |
| powdery |
| | hydroxycitronellol | FL/FR |
| spicy |
| alpha- | amyl cinnamyl alcohol | FL/FR |
| | carvacrol | FL/FR |
| | cinnamon bark oil (cinnamomum zeylanicum) india | FL/FR |
| | cinnamon leaf oil ceylon | FL/FR |
| | cinnamyl acetate | FL/FR |
| | cinnamyl cinnamate | FL/FR |
| | clove bud absolute | FL/FR |
| | clove bud oil | FL/FR |
| | clove flavor | FL |
| | clove leaf oil | FL/FR |
| | clove stem oil | FL/FR |
| | cubeb oleoresin | FL |
| | elettaria cardamomum seed oil | FL/FR |
| | elettaria cardamomum seed oil guatemala | FL/FR |
| iso | eugenyl phenyl acetate | FL/FR |
| | ginger root oil china | FL/FR |
| | myristica fragrans fruit extract | FL/FR |
| | myristica fragrans seed tincture | FL/FR |
| | nutmeg absolute | FL/FR |
| | nutmeg oleoresin | FL/FR |
| | pepper tree berry oil | FL/FR |
| sulfurous |
| | buchu leaf distillates | FL |
| tea |
| green | tea leaf absolute | FL/FR |
| thujonic |
| | sage oil cuba | FL/FR |
| | sage oil dalmatian | FL/FR |
| | sage oil england | FL/FR |
| | sage oil france | FL/FR |
| | sage oil germany | FL/FR |
| | sage oil reunion | FL/FR |
| | sage oil sardinia | FL/FR |
| tropical |
| alpha- | amyl cinnamaldehyde | FL/FR |
| beta- | cyclocitral | FL/FR |
| waxy |
| | adoxal (Givaudan) | FL/FR |
| 2- | decen-1-ol | FL/FR |
| 9- | decen-1-ol | FL/FR |
| | geranyl propionate | FL/FR |
| | hydroxycitronellal dimethyl acetal | FL/FR |
| | methyl 10-undecenoate | FL/FR |
| | methyl undecylenate | FL/FR |
| | nonanol | FL/FR |
| | octanol | FL/FR |
| | phenoxyethyl propionate | FL/FR |
| woody |
| | amyris wood oil | FL/FR |
| iso | bornyl acetate | FL/FR |
| iso | bornyl formate | FL/FR |
| | copaiba balsam | FL/FR |
| beta- | damascenone | FL/FR |
| delta- | damascone | FL/FR |
| | guaiacwood oil | FL/FR |
| | longifolene | FL/FR |
| | perilla alcohol | FL/FR |
| alpha- | pinene | FL/FR |
| | safranal | FL/FR |
| | sandalwood oil | FL/FR |
| | sandalwood oil CO2 extract | FL/FR |
| | sclareol | FL/FR |
| | vetiver oil bourbon | FL/FR |
| | vetiver oil brazil | FL/FR |
| | vetiver oil china | FL/FR |
| | vetiver oil haiti | FL/FR |
| | vetiver oil india | FL/FR |
| | vetiverol | FL/FR |
| |
Potential Uses:
Occurrence (nature, food, other): note
Synonyms:
| | essential oil obtained from the flowering tops and leaves of the rosemary, rosmarinus officinalis l., lamiaceae spain | | | rosemary colorless spain (Robertet) | | | rosemary EO spain | | garden | rosemary oil (rosmarinus officinalis) spain | | | rosemary oil FCC (rosmarinus officinalis) spanish | | | rosemary oil spain | | | rosemary oil spanish | | | rosemary oil, spanish | | | rosemary spain ess | | | rosemary spain essential oil | | | rosemary sureste TICO (Takasago) | | | rosmarinus officinalis leaf oil spain |
Articles:
| PubMed: | Rosmarinus officinalis L. extract and some of its active ingredients as potential emulsion stabilizers: a new approach to the formation of multiple (W/O/W) emulsion. |
| PubMed: | The influence of purge times on the yields of essential oil components extracted from plants by pressurized liquid extraction. |
| PubMed: | Chemical composition of Rosmarinus and Lavandula essential oils and their insecticidal effects on Orgyia trigotephras (Lepidoptera, Lymantriidae). |
| PubMed: | Transdermal absorption enhancing effect of the essential oil of Rosmarinus officinalis on percutaneous absorption of Na diclofenac from topical gel. |
| PubMed: | Rosemary oil vs minoxidil 2% for the treatment of androgenetic alopecia: a randomized comparative trial. |
| PubMed: | Comparative and synergistic activity of Rosmarinus officinalis L. essential oil constituents against the larvae and an ovarian cell line of the cabbage looper, Trichoplusia ni (Lepidoptera: Noctuidae). |
| PubMed: | Study of quantitative and qualitative variations in essential oils of Sicilian Rosmarinus officinalis L. |
| PubMed: | Antimicrobial and antioxidant activities and chemical characterization of essential oils of Thymusvulgaris, Rosmarinus officinalis, and Origanum majorana from northeastern México. |
| PubMed: | Enhancing stability of essential oils by microencapsulation for preservation of button mushroom during postharvest. |
| PubMed: | In vitro susceptibility of Brazilian Pythium insidiosum isolates to essential oils of some Lamiaceae family species. |
