| |
| For Odor |
| No odor group found for these |
| | arnica montana flower extract | FL/FR |
| | tagete oil rwanda | |
| aldehydic |
| | agrumen nitrile | FR |
| animal |
| iso | butyl quinoline | FR |
| anise |
| sweet | fennel seed oil | FL/FR |
| anisic |
| | estragole | FL/FR |
| bitter | fennel seed oil spain | FR |
| | ocimum basilicum leaf oil america | FL/FR |
| balsamic |
| laevo- | borneol | FL/FR |
| dextro,laevo- | borneol | FL/FR |
| dextro,laevo-iso | borneol | FL/FR |
| iso | bornyl acetate | FL/FR |
| iso | bornyl isobutyrate | FL/FR |
| iso | bornyl methyl ether | FL/FR |
| | cinnamyl formate | FL/FR |
| | copaiba balsam oil | FL/FR |
| | frankincense absolute | FL/FR |
| christmas | pine fragrance | FR |
| camphoreous |
| dextro- | bornyl acetate | |
| | bornyl ethyl ether | |
| | camphor tree bark oil | FL/FR |
| 2,6- | dimethyl-3-oxatricyclo(4.2.1.0*2,4*)nonane | FR |
| laevo- | fenchone | FL/FR |
| | herbal ethanone | FR |
| caramellic |
| 2-iso | butyl-3-methyl pyrazine | FL/FR |
| cheesy |
| 2- | heptanone | FL/FR |
| chocolate |
| 1,3,3,4,5,6- | hexamethyl(2.2.2)bicyclooct-5-en-2-ol | |
| citrus |
| | citronella oil ceylon | FL/FR |
| iso | decyl acetate | FR |
| | dipentene | FL/FR |
| | lemon balm fragrance | FR |
| | melissa oil replacer | FR |
| | ocimene quintoxide | FL/FR |
| earthy |
| | bornyl methyl ether | |
| (-)-alpha- | fenchol | FL/FR |
| | geosmin | FL/FR |
| 3- | octen-2-one | FL/FR |
| (S)-1- | octen-3-ol | FL/FR |
| ethereal |
| | ethyl 4-pentenoate | FL/FR |
| fatty |
| 2- | octenal | FL/FR |
| (E)-2- | octenal | FL/FR |
| | perillaldehyde propylene glycol acetal | FL/FR |
| floral |
| | bois de rose oil peru | FL/FR |
| | cassie specialty (acacia farnesiana) | FR |
| | cassis oxime 10% | FR |
| | cilantro herb oil egypt | FL/FR |
| | coriander seed oil | FL/FR |
| | cymbopogon validus leaf oil | FR |
| | dictamnus hispanicus oil | FR |
| | dihydrocitronellyl ethyl ether | FR |
| | dihydrorose oxide | FR |
| | dimethyl benzyl carbinyl butyrate | FL/FR |
| 2,4- | dimethyl-3-cyclohexene-1-methanol | FR |
| 2,4- | dimethyl-alpha-allyl-3-cyclohexene methanol | |
| 4,6- | dimethyl-alpha-allyl-3-cyclohexene methanol | |
| | geranium oil africa | FL/FR |
| | geranium oil egypt | FL/FR |
| | heather fragrance | FR |
| | ho leaf oil | FR |
| (Z)- | jasmone | FL/FR |
| | lavender absolute replacer | FR |
| | linalool oxide (furanoid) | FL/FR |
| | linden flower absolute | FR |
| | linden flower absolute replacer | FR |
| | melaleuca ericifolia leaf oil | FR |
| para- | methyl benzyl acetate | FL/FR |
| | neryl formate | FL/FR |
| 3- | nonanone | FL/FR |
| 2- | pentyl cyclopentanone | FR |
| iso | phytol | FL/FR |
| | prenyl salicylate | FL/FR |
| | reseda absolute | FR |
| (Z)- | rose oxide | FL/FR |
