|
Category: flavor and fragrance agents
US / EU / FDA / JECFA / FEMA / FLAVIS / Scholar / Patent Information:
Physical Properties:
| Appearance: | colorless clear viscous liquid (est) |
| Assay: | 94.00 to 100.00 % sum of isomers
|
| Food Chemicals Codex Listed: | No |
| Specific Gravity: | 0.91100 to 0.91700 @ 25.00 °C.
|
| Pounds per Gallon - (est).: | 7.580 to 7.630
|
| Refractive Index: | 1.45400 to 1.46100 @ 20.00 °C.
|
| Boiling Point: | 76.00 to 78.00 °C. @ 8.00 mm Hg
|
| Vapor Pressure: | 0.163000 mmHg @ 25.00 °C. (est) |
| Flash Point: | 180.00 °F. TCC ( 82.22 °C. )
|
| logP (o/w): | 2.729 (est) |
| Soluble in: |
| | alcohol | | | oils | | | water, 566 mg/L @ 20 °C (exp) |
| Insoluble in: |
| | water |
| Stability: |
| | alcoholic, good | | | antiperspirant spray, good | | | liquid bleach, good | | | ph = 10, good | | | ph = 2, good | | | powder detergent, good | | | soap, good | | | toiletry, good |
Organoleptic Properties:
| |
| Odor Type: mentholic |
| |
| Odor Strength: | medium |
| |
| Substantivity: | 4 hour(s) at 100.00 % |
| |
| | fresh minty peppermint woody camphoreous |
Odor Description: at 100.00 %. | fresh mint peppermint woody camphor Luebke, William tgsc, (1988) |
| |
| | cooling minty mentholic spearmint camphoreous |
Odor Description:
| Cooling, minty, mentholic, spearmint-like, with a camphoraceous undernote Mosciano, Gerard P&F 17, No. 4, 33, (1992) |
| |
| |
| Flavor Type: mentholic |
| |
| | cooling peppermint spearmint |
Taste Description: at 25.00 ppm. | Cooling, peppermint and spearmint-like Mosciano, Gerard P&F 17, No. 4, 33, (1992) |
| |
| Odor and/or flavor descriptions from others (if found). |
| |
| Givaudan |
| Freskomenthe® |
| Odor Description: | Fresh, Cool Mint, Agrestic, Woody aspect Freskomenthe adds an element of freshness to a wide range of accords,including lavender, citrus, aromatic, geranium and green notes. It contributes a unique cooling effect in powder detergent, without becoming overly minty. Freskomenthe can be used to modify a typical mint character and suggest peppermint in a blend containing none of the natural mint. Very stable in all applications, including bleach. |
| Taste Description: | cooling peppermint spearmint |
| |
| Moellhausen |
| FRESKOMENTHE |
| Odor Description: | dusty, herbal, woody, camphoraceous, minty |
| Taste Description: | cooling, fresh, peppermint |
| |
| |
Cosmetic Information:
Suppliers:
| Augustus Oils |
| Freskomenthe
|
| Services |
| BOC Sciences |
| For experimental / research use only. |
| Cyclohexanone,2-(1-methylpropyl)-
|
| Ernesto Ventós |
| FRESKOMENTHE GIVAUDAN
|
| Givaudan |
| Freskomenthe®
Odor: Fresh, Cool Mint, Agrestic, Woody aspect Use: Freskomenthe adds an element of freshness to a wide range of accords,including lavender, citrus, aromatic, geranium and green notes. It contributes a unique cooling effect in powder detergent, without becoming overly minty. Freskomenthe can be used to modify a typical mint character and suggest peppermint in a blend containing none of the natural mint. Very stable in all applications, including bleach. |
| Indukern F&F |
| FRESKOMENTHE
