[(Z)-hex-3-enyl] 2-phenylacetate (Click)
IUPAC Name: [(Z)-hex-3-enyl] 2-phenylacetate
Std.InChI: InChI=1S/C14H18O2/c1-2-3-4-8-11-16-14(15)12-13-9-6-5-7-10-13/h3-7,9-10H,2,8,11-12H2,1H3/b4-3-
InChI: InChI=1/C14H18O2/c1-2-3-4-8-11-16-14(15)12-13-9-6-5-7-10-13/h3-7,9-10H,2,8,11-12H2,1H3/b4-3-
Std.InChIKey: FJKFIIYSBXHBCT-ARJAWSKDSA-N
InChIKey: FJKFIIYSBXHBCT-ARJAWSKDBH
SMILES: CC/C=C\CCOC(=O)CC1=CC=CC=C1
|
CAS Number: | 42436-07-7 |
|
% from: | 98.00% to 99.90% |
ECHA EINECS - REACH Pre-Reg: | 255-826-6 |
FDA UNII: | 8XZ0MZ4575 |
Nikkaji Web: | J73.248F |
Beilstein Number: | 3266406 |
MDL: | MFCD00036531 |
CoE Number: | 10682 |
XlogP3: | 3.70 (est) |
Molecular Weight: | 218.29586000 |
Formula: | C14 H18 O2 |
NMR Predictor: | Predict (works with chrome or firefox) |
Also(can) Contains: | (E)-3-hexen-1-yl phenyl acetate |
EFSA/JECFA Comments: | According to JECFA: Min. assay value is "97 %" and "predominantly (>90 %) cis-isomer". |
Category: flavor and fragrance agents
US / EU / FDA / JECFA / FEMA / FLAVIS / Scholar / Patent Information:
Physical Properties:
Organoleptic Properties:
Odor Type: | green |
Odor Strength: | medium |
| green rose honey waxy sweet pea tropical kiwi beany |
Odor Description: at 100.00 %. | green rose honey waxy sweet pea tropical kiwi beany Luebke, William tgsc, (2009) |
| green floral vegetable tropical melon |
Odor Description:
| Green, floral, vegetable, tropical and melon-like nuances Mosciano, Gerard P&F 16, No. 2, 49, (1991) |
| waxy green floral vegetable melon |
Taste Description: at 15.00 ppm. | Waxy, green, floral with vegetable and melon nuances Mosciano, Gerard P&F 16, No. 2, 49, (1991) |
Substantivity: | 171 hour(s) at 100.00 % |
| |
Cosmetic Information:
Suppliers:
A.C.S. International |
cis-3-Hexenyl Phenylacetate
|
Operational Capabilities |
Apiscent Labs |
C3 HEXENYL PHENYL ACETATE
Odor: Sweet green-rosy odor, woody undertone |
Apple Flavor & Fragrance |
cis-3-Hexenyl phenylacetate
|
Bedoukian Research |
cis-3-HEXENYL PHENYLACETATE
≥98.0% (cis), Kosher Odor: Floral, honey, green Use: Has a boosting effect in mint fragrances. Also used for subtle honey and rose notes Flavor: waxy green Finds use in honey, pear, cabbage and onion flavors. |
BOC Sciences |
For experimental / research use only. |
cis-3-HEXENYL PHENYLACETATE 99.0% (sum of isomers)
|
CG Herbals |
cis-3-Hexenyl Phenyl Acetate
|
CTC Organics |
3-hexenyl phenylacetate
|
FCI SAS |
CIS-3-HEXENYL PHENYL ACETATE
Odor: Sweet green-rosy odor with a woody undertone |
Flowersynth |
CIS-3-HEXENYL-PHENYLACETATE
Odor: GREEN / FLORAL / MELON / WOODY |
Inoue Perfumery |
CIS-3-HEXENYL PHENYL ACETATE
|
Penta International |
cis-3-HEXENYL PHENYLACETATE, Kosher
|
Reincke & Fichtner |
cis-3-Hexenyl Phenylacetate
|
Shanghai Vigen Fine Chemical |
cis-3-Hexenyl Phenylacetate
|
Sigma-Aldrich |
cis-3-Hexenyl phenylacetate, ≥98%, stabilized, FG
Odor: herbaceous; mossy; woody; sweet |
Certified Food Grade Products |
TCI AMERICA |
For experimental / research use only. |
cis-3-Hexen-1-yl Phenylacetate >95.0%(GC)
|
Safety Information:
Preferred SDS: View |
European information : |
Most important hazard(s): | None - None found. |
S 02 - Keep out of the reach of children. S 24/25 - Avoid contact with skin and eyes. S 36 - Wear suitable protective clothing.
