|
Category: flavor and fragrance agents
US / EU / FDA / JECFA / FEMA / FLAVIS / Scholar / Patent Information:
Physical Properties:
| Appearance: | colorless clear liquid (est) |
| Assay: | 99.00 to 100.00 % sum of isomers
|
| Food Chemicals Codex Listed: | No |
| Boiling Point: | 170.00 to 171.00 °C. @ 760.00 mm Hg
|
| Vapor Pressure: | 1.904000 mmHg @ 25.00 °C. (est) |
| Flash Point: | 136.00 °F. TCC ( 57.78 °C. )
|
| logP (o/w): | 3.020 (est) |
| Soluble in: |
| | alcohol | | | water, 70.97 mg/L @ 25 °C (est) |
| Insoluble in: |
| | water |
| Stability: |
| | detergent | | | soap |
Organoleptic Properties:
| |
| Odor Type: herbal |
| |
| Odor Strength: | medium , recommend smelling in a 10.00 % solution or less |
| |
| Substantivity: | 4 hour(s) at 20.00 % |
| |
| | fresh camphoreous herbal rosemary |
Odor Description: at 10.00 % in dipropylene glycol. | fresh camphor herbal rosemary Luebke, William tgsc, (1985) |
| |
| | sweet floral citrus woody cooling minty camphoreous |
Odor Description:
| Sweet, floral, citrus with woody, cooling, minty and camphoreous nuances Mosciano, Gerard P&F 18, No. 3, 53, (1993) |
| |
| |
| Flavor Type: camphoreous |
| |
| | sweet camphoreous woody cooling floral |
Taste Description: at 20.00 ppm. | Sweet, camphoreous, woody, cooling, with floral nuances Mosciano, Gerard P&F 18, No. 3, 53, (1993) |
| |
| Odor and/or flavor descriptions from others (if found). |
| |
| Bedoukian Research |
| 2,2,6-TRIMETHYL-6-VINYLTETRAHYDROPYRAN ≥95.0%, Kosher |
| Odor Description: | A fresh camphor, herbal, rosemary odor Blends well with marjoram and lavender; also can be used in bois de rose and geranium. |
| Taste Description: | herbal Used in berry, blueberry, tea and other floral flavors. |
| |
| Givaudan |
| Limetol |
| Odor Description: | Fresh, Camphoraceous, Woody, Cineole-Lime Limetol is used where a lemon-woody note is desired. It also offers pine needle and lime nuances. |
| Taste Description: | sweet camphor woody cooling floral |
| |
| Indukern F&F |
| LIMETOL |
| Odor Description: | CITRUS, FRESH, TERPENIC, MENTHOLATED |
| |
| Moellhausen |
| LIMETOL |
| Odor Description: | Fresh, Camphoraceous, Woody, Cineole-Lime |
| Taste Description: | sweet camphor woody cooling floral |
| |
| |
Cosmetic Information:
Suppliers:
| BOC Sciences |
| For experimental / research use only. |
| 2,2,6-Trimethyl-6-vinyltetrahydropyran
|
| Givaudan |
| Limetol
Odor: Fresh, Camphoraceous, Woody, Cineole-Lime Use: Limetol is used where a lemon-woody note is desired. It also offers pine needle and lime nuances. |
| Indukern F&F |
| LIMETOL
Odor: CITRUS, FRESH, TERPENIC, MENTHOLATED |
| Lluch Essence |
| LIMETOL
|
| Moellhausen |
| LIMETOL
|
| Penta International |
| 2,2,6-TRIMETHYL-6-VINYLTETRAHYDROPYRAN NATURAL
|
| Penta International |
| 2,2,6-TRIMETHYL-6-VINYLTETRAHYDROPYRAN
|
| Santa Cruz Biotechnology |
| For experimental / research use only. |
| Limetol
|
| The Perfumers Apprentice |
| Limetol (G)
Odor: Fresh, Camphoraceous, Woody, Cineole-Lime-like Use: Used where a lemon-woody note is desired. Also gives a pine needle and lime nuance |
| Vigon International |
| Limetol
Odor: Fresh, Camphoraceous, Woody, Cineole-Lime |
Safety Information:
| Preferred SDS: View |
| European information : |
| Most important hazard(s): | | Xi - Irritant |
R 10 - Flammable. R 38 - Irritating to skin. S 02 - Keep out of the reach of children. S 24/25 - Avoid contact with skin and eyes. S 26 - In case of contact with eyes, rinse immediately with plenty of water and seek medical advice. S 36 - Wear suitable protective clothing.
