| Name: | sassafras albidum (nuttall) nees oil |
| CAS Number: | 8006-80-2 |
|
| FDA UNII: | 78ZX2PFG2Z |
| MDL: | MFCD00148252 |
Category: flavor and fragrance agents
US / EU / FDA / JECFA / FEMA / FLAVIS / Scholar / Patent Information:
Physical Properties:
| Appearance: | yellowish brown clear liquid (est) |
| Food Chemicals Codex Listed: | No |
| Specific Gravity: | 1.07900 to 1.09800 @ 25.00 °C.
|
| Pounds per Gallon - (est).: | 8.978 to 9.136
|
| Refractive Index: | 1.53300 to 1.53700 @ 20.00 °C.
|
| Boiling Point: | 236.00 °C. @ 760.00 mm Hg
|
| Flash Point: | 225.00 °F. TCC ( 107.22 °C. )
|
| Soluble in: |
| | water, 75.98 mg/L @ 25 °C (est) |
Organoleptic Properties:
| |
| Odor Type: spicy |
| |
| Odor Strength: | medium , recommend smelling in a 1.00 % solution or less |
| |
| Substantivity: | 144 hour(s) at 100.00 % |
| |
| | sweet spicy fresh camphoreous woody floral root beer sarsaparilla |
Odor Description: at 1.00 % in dipropylene glycol. | sweet spicy fresh camphor woody floral rootbeer Luebke, William tgsc, (1983) |
| |
| Odor and/or flavor descriptions from others (if found). |
| |
| |
Cosmetic Information:
Suppliers:
Safety Information:
| European information : |
| Most important hazard(s): | | T - Toxic. |
R 22 - Harmful if swallowed. R 45 - May cause cancer. R 68 - Possible risk of irreversible effects. S 01/02 - Keep locked up and out of the reach of children. S 20/21 - When using do not eat, drink or smoke. S 23 - Do not breath vapour. S 24/25 - Avoid contact with skin and eyes. S 26 - In case of contact with eyes, rinse immediately with plenty of water and seek medical advice. S 36/37/39 - Wear suitable clothing, gloves and eye/face protection. S 45 - In case of accident or if you feel unwell seek medical advice immediately. S 53 - Avoid exposure - obtain special instructions before use.
|
| |
| Hazards identification |
| |
| Classification of the substance or mixture |
| GHS Classification in accordance with 29 CFR 1910 (OSHA HCS) |
| None found. |
| GHS Label elements, including precautionary statements |
| |
| Pictogram | |
| |
| Hazard statement(s) |
| None found. |
| Precautionary statement(s) |
| None found. |
| Oral/Parenteral Toxicity: |
oral-rat LD50 1900 mg/kg Food and Chemical Toxicology. Vol. 20, Pg. 825, 1982.
oral-man LDLo 83 mg/kg SENSE ORGANS AND SPECIAL SENSES: MYDRIASIS (PUPILLARY DILATION): EYE
LUNGS, THORAX, OR RESPIRATION: OTHER CHANGES
GASTROINTESTINAL: NAUSEA OR VOMITING Archives of Disease in Childhood. Vol. 28, Pg. 475, 1953.
|
| Dermal Toxicity: |
skin-rabbit LD50 > 5000 mg/kg Food and Chemical Toxicology. Vol. 20, Pg. 825, 1982.
|
| Inhalation Toxicity: |
|
Not determined
|
Safety in Use Information:
| Category: | flavor and fragrance agents |
| RIFM Fragrance Material Safety Assessment: Search |
| IFRA Code of Practice Notification of the 49th Amendment to the IFRA Code of Practice |
| IFRA fragrance material specification: | | | Safrole as such should not be used as a fragrance ingredient; essential oils containing safrole should not be used at a level such that the total concentration of safrole exceeds 0.01% in consumer products. Examples of essential oils with a high safrole content are Sassafras oil (Sassafras officinale Nees& Eberm.), Ocotea Cymbarum oil (Ocotea pretiosa Metz) and certain qualities of Camphor oils.