| PubMed: | Effect of rosemary (Rosmarinus officinalis) extracts on the oxidative stability and sensory acceptability of soybean oil. |
| PubMed: | Active monoterpene ketones isolated from Rosmarinus officinalis with fumigant and contact action against Tyrophagus putrescentiae (Schrank). |
| PubMed: | In vitro biological evaluation of eight different essential oils against Trypanosoma cruzi, with emphasis on Cinnamomum verum essential oil. |
| PubMed: | Protective Effect of Lavandula stoechas and Rosmarinus officinalis essential oils against reproductive damage and oxidative stress in alloxan-induced diabetic rats. |
| PubMed: | Effect of bioclimatic area on the composition and bioactivity of Tunisian Rosmarinus officinalis essential oils. |
| PubMed: | Dairy matrix effect on the transference of rosemary (Rosmarinus officinalis) essential oil compounds during cheese making. |
| PubMed: | Effects of Rosmarinus officinalis essential oil on germ tube formation by Candida albicans isolated from denture wearers. |
| PubMed: | Antifungal activity and inhibition of fumonisin production by Rosmarinus officinalis L. essential oil in Fusarium verticillioides (Sacc.) Nirenberg. |
| PubMed: | Oxidative stress modulation by Rosmarinus officinalis in creosote-induced hepatotoxicity. |
| PubMed: | Antioxidant activity of rosemary (Rosmarinus officinalis L.) essential oil and its hepatoprotective potential. |
| PubMed: | Assessment of antioxidative, chelating, and DNA-protective effects of selected essential oil components (eugenol, carvacrol, thymol, borneol, eucalyptol) of plants and intact Rosmarinus officinalis oil. |
| PubMed: | Microwave-assisted hydrodistillation of essential oil from rosemary. |
| PubMed: | Antibacterial activity against Clostridium genus and antiradical activity of the essential oils from different origin. |
| PubMed: | Effects of Rosmarinus officinalis on the survivability of random-patterned skin flaps: an experimental study. |
| PubMed: | Combined effects of gamma-irradiation and modified atmosphere packaging on quality of some spices. |
| PubMed: | Secondary metabolites isolation in natural products chemistry: comparison of two semipreparative chromatographic techniques (high pressure liquid chromatography and high performance thin-layer chromatography). |
| PubMed: | Solvent-free microwave extraction of essential oil from aromatic herbs: from laboratory to pilot and industrial scale. |
| PubMed: | Systemic administration of Rosmarinus officinalis attenuates the inflammatory response induced by carrageenan in the mouse model of pleurisy. |
| PubMed: | Effectiveness of Rosmarinus officinalis essential oil as antihypotensive agent in primary hypotensive patients and its influence on health-related quality of life. |
| PubMed: | Microbiological quality and other characteristics of refrigerated chicken meat in contact with cellulose acetate-based film incorporated with rosemary essential oil. |
| PubMed: | The potential of use basil and rosemary essential oils as effective antibacterial agents. |
| PubMed: | Effects of inhaled rosemary oil on subjective feelings and activities of the nervous system. |
| PubMed: | Increased seizure latency and decreased severity of pentylenetetrazol-induced seizures in mice after essential oil administration. |
| PubMed: | Biogenic amines as freshness index of meat wrapped in a new active packaging system formulated with essential oils of Rosmarinus officinalis. |
| PubMed: | Effect of the dietary supplementation of essential oils from rosemary and artemisia on muscle fatty acids and volatile compound profiles in Barbarine lambs. |
| PubMed: | Larvicidal activity of essential extract of Rosmarinus officinalis against Culex quinquefasciatus. |
| PubMed: | The Antibacterial Activity of Selected Labiatae (Lamiaceae) Essential Oils against Brucella melitensis. |
| PubMed: | Efficacy of plant essential oils on postharvest control of rots caused by fungi on different stone fruits in vivo. |
| PubMed: | Transfer of metals and metalloids from soil to shoots in wild rosemary (Rosmarinus officinalis L.) growing on a former lead smelter site: human exposure risk. |
| PubMed: | In vitro and in vivo antifungal activity of some essential oils against feline isolates of Microsporum canis. |