Odor: FRESH, MENTHOLATED, WOODY, EARTHY |
| Lluch Essence |
| FRESKOMENTHE
|
| M&U International |
| Peppermint Cyclohexanone
|
| Moellhausen |
| FRESKOMENTHE
Odor: dusty, herbal, woody, camphoraceous, minty Flavor: cooling, fresh, peppermint |
| O'Laughlin Industries |
| 2-(1-Methylpropyl) Cyclohexanone
|
| Penta International |
| O-SEC-BUTYLCYCLOHEXANONE
|
| Santa Cruz Biotechnology |
| For experimental / research use only. |
| 2-sec-Butylcyclohexanone
|
| Sigma-Aldrich |
| 2-sec-Butylcyclohexanone, mixture of diastereomers, ≥98%, FG
Odor: musty; woody; vanilla; green; minty; spicy |
| Certified Food Grade Products |
| Symrise |
| Isobutylmenthone
Odor: Mint, Herbaceous, Green, Pennyroyal, Geranium |
| Synerzine |
| 2-sec-Butylcyclohexanone
|
| TCI AMERICA |
| For experimental / research use only. |
| 2-sec-Butylcyclohexanone (mixture of isomers) >98.0%(GC)
|
| The Lermond Company |
| PEPPERMINT CYCLOHEXANONE
|
| Vigon International |
| Butyl-2 Secondary Cyclohexanone (Freskomenthe )
Odor: Fresh, Cool Mint, Agrestic, Woody aspect |
Safety Information:
| Preferred SDS: View |
| European information : |
| Most important hazard(s): | | Xi - Irritant |
R 36/37/38 - Irritating to eyes, respiratory system, and skin. S 02 - Keep out of the reach of children. S 24/25 - Avoid contact with skin and eyes. S 26 - In case of contact with eyes, rinse immediately with plenty of water and seek medical advice. S 36 - Wear suitable protective clothing.
|
| |
| Hazards identification |
| |
| Classification of the substance or mixture |
| GHS Classification in accordance with 29 CFR 1910 (OSHA HCS) |
| None found. |
| GHS Label elements, including precautionary statements |
| |
| Pictogram | |
| |
| Hazard statement(s) |
| None found. |
| Precautionary statement(s) |
| None found. |
| Oral/Parenteral Toxicity: |
oral-rat LD50 2400 mg/kg Food and Chemical Toxicology. Vol. 30, Pg. 11S, 1992.
|
| Dermal Toxicity: |
skin-rabbit LD50 > 5000 mg/kg Food and Chemical Toxicology. Vol. 30, Pg. 11S, 1992.
|
| Inhalation Toxicity: |
|
Not determined
|
Safety in Use Information:
| Category: | flavor and fragrance agents |
| RIFM Fragrance Material Safety Assessment: Search |
| IFRA Code of Practice Notification of the 49th Amendment to the IFRA Code of Practice |
| Recommendation for peppermint cyclohexanone usage levels up to: | | | 6.0000 % in the fragrance concentrate.
|
| |
| Maximised Survey-derived Daily Intakes (MSDI-EU): | 5.10 (μg/capita/day) |
| Maximised Survey-derived Daily Intakes (MSDI-USA): | ND (μg/capita/day) |
| Structure Class: | II |
| Use levels for FEMA GRAS flavoring substances on which the FEMA Expert Panel based its judgments that the substances are generally recognized as safe (GRAS). |
| The Expert Panel also publishes separate extensive reviews of scientific information on all FEMA GRAS flavoring substances and can be found at FEMA Flavor Ingredient Library |
| publication number: 5 |
| Click here to view publication 5 |
| | average usual ppm | average maximum ppm |
| baked goods: | - | 100.00000 |
| beverages(nonalcoholic): | - | 25.00000 |
| beverages(alcoholic): | - | - |
| breakfast cereal: | - | - |