The total concentration of safrole, isosafrole and dihydrosafrole should not exceed 0.01% in consumer products. |
| contains the following IFRA (Annex) restricted components: (non-analysis max. level reference only) |
| safrole | Max. Found: 92.00 % and Reason: Carcinogenicity |
| Recommendation for white sassafras oil usage levels up to: | | | 4.0000 % in the fragrance concentrate.
|
| |
Safety References:
References:
| | sassafras albidum (nuttall) nees oil |
| Canada Domestic Sub. List: | 8006-80-2 |
| Pubchem (sid): | 135355615 |
Other Information:
Potential Blenders and core components note
| |
| For Odor |
| No odor group found for these |
| 4- | methyl-2-(2-methyl propyl)-1,3-oxathiane | |
| aldehydic |
| 2,6- | dimethyl-2,18-nonadecadien-8-one | |
| anisic |
| | dihydroanethol | FL/FR |
| | estragole | FL/FR |
| bitter | fennel seed oil spain | FR |
| | ocotea cymbarum oil | |
| | sassafras acetate | FL/FR |
| balsamic |
| laevo- | borneol | FL/FR |
| dextro,laevo- | borneol | FL/FR |
| iso | bornyl methyl ether | FL/FR |
| | guaiacyl phenyl acetate | FL/FR |
| berry |
| sec- | butyl ethyl ether | FL/FR |
| camphoreous |
| | bornyl ethyl ether | |
| 2,6- | dimethyl-3-oxatricyclo(4.2.1.0*2,4*)nonane | FR |
| chocolate |
| 1,3,3,4,5,6- | hexamethyl(2.2.2)bicyclooct-5-en-2-ol | |
| citrus |
| | citrus woody floral fragrance | FR |
| | myrcenyl acetate | FL/FR |
| earthy |
| (-)-alpha- | fenchol | FL/FR |
| (Z)- | linalool oxide (furanoid) | FL/FR |
| floral |
| | amyl cyclopentenone | CS |
| | bois de rose oil peru | FL/FR |
| | cassie absolute | FL/FR |
| delta- | damascone | FL/FR |
| | dihydro-alpha-ionone | FL/FR |
| 2',4'- | dimethyl acetophenone | FL/FR |
| 2,4- | dimethyl cyclohexyl methyl acetate | FR |
| 4- | dimethyl ionone | FR |
| | elder flower wood specialty | FR |
| | epoxylinalyl acetate | |
| | ho leaf oil | FR |
| (E)-beta- | ionone | FL/FR |
| alpha- | ionone | FL/FR |
| alpha- | ionyl acetate | FR |
| | lavandula angustifolia flower oil | FL/FR |
| | lavender oil france | FL/FR |
| | lavender oil greece | FL/FR |
| laevo- | linalool | FL/FR |
| | linalool oxide | FL/FR |
| | melaleuca ericifolia leaf oil | FR |
| alpha-iso | methyl ionone (60% min.) | FL/FR |
| alpha-iso | methyl ionone (70% min.) | FL/FR |
| alpha-iso | methyl ionone (80% min.) | FL/FR |
| 2- | methyl naphthalene | FL/FR |
| | mimosa concrete france | FL/FR |
| | mimosa tenuiflora leaf extract | FL/FR |
| bitter | orangeflower concrete | FR |
| | orris rhizome absolute replacer | FR |
| | petitgrain cedrat oil | FL/FR |
| | petitgrain oil terpenes | FR |
| | phenethyl hexanoate | FL/FR |
| | rose concrete (rosa centifolia) | FR |
| | styralyl formate | FL/FR |
| | vetiver pentanone | FR |
| fruity |
| 3- | allyl oxy-1,4-dimethyl bicyclo(3.2.1)octane | FR |
| 1,4- | diisopropyl-6,8-dioxabicyclo(3.2.1)octane | FR |
| 2- | ethyl butyl 2-butenoate | |
| | linalool oxide acetates | FL/FR |
| | octyl propionate | FL/FR |
| 1,3,3,5- | tetramethyl-7 and 8-acetyl bicyclo(2.2.2)oct-5-ene | |
| | tropical ionone | FL/FR |
| green |
| iso | green methanoindene | FR |
| (E)-2- | hexen-1-yl salicylate | FR |
| para- | methyl hydratropaldehyde | FL/FR |
| herbal |
| 1- | allyl-2,2,7,7-tetramethyl cycloheptanol | FR |
| | calendula officinalis flower oil CO2 extract | FR |