|
| |
| Hazards identification |
| |
| Classification of the substance or mixture |
| GHS Classification in accordance with 29 CFR 1910 (OSHA HCS) |
| None found. |
| GHS Label elements, including precautionary statements |
| |
| Pictogram | |
| |
| Hazard statement(s) |
| None found. |
| Precautionary statement(s) |
| None found. |
| Oral/Parenteral Toxicity: |
oral-rat LD50 [sex: M,F] 2700 - 2800 mg/kg (Sauer-Freeman, 1980)
oral-mouse LD50 [sex: M,F] 4000 - 8000 mg/kg (Roure Bertrand Dupont, 1979)
|
| Dermal Toxicity: |
|
Not determined
|
| Inhalation Toxicity: |
|
Not determined
|
Safety in Use Information:
| Category: | flavor and fragrance agents |
| RIFM Fragrance Material Safety Assessment: Search |
| IFRA Code of Practice Notification of the 49th Amendment to the IFRA Code of Practice |
| Recommendation for geranic oxide usage levels up to: | | | 3.0000 % in the fragrance concentrate.
|
| |
| Maximised Survey-derived Daily Intakes (MSDI-EU): | 0.024 (μg/capita/day) |
| Maximised Survey-derived Daily Intakes (MSDI-USA): | 8.00 (μg/capita/day) |
| Structure Class: | II |
| Use levels for FEMA GRAS flavoring substances on which the FEMA Expert Panel based its judgments that the substances are generally recognized as safe (GRAS). |
| The Expert Panel also publishes separate extensive reviews of scientific information on all FEMA GRAS flavoring substances and can be found at FEMA Flavor Ingredient Library |
| publication number: 13. Update in publication number(s): 14 |
| Click here to view publication 13 |
| | average usual ppm | average maximum ppm |
| baked goods: | - | - |
| beverages(nonalcoholic): | - | 0.50000 |
| beverages(alcoholic): | - | - |
| breakfast cereal: | - | - |
| cheese: | - | - |
| chewing gum: | - | - |
| condiments / relishes: | - | - |
| confectionery froastings: | - | 1.00000 |
| egg products: | - | - |
| fats / oils: | - | - |
| fish products: | - | - |
| frozen dairy: | - | - |
| fruit ices: | - | - |
| gelatins / puddings: | - | 2.00000 |
| granulated sugar: | - | - |
| gravies: | - | - |
| hard candy: | - | - |
| imitation dairy: | - | - |
| instant coffee / tea: | - | - |
| jams / jellies: | - | - |
| meat products: | - | - |
| milk products: | - | - |
| nut products: | - | - |
| other grains: | - | - |
| poultry: | - | - |
| processed fruits: | - | - |
| processed vegetables: | - | - |
| reconstituted vegetables: | - | - |
| seasonings / flavors: | - | - |
| snack foods: | - | - |
| soft candy: | - | 0.50000 |
| soups: | - | - |
| sugar substitutes: | - | - |
| sweet sauces: | - | - |
Safety References:
| European Food Safety Athority(EFSA): | Flavor usage levels; Subacute, Subchronic, Chronic and Carcinogenicity Studies; Developmental / Reproductive Toxicity Studies; Genotoxicity Studies... |
| European Food Safety Authority (EFSA) reference(s): |
Opinion of the Scientific Panel on food additives, flavourings, processing aids and materials in contact with food (AFC) related to Flavouring Group Evaluation 23 (FGE.23): Aliphatic, alicyclic and aromatic ethers including anisole derivatives From chemical groups 15, 16 and 26 (Commission Regulation (EC) No 1565/2000 of 18 July 2000 View page or View pdf |