| cheese: | - | - |
| chewing gum: | - | 1000.00000 |
| condiments / relishes: | - | - |
| confectionery froastings: | - | - |
| egg products: | - | - |
| fats / oils: | - | - |
| fish products: | - | - |
| frozen dairy: | - | 25.00000 |
| fruit ices: | - | 25.00000 |
| gelatins / puddings: | - | - |
| granulated sugar: | - | - |
| gravies: | - | - |
| hard candy: | - | 150.00000 |
| imitation dairy: | - | - |
| instant coffee / tea: | - | - |
| jams / jellies: | - | - |
| meat products: | - | - |
| milk products: | - | - |
| nut products: | - | - |
| other grains: | - | - |
| poultry: | - | - |
| processed fruits: | - | - |
| processed vegetables: | - | - |
| reconstituted vegetables: | - | - |
| seasonings / flavors: | - | - |
| snack foods: | - | - |
| soft candy: | - | - |
| soups: | - | - |
| sugar substitutes: | - | - |
| sweet sauces: | - | - |
Safety References:
| Flavor & Extract Manufacturers Association (FEMA) reference(s): |
| The FEMA GRAS assessment of alicyclic substances used as flavor ingredients. View pdf |
| European Food Safety Athority(EFSA): | Flavor usage levels; Subacute, Subchronic, Chronic and Carcinogenicity Studies; Developmental / Reproductive Toxicity Studies; Genotoxicity Studies... |
| European Food Safety Authority (EFSA) reference(s): |
Flavouring Group Evaluation 51, (FGE.51)[1] - Consideration of alicyclic ketones and secondary alcohols and related esters evaluated by JECFA (59th meeting) and structurally related to alicyclic ketones, secondary alcohols and related esters evaluated by EFSA in FGE.09 (2004) - Opinion of the Scientific Panel on Food Additives, Flavourings, Processing Aids and Materials in Contact with Food View page or View pdf |
Flavouring Group Evaluation 9, Revision 1: (FGE.09 Rev1)[1] - Secondary alicyclic saturated and unsaturated alcohols, ketones and esters containing secondary alicyclic alcohols from chemical groups 8 and 30, and an ester of a phenol carboxylic acid from chemical group 25 - Scientific Opinion of the Panel on Food Additives, Flavourings, Processing Aids and Materials in Contact with Food View page or View pdf |
Flavouring Group Evaluation 9, Revision 2 (FGE.09Rev2): Secondary alicyclic saturated and unsaturated alcohols, ketones and esters containing secondary alicyclic alcohols from chemical group 8 and 30, and an ester of a phenol derivative from chemical group 25 View page or View pdf |
Scientific Opinion on Flavouring Group Evaluation 51, Revision 1 (FGE.51Rev1): Consideration of alicyclic ketones and secondary alcohols and related esters evaluated by the JECFA (59th meeting) structurally related to alicyclic ketones secondary alcohols and related esters in FGE.09Rev3 (2011) View page or View pdf |
Flavouring Group Evaluation 51, Revision 2 (FGE.51Rev2): Consideration of alicyclic ketones and secondary alcohols and related esters evaluated by JECFA (59th meeting) structurally related to alicyclic ketones secondary alcohols and related esters in FGE.09Rev6 (2015) View page or View pdf |
| EPI System: | View |
| AIDS Citations: | Search |
| Cancer Citations: | Search |
| Toxicology Citations: | Search |