| PubMed: | Seasonal variations in the composition of the essential oils of rosemary (Rosmarinus officinalis, Lamiaceae). |
| PubMed: | A herbal antifungal formulation of Thymus serpillum, Origanum vulgare and Rosmarinus officinalis for treating ovine dermatophytosis due to Trichophyton mentagrophytes. |
| PubMed: | An in-depth review on the medicinal flora Rosmarinus officinalis (Lamiaceae). |
| PubMed: | Supercritical carbon dioxide extraction of antioxidants from rosemary (Rosmarinus officinalis) leaves for use in edible vegetable oils. |
| PubMed: | Rosmarinus officinalis L. essential oil and its majority compound 1,8-cineole at sublethal amounts induce no direct and cross protection in Staphylococcus aureus ATCC 6538. |
| PubMed: | Antidepressant-like effects of fractions, essential oil, carnosol and betulinic acid isolated from Rosmarinus officinalis L. |
| PubMed: | Antioxidant capacity and inhibitory effect of grape seed and rosemary extract in marinades on the formation of heterocyclic amines in fried beef patties. |
| PubMed: | Degradation study of carnosic acid, carnosol, rosmarinic acid, and rosemary extract (Rosmarinus officinalis L.) assessed using HPLC. |
| PubMed: | The effects of thyme (Thymus vulgaris) and rosemary (Rosmarinus officinalis) essential oils on Brochothrix thermosphacta and on the shelf life of beef packaged in high-oxygen modified atmosphere. |
| PubMed: | Rosmarinus officinalis L. essential oil and the related compound 1,8-cineole do not induce direct or cross-protection in Listeria monocytogenes ATCC 7644 cultivated in meat broth. |
| PubMed: | Environment-related variations of the composition of the essential oils of rosemary (Rosmarinus officinalis L.) in the Balkan Penninsula. |
| PubMed: | Comparative molecular docking analysis of essential oil constituents as elastase inhibitors. |
| PubMed: | Composition and biological activity of essential oils against Metopolophium dirhodum (Hemiptera: Aphididae) cereal crop pest. |
| PubMed: | Hybrid magnetite nanoparticles/Rosmarinus officinalis essential oil nanobiosystem with antibiofilm activity. |
| PubMed: | Antibacterial activity and anticancer activity of Rosmarinus officinalis L. essential oil compared to that of its main components. |
| PubMed: | Effects of extract and essential oil of Rosmarinus officinalis L. on TNBS-induced colitis in rats. |
| PubMed: | Application of ionic liquids based microwave-assisted simultaneous extraction of carnosic acid, rosmarinic acid and essential oil from Rosmarinus officinalis. |
| PubMed: | Inhibitory activity of Asian spices on heterocyclic amines formation in cooked beef patties. |
| PubMed: | Acaricidal effect of essential oils from Lippia graveolens (Lamiales: Verbenaceae), Rosmarinus officinalis (Lamiales: Lamiaceae), and Allium sativum (Liliales: Liliaceae) against Rhipicephalus (Boophilus) microplus (Acari: Ixodidae). |
| PubMed: | Antioxidant and antigenotoxic effects of rosemary (Rosmarinus officinalis L.) extracts in Salmonella typhimurium TA98 and HepG2 cells. |
| PubMed: | Larvicidal and repellent properties of some essential oils against Culex tritaeniorhynchus Giles and Anopheles subpictus Grassi (Diptera: Culicidae). |
| PubMed: | Chemical composition and antimicrobial activity of essential oils of Thymus algeriensis, Eucalyptus globulus and Rosmarinus officinalis from Morocco. |
| PubMed: | Evaluation of antileishmanial, cytotoxic and antioxidant activities of essential oils extracted from plants issued from the leishmaniasis-endemic region of Sned (Tunisia). |
| PubMed: | Rosmarinus officinalis L. essential oil inhibits in vivo and in vitro leukocyte migration. |
| PubMed: | Effect of distillation waste water and plant hormones on spearmint growth and composition. |
| PubMed: | Control of the myiasis-producing fly, Lucilia sericata, with Egyptian essential oils. |
| PubMed: | Investigation of the volatile fraction of rosemary infusion extracts. |
| PubMed: | Antibacterial activity of the essential oil from Rosmarinus officinalis and its major components against oral pathogens. |
| PubMed: | Comparative larvicidal activity of essential oils from three medicinal plants against Aedes aegypti L. |
