|
Category: flavor and fragrance agents
US / EU / FDA / JECFA / FEMA / FLAVIS / Scholar / Patent Information:
Physical Properties:
| Appearance: | colorless clear liquid (est) |
| Assay: | 97.00 to 100.00 %
|
| Food Chemicals Codex Listed: | No |
| Specific Gravity: | 0.91900 to 0.93000 @ 25.00 °C.
|
| Pounds per Gallon - (est).: | 7.647 to 7.739
|
| Refractive Index: | 1.46300 @ 20.00 °C.
|
| Boiling Point: | 70.00 °C. @ 10.00 mm Hg
|
| Vapor Pressure: | 1.000000 mmHg @ 20.00 °C. |
| Vapor Density: | 5.8 ( Air = 1 ) |
| Flash Point: | 142.00 °F. TCC ( 61.11 °C. )
|
| logP (o/w): | 3.340 |
| Soluble in: |
| | alcohol | | | water, 58.15 mg/L @ 25 °C (est) |
| Insoluble in: |
| | water |
Organoleptic Properties:
| |
| Odor Type: balsamic |
| |
| Odor Strength: | medium |
| |
| Substantivity: | > 2 hour(s) at 100.00 % |
| |
| | pine woody camphoreous balsamic |
Odor Description: at 100.00 %. | pine woody camphor borneol Luebke, William tgsc, (1987) |
| |
| Odor and/or flavor descriptions from others (if found). |
| |
| Takasago |
| Isobornyl Methyl Ether Biobased 90% |
| Odor Description: | Pine Can be used in herbal, pine, and woody fragrances. |
| |
| Moellhausen |
| isoBORNYL METHYLETHER |
| Odor Description: | fresh, camphoraceous, pine |
| Taste Description: | camphoraceous, green |
| |
| |
Cosmetic Information:
Suppliers:
Safety Information:
| Preferred SDS: View |
| European information : |
| Most important hazard(s): | | Xi - Irritant |
R 36/38 - Irritating to skin and eyes. S 02 - Keep out of the reach of children. S 26 - In case of contact with eyes, rinse immediately with plenty of water and seek medical advice. S 36/37/39 - Wear suitable clothing, gloves and eye/face protection.
|
| |
| Hazards identification |
| |
| Classification of the substance or mixture |
| GHS Classification in accordance with 29 CFR 1910 (OSHA HCS) |
| None found. |
| GHS Label elements, including precautionary statements |
| |
| Pictogram | |
| |
| Hazard statement(s) |
| None found. |
| Precautionary statement(s) |
| None found. |
| Human Experience: |
| Undiluted liquid reported to be a skin irritant. |
| Oral/Parenteral Toxicity: |
oral-rat LDLo 5000 mg/kg Food and Chemical Toxicology. Vol. 30, Pg. 53S, 1992.
|
| Dermal Toxicity: |
skin-rabbit LD50 > 5000 mg/kg Food and Chemical Toxicology. Vol. 30, Pg. 53S, 1992.
|
| Inhalation Toxicity: |
|
Not determined
|
Safety in Use Information:
Safety References:
| EPI System: | View |
| AIDS Citations: | Search |
| Cancer Citations: | Search |
| Toxicology Citations: | Search |
| EPA Substance Registry Services (TSCA): | 5331-32-8 |
| EPA ACToR: | Toxicology Data |
| EPA Substance Registry Services (SRS): | Registry |
| Laboratory Chemical Safety Summary : | 95330 |
| National Institute of Allergy and Infectious Diseases: | Data |
| WISER: | UN 1993 |
| WGK Germany: | 2 |
| | 6-methoxy-1,7,7-trimethylbicyclo[2.2.1]heptane |
| Chemidplus: | 0005331328 |
| RTECS: | DT5078000 for cas# 5331-32-8 |
| | (1S,4R,6S)-6-methoxy-1,7,7-trimethylbicyclo[2.2.1]heptane |
References:
| | 6-methoxy-1,7,7-trimethylbicyclo[2.2.1]heptane |
| NIST Chemistry WebBook: | Search Inchi |
| Canada Domestic Sub. List: | 5331-32-8 |
| Pubchem (cid): | 95330 |
| Pubchem (sid): | 135054724 |
| | (1S,4R,6S)-6-methoxy-1,7,7-trimethylbicyclo[2.2.1]heptane |
| NIST Chemistry WebBook: | Search Inchi |
| Canada Domestic Sub. List: | 5331-32-8 |
| Pubchem (cid): | 220050 |