| EPA Substance Registry Services (TSCA): | 14765-30-1 |
| EPA ACToR: | Toxicology Data |
| EPA Substance Registry Services (SRS): | Registry |
| Laboratory Chemical Safety Summary : | 61771 |
| National Institute of Allergy and Infectious Diseases: | Data |
| WGK Germany: | 2 |
| | 2-butan-2-ylcyclohexan-1-one |
| Chemidplus: | 0014765301 |
| RTECS: | GW1804000 for cas# 14765-30-1 |
References:
Other Information:
Potential Blenders and core components note
| |
| For Odor |
| No odor group found for these |
|
| laevo-mono | menthyl glutarate | FL/FR |
| aldehydic |
| | citrus carbaldehyde | FR |
| | dodecanal (aldehyde C-12 lauric) | FL/FR |
| anise |
| | anise seed oil colombia | FL/FR |
| balsamic |
| | benzyl salicylate | FL/FR |
| laevo- | borneol | FL/FR |
| dextro,laevo- | borneol | FL/FR |
| laevo- | bornyl acetate | FL/FR |
| iso | bornyl acetate | FL/FR |
| iso | bornyl methyl ether | FL/FR |
| dextro- | fenchone | FL/FR |
| camphoreous |
| | bornyl ethyl ether | |
| dextro- | camphor | FL/FR |
| | camphor tree bark oil | FL/FR |
| beta-homo | cyclocitral | FL/FR |
| 2,6- | dimethyl-3-oxatricyclo(4.2.1.0*2,4*)nonane | FR |
| | eucalyptus phellandra oil | |
| | eucalyptus polybractea oil | FR |
| | fenchol | FL/FR |
| laevo- | fenchone | FL/FR |
| chocolate |
| 1,3,3,4,5,6- | hexamethyl(2.2.2)bicyclooct-5-en-2-ol | |
| earthy |
| (-)-alpha- | fenchol | FL/FR |
| floral |
| alpha- | amyl cinnamaldehyde | FL/FR |
| iso | amyl salicylate | FL/FR |
| | bois de rose oil brazil | FL/FR |
| | bois de rose oil peru | FL/FR |
| | citronellol | FL/FR |
| | coriander seed oil | FL/FR |
| | cyclamen aldehyde | FL/FR |
| | dihydrocarvyl acetate | FL/FR |
| | geraniol | FL/FR |
| (Z)-3- | hexen-1-yl salicylate | FL/FR |
| alpha- | hexyl cinnamaldehyde | FL/FR |
| | ho leaf oil | FR |
| | hyacinth ether | FR |
| laevo- | linalool | FL/FR |
| | linalool oxide | FL/FR |
| | methyl dihydrojasmonate | FL/FR |
| | ocean propanal | FL/FR |
| | rose butanoate | FL/FR |
| fruity |
| 3- | allyl oxy-1,4-dimethyl bicyclo(3.2.1)octane | FR |
| | cherry propanol | FL/FR |
| | green acetate | FR |
| | menthyl isovalerate | FL/FR |
| 1,3,3,5- | tetramethyl-7 and 8-acetyl bicyclo(2.2.2)oct-5-ene | |
| gamma- | undecalactone (aldehyde C-14 (so-called)) | FL/FR |
| green |
| (Z)-3- | hexen-1-ol | FL/FR |
| | phenyl acetaldehyde dimethyl acetal | FL/FR |
| herbal |
| 6- | acetoxydihydrotheaspirane | FL/FR |
| 1- | allyl-2,2,7,7-tetramethyl cycloheptanol | FR |
| 1,4- | cineole | FL/FR |
| | clary sage oil france | FL/FR |
| | dimethyl cyclormol (IFF) | FR |
| | geranic oxide | FL/FR |
| | herbal dioxane | FR |
| 6- | hydroxydihydrotheaspirane (mixture of isomers) | FL/FR |
| | lavender absolute bulgaria | FL/FR |
| | linalyl acetate | FL/FR |
| | methyl cyclogeranate (Firmenich) | FR |
| | myrtenol | FL/FR |
| | origanum oil | FL/FR |
| | origanum oil greece | FL/FR |
| | rosemary absolute | FL/FR |
| | rosemary oil | FL/FR |
| | rosemary oil africa | FL/FR |
| | rosemary oil morocco | FL/FR |
| | rosemary oil spain | FL/FR |
| | rosemary oil tunisia | FL/FR |
| | sabinene hydrate | FL/FR |
| | theaspirane | FL/FR |