| | rose pyran | FR |
| | terpinyl isobutyrate | FL/FR |
| 5- | tricyclodecenyl acetate | FR |
| fruity |
| 3- | allyl oxy-1,4-dimethyl bicyclo(3.2.1)octane | FR |
| 3- | butyl bicyclo[3.2.1]-6-octen-2-one | FR |
| 1,4- | diethyl-6,8-dioxabicyclo(3.2.1)octane | FR |
| | ethyl 2-ethyl acetoacetate | FL/FR |
| 1- | ethyl-2-methyl propyl chrysanthemumate | |
| | green acetate | FR |
| | herbanate (Givaudan) | FR |
| 2- | phenyl propyl butyrate | FL/FR |
| 1,3,3,5- | tetramethyl-7 and 8-acetyl bicyclo(2.2.2)oct-5-ene | |
| | tropical indene | FR |
| garlic |
| 4- | methyl-2-[2-(methyl thio)ethyl]-1,3-oxathiane | |
| green |
| | agrumen aldehyde | FR |
| | aloe vera fragrance | FR |
| | birch leaf specialty | FR |
| iso | butyl heptanoate | FL/FR |
| iso | butyl methyl ketone | FL/FR |
| 2-sec- | butyl thiazole | FL/FR |
| S-sec- | butyl thioisovalerate | FL/FR |
| sec- | butyl-3-methyl but-2-ene thioate | FL/FR |
| | carrot leaf oil (daucus carota ssp.maximus) | FR |
| | chrysanthemum carbaldehyde | FR |
| black | currant bud absolute replacer | FL/FR |
| | heptanal (aldehyde C-7) | FL/FR |
| 1- | heptanol | FL/FR |
| | heptyl benzoate | FL/FR |
| (E)-4- | hexen-1-ol | |
| (Z)-4- | hexen-1-ol | FL/FR |
| 3- | hexenyl 2-methyl butyrate | FL/FR |
| | hexyl hexanoate | FL/FR |
| english | ivy leaf absolute | FR |
| | marigold pot absolute | FL/FR |
| 6- | methyl-3-hepten-2-one | FL/FR |
| | privet dioxane | FR |
| 3- | propyl bicyclo(3.2.1)-6-octen-2-one | FR |
| | seaweed absolute (fucus vesiculosus et serratus) | FL/FR |
| | terpinyl propionate | FL/FR |
| | triplal / ethyl anthranilate schiff's base | FR |
| herbal |
| 6- | acetoxydihydrotheaspirane | FL/FR |
| 9- | acetyl-5-methyl-tricyclo[6.2.1.0.sup.2,7 ]undec-4-ene | |
| | agate fragrance | FR |
| | ajowan seed oil | FL/FR |
| 1- | allyl-2,2,7,7-tetramethyl cycloheptanol | FR |
| alpha- | amyl cinnamyl formate | FL/FR |
| | anethum graveolens herb oil | FL/FR |
| | anethum graveolens herb tincture | FL/FR |
| | anthemis nobilis flower extract | FL/FR |
| | anthemis nobilis flower oil roman | FL/FR |
| | apium graveolens seed oil | FL/FR |
| | apium graveolens seed oil india | FL/FR |
| | artemisia alba oil | FR |
| sweet | basil absolute | FL/FR |
| | blue grass fragrance | FR |
| delta- | cadinene | |
| (+)-alpha- | campholenic aldehyde | FL/FR |
| | carrot seed oil (daucus carota ssp. maximus (desf.) ball) | FR |
| | carum carvi fruit oil | FL/FR |
| | carvacryl methyl ether | FL/FR |
| | celery ketone | FL/FR |
| | celery specialty | FR |
| | chamomile oil morocco | FR |
| | chamomile oil replacer | FR |
| | chrysanthemum ketone | FR |
| | chrysanthemum specialty | FR |
| 1,8- | cineole | FL/FR |
| | coriander oleoresin | FL/FR |
| | coriander seed concrete | FR |
