|
Category: flavor and fragrance agents
US / EU / FDA / JECFA / FEMA / FLAVIS / Scholar / Patent Information:
Physical Properties:
| Appearance: | colorless crystals (est) |
| Assay: | 80.00 to 100.00 %
|
| Food Chemicals Codex Listed: | No |
| Optical Rotation: | -20.00 to 0.00
|
| Melting Point: | 206.00 to 208.00 °C. @ 760.00 mm Hg
|
| Boiling Point: | 210.00 to 212.00 °C. @ 779.00 mm Hg
|
| Boiling Point: | 203.00 to 204.00 °C. @ 760.00 mm Hg
|
| Vapor Pressure: | 0.040000 mmHg @ 25.00 °C. (est) |
| Vapor Density: | 5.3 ( Air = 1 ) |
| Flash Point: | 150.00 °F. TCC ( 65.56 °C. )
|
| logP (o/w): | 3.010 |
| Shelf Life: | 24.00 month(s) or longer if stored properly. |
| Storage: | store in cool, dry place in tightly sealed containers, protected from heat and light. |
| Soluble in: |
| | alcohol | | | dipropylene glycol | | | propylene glycol | | | water, 1186 mg/L @ 25 °C (est) |
| Insoluble in: |
| | water |
| Stability: |
| | bath foam | | | cream | | | detergent | | | lotion | | | non-discoloring in most media | | | shampoo |
Organoleptic Properties:
| |
| Odor Type: balsamic |
| |
| Odor Strength: | medium , recommend smelling in a 10.00 % solution or less |
| |
| Substantivity: | 16 hour(s) at 100.00 % |
| |
| | pine woody camphoreous peppery |
Odor Description: at 10.00 % in dipropylene glycol. | pine woody camphor Luebke, William tgsc, (1989) |
| |
| |
| Flavor Type: camphoreous |
| |
| | earthy minty camphoreous herbal woody musty |
Taste Description:
| earthy minty camphoreous herbal woody musty Luebke, William tgsc, (1989) |
| |
| Odor and/or flavor descriptions from others (if found). |
| |
| |
Cosmetic Information:
Suppliers:
Safety Information:
| Preferred SDS: View |
| European information : |
| Most important hazard(s): | | Xn - Harmful. |
R 22 - Harmful if swallowed. R 43 - May cause sensitisation by skin contact. S 02 - Keep out of the reach of children. S 22 - Do not breath dust. S 36/39 - Wear suitable clothing and eye/face protection.
|
| |
| Hazards identification |
| |
| Classification of the substance or mixture |
| GHS Classification in accordance with 29 CFR 1910 (OSHA HCS) |
| None found. |
| GHS Label elements, including precautionary statements |
| |
| Pictogram | |
| |
| Hazard statement(s) |
| None found. |
| Precautionary statement(s) |
| None found. |
| Human Experience: |
| 20 % solution: no irritation or sensitization. |
| Oral/Parenteral Toxicity: |
oral-rat LD50 5800 mg/kg Food and Cosmetics Toxicology. Vol. 16, Pg. 655, 1978.
|
| Dermal Toxicity: |
|
Not determined
|
| Inhalation Toxicity: |
|
Not determined
|
Safety in Use Information:
| Category: | flavor and fragrance agents |
| RIFM Fragrance Material Safety Assessment: Search |
| IFRA Code of Practice Notification of the 49th Amendment to the IFRA Code of Practice |
| Recommendation for laevo-borneol usage levels up to: | | | 8.0000 % in the fragrance concentrate.