| mentholic |
| | cornmint oil | FL/FR |
| | cornmint oil china | FL/FR |
| | cornmint oil india | FL/FR |
| | cornmint oil terpeneless | FL/FR |
| neoiso | menthol | FL/FR |
| dextro-neo | menthol | FL/FR |
| (±)- | menthol | FL/FR |
| dextro,laevo-neo | menthol | FL/FR |
| dextro,laevo- | menthol | FL/FR |
| laevo- | menthol | FL/FR |
| (+)- | menthone | FL/FR |
| (±)-iso | menthone | FL/FR |
| | menthyl acetate | FL/FR |
| laevo- | menthyl acetate | FL/FR |
| | menthyl acetate racemic | FL/FR |
| dextro- | piperitone | FL/FR |
| iso | pulegyl acetate | FL/FR |
| minty |
| | camphene hydrate | |
| laevo- | carvone | FL/FR |
| | cornmint oil japan | FL/FR |
| | cornmint oil terpenes | FR |
| | dihydrocarveol | FL/FR |
| (+)- | dihydrocarvone | FL/FR |
| | mentha piperita extract | FL/FR |
| | mentha piperita flower/leaf/stem extract | FL/FR |
| | mentha piperita flower/leaf/stem water | FR |
| | mentha piperita herb extract america | FR |
| | mentha piperita leaf water | FR |
| | mentha piperita tincture | FL/FR |
| (-)- | menthone | FL/FR |
| (±)- | menthone | FL/FR |
| 2- | methyl cyclohexanone | FL/FR |
| | methyl salicylate | FL/FR |
| | pennyroyal oil | FL/FR |
| | pennyroyal oil fractions | FL/FR |
| | peppermint absolute | FL/FR |
| | peppermint distillates | FL/FR |
| | peppermint fragrance | FR |
| | peppermint leaf | CS |
| | peppermint oil | FL/FR |
| | peppermint oil america | FL/FR |
| | peppermint oil brazil | FL/FR |
| | peppermint oil china | FL/FR |
| | peppermint oil CO2 extract | FL/FR |
| | peppermint oil dementholized | FL/FR |
| | peppermint oil england | FL/FR |
| | peppermint oil france | FL/FR |
| | peppermint oil hungary | FL/FR |
| | peppermint oil idaho | FL/FR |
| | peppermint oil india | FL/FR |
| | peppermint oil mongolia | FL/FR |
| | peppermint oil montana | FL/FR |
| | peppermint oil morocco | FL/FR |
| | peppermint oil russia | FL/FR |
| | peppermint oil special fractions | FL/FR |
| | peppermint oil tasmania | FL/FR |
| | peppermint oil terpeneless | FL/FR |
| | peppermint oil terpenes | FR |
| | peppermint oil willamette | FL/FR |
| | peppermint oil yakima | FL/FR |
| | peppermint water | FL/FR |
| laevo- | piperitone | FL/FR |
| 5- and 6-iso | propyl-1,3,3-trimethyl bicyclo(2.2.2)-5,7-octadien-2-one | |
| iso | pulegol | FL/FR |
| iso | pulegone | FL/FR |
| (R)-(+)- | pulegone | FR |
| | spearmint oil america | FL/FR |
| | wintergreen oil | FL/FR |
| | WS-23 | FL/FR |
| naphthyl |
| para- | methyl anisole | FL/FR |
| powdery |
| para- | anisyl alcohol | FL/FR |
| spicy |
| | clove bud oil | FL/FR |
| | eugenol | FL/FR |
| alpha- | methyl cinnamaldehyde | FL/FR |
| black | pepper oil | FL/FR |
| white | sassafras oil | FL/FR |
| sulfurous |
| | grapefruit menthane | FL/FR |
| | passiflora acetate | FL/FR |
| thujonic |
| | cedarleaf oil terpeneless | FR |
| tonka |
| | tonka bean absolute | FR |
| vanilla |
| | ethyl vanillin | FL/FR |
| | vanilla bean absolute (vanilla planifolia) | FL/FR |
| woody |
| 2-tert- | butyl cyclohexanone | FR |
| (+)- | camphene | FL/FR |
| | camphene | FL/FR |
| 1,4- | dimethyl bicyclo(3.2.1)octan-3-one | FR |