Flavouring Group Evaluation 59 (FGE.59): Consideration of aliphatic and aromatic ethers evaluated by JECFA (61st meeting) structurally related to aliphatic, alicyclic and aromatic ethers including anisole derivatives evaluated by EFSA in FGE.23 (2006) (Commission Regulation (EC) No 1565/2000 of 18 July 2000) - Opinion of the Scientific Panel on Food Additives, Flavourings, Processing Aids and Materials in contact with Food (AFC) View page or View pdf |
Flavouring Group Evaluation 23, Revision 1 (FGE.23Rev1): Aliphatic, alicyclic and aromatic ethers including anisole derivatives from chemical groups 15, 16, 26 and 30[1] - Opinion of the Scientific Panel on Food Additives, Flavourings, Processing Aids and Materials in Contact with Food View page or View pdf |
Flavouring Group Evaluation 33 (FGE.33)[1] - Six Tetrahydrofuran Derivatives from Chemical Groups 13, 14, 16 and 26 - Scientific Opinion of the Panel on Food Additives, Flavourings, Processing Aids and Materials in Contact with Food View page or View pdf |
Scientific Opinion on Flavouring Group Evaluation 59, Revision 1 (FGE.59Rev1): Consideration of aliphatic and aromatic ethers evaluated by JECFA (61st meeting and 63rd meeting) structurally related to aliphatic, alicyclic and aromatic ethers including anisole derivatives evaluated by EFSA in FGE.23 Rev2 (2010) View page or View pdf |
| EPI System: | View |
| AIDS Citations: | Search |
| Cancer Citations: | Search |
| Toxicology Citations: | Search |
| EPA Substance Registry Services (TSCA): | 7392-19-0 |
| EPA ACToR: | Toxicology Data |
| EPA Substance Registry Services (SRS): | Registry |
| Laboratory Chemical Safety Summary : | 522514 |
| National Institute of Allergy and Infectious Diseases: | Data |
| WISER: | UN 1993 |
| WGK Germany: | 2 |
| | 2-ethenyl-2,6,6-trimethyloxane |
| Chemidplus: | 0007392190 |
References:
Other Information:
Potential Blenders and core components note
| |
| For Odor |
| No odor group found for these |
| | fenchone | FL/FR |
|
| | camphenilone | |
| | laurel leaf absolute | FL/FR |
| 2- | methyl-3-butanone | FL/FR |
| balsamic |
| dextro,laevo-iso | borneol | FL/FR |
| dextro,laevo- | borneol | FL/FR |
| laevo- | borneol | FL/FR |
| | bornyl acetate | FL/FR |
| iso | bornyl acetate | FL/FR |
| iso | bornyl formate | FL/FR |
| iso | bornyl methyl ether | FL/FR |
| iso | bornyl propionate | FL/FR |
| dextro- | fenchone | FL/FR |
| camphoreous |
| 3- | benzylidene-2-butanone | FL/FR |
| | bornyl ethyl ether | |
| | bornyl isobutyrate | FL/FR |
| | butyrophenone | FL/FR |
| dextro- | camphor | FL/FR |
| (±)- | camphor | FL/FR |
| | camphor tree bark oil | FL/FR |
| beta-homo | cyclocitral | FL/FR |
| 2,6- | dimethyl-3-oxatricyclo(4.2.1.0*2,4*)nonane | FR |
| | fenchol | FL/FR |
| laevo- | fenchone | FL/FR |
| | herbal ethanone | FR |
| | hinoki leaf oil | FR |