|
|
Hazards identification |
|
Classification of the substance or mixture |
GHS Classification in accordance with 29 CFR 1910 (OSHA HCS) |
None found. |
GHS Label elements, including precautionary statements |
|
Pictogram | |
|
Hazard statement(s) |
None found. |
Precautionary statement(s) |
None found. |
Oral/Parenteral Toxicity: |
oral-rat LD50 > 5000 mg/kg (Moreno, 1976n)
oral-rat LD50 > 5000 mg/kg Food and Cosmetics Toxicology. Vol. 17, Pg. 803, 1979.
|
Dermal Toxicity: |
skin-rabbit LD50 > 5000 mg/kg Food and Cosmetics Toxicology. Vol. 17, Pg. 803, 1979.
|
Inhalation Toxicity: |
Not determined
|
Safety in Use Information:
Category: | flavor and fragrance agents |
Recommendation for (Z)-3-hexen-1-yl phenyl acetate usage levels up to: | | 12.0000 % in the fragrance concentrate.
|
|
Maximised Survey-derived Daily Intakes (MSDI-EU): | 0.73 (μg/capita/day) |
Maximised Survey-derived Daily Intakes (MSDI-USA): | 0.05 (μg/capita/day) |
Structure Class: | I |
Use levels for FEMA GRAS flavoring substances on which the FEMA Expert Panel based its judgments that the substances are generally recognized as safe (GRAS). |
The Expert Panel also publishes separate extensive reviews of scientific information on all FEMA GRAS flavoring substances and can be found at FEMA Flavor Ingredient Library |
publication number: 12 |
Click here to view publication 12 |
| average usual ppm | average maximum ppm |
baked goods: | - | 8.80000 |
beverages(nonalcoholic): | - | 7.80000 |
beverages(alcoholic): | - | 5.00000 |
breakfast cereal: | - | - |
cheese: | - | - |
chewing gum: | - | - |
condiments / relishes: | - | - |
confectionery froastings: | - | - |
egg products: | - | - |
fats / oils: | - | - |
fish products: | - | - |
frozen dairy: | - | 7.80000 |
fruit ices: | - | - |
gelatins / puddings: | - | 8.80000 |
granulated sugar: | - | - |
gravies: | - | - |
hard candy: | - | - |
imitation dairy: | - | - |
instant coffee / tea: | - | - |
jams / jellies: | - | - |
meat products: | - | - |
milk products: | - | - |
nut products: | - | - |
other grains: | - | - |
poultry: | - | - |
processed fruits: | - | - |
processed vegetables: | - | - |
reconstituted vegetables: | - | - |
seasonings / flavors: | - | - |
snack foods: | - | - |
soft candy: | - | 8.80000 |
soups: | - | - |
sugar substitutes: | - | - |
sweet sauces: | - | - |
Safety References:
Flavor & Extract Manufacturers Association (FEMA) reference(s): |
The FEMA GRAS assessment of phenethyl alcohol, aldehydes, acids, and related acetals and esters used as flavor ingredients. View pdf |
European Food Safety Athority(efsa): | Flavor usage levels; Subacute, Subchronic, Chronic and Carcinogenicity Studies; Developmental / Reproductive Toxicity Studies; Genotoxicity Studies... |
European Food Safety Authority (EFSA) reference(s): |