| 1,2,3,3,4,5,6- | heptamethyl bicyclo(2.2.2)oct-5-en-2-ol | |
| | hinoki root oil | FR |
| | juniper berry oil terpenes | FR |
| | santall | FR |
| 1,3,3,5- | tetramethyl-7 and 8-cyanobicyclo(2.2.2)oct-5-ene | |
| | woody acetate | FR |
| |
| For Flavor |
| |
| No flavor group found for these |
| 6- | acetoxydihydrotheaspirane | FL/FR |
| dextro,laevo- | borneol | FL/FR |
| iso | bornyl methyl ether | FL/FR |
| (+)- | camphene | FL/FR |
| | camphene hydrate | |
| (+)- | dihydrocarvone | FL/FR |
| | eucalyptus phellandra oil | |
| 1,2,3,3,4,5,6- | heptamethyl bicyclo(2.2.2)oct-5-en-2-ol | |
| 1,3,3,4,5,6- | hexamethyl(2.2.2)bicyclooct-5-en-2-ol | |
| dextro,laevo-neo | menthol | FL/FR |
| neoiso | menthol | FL/FR |
| | menthyl acetate racemic | FL/FR |
| laevo-mono | menthyl glutarate | FL/FR |
| | menthyl propylene glycol carbonate | FL |
| 2- | methyl cyclohexanone | FL/FR |
| 5- and 6-iso | propyl-1,3,3-trimethyl bicyclo(2.2.2)-5,7-octadien-2-one | |
| iso | pulegone | FL/FR |
| white | sassafras oil | FL/FR |
| 1,3,3,5- | tetramethyl-7 and 8-acetyl bicyclo(2.2.2)oct-5-ene | |
| 1,3,3,5- | tetramethyl-7 and 8-cyanobicyclo(2.2.2)oct-5-ene | |
| anise |
| | anise seed oil colombia | FL/FR |
| balsamic |
| | benzyl salicylate | FL/FR |
| laevo- | bornyl acetate | FL/FR |
| camphoreous |
| laevo- | borneol | FL/FR |
| | bornyl ethyl ether | |
| | camphene | FL/FR |
| | camphor tree bark oil | FL/FR |
| (-)-alpha- | fenchol | FL/FR |
| | fenchol | FL/FR |
| laevo- | fenchone | FL/FR |
| | geranic oxide | FL/FR |
| 6- | hydroxydihydrotheaspirane (mixture of isomers) | FL/FR |
| | rosemary oil tunisia | FL/FR |
| citrus |
| laevo- | linalool | FL/FR |
| cooling |
| 1,4- | cineole | FL/FR |
| beta-homo | cyclocitral | FL/FR |
| dextro- | fenchone | FL/FR |
| laevo- | menthol | FL/FR |
| iso | menthol | FL |
| dextro,laevo- | menthol | FL/FR |
| | menthyl acetate | FL/FR |
| | peppermint oil america | FL/FR |
| | sabinene hydrate | FL/FR |
| | theaspirane | FL/FR |
| | WS-3 | FL |
| | WS-5 | FL |
| creamy |
| gamma- | undecalactone (aldehyde C-14 (so-called)) | FL/FR |
| floral |
| | bois de rose oil brazil | FL/FR |
| | bois de rose oil peru | FL/FR |
| | citronellol | FL/FR |
| | dihydrocarvyl acetate | FL/FR |
| | geraniol | FL/FR |
| | linalyl acetate | FL/FR |
| | methyl dihydrojasmonate | FL/FR |
| | ocean propanal | FL/FR |
| fruity |
| para- | anisyl alcohol | FL/FR |
| | cherry propanol | FL/FR |
| | menthyl isovalerate | FL/FR |
| | rose butanoate | FL/FR |
| green |
| iso | amyl salicylate | FL/FR |
| | cyclamen aldehyde | FL/FR |
| | dihydrocarveol | FL/FR |
| (Z)-3- | hexen-1-ol | FL/FR |
| (Z)-3- | hexen-1-yl salicylate | FL/FR |
| | linalool oxide | FL/FR |
| | phenyl acetaldehyde dimethyl acetal | FL/FR |
| herbal |
| | clary sage oil france | FL/FR |
| | coriander seed oil | FL/FR |
| | lavender absolute bulgaria | FL/FR |
| | origanum oil | FL/FR |
| | origanum oil greece | FL/FR |
| | rosemary absolute | FL/FR |
| | rosemary oil | FL/FR |
| | rosemary oil africa | FL/FR |
| | rosemary oil morocco | FL/FR |
| | rosemary oil spain | FL/FR |
| medicinal |
| dextro- | camphor | FL/FR |