| | dehydroxylinalool oxide | FL/FR |
| | dill weed oil cuba | FL/FR |
| | dill weed oil reunion | FL/FR |
| | dimethyl benzyl carbinyl formate | FL/FR |
| | dimethyl cyclormol (IFF) | FR |
| 2-(2,4- | dimethyl-3-cyclohexene-1-yl)-4,4-dimethyl-1,3-oxathiane | FR |
| | elder flower absolute (sambucus canadensis and s. nigra) | FR |
| 2,10- | epoxypinane | FR |
| | eucalyptus globulus oil | FL/FR |
| | eucalyptus radiata leaf/stem oil | FR |
| | fougere herbal fragrance | FR |
| | geranic oxide | FL/FR |
| | herbal acetal | FR |
| | herbal carene | FR |
| cis- | herbal cyclohexane | FR |
| | herbal dioxane | FR |
| | herbal heptane | FR |
| | hop absolute | FL/FR |
| | hop oil | FL/FR |
| | hyssopus officinalis extract | FL/FR |
| | hyssopus officinalis leaf tincture | FL/FR |
| | lantana camara flower oil | FR |
| | laurel bark oil | |
| | laurel stem oil | |
| | lavandin absolute | FL/FR |
| | lavandin absolute decolorized | FL/FR |
| | lavandin concrete | FL/FR |
| abrialis | lavandin oil | FL/FR |
| spike | lavender absolute | FL/FR |
| | lavender absolute bulgaria | FL/FR |
| | lavender absolute france | FL/FR |
| spike | lavender oil | FL/FR |
| | linalyl formate | FL/FR |
| | linalyl octanoate | FL/FR |
| | marigold absolute (tagetes patula) | FR |
| | marigold oil mexico | FL/FR |
| | melaleuca leucadendron var. cajuputi leaf oil | FL/FR |
| 1-para- | menthen-9-yl acetate | FL/FR |
| 1-(2- | methyl allyl oxy) heptane | FR |
| | methyl cyclogeranate (Firmenich) | FR |
| (E)-6- | methyl-3-hepten-2-one | FL/FR |
| | mistletoe absolute | |
| | mistletoe fragrance | FR |
| | monarda fistulosa oil | FR |
| T- | muurolol | FL/FR |
| | myrtenol | FL/FR |
| | niaouli oil | FR |
| 3- | nonanol | FL/FR |
| | nonisyl formate | FR |
| (E,Z)-3,5- | octadien-2-one | |
| 3- | octanon-1-ol | FL/FR |
| 1- | octen-3-yl acetate | FL/FR |
| | oregano flower/leaf/stem water | FR |
| | oregano leaf | |
| | oregano oil mexico | FL/FR |
| | oregano oil replacer | FR |
| | oregano specialty | FR |
| | origanum oil greece | FL/FR |
| | origanum oil terpenes | FR |
| curled | parsley leaf oil | FL/FR |
| | perilla leaf oil | FL/FR |
| | perillaldehyde | FL/FR |
| | petroselinum crispum seed oil CO2 extract | FL/FR |
| | phenyl acetaldehyde diisoamyl acetal | FR |
| alpha- | pinene | FL/FR |
| | pinocarveol | FL/FR |
| | prenyl senecioate | FL/FR |
| | rain forest specialty | FR |
| | rosemary absolute | FL/FR |
| | rosemary oil | FL/FR |
| | rosemary oil africa | FL/FR |
| | rosemary oil morocco | FL/FR |
| | rosemary oil spain | FL/FR |
| | rosemary oil tunisia | FL/FR |
| | rosmarinus officinalis extract | FL/FR |
| | rosmarinus officinalis tincture | FL/FR |
| | sage absolute spain | FL/FR |
| | tagete oil CO2 extract | FL/FR |
| | tagete oil south africa | FL/FR |