Opinion of the Scientific Panel on food additives, flavourings, processing aids and materials in contact with food (AFC) related to: Flavouring Group Evaluation 14 (FGE.14): Phenethyl alcohol, aldehyde, esters, and related phenylacetic acid esters from chemical group 15 (Commission Regulation (EC) No 1565/2000 of 18 July 2000) View page or View pdf |
Flavouring Group Evaluation 53 (FGE.53): Consideration of phenethyl alcohol, aldehyde, acid and related acetals and esters evaluated by JECFA (59th meeting) structurally related to phenethyl alcohol, aldehyde, esters and related phenylacetic acid esters evaluated by EFSA in FGE.14 (2005) and one phenoxyethyl ester evaluated in FGE.23 (2006) (Commission Regulation (EC) No 1565/2000 of 18 July 2000) - Opinion of the Scientific Panel on Food Additives, Flavourings, Processing Aids and Materials in contact with Food (AFC) View page or View pdf |
Flavouring Group Evaluation 14, Revision 1 (FGE.14Rev1): Phenethyl alcohol, aldehyde, acetals, carboxylic acid and related esters from chemical group 15 and 22 [1] - Opinion of the Scientific Panel on Food Additives, Flavourings, Processing Aids and Materials in Contact with Food View page or View pdf |
Flavouring Group Evaluation 53, Revision 1 (FGE.53Rev1): Consideration of phenethyl alcohol, aldehyde, acid and related acetals and esters evaluated by JECFA (59th meeting) FGE.23Rev1 (2008) View page or View pdf |
EPI System: | View |
EPA Substance Registry Services (TSCA): | 42436-07-7 |
EPA ACToR: | Toxicology Data |
EPA Substance Registry Services (SRS): | Registry |
Laboratory Chemical Safety Summary : | 5367698 |
National Institute of Allergy and Infectious Diseases: | Data |
WGK Germany: | 2 |
| [(Z)-hex-3-enyl] 2-phenylacetate |
Chemidplus: | 0042436077 |
RTECS: | CY1630000 for cas# 42436-07-7 |
References:
Other Information:
Potential Blenders and core components note
|
For Odor |
acidic |
acidic |
| cyclohexyl acetic acid | FL/FR |
aldehydic |
| undecenal mixture (aldehyde C-11 mixed) | FL/FR |
animal |
para- | cresyl phenyl acetate | FL/FR |
1,2,3,4- | tetrahydroquinoline | FR |
anisic |
para- | anisyl phenyl acetate | FL/FR |
balsamic |
| cinnamyl alcohol | FL/FR |
| guaiacyl phenyl acetate | FL/FR |
caramellic |
| immortelle absolute | FL/FR |
cereal |
| bran absolute | FR |
cheesy |
2- | heptanone | FL/FR |
chocolate |
iso | amyl phenyl acetate | FL/FR |
| cocoa pentenal | FL/FR |
citrus |
| bergamot oil turkey | FL/FR |
(E)-2- | tetradecenal | FL/FR |
coconut |
gamma- | nonalactone (aldehyde C-18 (so-called)) | FL/FR |
ethereal |
| ethyl formate | FL/FR |
fatty |
| allyl octanoate | FL/FR |
| decanol | FL/FR |
| ethyl undecylenate | FL/FR |
| methyl (E)-2-hexenoate | FL/FR |
2- | nonen-1-ol | FL/FR |
floral |
| acetaldehyde dibutyl acetal | FL/FR |
iso | amyl salicylate | FL/FR |
| benzyl phenyl acetate | FL/FR |
| cardamom absolute | FL/FR |
| citronellal | FL/FR |
| citronellyl acetate | FL/FR |
(S)- | citronellyl acetate | FL/FR |
| citronellyl butyrate | FL/FR |
| citronellyl isovalerate | FL/FR |
| citronellyl phenyl acetate | FL/FR |
| citronellyl propionate | FL/FR |
| citronellyl valerate | FL/FR |