|
| |
| Use levels for FEMA GRAS flavoring substances on which the FEMA Expert Panel based its judgments that the substances are generally recognized as safe (GRAS). |
| The Expert Panel also publishes separate extensive reviews of scientific information on all FEMA GRAS flavoring substances and can be found at FEMA Flavor Ingredient Library |
| publication number: 3 |
| Click here to view publication 3 |
| | average usual ppm | average maximum ppm |
| baked goods: | - | 5.10000 |
| beverages(nonalcoholic): | 0.25000 | 1.40000 |
| beverages(alcoholic): | - | - |
| breakfast cereal: | - | - |
| cheese: | - | - |
| chewing gum: | - | 0.30000 |
| condiments / relishes: | - | - |
| confectionery froastings: | - | - |
| egg products: | - | - |
| fats / oils: | - | - |
| fish products: | - | - |
| frozen dairy: | - | 1.40000 |
| fruit ices: | - | 1.40000 |
| gelatins / puddings: | - | - |
| granulated sugar: | - | - |
| gravies: | - | - |
| hard candy: | - | 3.70000 |
| imitation dairy: | - | - |
| instant coffee / tea: | - | - |
| jams / jellies: | - | - |
| meat products: | - | - |
| milk products: | - | - |
| nut products: | - | - |
| other grains: | - | - |
| poultry: | - | - |
| processed fruits: | - | - |
| processed vegetables: | - | - |
| reconstituted vegetables: | - | - |
| seasonings / flavors: | - | - |
| snack foods: | - | - |
| soft candy: | - | - |
| soups: | - | - |
| sugar substitutes: | - | - |
| sweet sauces: | - | - |
Safety References:
| Flavor & Extract Manufacturers Association (FEMA) reference(s): |
| The FEMA GRAS assessment of alicyclic substances used as flavor ingredients. View pdf |
| EPI System: | View |
| AIDS Citations: | Search |
| Cancer Citations: | Search |
| Toxicology Citations: | Search |
| EPA GENetic TOXicology: | Search |
| EPA Substance Registry Services (TSCA): | 464-45-9 |
| EPA ACToR: | Toxicology Data |
| EPA Substance Registry Services (SRS): | Registry |
| Laboratory Chemical Safety Summary : | 10049 |
| National Institute of Allergy and Infectious Diseases: | Data |
| WISER: | UN 1312 |
| WGK Germany: | 2 |
| | (1S,4R,6R)-1,7,7-trimethylbicyclo[2.2.1]heptan-6-ol |
| Chemidplus: | 0000464459 |
| RTECS: | DT5095000 for cas# 464-45-9 |
References:
Other Information:
Potential Blenders and core components note
| |
| For Odor |
| alcoholic |
| alcoholic |
| iso | propyl alcohol | FL/FR |
| aldehydic |
| | agrumen nitrile | FR |
| | dodecanal (aldehyde C-12 lauric) | FL/FR |
| 2- | methyl undecanal (aldehyde C-12 mna) | FL/FR |
| amber |
| | amber naphthofuran | FL/FR |
| | ambrette seed oil | FL/FR |
| | angelica root oil | FL/FR |
| | cistus ladaniferus resinoid | FL/FR |
| animal |
| | costus valerolactone | FR |
| balsamic |
| | amyris wood oil | FL/FR |
| siam | benzoin resinoid | FL/FR |
| | benzyl salicylate | FL/FR |
| dextro,laevo-iso | borneol | FL/FR |
| dextro- | borneol | FL/FR |
| dextro,laevo- | borneol | FL/FR |
| | bornyl acetate | FL/FR |
| iso | bornyl acetate | FL/FR |