| | thujyl alcohol | FL/FR |
| | verbenone | FL/FR |
| chocolate |
| 1,3,3,4,5,6- | hexamethyl(2.2.2)bicyclooct-5-en-2-ol | |
| citrus |
| | bergamot oil italy | FL/FR |
| | bergamot oil ivory coast | FL/FR |
| | bergamot oil terpeneless | FL/FR |
| (S)-(-)- | citronellal | FL/FR |
| | citrus ocimenol | FR |
| | citrus woody floral fragrance | FR |
| | jambu flower oil brazil | |
| | ocimene quintoxide | FL/FR |
| | tetrahydromyrcenyl acetate | FR |
| earthy |
| (-)-alpha- | fenchol | FL/FR |
| 2- | octanone | FL/FR |
| floral |
| iso | amyl salicylate | FL/FR |
| | anise indene | FR |
| | bigarade oxide | FR |
| | bois de rose oil peru | FL/FR |
| | cilantro herb oil egypt | FL/FR |
| | citronellyl acetate | FL/FR |
| | coriander oil fractions | FL/FR |
| | cyclohexyl ethyl acetate | FL/FR |
| 2- | decalinol | FR |
| | dihydrolinalool | FL/FR |
| | dihydromyrcene | FR |
| | gardenia amide | FR |
| | geranium oil china | FL/FR |
| | geranyl tiglate | FL/FR |
| | ho leaf oil | FR |
| (Z)- | jasmone | FL/FR |
| | karo karounde absolute | FR |
| | lavandula angustifolia flower oil | FL/FR |
| | lavender oil france | FL/FR |
| | menthadienyl formate | FR |
| | methyl nerate | |
| (E)- | nerolidol | FL/FR |
| | nerolidol | FL/FR |
| | nonisyl propionate | FR |
| | petitgrain bigarade oil | FL/FR |
| | prenyl salicylate | FL/FR |
| fruity |
| 3- | allyl oxy-1,4-dimethyl bicyclo(3.2.1)octane | FR |
| 3- | benzyl-4-heptanone | FL/FR |
| | linalyl isobutyrate | FL/FR |
| | ocimen-1-yl acetate | FR |
| 1,3,3,5- | tetramethyl-7 and 8-acetyl bicyclo(2.2.2)oct-5-ene | |
| green |
| | agrumen aldehyde | FR |
| | cilantro leaf oil | FL/FR |
| iso | cyclocitral (IFF) | FL/FR |
| | geranium absolute | FL/FR |
| 2,4- | ivy carbaldehyde | FL/FR |
| 3,6- | ivy carbaldehyde | FL/FR |
| 3,5- | ivy carbaldehyde | FL/FR |
| | ivy carbaldehyde | FL/FR |
| para- | methyl hydratropaldehyde | FL/FR |
| herbal |
| 6- | acetoxydihydrotheaspirane | FL/FR |
| | acorus calamus rhizome oil | FR |
| 1- | allyl-2,2,7,7-tetramethyl cycloheptanol | FR |
| | bornyl butyrate | FL/FR |
| beta- | bourbonene | FL/FR |
| delta- | cadinene | |
| alpha- | cadinol | FL/FR |
| 1,4- | cineole | FL/FR |
| (R)-(+)- | citronellal | FL/FR |
| | citrus ocimenol acetate | FR |
| | coriander oleoresin | FL/FR |
| iso | dihydrolavandulol | FR |
| (Z)-iso | dihydrolavandulyl acetate | FR |
| | dihydroterpinyl acetate | FL/FR |
| | dimethyl cyclormol (IFF) | FR |
| | eucalyptus citriodora oil | FR |
| | eucalyptus radiata leaf/stem oil | FR |
| | freesia heptanol | FL/FR |
| | guava leaf oil cuba | FR |
| cis- | herbal cyclohexane | FR |
| | herbal dioxane | FR |
| | herbal undecanol | FR |
| | herbal undecanone | FR |
| 6- | hydroxydihydrotheaspirane (mixture of isomers) | FL/FR |
| | hyssop oil | FL/FR |
| | immortelle flower oil | FL/FR |
| | jambu oleoresin | FL/FR |
| | laurel bark oil | |
| | laurel stem oil | |
| | laurus nobilis leaf oil | FL/FR |
| spike | lavender oil | FL/FR |
| | methyl cyclogeranate (Firmenich) | FR |