iso | cyclodimethyl octanol | FR |
| cymbopogon validus leaf oil | FR |
gamma- | damascone | FR |
| dihydrocarvyl acetate | FL/FR |
| dihydrojasmone | FL/FR |
| dimethyl benzyl carbinol | FL/FR |
| dimethyl benzyl carbinyl butyrate | FL/FR |
3,6- | dimethyl-3-octyl acetate | FR |
| ethyl hydrocinnamate | FL/FR |
| ethyl phenyl acetate | FL/FR |
| genet concrete | FR |
| geranium oil egypt | FL/FR |
| geranyl acetate | FL/FR |
| geranyl formate | FL/FR |
| geranyl nonanoate | CS |
| geranyl phenyl acetate | FL/FR |
| geranyl propionate | FL/FR |
| glycoacetal | FR |
(Z)-3- | hexen-1-yl salicylate | FL/FR |
| hexyl 2-furoate | FL/FR |
alpha- | hexyl cinnamaldehyde | FL/FR |
| hyacinth acetals | FL/FR |
| hydroxycitronellal | FL/FR |
| hydroxycitronellal dimethyl acetal | FL/FR |
| hydroxycitronellol | FL/FR |
alpha- | ionol | FL/FR |
beta- | ionone | FL/FR |
| kewda absolute | |
| kewda oil | CS |
| linalool oxide | FL/FR |
| linalyl phenyl acetate | FL/FR |
southern | magnolia leaf oil fractions | FR |
(3- | methoxy-2-methyl propyl) benzene | FR |
(Z)- | methyl epi-jasmonate | FL/FR |
| methyl jasmonate | FL/FR |
| mimosa absolute morocco | FL/FR |
| muguet butanol | FR |
| muguet carbinol | FL/FR |
| narcissus acetate | FL/FR |
| neroli oil bigarde | FL/FR |
| neroli oil CO2 extract | FL/FR |
| nerolidol | FL/FR |
(E)- | nerolidol | FL/FR |
| neryl phenyl acetate | FR |
beta- | ocimene | FL/FR |
(Z)-beta- | ocimene | FL/FR |
| octyl isovalerate | FL/FR |
| orange leaf absolute | FL/FR |
bitter | orangeflower absolute morocco | FL/FR |
| papaya isobutyrate | FL/FR |
| phenethyl acetate | FL/FR |
| phenethyl anthranilate | FL/FR |
| phenethyl benzoate | FL/FR |
| phenethyl butyrate | FL/FR |
| phenethyl formate | FL/FR |
| phenethyl hexanoate | FL/FR |
| phenethyl phenyl acetate | FL/FR |
| phenethyl propionate | FL/FR |
| phenyl acetaldehyde digeranyl acetal | FR |
| phenyl glycol diacetate | FR |
2- | phenyl propionaldehyde dimethyl acetal | FL/FR |
3- | phenyl propyl formate | FL/FR |
| phenyl propyl phenyl acetate | FR |
(E)-2- | phenyl-1(2)-propene-1-yl acetate | FR |
iso | propyl anthranilate | FL/FR |
| rhodinyl phenyl acetate | FL/FR |
| rosa alba flower oil CO2 extract | FR |
| rose absolute (rosa centifolia) morocco | FL/FR |
| rose absolute (rosa damascena) bulgaria | FL/FR |
| rose butanoate | FL/FR |
| rose carboxylate | FR |
| rose concrete (rosa centifolia) | FR |
(Z)- | rose oxide | FL/FR |
| rose pyran | FR |
| sambucus nigra flower oil CO2 extract | FR |
| styralyl propionate | FL/FR |
| wallflower absolute | FR |
fruity |
| allyl cyclohexyl propionate | FL/FR |
| allyl phenoxyacetate | FL/FR |
iso | amyl butyrate | FL/FR |
| butyl hexanoate | FL/FR |
| cyclohexyl propionate | FL/FR |
(E)-beta- | damascenone | FL/FR |
beta- | damascone | FL/FR |
(E)-beta- | damascone | FL/FR |
| decen-1-yl cyclopentanone | FL/FR |
| ethyl (E)-2-decenoate | FL/FR |
| ethyl levulinate | FL/FR |