| PubMed: | Genotoxicity and mutagenicity of Rosmarinus officinalis (Labiatae) essential oil in mammalian cells in vivo. |
| PubMed: | Rosmarinus officinalis essential oil: antiproliferative, antioxidant and antibacterial activities. |
| PubMed: | In vitro and in vivo antifungal activities of the essential oils of various plants against tomato grey mould disease agent Botrytis cinerea. |
| PubMed: | Essential oils composition in two Rosmarinus officinalis L. varieties and incidence for antimicrobial and antioxidant activities. |
| PubMed: | Essential oil composition and larvicidal activity of six Mediterranean aromatic plants against the mosquito Aedes albopictus (Diptera: Culicidae). |
| PubMed: | Biodegradable gelatin-chitosan films incorporated with essential oils as antimicrobial agents for fish preservation. |
| PubMed: | Chemical composition and antioxidant and anti-Listeria activities of essential oils obtained from some Egyptian plants. |
| PubMed: | Healing potential of Rosmarinus officinalis L. on full-thickness excision cutaneous wounds in alloxan-induced-diabetic BALB/c mice. |
| PubMed: | Bioactivity of Rosmarinus officinalis essential oils against Apis mellifera, Varroa destructor and Paenibacillus larvae related to the drying treatment of the plant material. |
| PubMed: | Antidepressant-like effect of Salvia sclarea is explained by modulation of dopamine activities in rats. |
| PubMed: | Rosmarinus officinalis L.: chemical modifications of the essential oil and evaluation of antioxidant and antimicrobial activity. |
| PubMed: | Testing and enhancing the in vitro bioaccessibility and bioavailability of Rosmarinus officinalis extracts with a high level of antioxidant abietanes. |
| PubMed: | In vitro antimicrobial and antioxidant activity of commercial rosemary extract formulations. |
| PubMed: | Protective effect of supercritical fluid rosemary extract, Rosmarinus officinalis, on antioxidants of major organs of aged rats. |
| PubMed: | The antimicrobial activity of four commercial essential oils in combination with conventional antimicrobials. |
| PubMed: | Antinociceptive effect and GC/MS analysis of Rosmarinus officinalis L. essential oil from its aerial parts. |
| PubMed: | Anti-inflammatory and antinociceptive effects of Rosmarinus officinalis L. essential oil in experimental animal models. |
| PubMed: | In vitro activity of essential oils extracted from plants used as spices against fluconazole-resistant and fluconazole-susceptible Candida spp. |
| PubMed: | Antioxidant activities of rosemary (Rosmarinus Officinalis L.) extract, blackseed (Nigella sativa L.) essential oil, carnosic acid, rosmarinic acid and sesamol. |
| PubMed: | Phytotherapeutic prevention of dental biofilm formation. |
| PubMed: | Chemical composition and antifungal activity of rosemary (Rosmarinus officinalis L.) oil from Turkey. |
| PubMed: | Variation of the chemical profile and antioxidant behavior of Rosmarinus officinalis L. and Salvia fruticosa Miller grown in Greece. |
| PubMed: | Effect of some essential oils on rheological properties of wheat flour dough. |
| PubMed: | Antioxidative activity of Rosmarinus officinalis L. essential oil compared to its main components. |
| PubMed: | Inhibitory effect of Turkish Rosmarinus officinalis L. on acetylcholinesterase and butyrylcholinesterase enzymes. |
| PubMed: | Antibacterial efficiency of Spanish Satureja montana essential oil against Listeria monocytogenes among natural flora in minced pork. |
| PubMed: | Antimycotoxigenic characteristics of Rosmarinus officinalis and Trachyspermum copticum L. essential oils. |
| PubMed: | Investigation of antibacterial activity of rosemary essential oil against Propionibacterium acnes with atomic force microscopy. |
| PubMed: | Antimicrobial and antioxidant properties of rosemary and sage (Rosmarinus officinalis L. and Salvia officinalis L., Lamiaceae) essential oils. |
| PubMed: | Relative characterization of rosemary samples according to their geographical origins using microwave-accelerated distillation, solid-phase microextraction and Kohonen self-organizing maps. |
| PubMed: | Antimicrobial activity of clove and rosemary essential oils alone and in combination. |
| PubMed: | [The virtue of that precious balsam...: approach to Don Quixote from the psychopharmacological perspective]. |