| | origanum oil | FL/FR |
| | origanum oil greece | FL/FR |
| curled | parsley leaf oil | FL/FR |
| | petitgrain heptane | FR |
| | pine hexanol | FR |
| alpha- | pinene | FL/FR |
| | pinocarveol | FL/FR |
| | piperitone | FL/FR |
| | rosemary absolute | FL/FR |
| | rosemary oil | FL/FR |
| | rosemary oil africa | FL/FR |
| | rosemary oil egypt | FL/FR |
| | rosemary oil morocco | FL/FR |
| | rosemary oil spain | FL/FR |
| | rosemary oil tunisia | FL/FR |
| | sabinene hydrate | FL/FR |
| | saffron pyranone | FR |
| | tea leaf absolute | FL/FR |
| oswego | tea specialty | FR |
| | terpinolene | FL/FR |
| | thyme oil wild or creeping | FL/FR |
| | tricyclodecenyl propionate | FR |
| 2,4,6- | trimethyl-6-(3-methyl-2-buten-1-yl)-2-cyclohexen-1-one | |
| | yarrow oil | FL/FR |
| laevo- | menthyl acetate | FL/FR |
| | peppermint cyclohexanone | FL/FR |
| minty |
| dextro- | dihydrocarvone | FL/FR |
| | pennyroyal oil | FL/FR |
| 5- and 6-iso | propyl-1,3,3-trimethyl bicyclo(2.2.2)-5,7-octadien-2-one | |
| naphthyl |
| para- | methyl anisole | FL/FR |
| pine |
| | dipentene terpene hydrocarbon byproducts | FR |
| | pine oil 85 | FR |
| soapy |
| 2- | ethyl decanoic acid | |
| spicy |
| 4- | carvomenthenol | FL/FR |
| | caryophyllene | FL/FR |
| beta- | caryophyllene | FL/FR |
| | cinnamon acrolein | FL/FR |
| | cubeb oil CO2 extract (piper cubeba) | FL/FR |
| black | currant bud absolute | FL/FR |
| | galangal root oil | FL/FR |
| | ginger oleoresin africa | FL/FR |
| | ginger root oil cochin | FL/FR |
| | piper matico leaf oil | |
| 4-iso | propyl-2-cyclohexenone | FL/FR |
| white | sassafras oil | FL/FR |
| | sugandha kokila berry oil | FR |
| laevo- | verbenone | FL/FR |
| terpenic |
| para- | cymene | FL/FR |
| gamma- | terpinene | FL/FR |
| alpha- | terpineol | FL/FR |
| thujonic |
| | armoise oil | FR |
| | cedarleaf oil terpeneless | FR |
| common | tansy leaf oil dutch | FR |
| | woody ketone | FL/FR |
| waxy |
| | decanal dimethyl acetal | FL/FR |
| woody |
| iso | bornyl isovalerate | FL/FR |
| 2-tert- | butyl cyclohexanone | FR |
| (R)-gamma- | cadinene | |
| | camphene | FL/FR |
| (+)- | camphene | FL/FR |
| | cistus twig/leaf oil | FL/FR |
| 6,7- | dihydrolinalool | FL/FR |
| | dragons blood fragrance | FR |
| (E)-beta- | farnesene | FL/FR |
| alpha- | farnesene | FL/FR |
| 1,2,3,3,4,5,6- | heptamethyl bicyclo(2.2.2)oct-5-en-2-ol | |
| | hinoki root oil | FR |
| | juniper berry oil terpenes | FR |
| iso | longifolene epoxide | FR |
| | marine formate | FR |
| gamma- | muurolene | |
| | patchouli ethanol | FR |
| | patchouli hexanol | FR |
| | polylimonene | FL/FR |
| | spruce needle oil canada | FL/FR |
| 1,3,3,5- | tetramethyl-7 and 8-cyanobicyclo(2.2.2)oct-5-ene | |
| |
| For Flavor |
| |
| No flavor group found for these |
| 6- | acetoxydihydrotheaspirane | FL/FR |
| 3- | benzylidene-2-butanone | FL/FR |
| dextro,laevo- | borneol | FL/FR |
| | bornyl butyrate | FL/FR |
| | bornyl isobutyrate | FL/FR |
| iso | bornyl methyl ether | FL/FR |
| beta- | bourbonene | FL/FR |