| | dimethyl cyclormol (IFF) | FR |
| | freesia heptanol | FL/FR |
| | geranic oxide | FL/FR |
| | herbal dioxane | FR |
| | immortelle flower oil | FL/FR |
| | laurel bark oil | |
| | laurel stem oil | |
| | laurus nobilis leaf oil | FL/FR |
| | marigold pot flower oil | FL/FR |
| | methyl cyclogeranate (Firmenich) | FR |
| | origanum oil | FL/FR |
| | origanum oil greece | FL/FR |
| | rosemary absolute | FL/FR |
| | rosemary oil | FL/FR |
| | rosemary oil africa | FL/FR |
| | rosemary oil morocco | FL/FR |
| | rosemary oil spain | FL/FR |
| | rosemary oil tunisia | FL/FR |
| | rosmarinus officinalis extract | FL/FR |
| | thymol | FL/FR |
| licorice |
| bitter | fennel seed oil CO2 extract | FR |
| | peppermint cyclohexanone | FL/FR |
| minty |
| | pennyroyal oil | FL/FR |
| 5- and 6-iso | propyl-1,3,3-trimethyl bicyclo(2.2.2)-5,7-octadien-2-one | |
| mossy |
| | moss specialty | FR |
| musk |
| | amyris specialty | FR |
| | ethylene brassylate | FL/FR |
| powdery |
| (E)-alpha- | methyl ionone (44-50%) | FL/FR |
| rummy |
| | rum extract | FL/FR |
| spicy |
| 2,4- | dimethyl-alpha-isopropyl-3-cyclohexene-1-methanol | |
| | elettaria cardamomum seed oil | FL/FR |
| | elettaria cardamomum seed oil guatemala | FL/FR |
| iso | eugenol | FL/FR |
| | galangal root oil | FL/FR |
| | laurus nobilis fruit oil | FL/FR |
| | marjoram absolute spain | |
| | safrole | CS |
| iso | safrole | |
| | sassafras albidum bark tincture (safrol free) | FL/FR |
| | sassafras albidum leaf (safrole-free) | |
| | sassafras fragrance | FR |
| | spicy carbonate | FR |
| | zvoulimba leaf oil | FR |
| terpenic |
| alpha- | terpineol | FL/FR |
| thujonic |
| | cedarleaf oil terpeneless | FR |
| woody |
| | anthocephalus cadamba oil | FR |
| | bois de rose leaf oil brazil | FL/FR |
| | bornyl valerate | FL/FR |
| 2-tert- | butyl cyclohexanone | FR |
| | cabreuva wood oil | FR |
| | chloranthus spicatus absolute | FR |
| | convolvulus scoparius wood oil | FR |
| 2- | decalinyl acetate | FR |
| | dihydro-beta-ionol | FL/FR |
| 3',4'- | dimethoxyacetophenone | |
| 10-epi-gamma- | eudesmol | |
| | hedychium spicatum root oil | FR |
| 1,2,3,3,4,5,6- | heptamethyl bicyclo(2.2.2)oct-5-en-2-ol | |
| | hinoki root oil | FR |
| | homalomena rubescens root oil | FR |
| | juniper berry oil terpenes | FR |
| 3- | methyl pentyl angelate | FR |
| | sandal octanol | FR |
| | santalyl acetate | FL/FR |
| 1,3,3,5- | tetramethyl-7 and 8-cyanobicyclo(2.2.2)oct-5-ene | |
| | zdravetz absolute | FR |
| | zdravetz oil | FL/FR |
| | zedoary bark oil | FL/FR |
| |
| For Flavor |
| |
| No flavor group found for these |
| dextro,laevo- | borneol | FL/FR |
| iso | bornyl methyl ether | FL/FR |
| sec- | butyl ethyl ether | FL/FR |
| alpha- | campholene acetate | FL |
| | dihydro-beta-ionol | FL/FR |
| 2',4'- | dimethyl acetophenone | FL/FR |
| 2,6- | dimethyl-2,18-nonadecadien-8-one | |
| | epoxylinalyl acetate | |
| 2- | ethyl butyl 2-butenoate | |
| 10-epi-gamma- | eudesmol | |
| 1,2,3,3,4,5,6- | heptamethyl bicyclo(2.2.2)oct-5-en-2-ol | |
| 1,3,3,4,5,6- | hexamethyl(2.2.2)bicyclooct-5-en-2-ol | |
| | laurel bark oil | |
| | laurel stem oil | |
| | laurus nobilis fruit oil | FL/FR |
| (Z)- | linalool oxide (furanoid) | FL/FR |
| | linalool oxide acetates | FL/FR |