| geranyl acetoacetate | FL/FR |
| geranyl butyrate | FL/FR |
| hexanal propylene glycol acetal | FL/FR |
2- | methyl butyl 2-methyl butyrate | FL/FR |
| methyl nonanoate | FL/FR |
2- | nonanone | FL/FR |
| osmanthus flower absolute | FL/FR |
2- | pentyl furan | FL/FR |
| prenyl acetate | FL/FR |
| propyl hexanoate | FL/FR |
| propyl isobutyrate | FL/FR |
| strawberry glycidate 1 (aldehyde C-16 (so-called)) | FL/FR |
| strawberry glycidate 2 | FL/FR |
| tropical thiazole | FL/FR |
green |
alpha- | allyl-4-methyl-3-cyclohexene-1-methanyl acetate | |
| benzhydrol | FR |
| biphenyl | |
| carrot leaf oil (daucus carota ssp.maximus) | FR |
| cilantro leaf oil | FL/FR |
| dodecanal dimethyl acetal | FL/FR |
| ethyl (E,Z)-2,4-decadienoate | FL/FR |
| ethyl (E)-4-decenoate | FL/FR |
| geranium absolute | FL/FR |
| heptanal dimethyl acetal | FL/FR |
(Z)-4- | heptenal | FL/FR |
| heptyl formate | FL/FR |
(Z)-3- | hexen-1-yl (E)-crotonate | FL/FR |
(Z)-3- | hexen-1-yl benzoate | FL/FR |
(Z)-3- | hexen-1-yl formate | FL/FR |
(E)-2- | hexen-1-yl phenyl acetate | FL/FR |
(E)-2- | hexen-1-yl valerate | FL/FR |
3- | hexenal | FL/FR |
4- | hexenol | FL/FR |
| hexyl 2-methyl butyrate | FL/FR |
| hexyl butyrate | FL/FR |
| hexyl phenyl acetate | FL/FR |
| magnolia leaf oil | FL/FR |
| marigold pot absolute | FL/FR |
| melon nonenoate | FL/FR |
4- | methyl-4-phenyl pentanone | FR |
| nerol oxide | FL/FR |
(E,Z)-3,6- | nonadien-1-ol | FL/FR |
3,6- | nonadien-1-yl acetate | FL/FR |
| octanal diethyl acetal | FL/FR |
2- | octen-1-ol | FL/FR |
(Z)-5- | octen-1-yl propionate | FL/FR |
1- | penten-3-ol | FL/FR |
(E)-2- | pentenal | FL/FR |
| phenethyl isopropyl ether | FR |
| phenethyl oxyacetaldehyde | FR |
| phenethyl tiglate | FL/FR |
| phenoxyethyl isobutyrate | FL/FR |
| phenyl acetaldehyde | FL/FR |
| phenyl acetaldehyde dimethyl acetal | FL/FR |
| phenyl acetaldehyde ethylene glycol acetal | FR |
| rosa damascena leaf absolute | FR |
| rose leaf absolute (rosa centifolia) | FL/FR |
hay |
| beeswax absolute | FL/FR |
herbal |
| artemisyl ketone | FL/FR |
american | elder flower absolute | FR |
| linalyl acetate | FL/FR |
| matricaria chamomilla flower oil | FL/FR |
| rosmarinus officinalis extract | FL/FR |
honey |
| allyl phenyl acetate | FL/FR |
| butyl phenyl acetate | FL/FR |
| methyl hydrocinnamate | FL/FR |
| methyl phenyl acetate | FL/FR |
| phenethyl furoate | FL/FR |
| phenyl acetic acid | FL/FR |
| phenyl pyruvic acid | FL/FR |
| propyl phenyl acetate | FL/FR |
leathery |
| leather cyclohexanol | FR |
melon |
(Z)-6- | nonen-1-ol | FL/FR |
minty |
iso | propyl tiglate | FL/FR |
musty |
| cocoa butenal | FL/FR |
phenolic |
2'- | hydroxyacetophenone | FL/FR |
powdery |
| dibenzyl ketone | FL/FR |
spicy |
alpha- | amyl cinnamyl alcohol | FL/FR |
| carnation absolute | FR |
| carrot weed oil | FL/FR |
2,5- | dimethyl bicyclo(3.2.1)-2-octen-3-yl acetate + 1,4-dimethyl bicyclo(3.2.1)-2-octen-3-yl acetate | FR |
| eugenyl phenyl acetate | FL/FR |
