|
Category: flavor and fragrance agents
US / EU / FDA / JECFA / FEMA / FLAVIS / Scholar / Patent Information:
Physical Properties:
| Appearance: | brownish orange reddish clear oily liquid (est) |
| Food Chemicals Codex Listed: | No |
| Specific Gravity: | 0.95000 to 0.97500 @ 25.00 °C.
|
| Pounds per Gallon - (est).: | 7.905 to 8.113
|
| Specific Gravity: | 0.95300 to 0.97800 @ 20.00 °C.
|
| Pounds per Gallon - est.: | 7.939 to 8.147
|
| Refractive Index: | 1.49900 to 1.51500 @ 20.00 °C.
|
| Optical Rotation: | -48.00 to -65.00
|
| Boiling Point: | 287.00 °C. @ 760.00 mm Hg
|
| Flash Point: | 190.00 °F. TCC ( 87.78 °C. )
|
| Shelf Life: | 36.00 month(s) or longer if stored properly. |
| Storage: | store in cool, dry place in tightly sealed containers, protected from heat and light. |
| Soluble in: |
| | alcohol | | | water, 42.87 mg/L @ 25 °C (est) |
| Insoluble in: |
| | water |
Organoleptic Properties:
| |
| Odor Type: woody |
| |
| Odor Strength: | medium |
| |
| Substantivity: | 400 hour(s) at 100.00 % |
| |
| | patchouli |
Odor Description: at 100.00 %. | patchouli |
| |
| |
| Flavor Type: woody |
| |
| | woody earthy weedy balsamic spicy camphoreous |
Taste Description:
| woody earthy weedy balsamic spicy camphoreous |
| |
| Odor and/or flavor descriptions from others (if found). |
| |
| Pell Wall Perfumes |
| Patchouli Ultra Light (65% Patchoulol) |
| Odor Description: | patchouli, earthy, amber. Diffusive This form of molecular distilled patchouli contains a full 65% patchoulol (patchouli alcohol) and as a result has a very high impact on the diffusion and sillage of a fragrance witout introducing an overwhelming patchouli character. |
| Taste Description: | patchouli |
| |
| Hermitage Oils |
| Patchouli Molecular Distilled |
| Odor Description: | characteristic Adam Michael has this to say “This material is created as follows, the dark patchouli is sent from Indonesia to France. It is then re-distilled using a molecular still that results in all the components breaking down. Within this molecular still we have a plate and all the non-volatile parts such as residual waxes will stick to the plate. All the volatile vapours are collected and run through a condensing column and turned back into molecular distilled patchouli. It is golden yellow in colour and the smell is very clean and pleasant. |
| Taste Description: | patchouli |
| |
| Perfumery Laboratory |
| Patchouli OIL MD Biolandes |
| Odor Description: | Rich, deep, woody, amber-earthy aroma with a touch of powdery |
| Taste Description: | patchouli |
| |
| Van Aroma |
| PATCHOULI OIL SUMATRA MOLECULAR DISTILLED MIN 32% PA |
| Odor Description: | Sweet-herbaceous, aromatic-spicy and woody-balsamic |
| Taste Description: | woody earthy weedy balsamic spicy camphoreous |
| |
| IFF |
| Patchouli Oil Indonesia MD |
| Odor Description: | Woody with an earthy mint humidity, moss effect with a chocolate leather touch |
| Taste Description: | woody earthy weedy balsamic spicy camphoreous |
| |
| |
Cosmetic Information:
Suppliers:
| Berjé |
| Patchouli Oil Molecular Distilled
|
| Media |
| Bontoux |
| PATCHOULI MD ESSENTIAL OIL
|
| Charabot |
| Patchouli indo molecular oil
100% Pure & Natural, Kosher Odor: Woody, earthy |
| Ernesto Ventós |
| PATCHOULI MD, 30%
|
| Ernesto Ventós |
| PATCHOULI OIL MD 45% PATCHOULOL
|
| Ernesto Ventós |
| PATCHOULI OIL MD 65% PATCHOULOL
|
| Ernesto Ventós |
| PATCHOULI OIL MD 80% PATCHOULOL
|
| Ernesto Ventós |
| PATCHOULI OIL MD 865 INDESSO
|
| Ernesto Ventós |
| PATCHOULI OIL MD
|
| Fine Fragrances Pvt Ltd |
| Patchouli Oil Indonesia MD LMR
|
| Global Essence |
| Patchouli Oil MD
|
| Hermitage Oils |
| Patchouli Molecular Distilled (65% Patchoulol)
Odor: characteristic Use: Adam Michael has this to say about Patchouli Molecular Distilled (65% Patchoulol) “The appearance of this material resembles that of rose otto on a cold morning, very crystalised. As such this material needs a good 4-6 minutes of warmth before you can work with it. To my nose the aroma is comparable to patchouli light, displaying more of the cleaner, fresher, watery facets I detect within patchouli light following with camphoraceous and woody undertones. Steam distilled material which is then molecular distilled. The patchoulol content is a mind blowing 65%.” |
| Hermitage Oils |
| Patchouli Molecular Distilled