| Pubchem (sid): | 68957 |
Other Information:
Potential Blenders and core components note
| |
| For Odor |
| balsamic |
| | abies alba cone oil | FR |
| | abies alba leaf extract | FR |
| | abies alba needle oil | FL/FR |
| dextro- | borneol | FL/FR |
| dextro,laevo- | borneol | FL/FR |
| laevo- | borneol | FL/FR |
| | bornyl acetate | FL/FR |
| laevo- | bornyl acetate | FL/FR |
| iso | bornyl propionate | FL/FR |
| dextro- | fenchone | FL/FR |
| | fir balsam absolute | FR |
| | fir balsam fragrance | FR |
| | gurjun balsam | FR |
| camphoreous |
| | bornyl ethyl ether | |
| 2,6- | dimethyl-3-oxatricyclo(4.2.1.0*2,4*)nonane | FR |
| | fenchol | FL/FR |
| laevo- | fenchone | FL/FR |
| | hinoki leaf oil | FR |
| chocolate |
| 1,3,3,4,5,6- | hexamethyl(2.2.2)bicyclooct-5-en-2-ol | |
| citrus |
| | ocimene quintoxide | FL/FR |
| earthy |
| (-)-alpha- | fenchol | FL/FR |
| scotch | pine needle oil | FL/FR |
| scotch | pine needle oil estonia | FL/FR |
| scotch | pine needle oil yugoslavia | FL/FR |
| floral |
| | bois de rose oil peru | FL/FR |
| | ho leaf oil | FR |
| | verdyl acetate | FR |
| fruity |
| 3- | allyl oxy-1,4-dimethyl bicyclo(3.2.1)octane | FR |
| iso | butyl furyl propionate | FL/FR |
| 1,3,3,5- | tetramethyl-7 and 8-acetyl bicyclo(2.2.2)oct-5-ene | |
| herbal |
| 1- | allyl-2,2,7,7-tetramethyl cycloheptanol | FR |
| | barosma betulina leaf oil | FL/FR |
| | dimethyl cyclormol (IFF) | FR |
| | geranic oxide | FL/FR |
| | herbal dioxane | FR |
| | herbal specialty | FR |
| 6- | hydroxydihydrotheaspirane (mixture of isomers) | FL/FR |
| | hyssop oil | FL/FR |
| | lavandin concrete | FL/FR |
| | methyl cyclogeranate (Firmenich) | FR |
| | myrtenol | FL/FR |
| | nopyl acetate | FR |
| | origanum oil | FL/FR |
| | origanum oil greece | FL/FR |
| | pine hexanol | FR |
| laevo-beta- | pinene | FL/FR |
| alpha- | pinene | FL/FR |
| | pinocarveol | FL/FR |
| | rosemary absolute | FL/FR |
| | rosemary oil | FL/FR |
| | rosemary oil africa | FL/FR |
| | rosemary oil morocco | FL/FR |
| | rosemary oil replacer | FR |
| | rosemary oil spain | FL/FR |
| | rosemary oil tunisia | FL/FR |
| | terpineols (unspec.) (mixed isomers) | FL/FR |
| | terpinolene | FL/FR |
| | peppermint cyclohexanone | FL/FR |
| minty |
| 5- and 6-iso | propyl-1,3,3-trimethyl bicyclo(2.2.2)-5,7-octadien-2-one | |
| pine |
| | cypress oil replacer | FR |
| | evergreen fragrance | FR |
| white | pine bark oil | FL/FR |
| spicy |
| | ayou wood oil | FR |
| | carvacrol | FL/FR |
| | ginger fragrance | FR |
| | ginger root oil china | FL/FR |
| | ginger root oil replacer | FR |
| | ginger specialty | FR |
| | outdoors specialty | FR |
| white | sassafras oil | FL/FR |
| terpenic |
| | cypress leaf oil | FR |
| D-(+)-beta- | pinene | FL/FR |
| thujonic |
| | cedarleaf oil terpeneless | FR |
| woody |
| iso | bornyl isovalerate | FL/FR |
| 2-tert- | butyl cyclohexanone | FR |
| | cedarwood oil port orford | FR |
| 3,7- | dimethyl-1-octene | |
| (E+Z)-4,8- | dimethyl-3,7-nonadien-2-ol | FL/FR |
| 1,2,3,3,4,5,6- | heptamethyl bicyclo(2.2.2)oct-5-en-2-ol | |
| 1,3,3,4,5,6- | hexamethyl bicyclo(2.2.2)oct-5-en-2-one | |
| | hinoki root oil | FR |
| | juniper berry oil terpenes | FR |
| para- | menth-3-en-1-ol | FL/FR |
| 6- | methoxy-1,6,7-trimethyl octahydro-4,7-methanoindene + 5-methoxy-2,4,5-trimethyl octahydro-4,7-methan | |
| | myoporum crassifolium wood oil | FR |
| (-)- | myrtenol | |
| | myrtenyl formate | FL/FR |