| iso | bornyl formate | FL/FR |
| iso | bornyl isobutyrate | FL/FR |
| iso | bornyl methyl ether | FL/FR |
| iso | bornyl propionate | FL/FR |
| | brachyleana hutchinsii wood oil | FR |
| | fir balsam absolute | FR |
| | myrrh oil | FL/FR |
| | opoponax resinoid replacer | FR |
| | valerian rhizome absolute | FL/FR |
| camphoreous |
| | bornyl ethyl ether | |
| 2,6- | dimethyl-3-oxatricyclo(4.2.1.0*2,4*)nonane | FR |
| | fenchol | FL/FR |
| laevo- | fenchone | FL/FR |
| chocolate |
| 1,3,3,4,5,6- | hexamethyl(2.2.2)bicyclooct-5-en-2-ol | |
| citrus |
| | myrcenyl acetate | FL/FR |
| coconut |
| (S)-gamma- | hexalactone | |
| earthy |
| 2- | ethyl fenchol | FL/FR |
| (-)-alpha- | fenchol | FL/FR |
| (Z)- | linalool oxide (furanoid) | FL/FR |
| floral |
| | acetophenone | FL/FR |
| alpha- | amyl cinnamaldehyde | FL/FR |
| | bois de rose oil peru | FL/FR |
| | cassie absolute | FL/FR |
| | coriander seed oil | FL/FR |
| | dihydrocarvyl acetate | FL/FR |
| | dimethyl benzyl carbinol | FL/FR |
| alpha- | hexyl cinnamaldehyde | FL/FR |
| | ho leaf oil | FR |
| beta- | ionone | FL/FR |
| 2- | methyl naphthalene | FL/FR |
| | mimosa absolute morocco | FL/FR |
| bitter | orangeflower concrete morocco | FR |
| | petitgrain bigarade oil | FL/FR |
| fruity |
| 3- | allyl oxy-1,4-dimethyl bicyclo(3.2.1)octane | FR |
| (R)-gamma- | dodecalactone | FL/FR |
| 2- | ethyl butyl 2-butenoate | |
| | menthyl isovalerate | FL/FR |
| 1,3,3,5- | tetramethyl-7 and 8-acetyl bicyclo(2.2.2)oct-5-ene | |
| green |
| | geranic acid | FL/FR |
| iso | green methanoindene | FR |
| | rose leaf absolute (rosa centifolia) | FL/FR |
| 3,5,5- | trimethyl hexanol | FL/FR |
| herbal |
| 1- | allyl-2,2,7,7-tetramethyl cycloheptanol | FR |
| | anethum graveolens herb oil | FL/FR |
| | angelica archangelica seed extract | FL/FR |
| | anthemis nobilis flower oil roman | FL/FR |
| | barosma betulina leaf oil | FL/FR |
| | camphene carbinyl acetate | FR |
| | chamomile oil morocco | FR |
| 1,8- | cineole | FL/FR |
| | daucus carota fruit oil | FL/FR |
| iso | dihydrolavandulal | FL/FR |
| | dimethyl cyclormol (IFF) | FR |
| delta- | elemene | FL/FR |
| | geranic oxide | FL/FR |
| | herbal dioxane | FR |
| 6- | hydroxydihydrotheaspirane (mixture of isomers) | FL/FR |
| | hyssopus officinalis extract | FL/FR |
| | hyssopus officinalis leaf tincture | FL/FR |
| spike | lavender oil | FL/FR |
| | melaleuca leucadendron cajaputi oil | FL/FR |
| | methyl cyclogeranate (Firmenich) | FR |
| | myrtenol | FL/FR |
| | origanum oil | FL/FR |
| | origanum oil greece | FL/FR |
| curled | parsley leaf oil | FL/FR |
| | pine hexanol | FR |
| beta- | pinene | FL/FR |
| alpha- | pinene | FL/FR |
| | rosemary absolute | FL/FR |
| | rosemary oil | FL/FR |
| | rosemary oil africa | FL/FR |
| | rosemary oil morocco | FL/FR |
| | rosemary oil replacer | FR |
| | rosemary oil spain | FL/FR |
| | rosemary oil tunisia | FL/FR |
| | sabinene hydrate | FL/FR |