iso | eugenyl phenyl acetate | FL/FR |
sulfurous |
| grapefruit menthane | FL/FR |
| mango thiol | FL/FR |
3-( | methyl thio) hexanol | FL/FR |
sweet |
| beeswax absolute replacer | FR |
thujonic |
| cistus cyclohexanone | FL/FR |
tropical |
| hexyl 2-methyl-3-pentenoate | FL/FR |
2- | tropical oxathiane | FL/FR |
waxy |
| allyl nonanoate | FL/FR |
| dihydrocitronellyl acetate | FL/FR |
1- | dodecanol | FL/FR |
| methyl butyl phenyl acetate | FL/FR |
| nonyl acetate | FL/FR |
| octanol | FL/FR |
| orris rhizome oil CO2 extract | FL/FR |
| waxy acetate | FR |
woody |
(E)- | ethyl geranate | FR |
| santalyl phenyl acetate | FL/FR |
|
For Flavor |
|
No flavor group found for these |
| acetaldehyde dibutyl acetal | FL/FR |
1- | acetyl cyclohexyl acetate | FL |
| artemisyl ketone | FL/FR |
| cistus cyclohexanone | FL/FR |
| citronellyl isovalerate | FL/FR |
| citronellyl valerate | FL/FR |
(E)-beta- | damascenone | FL/FR |
| dihydrocitronellyl acetate | FL/FR |
| ethyl hydrocinnamate | FL/FR |
2- | ethyl-4,5-dimethyl oxazole | FL |
| eugenyl phenyl acetate | FL/FR |
| fig leaf absolute | FL |
(Z)-3- | hexen-1-yl (E)-crotonate | FL/FR |
(E)-2- | hexen-1-yl phenyl acetate | FL/FR |
(E)-4- | hexenal | FL |
| kewda absolute | |
| linalyl phenyl acetate | FL/FR |
| magnolia leaf oil | FL/FR |
| methyl (E)-2-hexenoate | FL/FR |
| methyl hydrocinnamate | FL/FR |
2- | methyl thiazole | FL |
4-( | methyl thio) butanol | FL |
| narcissus acetate | FL/FR |
| octyl isovalerate | FL/FR |
| osmanthus flower absolute | FL/FR |
| phenethyl furoate | FL/FR |
3- | phenyl propyl formate | FL/FR |
iso | propyl anthranilate | FL/FR |
2-iso | propyl-3-(methyl thio) pyrazine | FL |
| rose absolute (rosa damascena) bulgaria | FL/FR |
| santalyl phenyl acetate | FL/FR |
2- | tropical oxathiane | FL/FR |
| undecenal mixture (aldehyde C-11 mixed) | FL/FR |
|
beta- | damascone | FL/FR |
alliaceous |
3- | tetrahydrothiophenone | FL |
| tropical thiazole | FL/FR |
anisic |
para- | anisyl phenyl acetate | FL/FR |
aromatic |
| hyacinth acetals | FL/FR |
bitter |
| dibenzyl ketone | FL/FR |
brown |
| beeswax absolute | FL/FR |
cheesy |
2- | heptanone | FL/FR |
2- | nonanone | FL/FR |
citrus |
| bergamot oil turkey | FL/FR |
| cilantro leaf oil | FL/FR |
| styralyl propionate | FL/FR |
coconut |
gamma- | nonalactone (aldehyde C-18 (so-called)) | FL/FR |
ethereal |
| ethyl formate | FL/FR |
fatty |
| allyl octanoate | FL/FR |
| ethyl (E)-4-decenoate | FL/FR |
| ethyl undecylenate | FL/FR |
| heptyl formate | FL/FR |
(Z)-3- | hexen-1-yl benzoate | FL/FR |
2- | nonen-1-ol | FL/FR |
2- | octen-1-ol | FL/FR |
(E)-2- | octenoic acid | FL |
(E,E)-2,4- | undecadienal | FL |
floral |
iso | amyl phenyl acetate | FL/FR |
| biphenyl | |
| cardamom absolute | FL/FR |
| citronellal | FL/FR |
| citronellyl acetate | FL/FR |
(S)- | citronellyl acetate | FL/FR |
| citronellyl phenyl acetate | FL/FR |
| citronellyl propionate | FL/FR |
| cocoa pentenal | FL/FR |
| dihydrocarvyl acetate | FL/FR |