| | myrtenyl isobutyrate | |
| | nopyl aldehyde | FR |
| cis-2- | pinanol | FR |
| 1,3,3,5- | tetramethyl-7 and 8-cyanobicyclo(2.2.2)oct-5-ene | |
| |
| For Flavor |
| |
| No flavor group found for these |
| dextro,laevo- | borneol | FL/FR |
| dextro- | borneol | FL/FR |
| 3,7- | dimethyl-1-octene | |
| (E+Z)-4,8- | dimethyl-3,7-nonadien-2-ol | FL/FR |
| 1,2,3,3,4,5,6- | heptamethyl bicyclo(2.2.2)oct-5-en-2-ol | |
| 1,3,3,4,5,6- | hexamethyl bicyclo(2.2.2)oct-5-en-2-one | |
| 1,3,3,4,5,6- | hexamethyl(2.2.2)bicyclooct-5-en-2-ol | |
| para- | menth-3-en-1-ol | FL/FR |
| 6- | methoxy-1,6,7-trimethyl octahydro-4,7-methanoindene + 5-methoxy-2,4,5-trimethyl octahydro-4,7-methan | |
| | myrtenyl formate | FL/FR |
| | myrtenyl isobutyrate | |
| white | pine bark oil | FL/FR |
| scotch | pine needle oil | FL/FR |
| scotch | pine needle oil estonia | FL/FR |
| scotch | pine needle oil yugoslavia | FL/FR |
| D-(+)-beta- | pinene | FL/FR |
| laevo-beta- | pinene | FL/FR |
| 5- and 6-iso | propyl-1,3,3-trimethyl bicyclo(2.2.2)-5,7-octadien-2-one | |
| white | sassafras oil | FL/FR |
| | terpineols (unspec.) (mixed isomers) | FL/FR |
| 1,3,3,5- | tetramethyl-7 and 8-acetyl bicyclo(2.2.2)oct-5-ene | |
| 1,3,3,5- | tetramethyl-7 and 8-cyanobicyclo(2.2.2)oct-5-ene | |
|
| iso | butyl furyl propionate | FL/FR |
| balsamic |
| laevo- | bornyl acetate | FL/FR |
| iso | bornyl propionate | FL/FR |
| camphoreous |
| laevo- | borneol | FL/FR |
| | bornyl acetate | FL/FR |
| | bornyl ethyl ether | |
| (-)-alpha- | fenchol | FL/FR |
| | fenchol | FL/FR |
| laevo- | fenchone | FL/FR |
| | geranic oxide | FL/FR |
| 6- | hydroxydihydrotheaspirane (mixture of isomers) | FL/FR |
| | pinocarveol | FL/FR |
| | rosemary oil tunisia | FL/FR |
| cooling |
| dextro- | fenchone | FL/FR |
| iso | menthol | FL |
| floral |
| | bois de rose oil peru | FL/FR |
| green |
| | ocimene quintoxide | FL/FR |
| herbal |
| | barosma betulina leaf oil | FL/FR |
| | hyssop oil | FL/FR |
| | lavandin concrete | FL/FR |
| | origanum oil | FL/FR |
| | origanum oil greece | FL/FR |
| | rosemary absolute | FL/FR |
| | rosemary oil | FL/FR |
| | rosemary oil africa | FL/FR |
| | rosemary oil morocco | FL/FR |
| | rosemary oil spain | FL/FR |
| mentholic |
| | peppermint cyclohexanone | FL/FR |
| minty |
| (-)- | myrtenol | |
| | myrtenol | FL/FR |
| spicy |
| | carvacrol | FL/FR |
| | ginger root oil china | FL/FR |
| white | pepper oleoresin | FL |
| terpenic |
| | abies alba needle oil | FL/FR |
| para- | menthatriene | FL |
| woody |
| iso | bornyl isovalerate | FL/FR |
| alpha- | pinene | FL/FR |
| | terpinolene | FL/FR |
| |
Potential Uses:
Occurrence (nature, food, other): note
Synonyms:
| | bicyclo(2.2.1)heptane, 2-methoxy-1,7,7-trimethyl-, exo- | | | bicyclo[2.2.1]heptane, 2-methoxy-1,7,7-trimethyl- | | | bornane, 2-methoxy-, exo- | | iso | borneol methyl ether | | (±)-iso | bornyl methyl ether | | iso | bornyl methylether | | | ether, isobornyl methyl | | (rel-2- | methoxy-1,7,7-trimethyl bicyclo(2.2.1)heptane | | exo-2- | methoxy-1,7,7-trimethyl bicyclo(2.2.1)heptane | | exo-2- | methoxy-1,7,7-trimethyl norbornane | | exo-2- | methoxy-1,7,7-trimethylbicyclo(2.2.1)heptane | | 2- | methoxy-1,7,7-trimethylbicyclo[2.2.1]heptane | | 6- | methoxy-1,7,7-trimethylbicyclo[2.2.1]heptane | | exo-2- | methoxy-1,7,7-trimethylbicyclo[2.2.1]heptane | | | methoxy-1,7,7-trimethylnorbornane | | exo-2- | methoxybornane |
Articles:
|