| | theaspirane | FL/FR |
| | thyme absolute | FL/FR |
| white | thyme oil | FL/FR |
| | thyme oil (thymus zygis gracillis) spain | FL/FR |
| | thyme oil (thymus zygis spp. sylvestris) spain | FR |
| | thyme oil CO2 extract | FL/FR |
| | thyme oil CO2 extract spain | FL/FR |
| red | thyme oil india | FL/FR |
| red | thyme oil spain | FL/FR |
| | thyme oil wild or creeping canada | FL/FR |
| | thyme oil wild or creeping pakistan | FL/FR |
| | thyme undecane | FR |
| | thymol | FL/FR |
| | thymyl methyl ether | FL/FR |
| | tricyclodecyl acetate | FR |
| | viridiflorol | FL/FR |
| | wormwood oil america | FL/FR |
| | wormwood oil italy | FL/FR |
| | wormwood oil poland | FL/FR |
| | wormwood oil replacer | FR |
| licorice |
| bitter | fennel seed oil CO2 extract | FR |
| medicinal |
| summer | savory oil | FL/FR |
| | peppermint cyclohexanone | FL/FR |
| iso | pulegyl acetate | FL/FR |
| minty |
| | artemisia deserti krasch. oil iran | FR |
| | betula lenta bark oil america | FL/FR |
| | dihydrocarveol | FL/FR |
| (R)-(+)- | menthofuran | |
| (-)- | menthone | FL/FR |
| homo | menthyl acetate | FL/FR |
| | methyl salicylate | FL/FR |
| | peppermint oil special fractions | FL/FR |
| laevo- | piperitone | FL/FR |
| 5- and 6-iso | propyl-1,3,3-trimethyl bicyclo(2.2.2)-5,7-octadien-2-one | |
| (-)-iso | pulegol | FL/FR |
| (R)-(+)- | pulegone | FR |
| mossy |
| | oakmoss absolute | FL/FR |
| | treemoss absolute | FR |
| naphthyl |
| ortho- | methyl anisole | FL/FR |
| peppery |
| 1,5- | dimethyl-3-n-propyl-2-oxabicyclo(2.2.2)octane | |
| pine |
| | dipentene terpene hydrocarbon byproducts | FR |
| | plectranthus glandulosus hook f. leaf oil cameroon | FR |
| soapy |
| | methyl anthranilate / hexyl cinnamaldehyde schiff's base | FR |
| iso | butyl angelate | FL/FR |
| | cardamom oil replacer | FR |
| | carrot weed oil | FL/FR |
| | carvacrol | FL/FR |
| | carvacryl ethyl ether | FL/FR |
| | caryophyllene | FL/FR |
| | cubeb oil | FL/FR |
| (-)- | cubenol | FL/FR |
| | cuminaldehyde | FL/FR |
| | cuminyl alcohol | FL/FR |
| black | currant bud absolute | FL/FR |
| iso | cyclogeraniol (IFF) | FR |
| 1,5- | dimethyl-3-n-pentyl-2-oxabicyclo(2.2.2)octane | |
| | elettaria cardamomum seed oil | FL/FR |
| | elettaria cardamomum seed oil guatemala | FL/FR |
| | galangal root oil | FL/FR |
| | ginger root absolute | FL/FR |
| (R)-gamma- | heptalactone | |
| | laurus nobilis fruit oil | FL/FR |
| | maja fragrance | FR |
| | marjoram absolute spain | |
| sweet | marjoram oil (origanum majorana var. tenuifolium weston) cyprus | |
| | ocimum gratissimum herb oil india | FR |
| 2- | octanol | FL/FR |
| | origanum majorana oil | FL/FR |
| | origanum majorana oil CO2 extract | FL/FR |
| | origanum majorana oil cuba | FL/FR |
| | outdoors specialty | FR |