| | tea leaf absolute | FL/FR |
| | theaspirane | FL/FR |
| | thymol | FL/FR |
| | yerba mate absolute | FL/FR |
| honey |
| | methyl phenyl acetate | FL/FR |
| mentholic |
| (±)- | menthol | FL/FR |
| laevo- | menthol | FL/FR |
| | peppermint cyclohexanone | FL/FR |
| iso | pulegyl acetate | FL/FR |
| minty |
| | agathosma crenulata leaf oil | FL/FR |
| | peppermint oil idaho | FL/FR |
| 5- and 6-iso | propyl-1,3,3-trimethyl bicyclo(2.2.2)-5,7-octadien-2-one | |
| mossy |
| | oakmoss absolute | FL/FR |
| | oakmoss distillates | FL/FR |
| | veramoss (IFF) | FR |
| musk |
| | acetyl ethyl tetramethyl tetralin replacer | FR |
| | musk decanolide | FR |
| musty |
| ketoiso | phorone | FL/FR |
| nutty |
| 2- | ethyl pyrazine | FL/FR |
| powdery |
| para- | anisyl alcohol | FL/FR |
| spicy |
| | cassia bark oil china | FL/FR |
| | clove bud oil | FL/FR |
| black | currant bud absolute | FL/FR |
| 2,5- | dimethyl bicyclo(3.2.1)-2-octen-3-yl acetate + 1,4-dimethyl bicyclo(3.2.1)-2-octen-3-yl acetate | FR |
| | elettaria cardamomum seed oil | FL/FR |
| | ginger fragrance | FR |
| | ginger root absolute | FL/FR |
| | ginger root oil china | FL/FR |
| | ginger root oil replacer | FR |
| | ginger specialty | FR |
| | grains of paradise oil | FL/FR |
| | methyl heptadienone | FL/FR |
| | origanum majorana oleoresin | FL/FR |
| black | pepper oil CO2 extract | FL/FR |
| | pimenta acris leaf oil | FL/FR |
| white | sassafras oil | FL/FR |
| terpenic |
| | frankincense oil | FL/FR |
| | juniperus communis fruit oil | FL/FR |
| | pine needle oil dwarf | FL/FR |
| thujonic |
| | armoise oil | FR |
| | cedarleaf oil terpeneless | FR |
| tonka |
| | tonka bean absolute | FR |
| tropical |
| | genet absolute | FL/FR |
| vanilla |
| | vanillin | FL/FR |
| waxy |
| | ethyl laurate | FL/FR |
| woody |
| | agarwood oil (aetoxylon sympetalum) | FR |
| 2-tert- | butyl cyclohexanone | FR |
| | cabreuva wood oil | FR |
| atlas | cedarwood oil | FR |
| | cistus twig/leaf oil | FL/FR |
| | guaiacwood oil 20% in gurjun balsam oil | FR |
| | gurjun balsam oil | FR |
| 1,2,3,3,4,5,6- | heptamethyl bicyclo(2.2.2)oct-5-en-2-ol | |
| | hinoki root oil | FR |
| | homalomena rubescens root oil | FR |
| | juniper berry oil terpenes | FR |
| 6- | methoxy-1,6,7-trimethyl octahydro-4,7-methanoindene + 5-methoxy-2,4,5-trimethyl octahydro-4,7-methan | |
| | methyl cedryl ketone | FL/FR |
| (-)- | myrtenol | |
| | patchouli ethanone | FR |
| | patchouli oil | FL/FR |
| | sandalwood oil CO2 extract | FL/FR |
| | santall | FR |
| | spikenard oil CO2 extract | FL/FR |
| 1,3,3,5- | tetramethyl-7 and 8-cyanobicyclo(2.2.2)oct-5-ene | |
| | thuja occidentalis leaf oil | FL/FR |
| | woody acetate | FR |
| |
| For Flavor |
| |
| No flavor group found for these |
| dextro- | borneol | FL/FR |
| dextro,laevo- | borneol | FL/FR |
| iso | bornyl methyl ether | FL/FR |
| | cistus ladaniferus resinoid | FL/FR |
| (R)-gamma- | dodecalactone | FL/FR |
| delta- | elemene | FL/FR |