| dihydrojasmone | FL/FR |
| dimethyl benzyl carbinyl butyrate | FL/FR |
| geranium oil egypt | FL/FR |
| geranyl phenyl acetate | FL/FR |
| linalyl acetate | FL/FR |
(Z)- | methyl epi-jasmonate | FL/FR |
| methyl jasmonate | FL/FR |
| methyl phenyl acetate | FL/FR |
| mimosa absolute morocco | FL/FR |
| muguet carbinol | FL/FR |
| neroli oil bigarde | FL/FR |
| neroli oil CO2 extract | FL/FR |
| orange leaf absolute | FL/FR |
bitter | orangeflower absolute morocco | FL/FR |
| phenethyl anthranilate | FL/FR |
| phenethyl benzoate | FL/FR |
| phenethyl propionate | FL/FR |
| phenyl acetic acid | FL/FR |
| rose absolute (rosa centifolia) morocco | FL/FR |
fruity |
| allyl cyclohexyl propionate | FL/FR |
| allyl phenoxyacetate | FL/FR |
| butyl hexanoate | FL/FR |
| citronellyl butyrate | FL/FR |
| cyclohexyl propionate | FL/FR |
(E)-beta- | damascone | FL/FR |
| decen-1-yl cyclopentanone | FL/FR |
| ethyl (E)-2-decenoate | FL/FR |
| ethyl levulinate | FL/FR |
2- | furyl pentyl ketone | FL |
| geranyl butyrate | FL/FR |
| hexanal propylene glycol acetal | FL/FR |
| hexyl 2-methyl-3-pentenoate | FL/FR |
| hexyl phenyl acetate | FL/FR |
2- | methyl butyl 2-methyl butyrate | FL/FR |
| phenethyl butyrate | FL/FR |
2- | phenyl propionaldehyde dimethyl acetal | FL/FR |
| prenyl acetate | FL/FR |
| propyl hexanoate | FL/FR |
| propyl isobutyrate | FL/FR |
| rose butanoate | FL/FR |
| strawberry glycidate 1 (aldehyde C-16 (so-called)) | FL/FR |
| strawberry glycidate 2 | FL/FR |
green |
alpha- | allyl-4-methyl-3-cyclohexene-1-methanyl acetate | |
iso | amyl salicylate | FL/FR |
| carrot weed oil | FL/FR |
| cinnamyl alcohol | FL/FR |
| cocoa butenal | FL/FR |
| dihydroxyacetophenone (mixed isomers) | FL |
| dodecanal dimethyl acetal | FL/FR |
| ethyl (E,Z)-2,4-decadienoate | FL/FR |
| geranium absolute | FL/FR |
| geranyl acetate | FL/FR |
| geranyl formate | FL/FR |
| heptanal dimethyl acetal | FL/FR |
(E)-2- | heptenal | FL |
(Z)-4- | heptenal | FL/FR |
(E,E)-2,4- | hexadienal | FL |
(Z)-3- | hexen-1-yl formate | FL/FR |
(Z)-3- | hexen-1-yl salicylate | FL/FR |
(E)-2- | hexen-1-yl valerate | FL/FR |
3- | hexenal | FL/FR |
(E)-3- | hexenoic acid | FL |
| hexyl 2-furoate | FL/FR |
| hexyl 2-methyl butyrate | FL/FR |
| hexyl butyrate | FL/FR |
| hibiscus distillates | FL |
| immortelle absolute | FL/FR |
| linalool oxide | FL/FR |
| marigold pot absolute | FL/FR |
| melon nonenoate | FL/FR |
3-(5- | methyl-2-furyl) butanal | FL |
| nerol oxide | FL/FR |
(E)- | nerolidol | FL/FR |
| nerolidol | FL/FR |
(E,Z)-3,6- | nonadien-1-ol | FL/FR |
3,6- | nonadien-1-yl acetate | FL/FR |
beta- | ocimene | FL/FR |
(Z)-beta- | ocimene | FL/FR |
2,4- | octadienal | FL |
| octanal diethyl acetal | FL/FR |
(Z)-5- | octen-1-yl propionate | FL/FR |
| papaya isobutyrate | FL/FR |
1- | penten-3-ol | FL/FR |
(E)-2- | pentenal | FL/FR |
2- | pentyl furan | FL/FR |
| phenethyl formate | FL/FR |
| phenethyl tiglate | FL/FR |
| phenoxyethyl isobutyrate | FL/FR |