| black | pepper absolute | FL/FR |
| white | pepper oil | FL/FR |
| black | pepper oil CO2 extract | FL/FR |
| black | pepper oleoresin | FL/FR |
| | saffron oil CO2 extract | FL/FR |
| white | sassafras oil | FL/FR |
| | spicy carbonate | FR |
| | sugandha kokila berry oil | FR |
| | zvoulimba leaf oil | FR |
| para- | cymene | FL/FR |
| thujonic |
| | cedarleaf oil terpeneless | FR |
| | sage oil (salvia lavandulifolia vahl.) spain | FL/FR |
| woody |
| ar- | abietatriene | |
| | bornyl valerate | FL/FR |
| 2-tert- | butyl cyclohexanone | FR |
| | cedarwood oil himalaya | FR |
| | cinnamyl tiglate | FL/FR |
| | cistus twig/leaf oil | FL/FR |
| | dalbergia sissoo leaf oil | FR |
| alpha- | farnesene | FL/FR |
| alpha- | farnesene isomer | FL/FR |
| | fougere woody fragrance | FR |
| | guaiacwood oil | FL/FR |
| | hedychium spicatum root oil | FR |
| 1,2,3,3,4,5,6- | heptamethyl bicyclo(2.2.2)oct-5-en-2-ol | |
| | hinoki root oil | FR |
| (1R,4S)-1- | hydroxy-1,4-dimethyl spiro(4.6)undecan-2-one | |
| | juniper berry oil terpenes | FR |
| | longifolene | FL/FR |
| | origanum vulgare ssp. vulgare oil himalaya | |
| | patchouli absolute | FR |
| | sandalwood oil | FL/FR |
| (±)- | tetrahydronootkatone | FL/FR |
| 1,3,3,5- | tetramethyl-7 and 8-cyanobicyclo(2.2.2)oct-5-ene | |
| alpha- | thujene | |
| | thyme oil portuguese | FR |
| | verdoxan | FR |
| | zedoary bark oil | FL/FR |
| |
| For Flavor |
| |
| No flavor group found for these |
| ar- | abietatriene | |
| 6- | acetoxydihydrotheaspirane | FL/FR |
| 4- | acetyl-2-isopropenyl pyridine | FL |
| 9- | acetyl-5-methyl-tricyclo[6.2.1.0.sup.2,7 ]undec-4-ene | |
| alpha- | amyl cinnamyl formate | FL/FR |
| | arnica montana flower extract | FL/FR |
| dextro,laevo- | borneol | FL/FR |
| dextro- | bornyl acetate | |
| iso | bornyl methyl ether | FL/FR |
| iso | butyl heptanoate | FL/FR |
| 4- | butyl thiazole | FL |
| 2-sec- | butyl thiazole | FL/FR |
| S-sec- | butyl thioisovalerate | FL/FR |
| sec- | butyl-3-methyl but-2-ene thioate | FL/FR |
| delta- | cadinene | |
| | carvacryl ethyl ether | FL/FR |
| | carvacryl methyl ether | FL/FR |
| | cinnamyl tiglate | FL/FR |
| (±)-(cis+trans)-1,2- | dihydroperillaldehyde | FL |
| | dimethyl benzyl carbinyl formate | FL/FR |
| | dipentene | FL/FR |
| | ethyl 4-pentenoate | FL/FR |
| 1- | ethyl-2-methyl propyl chrysanthemumate | |
| | fig leaf absolute | FL |
| | fleabane oil (erigeron canadensis) | FL |
| (R)-gamma- | heptalactone | |
| 1,2,3,3,4,5,6- | heptamethyl bicyclo(2.2.2)oct-5-en-2-ol | |
| | heptyl benzoate | FL/FR |
| 2- | heptyl cyclopropane carboxylic acid | FL |
| (E,E)-2,4- | hexadien-1-ol | FL |
| 1,3,3,4,5,6- | hexamethyl(2.2.2)bicyclooct-5-en-2-ol | |
| (1R,4S)-1- | hydroxy-1,4-dimethyl spiro(4.6)undecan-2-one | |
| | laurel bark oil | |