| | marigold pot flower oil | FL/FR |
| | marjoram absolute spain | |
| (E)-alpha- | methyl ionone (44-50%) | FL/FR |
| alpha-iso | methyl ionone (60% min.) | FL/FR |
| 4- | methyl-2-(2-methyl propyl)-1,3-oxathiane | |
| | ocotea cymbarum oil | |
| 5- and 6-iso | propyl-1,3,3-trimethyl bicyclo(2.2.2)-5,7-octadien-2-one | |
| iso | safrole | |
| | styralyl formate | FL/FR |
| 1,3,3,5- | tetramethyl-7 and 8-acetyl bicyclo(2.2.2)oct-5-ene | |
| 1,3,3,5- | tetramethyl-7 and 8-cyanobicyclo(2.2.2)oct-5-ene | |
| | zdravetz oil | FL/FR |
| berry |
| | dihydro-alpha-ionone | FL/FR |
| camphoreous |
| laevo- | borneol | FL/FR |
| | bornyl ethyl ether | |
| (-)-alpha- | fenchol | FL/FR |
| | geranic oxide | FL/FR |
| | rosemary oil tunisia | FL/FR |
| citrus |
| | freesia heptanol | FL/FR |
| laevo- | linalool | FL/FR |
| | myrcenyl acetate | FL/FR |
| | petitgrain cedrat oil | FL/FR |
| alpha- | terpineol | FL/FR |
| cooling |
| iso | menthol | FL |
| estery |
| | octyl propionate | FL/FR |
| floral |
| | bois de rose leaf oil brazil | FL/FR |
| | bois de rose oil peru | FL/FR |
| alpha- | ionone | FL/FR |
| alpha-iso | methyl ionone (70% min.) | FL/FR |
| alpha-iso | methyl ionone (80% min.) | FL/FR |
| | mimosa concrete france | FL/FR |
| | mimosa tenuiflora leaf extract | FL/FR |
| | tropical ionone | FL/FR |
| green |
| | linalool oxide | FL/FR |
| para- | methyl hydratropaldehyde | FL/FR |
| herbal |
| | dihydroanethol | FL/FR |
| | immortelle flower oil | FL/FR |
| | laurus nobilis leaf oil | FL/FR |
| | lavandula angustifolia flower oil | FL/FR |
| | lavender oil france | FL/FR |
| | lavender oil greece | FL/FR |
| | origanum oil | FL/FR |
| | origanum oil greece | FL/FR |
| | rosemary absolute | FL/FR |
| | rosemary oil | FL/FR |
| | rosemary oil africa | FL/FR |
| | rosemary oil morocco | FL/FR |
| | rosemary oil spain | FL/FR |
| | rosmarinus officinalis extract | FL/FR |
| licorice |
| | estragole | FL/FR |
| mentholic |
| | peppermint cyclohexanone | FL/FR |
| minty |
| | pennyroyal oil | FL/FR |
| musk |
| | ethylene brassylate | FL/FR |
| oily |
| 2- | methyl naphthalene | FL/FR |
| phenolic |
| | guaiacyl phenyl acetate | FL/FR |
| | thymol | FL/FR |
| rummy |
| | rum extract | FL/FR |
| spicy |
| | cassie absolute | FL/FR |
| 2,4- | dimethyl-alpha-isopropyl-3-cyclohexene-1-methanol | |
| | elettaria cardamomum seed oil | FL/FR |
| | elettaria cardamomum seed oil guatemala | FL/FR |
| iso | eugenol | FL/FR |
| | galangal root oil | FL/FR |
| | sassafras albidum bark extract (safrol free) | FL |
| | sassafras albidum bark tincture (safrol free) | FL/FR |
| | sassafras albidum extract (safrole-free) | FL |
| | sassafras albidum leaf (safrole-free) | |
| tarragon |
| | sassafras acetate | FL/FR |
| waxy |
| | phenethyl hexanoate | FL/FR |
| woody |
| | bornyl valerate | FL/FR |
| delta- | damascone | FL/FR |
| 3',4'- | dimethoxyacetophenone | |
| (E)-beta- | ionone | FL/FR |
| | santalyl acetate | FL/FR |
| | zedoary bark oil | FL/FR |
| |
Potential Uses:
Occurrence (nature, food, other): note
Synonyms:
| | laurus albida oil | | | laurus sassafras oil | | | sassafras albidum oil | | | sassafras albidum var. molle oil | | | sassafras officinalis oil | | | sassafras oil chinese | | | sassafras sassafras oil | | | sassafras variifolium oil |
Articles:
|