| PubMed: | Characterization of topical antiinflammatory compounds in Rosmarinus officinalis L. |
| PubMed: | Efficacy and persistence of rosemary oil as an acaricide against twospotted spider mite (Acari: Tetranychidae) on greenhouse tomato. |
| PubMed: | The psychopharmacology of European herbs with cognition-enhancing properties. |
| PubMed: | Effect of Rosmarinus officinalis in modulating 7,12-dimethylbenz(a)anthracene induced skin tumorigenesis in mice. |
| PubMed: | Influence of rosemary (Rosmarinus officinalis, L.) on plant sterol oxidation in extra virgin olive oil. |
| PubMed: | Liquid chromatograpic-mass spectrometric analysis of phenolics and free radical scavenging activity of rosemary extract from different raw material. |
| PubMed: | Comparative toxicity of Rosmarinus officinalis L. essential oil and blends of its major constituents against Tetranychus urticae Koch (Acari: Tetranychidae) on two different host plants. |
| PubMed: | Antimicrobial activities of the essential oils of various plants against tomato late blight disease agent Phytophthora infestans. |
| PubMed: | [Influence of extraction methods on the composition of essential oils]. |
| PubMed: | Insecticidal, repellent and oviposition-deterrent activity of selected essential oils against Anopheles stephensi, Aedes aegypti and Culex quinquefasciatus. |
| PubMed: | Composition and insect attracting activity of the essential oil of Rosmarinus officinalis. |
| PubMed: | Chemical composition and antimicrobial activity of Rosmarinus officinalis L. essential oil obtained via supercritical fluid extraction. |
| PubMed: | Antifungal effect of various essential oils against Candida albicans. Potentiation of antifungal action of amphotericin B by essential oil from Thymus vulgaris. |
| PubMed: | Antiviral activity of medicinal plants of Nilgiris. |
| PubMed: | chemical composition, plant genetic differences, antimicrobial and antifungal activity investigation of the essential oil of Rosmarinus officinalis L. |
| PubMed: | Antioxidant activities of rosemary, sage, and sumac extracts and their combinations on stability of natural peanut oil. |
| PubMed: | Essential oils from Mediterranean lamiaceae as weed germination inhibitors. |
| PubMed: | Essential oil formulations useful as a new tool for insect pest control. |
| PubMed: | Roles of human CYP2A6 and 2B6 and rat CYP2C11 and 2B1 in the 10-hydroxylation of (-)-verbenone by liver microsomes. |
| PubMed: | Anti-Aspergillus activities of plant essential oils and their combination effects with ketoconazole or amphotericin B. |
| PubMed: | Main agronomic-productive characteristics of two ecotypes of Rosmarinus officinalis L. and chemical composition of their essential oils. |
| PubMed: | SPME determination of volatile aldehydes for evaluation of in-vitro antioxidant activity. |
| PubMed: | GC-MS analysis of essential oils from some Greek aromatic plants and their fungitoxicity on Penicillium digitatum. |
| PubMed: | Allied studies on the effect of Rosmarinus officinalis L. on experimental hepatotoxicity and mutagenesis. |
| PubMed: | Comparative evaluation of the antimicrobial activities of essential oils of Artemisia afra, Pteronia incana and Rosmarinus officinalis on selected bacteria and yeast strains. |
| PubMed: | GC evaluation of flavour compounds sorption from water solutions by corn starch cryotextures obtained by freezing. |
| PubMed: | Hyperglycemic and insulin release inhibitory effects of Rosmarinus officinalis. |
| PubMed: | Use of a programmed temperature vaporizer for off-line SFE/GC analysis in food composition studies. |
| PubMed: | Relaxant effect of the volatile oil of Rosmarinus officinalis on tracheal smooth muscle. |
| PubMed: | In Vitro Production of Essential Oil from Proliferating Shoots of Rosmarinus officinalis1. |
| PubMed: | Quantitative variations of some components of the foliage volatile oil of Rosmarinus officinalis L. in the spring. Terpenes and related compounds. XIX. |
| PubMed: | [Composition of etheric oil in the leaves of Rosmarinus officinalis L. 1. Monoterpenchydrocarbons. Terpenes and related materials VI]. |
| PubMed: | Comparison of rumen microbial inhibition resulting from various essential oils isolated from relatively unpalatable plant species. |
|