| | laurel stem oil | |
| | laurus nobilis fruit oil | FL/FR |
| | lavandin absolute decolorized | FL/FR |
| | linalool oxide (furanoid) | FL/FR |
| | marjoram absolute spain | |
| sweet | marjoram oil (origanum majorana var. tenuifolium weston) cyprus | |
| | melaleuca leucadendron var. cajuputi leaf oil | FL/FR |
| (R)-(+)- | menthofuran | |
| 4- | methyl-2-[2-(methyl thio)ethyl]-1,3-oxathiane | |
| 6- | methyl-3-hepten-2-one | FL/FR |
| (E)-6- | methyl-3-hepten-2-one | FL/FR |
| | mistletoe absolute | |
| T- | muurolol | FL/FR |
| 3- | nonanol | FL/FR |
| (E,Z)-3,5- | octadien-2-one | |
| 3- | octanon-1-ol | FL/FR |
| (S)-1- | octen-3-ol | FL/FR |
| 2- | octenal | FL/FR |
| 3- | octyl butyrate | FL |
| | origanum vulgare ssp. vulgare oil himalaya | |
| | perilla leaf oil | FL/FR |
| | perillaldehyde propylene glycol acetal | FL/FR |
| (Z,Z)- | photocitral A | FL |
| | prenyl senecioate | FL/FR |
| 2- | propyl thiazole | FL |
| 5- and 6-iso | propyl-1,3,3-trimethyl bicyclo(2.2.2)-5,7-octadien-2-one | |
| white | sassafras oil | FL/FR |
| | seaweed absolute (fucus vesiculosus et serratus) | FL/FR |
| | tagete oil rwanda | |
| | terpinyl isobutyrate | FL/FR |
| (±)- | tetrahydronootkatone | FL/FR |
| 1,3,3,5- | tetramethyl-7 and 8-acetyl bicyclo(2.2.2)oct-5-ene | |
| 1,3,3,5- | tetramethyl-7 and 8-cyanobicyclo(2.2.2)oct-5-ene | |
| alpha- | thujene | |
| ortho- | vinyl anisole | FL |
| | viridiflorol | FL/FR |
|
| | catsup flavor | FL |
| | hexyl 3-mercaptobutanoate | FL |
| anise |
| | fennel flavor | FL |
| sweet | fennel seed oil | FL/FR |
| balsamic |
| iso | bornyl isobutyrate | FL/FR |
| | copaiba balsam oil | FL/FR |
| buttery |
| | bovolide | FL |
| camphoreous |
| dextro,laevo-iso | borneol | FL/FR |
| laevo- | borneol | FL/FR |
| | bornyl ethyl ether | |
| | camphor tree bark oil | FL/FR |
| (-)-alpha- | fenchol | FL/FR |
| laevo- | fenchone | FL/FR |
| | geranic oxide | FL/FR |
| ortho- | methyl anisole | FL/FR |
| | pinocarveol | FL/FR |
| | rosemary oil tunisia | FL/FR |
| cheesy |
| 2- | heptanone | FL/FR |
| citrus |
| | citronella oil ceylon | FL/FR |
| cooling |
| spike | lavender oil | FL/FR |
| iso | menthol | FL |
| homo | menthyl acetate | FL/FR |
| | theaspirane | FL/FR |
| creamy |
| 3- | octen-2-one | FL/FR |
| earthy |
| | geosmin | FL/FR |
| fatty |
| (E)-2- | octenal | FL/FR |
| floral |
| | bois de rose oil peru | FL/FR |
| | dimethyl benzyl carbinyl butyrate | FL/FR |
| 4,6- | dimethyl-alpha-allyl-3-cyclohexene methanol | |
| 2,4- | dimethyl-alpha-allyl-3-cyclohexene methanol | |
| | geranium oil africa | FL/FR |
| | geranium oil egypt | FL/FR |
| fruity |
| black | currant bud absolute replacer | FL/FR |
| | ethyl 2-ethyl acetoacetate | FL/FR |
| | hexyl hexanoate | FL/FR |
| | linalyl octanoate | FL/FR |