| | butyrophenone | FL/FR |
| (R)-gamma- | cadinene | |
| delta- | cadinene | |
| alpha- | cadinol | FL/FR |
| (+)- | camphene | FL/FR |
| | camphenilone | |
| (R)-(+)- | citronellal | FL/FR |
| (S)-(-)- | citronellal | FL/FR |
| | decanal dimethyl acetal | FL/FR |
| 6,7- | dihydrolinalool | FL/FR |
| | dihydroterpinyl acetate | FL/FR |
| | epoxyoxophorone | FL |
| 2- | ethyl decanoic acid | |
| (E)-beta- | farnesene | FL/FR |
| | fenchone | FL/FR |
| 1,2,3,3,4,5,6- | heptamethyl bicyclo(2.2.2)oct-5-en-2-ol | |
| 2- | heptyl cyclopropane carboxylic acid | FL |
| 1,3,3,4,5,6- | hexamethyl(2.2.2)bicyclooct-5-en-2-ol | |
| 3,5- | ivy carbaldehyde | FL/FR |
| | ivy carbaldehyde | FL/FR |
| | jambu flower oil brazil | |
| | laurel bark oil | |
| | laurel stem oil | |
| 3- | methyl cyclohexanone | FL |
| | methyl nerate | |
| 1- | methyl pyrrole | FL |
| 2- | methyl-3-butanone | FL/FR |
| gamma- | muurolene | |
| 3- | octyl butyrate | FL |
| (Z,Z)- | photocitral A | FL |
| | piper matico leaf oil | |
| | piperitenone oxide | FL |
| | polylimonene | FL/FR |
| 5- and 6-iso | propyl-1,3,3-trimethyl bicyclo(2.2.2)-5,7-octadien-2-one | |
| 4-iso | propyl-2-cyclohexenone | FL/FR |
| white | sassafras oil | FL/FR |
| 1,3,3,5- | tetramethyl-7 and 8-acetyl bicyclo(2.2.2)oct-5-ene | |
| 1,3,3,5- | tetramethyl-7 and 8-cyanobicyclo(2.2.2)oct-5-ene | |
| 2,4,6- | trimethyl-6-(3-methyl-2-buten-1-yl)-2-cyclohexen-1-one | |
| (E)-4- | undecenal | FL |
| laevo- | verbenone | FL/FR |
| | verbenone | FL/FR |
| | woody ketone | FL/FR |
|
| | laurel leaf absolute | FL/FR |
| | thujyl alcohol | FL/FR |
| balsamic |
| iso | bornyl propionate | FL/FR |
| camphoreous |
| laevo- | borneol | FL/FR |
| dextro,laevo-iso | borneol | FL/FR |
| | bornyl acetate | FL/FR |
| | bornyl ethyl ether | |
| | camphene | FL/FR |
| (±)- | camphor | FL/FR |
| | camphor tree bark oil | FL/FR |
| | fenchol | FL/FR |
| (-)-alpha- | fenchol | FL/FR |
| laevo- | fenchone | FL/FR |
| 6- | hydroxydihydrotheaspirane (mixture of isomers) | FL/FR |
| | pinocarveol | FL/FR |
| | rosemary oil tunisia | FL/FR |
| citrus |
| | bergamot oil italy | FL/FR |
| | bergamot oil ivory coast | FL/FR |
| | bergamot oil terpeneless | FL/FR |
| | cilantro leaf oil | FL/FR |
| | freesia heptanol | FL/FR |
| | petitgrain bigarade oil | FL/FR |
| alpha- | terpineol | FL/FR |
| cooling |
| 4- | carvomenthenol | FL/FR |
| 1,4- | cineole | FL/FR |
| beta-homo | cyclocitral | FL/FR |
| dextro- | fenchone | FL/FR |
| | jambu oleoresin | FL/FR |
| spike | lavender oil | FL/FR |
| iso | menthol | FL |
| | sabinene hydrate | FL/FR |
| dairy |
| 2- | octanone | FL/FR |
| floral |
| | bois de rose oil peru | FL/FR |
| | citronellyl acetate | FL/FR |
| | dihydrolinalool | FL/FR |
| | geranium oil china | FL/FR |
| | geranyl tiglate | FL/FR |
| | linalyl isobutyrate | FL/FR |
| fruity |
| 3- | benzyl-4-heptanone | FL/FR |
| green |
| iso | amyl salicylate | FL/FR |
| iso | cyclocitral (IFF) | FL/FR |
| | cyclohexyl ethyl acetate | FL/FR |