| 2- | ethyl butyl 2-butenoate | |
| | grains of paradise oil | FL/FR |
| 1,2,3,3,4,5,6- | heptamethyl bicyclo(2.2.2)oct-5-en-2-ol | |
| (S)-gamma- | hexalactone | |
| 1,3,3,4,5,6- | hexamethyl(2.2.2)bicyclooct-5-en-2-ol | |
| (Z)- | linalool oxide (furanoid) | FL/FR |
| 6- | methoxy-1,6,7-trimethyl octahydro-4,7-methanoindene + 5-methoxy-2,4,5-trimethyl octahydro-4,7-methan | |
| 5- and 6-iso | propyl-1,3,3-trimethyl bicyclo(2.2.2)-5,7-octadien-2-one | |
| white | sassafras oil | FL/FR |
| | spikenard oil CO2 extract | FL/FR |
| 1,3,3,5- | tetramethyl-7 and 8-acetyl bicyclo(2.2.2)oct-5-ene | |
| 1,3,3,5- | tetramethyl-7 and 8-cyanobicyclo(2.2.2)oct-5-ene | |
| alcoholic |
| iso | propyl alcohol | FL/FR |
| amber |
| | amber naphthofuran | FL/FR |
| | ambrette seed oil | FL/FR |
| balsamic |
| siam | benzoin resinoid | FL/FR |
| | benzyl salicylate | FL/FR |
| iso | bornyl isobutyrate | FL/FR |
| iso | bornyl propionate | FL/FR |
| | myrrh oil | FL/FR |
| camphoreous |
| dextro,laevo-iso | borneol | FL/FR |
| | bornyl acetate | FL/FR |
| | bornyl ethyl ether | |
| (-)-alpha- | fenchol | FL/FR |
| | fenchol | FL/FR |
| laevo- | fenchone | FL/FR |
| | geranic oxide | FL/FR |
| 6- | hydroxydihydrotheaspirane (mixture of isomers) | FL/FR |
| | rosemary oil tunisia | FL/FR |
| citrus |
| | myrcenyl acetate | FL/FR |
| | petitgrain bigarade oil | FL/FR |
| ketoiso | phorone | FL/FR |
| cooling |
| spike | lavender oil | FL/FR |
| iso | menthol | FL |
| laevo- | menthol | FL/FR |
| | sabinene hydrate | FL/FR |
| | theaspirane | FL/FR |
| | WS-3 | FL |
| earthy |
| 2- | ethyl fenchol | FL/FR |
| floral |
| | bois de rose oil peru | FL/FR |
| | dihydrocarvyl acetate | FL/FR |
| | methyl phenyl acetate | FL/FR |
| | mimosa absolute morocco | FL/FR |
| fruity |
| para- | anisyl alcohol | FL/FR |
| | menthyl isovalerate | FL/FR |
| | valerian rhizome absolute | FL/FR |
| green |
| | angelica root oil | FL/FR |
| | geranic acid | FL/FR |
| | methyl heptadienone | FL/FR |
| | oakmoss absolute | FL/FR |
| iso | phorone | FL |
| | rose leaf absolute (rosa centifolia) | FL/FR |
| 3,5,5- | trimethyl hexanol | FL/FR |
| hay |
| | genet absolute | FL/FR |
| herbal |
| | anethum graveolens herb oil | FL/FR |
| | angelica archangelica seed extract | FL/FR |
| | anthemis nobilis flower oil roman | FL/FR |
| | barosma betulina leaf oil | FL/FR |
| | cardamom distillates | FL |
| | cardamom flavor | FL |
| | coriander seed oil | FL/FR |
| | daucus carota fruit oil | FL/FR |
| iso | dihydrolavandulal | FL/FR |
| | dill flavor | FL |
| | eucalyptus flavor | FL |
| | hyssopus officinalis extract | FL/FR |
| | hyssopus officinalis leaf tincture | FL/FR |
| | melaleuca leucadendron cajaputi oil | FL/FR |
| | origanum oil | FL/FR |
| | origanum oil greece | FL/FR |
| | parsley flavor | FL |
| curled | parsley leaf oil | FL/FR |
| curled | parsley oleoresin | FL |
| | rosemary absolute | FL/FR |
| | rosemary oil | FL/FR |
| | rosemary oil africa | FL/FR |