| 1-para- | menthen-9-yl acetate | FL/FR |
| para- | methyl benzyl acetate | FL/FR |
| | neryl formate | FL/FR |
| | tagete oil CO2 extract | FL/FR |
| | tagete oil south africa | FL/FR |
| green |
| | anethum graveolens herb tincture | FL/FR |
| iso | butyl angelate | FL/FR |
| iso | butyl methyl ketone | FL/FR |
| 2-iso | butyl-3-methyl pyrazine | FL/FR |
| (+)-alpha- | campholenic aldehyde | FL/FR |
| | carrot weed oil | FL/FR |
| | celery distillates | FL |
| | celery ketone | FL/FR |
| | dihydrocarveol | FL/FR |
| alpha- | farnesene | FL/FR |
| alpha- | farnesene isomer | FL/FR |
| | heptanal (aldehyde C-7) | FL/FR |
| (E)-4- | hexen-1-ol | |
| (Z)-4- | hexen-1-ol | FL/FR |
| 3- | hexenyl 2-methyl butyrate | FL/FR |
| | marigold pot absolute | FL/FR |
| 3- | nonanone | FL/FR |
| | oakmoss absolute | FL/FR |
| | ocimene quintoxide | FL/FR |
| 1- | octen-3-yl acetate | FL/FR |
| (Z)- | rose oxide | FL/FR |
| | terpinyl propionate | FL/FR |
| herbal |
| | ajowan seed oil | FL/FR |
| | anethum graveolens herb oil | FL/FR |
| | anthemis nobilis flower extract | FL/FR |
| | anthemis nobilis flower oil roman | FL/FR |
| | apium graveolens seed oil | FL/FR |
| | apium graveolens seed oil india | FL/FR |
| sweet | basil absolute | FL/FR |
| | bornyl methyl ether | |
| | caraway flavor | FL |
| | cardamom distillates | FL |
| | cardamom flavor | FL |
| | carum carvi fruit oil | FL/FR |
| | celery seed oleoresin | FL |
| | cilantro herb oil egypt | FL/FR |
| | coriander oleoresin | FL/FR |
| | coriander seed oil | FL/FR |
| | dill weed oil cuba | FL/FR |
| | dill weed oil reunion | FL/FR |
| | eucalyptus globulus oil | FL/FR |
| | hop absolute | FL/FR |
| | hop oil | FL/FR |
| | hyssopus officinalis extract | FL/FR |
| | hyssopus officinalis leaf tincture | FL/FR |
| | lavandin absolute | FL/FR |
| | lavandin concrete | FL/FR |
| abrialis | lavandin oil | FL/FR |
| spike | lavender absolute | FL/FR |
| | lavender absolute bulgaria | FL/FR |
| | lavender absolute france | FL/FR |
| | lavender flavor | FL |
| | linalyl formate | FL/FR |
| | marigold oil mexico | FL/FR |
| | ocimum basilicum leaf oil america | FL/FR |
| | oregano distillates | FL |
| | oregano essence | FL |
| | oregano flavor | FL |
| | oregano leaf | |
| | oregano oil mexico | FL/FR |
| | oregano oleoresin | FL |
| | origanum majorana oil | FL/FR |
| | origanum majorana oil CO2 extract | FL/FR |
| | origanum oil greece | FL/FR |
| curled | parsley leaf oil | FL/FR |
| | petroselinum crispum seed oil CO2 extract | FL/FR |
| | prenyl salicylate | FL/FR |
| | rosemary absolute | FL/FR |
| | rosemary oil | FL/FR |
| | rosemary oil africa | FL/FR |
| | rosemary oil morocco | FL/FR |
| | rosemary oil spain | FL/FR |
| | rosmarinus officinalis extract | FL/FR |