| phenyl acetaldehyde dimethyl acetal | FL/FR |
iso | phorone | FL |
2- | propyl pyrazine | FL |
iso | propyl tiglate | FL/FR |
| propylene glycol acetone ketal | FL |
| rose leaf absolute (rosa centifolia) | FL/FR |
(Z)- | rose oxide | FL/FR |
herbal |
| matricaria chamomilla flower oil | FL/FR |
| rosmarinus officinalis extract | FL/FR |
honey |
| allyl phenyl acetate | FL/FR |
| benzyl phenyl acetate | FL/FR |
| butyl phenyl acetate | FL/FR |
| ethyl phenyl acetate | FL/FR |
| phenethyl acetate | FL/FR |
| phenethyl phenyl acetate | FL/FR |
| phenyl acetaldehyde | FL/FR |
| propyl phenyl acetate | FL/FR |
leafy |
| methyl butyl phenyl acetate | FL/FR |
medicinal |
| dimethyl benzyl carbinol | FL/FR |
metallic |
4- | hexenol | FL/FR |
3-( | methyl thio) hexanol | FL/FR |
musty |
| geranyl acetoacetate | FL/FR |
naphthyl |
2'- | hydroxyacetophenone | FL/FR |
phenolic |
para- | cresyl phenyl acetate | FL/FR |
| guaiacyl phenyl acetate | FL/FR |
| phenyl pyruvic acid | FL/FR |
powdery |
| hydroxycitronellol | FL/FR |
soapy |
1- | dodecanol | FL/FR |
sour |
2,4- | dimethyl-2-pentenoic acid | FL |
spicy |
alpha- | amyl cinnamyl alcohol | FL/FR |
iso | eugenyl phenyl acetate | FL/FR |
sulfurous |
| grapefruit menthane | FL/FR |
| mango thiol | FL/FR |
| methyl 2-(methyl thio) butyrate | FL |
| methyl benzyl disulfide | FL |
sweet |
| cyclohexyl acetic acid | FL/FR |
waxy |
| allyl nonanoate | FL/FR |
iso | amyl butyrate | FL/FR |
| decanol | FL/FR |
| geranyl propionate | FL/FR |
alpha- | hexyl cinnamaldehyde | FL/FR |
| hydroxycitronellal | FL/FR |
| hydroxycitronellal dimethyl acetal | FL/FR |
(Z)-6- | nonen-1-ol | FL/FR |
| nonyl acetate | FL/FR |
| octanol | FL/FR |
| phenethyl hexanoate | FL/FR |
| rhodinyl phenyl acetate | FL/FR |
(E)-2- | tetradecenal | FL/FR |
winey |
| methyl nonanoate | FL/FR |
woody |
alpha- | ionol | FL/FR |
beta- | ionone | FL/FR |
| orris rhizome oil CO2 extract | FL/FR |
|
Potential Uses:
Occurrence (nature, food, other): note
Synonyms:
| benzene acetic acid (3Z)-3-hexen-1-yl ester | (Z)- | benzene acetic acid 3-hexen-1-yl ester | | benzeneacetic acid, (3Z)-3-hexen-1-yl ester | | benzeneacetic acid, (3Z)-3-hexenyl ester | | benzeneacetic acid, 3-hexenyl ester, (Z)- | (3Z)- | hex-3-en-1-yl phenylacetate | (Z)- | hex-3-enyl phenyl acetate | cis- | hex-3-enyl phenyl acetate | (Z)- | hex-3-enyl phenylacetate | [(Z)- | hex-3-enyl] 2-phenylacetate | 3- | hexen-1-yl alpha-toluate | beta,gamma- | hexen-1-yl alpha-toluate | (Z)-3- | hexen-1-yl benzene acetate | (Z)-3- | hexen-1-yl phenyl acetate | 3- | hexen-1-yl phenyl acetate | cis-3- | hexen-1-yl phenyl acetate | cis-3- | hexen-1-yl phenylacetate | 3- | hexenyl benzeneacetate, (Z)- | 3- | hexenyl benzeneacetate, cis- | (Z)-3- | hexenyl phenyl acetate | C3 | hexenyl phenyl acetate | cis-3- | hexenyl phenyl acetate | (Z)-3- | hexenyl phenylacetate | cis-3- | hexenyl phenylacetate | | phenylacetic acid cis-3-hexen-1-yl ester |
Articles:
|