| | rosemary oil morocco | FL/FR |
| | rosemary oil spain | FL/FR |
| | yerba mate absolute | FL/FR |
| medicinal |
| | dimethyl benzyl carbinol | FL/FR |
| mentholic |
| (±)- | menthol | FL/FR |
| | peppermint cyclohexanone | FL/FR |
| minty |
| | agathosma crenulata leaf oil | FL/FR |
| 1,8- | cineole | FL/FR |
| (-)- | myrtenol | |
| | myrtenol | FL/FR |
| | peppermint oil idaho | FL/FR |
| mossy |
| | oakmoss distillates | FL/FR |
| nutty |
| 2- | ethyl pyrazine | FL/FR |
| oily |
| 2- | methyl naphthalene | FL/FR |
| phenolic |
| | thymol | FL/FR |
| pine |
| | pine needle oil dwarf | FL/FR |
| beta- | pinene | FL/FR |
| powdery |
| | acetophenone | FL/FR |
| smoky |
| dextro- | xylose | FL |
| soapy |
| | dodecanal (aldehyde C-12 lauric) | FL/FR |
| spicy |
| | cassia bark oil china | FL/FR |
| | cassie absolute | FL/FR |
| | clove bud oil | FL/FR |
| black | currant bud absolute | FL/FR |
| | elettaria cardamomum seed oil | FL/FR |
| | ginger root absolute | FL/FR |
| | ginger root oil china | FL/FR |
| | origanum majorana oleoresin | FL/FR |
| black | pepper oil CO2 extract | FL/FR |
| | pimenta acris leaf oil | FL/FR |
| tea |
| | mate flavor | FL |
| | tea leaf absolute | FL/FR |
| | yerba mate flavor | FL |
| terpenic |
| | juniperus communis fruit oil | FL/FR |
| para- | menthatriene | FL |
| tropical |
| alpha- | amyl cinnamaldehyde | FL/FR |
| vanilla |
| | vanillin | FL/FR |
| waxy |
| | ethyl laurate | FL/FR |
| alpha- | hexyl cinnamaldehyde | FL/FR |
| 2- | methyl undecanal (aldehyde C-12 mna) | FL/FR |
| woody |
| | amyris wood oil | FL/FR |
| iso | bornyl acetate | FL/FR |
| iso | bornyl formate | FL/FR |
| | cistus twig/leaf oil | FL/FR |
| | frankincense oil | FL/FR |
| beta- | ionone | FL/FR |
| | methyl cedryl ketone | FL/FR |
| | patchouli oil | FL/FR |
| alpha- | pinene | FL/FR |
| iso | pulegyl acetate | FL/FR |
| | sandalwood oil CO2 extract | FL/FR |
| | thuja occidentalis leaf oil | FL/FR |
| |
Potential Uses:
Occurrence (nature, food, other): note
Synonyms:
| | bicyclo[2.2.1]heptan-2-ol, 1,7,7-trimethyl-, (1S,2R,4R)- | | L-2- | bornanol | | L-endo-2- | bornanol | | laevo-2- | bornanol | | laevo-endo-2- | bornanol | | ((1S)-endo)-(-)- | borneol | | (1S,2R,4S)-(-)- | borneol | | L- | borneol | | L- | borneol crystals 80% | | L- | borneol crystals 95% | | laevo- | borneol crystals extra (80-20) | | L- | borneol flakes | | L- | borneol natural | | L- | borneol pure | | L-2- | camphanol | | L-endo-2- | camphanol | | laevo-2- | camphanol | | laevo-endo-2- | camphanol | | L- | camphol | | laevo- | camphol | | L-endo-2- | hydroxybornane | | laevo-2- | hydroxybornane | | laevo-endo-2- | hydroxycamphane | | (1S-endo)-1,7,7- | trimethyl bicyclo(2.2.1)heptan-2-ol | | L-1,7,7- | trimethyl bicyclo(2.2.1)heptan-2-ol | | laevo-1,7,7- | trimethyl bicyclo(2.2.1)heptan-2-ol | | (1S,2R,4R)-1,7,7- | trimethylbicyclo[2.2.1]heptan-2-ol | | (1S,4R,6R)-1,7,7- | trimethylbicyclo[2.2.1]heptan-6-ol |
Articles:
|