| | rosmarinus officinalis tincture | FL/FR |
| | sage absolute spain | FL/FR |
| | sage oil (salvia lavandulifolia vahl.) spain | FL/FR |
| | tarragon oleoresin | FL |
| | thyme absolute | FL/FR |
| white | thyme oil | FL/FR |
| | thyme oil (thymus zygis gracillis) spain | FL/FR |
| | thyme oil CO2 extract | FL/FR |
| | thyme oil CO2 extract spain | FL/FR |
| red | thyme oil india | FL/FR |
| red | thyme oil spain | FL/FR |
| | thyme oil wild or creeping canada | FL/FR |
| | thyme oil wild or creeping pakistan | FL/FR |
| | thyme oleoresin | FL |
| | wormwood oil america | FL/FR |
| | wormwood oil italy | FL/FR |
| | wormwood oil poland | FL/FR |
| licorice |
| | estragole | FL/FR |
| medicinal |
| | frankincense absolute | FL/FR |
| summer | savory oil | FL/FR |
| mentholic |
| | peppermint cyclohexanone | FL/FR |
| minty |
| | betula lenta bark oil america | FL/FR |
| 1,8- | cineole | FL/FR |
| (-)- | menthone | FL/FR |
| | methyl salicylate | FL/FR |
| (1R)-(-)- | myrtenal | FL |
| | myrtenol | FL/FR |
| | peppermint oil special fractions | FL/FR |
| laevo- | piperitone | FL/FR |
| (-)-iso | pulegol | FL/FR |
| mustard |
| | mustard flavor | FL |
| musty |
| | thymyl methyl ether | FL/FR |
| oily |
| iso | phytol | FL/FR |
| peppery |
| 1,5- | dimethyl-3-n-propyl-2-oxabicyclo(2.2.2)octane | |
| phenolic |
| | thymol | FL/FR |
| solvent |
| 1- | heptanol | FL/FR |
| spicy |
| sweet | bay oleoresin | FL |
| | carvacrol | FL/FR |
| | caryophyllene | FL/FR |
| | chipotle chili distillates | FL |
| | chipotle chili oleoresin | FL |
| | cinnamyl formate | FL/FR |
| | cubeb oil | FL/FR |
| | cubeb oleoresin | FL |
| (-)- | cubenol | FL/FR |
| | cuminaldehyde | FL/FR |
| | cuminyl alcohol | FL/FR |
| black | currant bud absolute | FL/FR |
| 1,5- | dimethyl-3-n-pentyl-2-oxabicyclo(2.2.2)octane | |
| | elettaria cardamomum seed oil | FL/FR |
| | elettaria cardamomum seed oil guatemala | FL/FR |
| | galangal root oil | FL/FR |
| | geranium flavor | FL |
| | ginger root absolute | FL/FR |
| | jalapeno oleoresin | FL |
| 2- | octanol | FL/FR |
| | origanum majorana oil cuba | FL/FR |
| black | pepper absolute | FL/FR |
| white | pepper oil | FL/FR |
| black | pepper oil CO2 extract | FL/FR |
| black | pepper oleoresin | FL/FR |
| | perillaldehyde | FL/FR |
| 2- | phenyl propyl butyrate | FL/FR |
| | saffron oil CO2 extract | FL/FR |
| winter | savory oil | FL |
| terpenic |
| para- | cymene | FL/FR |
| woody |
| iso | bornyl acetate | FL/FR |
| | bornyl valerate | FL/FR |
| | cistus twig/leaf oil | FL/FR |
| | dehydroxylinalool oxide | FL/FR |
| | guaiacwood oil | FL/FR |
| (Z)- | jasmone | FL/FR |
| | longifolene | FL/FR |
| alpha- | pinene | FL/FR |
| iso | pulegyl acetate | FL/FR |
| | sandalwood oil | FL/FR |
| | zedoary bark oil | FL/FR |
| |