| dextro- | dihydrocarvone | FL/FR |
| alpha- | farnesene | FL/FR |
| | geranium absolute | FL/FR |
| 3,6- | ivy carbaldehyde | FL/FR |
| 2,4- | ivy carbaldehyde | FL/FR |
| para- | methyl hydratropaldehyde | FL/FR |
| | nerolidol | FL/FR |
| (E)- | nerolidol | FL/FR |
| | ocimene quintoxide | FL/FR |
| iso | phorone | FL |
| herbal |
| | cilantro herb oil egypt | FL/FR |
| | coriander oil fractions | FL/FR |
| | coriander oleoresin | FL/FR |
| | hyssop oil | FL/FR |
| | immortelle flower oil | FL/FR |
| | laurus nobilis leaf oil | FL/FR |
| | lavandula angustifolia flower oil | FL/FR |
| | lavender oil france | FL/FR |
| | origanum oil | FL/FR |
| | origanum oil greece | FL/FR |
| curled | parsley leaf oil | FL/FR |
| | prenyl salicylate | FL/FR |
| | rosemary absolute | FL/FR |
| | rosemary oil | FL/FR |
| | rosemary oil africa | FL/FR |
| | rosemary oil egypt | FL/FR |
| | rosemary oil morocco | FL/FR |
| | rosemary oil spain | FL/FR |
| | thyme oil wild or creeping | FL/FR |
| | yarrow oil | FL/FR |
| medicinal |
| dextro- | camphor | FL/FR |
| mentholic |
| | peppermint cyclohexanone | FL/FR |
| minty |
| laevo- | menthyl acetate | FL/FR |
| | pennyroyal oil | FL/FR |
| | piperitone | FL/FR |
| naphthyl |
| para- | methyl anisole | FL/FR |
| spicy |
| | caryophyllene | FL/FR |
| beta- | caryophyllene | FL/FR |
| | cinnamon acrolein | FL/FR |
| | cubeb oil CO2 extract (piper cubeba) | FL/FR |
| black | currant bud absolute | FL/FR |
| | galangal root oil | FL/FR |
| | ginger oleoresin africa | FL/FR |
| | ginger root oil cochin | FL/FR |
| tea |
| | tea leaf absolute | FL/FR |
| terpenic |
| para- | cymene | FL/FR |
| gamma- | terpinene | FL/FR |
| woody |
| iso | bornyl acetate | FL/FR |
| iso | bornyl formate | FL/FR |
| iso | bornyl isovalerate | FL/FR |
| | cistus twig/leaf oil | FL/FR |
| (Z)- | jasmone | FL/FR |
| alpha- | pinene | FL/FR |
| | spruce needle oil canada | FL/FR |
| | terpinolene | FL/FR |
| |
Potential Uses:
Occurrence (nature, food, other): note
Synonyms:
| | bois de rose oxide | | 2- | ethenyl tetrahydro-2,6,6-trimethyl-2H-pyran | | 2- | ethenyl-2,6,6-trimethyloxane | | 2- | ethenyl-2,6,6-trimethyltetrahydro-2H-pyran | | 2- | ethenyltetrahydro-2,6,6-trimethyl-2H-pyran | | | geranic oxide | | | limetol (Givaudan) | | | linaloyl oxide | | 4H- | pyran, 2,6,6-trimethyl-2-vinyl- | | 2H- | pyran, 2-ethenyltetrahydro-2,6,6-trimethyl- | | 2H- | pyran, tetrahydro-2,2,6-trimethyl-6-vinyl- | | | tetrahydro-2,2,6-trimethyl-6-vinyl-2H-pyran | | (±)- | tetrahydro-2,6,6-trimethyl-2-vinyl-2H-pyran | | | trimethoxy-2-vinyl tetrahydropyran | | 2,6,6- | trimethoxy-2-vinyltetrahydropyran | | 2,6,6- | trimethyl-2-vinyl tetrahydropyran | | 2,6,6- | trimethyl-2-vinyltetrahydropyran | | 2,2,6- | trimethyl-6-ethenyl tetrahydropyran | | 2,2,6- | trimethyl-6-vinyl tetrahydro-2H-pyran | | 2,2,6- | trimethyl-6-vinyl tetrahydropyran | | 2,2,6- | trimethyl-6-vinyl-tetrahydropyran | | 2,2,6- | trimethyl-6-vinyltetrahydropyran | | 2,6,6- | trimethyl-6-vinyltetrahydropyran |
Articles:
|