| mentholic |
| | cornmint oil | FL/FR |
| | cornmint oil terpeneless | FL/FR |
| (±)- | menthol | FL/FR |
| dextro-neo | menthol | FL/FR |
| (+)- | menthone | FL/FR |
| minty |
| laevo- | carvone | FL/FR |
| | cherry menthol flavor | FL |
| | cornmint oil china | FL/FR |
| | cornmint oil india | FL/FR |
| | cornmint oil japan | FL/FR |
| | mentha piperita extract | FL/FR |
| | mentha piperita flower/leaf/stem extract | FL/FR |
| | mentha piperita tincture | FL/FR |
| (±)-iso | menthone | FL/FR |
| (±)- | menthone | FL/FR |
| (-)- | menthone | FL/FR |
| laevo- | menthyl acetate | FL/FR |
| | methyl salicylate | FL/FR |
| | myrtenol | FL/FR |
| | pennyroyal oil | FL/FR |
| | pennyroyal oil fractions | FL/FR |
| | peppermint absolute | FL/FR |
| | peppermint distillates | FL/FR |
| | peppermint flavor | FL |
| | peppermint oil | FL/FR |
| | peppermint oil brazil | FL/FR |
| | peppermint oil china | FL/FR |
| | peppermint oil CO2 extract | FL/FR |
| | peppermint oil dementholized | FL/FR |
| | peppermint oil england | FL/FR |
| | peppermint oil france | FL/FR |
| | peppermint oil hungary | FL/FR |
| | peppermint oil idaho | FL/FR |
| | peppermint oil india | FL/FR |
| | peppermint oil mongolia | FL/FR |
| | peppermint oil montana | FL/FR |
| | peppermint oil morocco | FL/FR |
| | peppermint oil russia | FL/FR |
| | peppermint oil special fractions | FL/FR |
| | peppermint oil tasmania | FL/FR |
| | peppermint oil terpeneless | FL/FR |
| | peppermint oil willamette | FL/FR |
| | peppermint oil yakima | FL/FR |
| | peppermint water | FL/FR |
| laevo- | piperitone | FL/FR |
| dextro- | piperitone | FL/FR |
| iso | pulegol | FL/FR |
| | spearmint oil america | FL/FR |
| | wintergreen oil | FL/FR |
| | WS-23 | FL/FR |
| naphthyl |
| para- | methyl anisole | FL/FR |
| soapy |
| | dodecanal (aldehyde C-12 lauric) | FL/FR |
| spicy |
| | clove bud oil | FL/FR |
| | eugenol | FL/FR |
| alpha- | methyl cinnamaldehyde | FL/FR |
| black | pepper oil | FL/FR |
| sulfurous |
| | grapefruit menthane | FL/FR |
| terpenic |
| para- | menthatriene | FL |
| tropical |
| alpha- | amyl cinnamaldehyde | FL/FR |
| | passiflora acetate | FL/FR |
| vanilla |
| | ethyl vanillin | FL/FR |
| | vanilla bean absolute (vanilla planifolia) | FL/FR |
| waxy |
| alpha- | hexyl cinnamaldehyde | FL/FR |
| woody |
| iso | bornyl acetate | FL/FR |
| iso | pulegyl acetate | FL/FR |
| |
Potential Uses:
Occurrence (nature, food, other): note
Synonyms:
| 2- | butan-2-ylcyclohexan-1-one | | 2-sec- | butyl cyclohexanone | | o-sec- | butyl cyclohexanone | | ortho-sec- | butyl cyclohexanone | | iso | butyl menthone | | 2-(sec- | butyl)cyclohexanone | | 2-sec- | butylcyclohexan-1-one | | 2-sec- | butylcyclohexanone | | o-sec- | butylcyclohexanone | | | butylcyclohexanone, O-sec- | | iso | butylmenthone | | | cyclohexanone, 2-(1-methylpropyl)- | | | cyclohexanone, 2-sec-butyl- | | | freskomenthe (Givaudan) | | 2-1- | methyl propyl cyclohexanone | | 2-(1- | methyl propyl) cyclohexanone | | 2-( | methylpropyl)cyclohexan-1-one | | 2-(1- | methylpropyl)cyclohexanone | | 2-1- | methylpropylcyclohexanone | | | peppermint cyclohexanone |
Articles:
|