Odor: characteristic Use: Adam Michael has this to say “This material is created as follows, the dark patchouli is sent from Indonesia to France. It is then re-distilled using a molecular still that results in all the components breaking down. Within this molecular still we have a plate and all the non-volatile parts such as residual waxes will stick to the plate. All the volatile vapours are collected and run through a condensing column and turned back into molecular distilled patchouli. It is golden yellow in colour and the smell is very clean and pleasant. |
| IFF |
| Patchouli Oil Indonesia MD
Odor: Woody with an earthy mint humidity, moss effect with a chocolate leather touch |
| Indukern F&F |
| PATCHOULI OIL MD
Odor: WOODY, SWEET, BALSAMIC |
| Kanta Enterprises |
| Patchouli Molecular Distillation Oil
|
| Lluch Essence |
| PATCHOULI DM SULAWESI OIL (29% PATCHOULOL/IRON FREE)
|
| Moellhausen |
| PATCHOULY EO MD 30% PA
|
| Moellhausen |
| PATCHOULY OIL MD
|
| OQEMA |
| Patchouli Oil MD
|
| Payand Betrand |
| Patchouly Oil Molecular distillation France
For fragrance use |
| Pell Wall Perfumes |
| Patchouli Ultra Light (65% Patchoulol)
Odor: patchouli, earthy, amber. Diffusive Use: This form of molecular distilled patchouli contains a full 65% patchoulol (patchouli alcohol) and as a result has a very high impact on the diffusion and sillage of a fragrance witout introducing an overwhelming patchouli character. |
| Penta International |
| PATCHOULY OIL MD COLORLESS
|
| Perfumer Supply House |
| Patchouli Oil MD 65% Patchoulol (Ventos)
Odor: A deep woody, odor which is earthy, and camphoraceous and somewhat powdery |
| Perfumery Laboratory |
| Patchouli OIL MD Biolandes
Odor: Rich, deep, woody, amber-earthy aroma with a touch of powdery |
| Phoenix Aromas & Essential Oils |
| Patchouli Oil Md
|
| Prodasynth |
| PATCHOULI OIL 65%
(PATCHOULOL > 65%) Odor: CAMPHORACEOUS AND WOODY UNDERTONES |
| Prodasynth |
| PATCHOULI OIL MD
(PATCHOULOL > 32%) Odor: CAMPHORACEOUS AND WOODY UNDERTONES |
| PT Mitra Ayu Adi Pratama |
| Patchouli MD PA 40+
|
| PT Mitra Ayu Adi Pratama |
| Patchouli MD PA 60+
|
| R C Treatt & Co Ltd |
| Patchouli Oil Decolourised M.D.
|
| Robertet |
| Patchouli indo molecular oil
100% Pure & Natural, Kosher Odor: Woody, earthy |
| Seasons and Harvest / Crop calendar |
| SRS Aromatics |
| PATCHOULI OIL INDONESIAN MD
|
| The Lebermuth Company |
| Patchouli M.D.
Odor: Camphoraceous, woody |
| Spring/Summer 2022 Fragrance Trends |
| Ultra International |
| Patchouli Oil MD Indonesia
|
| Crop Calendar |
| Ungerer & Company |
| Patchouli Oil MD
|
| Van Aroma |
| PATCHOULI OIL SULAWESI MOLECULAR DISTILLED MIN 30% PA
|
| maps.vanaroma.com |
| Van Aroma |
| PATCHOULI OIL SUMATRA MOLECULAR DISTILLED MIN 30% PA
|
| Van Aroma |
| PATCHOULI OIL SUMATRA MOLECULAR DISTILLED MIN 32% PA
Odor: Sweet-herbaceous, aromatic-spicy and woody-balsamic |
| Van Aroma |
| PATCHOULI OIL SUMATRA MOLECULAR DISTILLED MIN 34% PA
|
| Vigon International |
| Patchouli Oil Molecular Distilled
|
Safety Information:
| |
| Hazards identification |
| |
| Classification of the substance or mixture |
| GHS Classification in accordance with 29 CFR 1910 (OSHA HCS) |
| None found. |
| GHS Label elements, including precautionary statements |
| |
| Pictogram | |
| |
| Hazard statement(s) |
| None found. |
| Precautionary statement(s) |
| None found. |
| Oral/Parenteral Toxicity: |
oral-rat LD50 > 5000 mg/kg Food and Chemical Toxicology. Vol. 20, Pg. 791, 1982.
|
| Dermal Toxicity: |
skin-rabbit LD50 > 5000 mg/kg Food and Chemical Toxicology. Vol. 20, Pg. 791, 1982.
|
| Inhalation Toxicity: |
|
Not determined
|
Safety in Use Information:
| Category: | flavor and fragrance agents |
| RIFM Fragrance Material Safety Assessment: Search |
| IFRA Code of Practice Notification of the 49th Amendment to the IFRA Code of Practice |
| Recommendation for patchouli oil molecular distilled usage levels up to: | | | 10.0000 % in the fragrance concentrate.
|
| |
| Use levels for FEMA GRAS flavoring substances on which the FEMA Expert Panel based its judgments that the substances are generally recognized as safe (GRAS). |
| The Expert Panel also publishes separate extensive reviews of scientific information on all FEMA GRAS flavoring substances and can be found at FEMA Flavor Ingredient Library |
| publication number: 3 |
| Click here to view publication 3 |
| | average usual ppm | average maximum ppm |
| baked goods: | - | 10.00000 |
| beverages(nonalcoholic): | - | 0.88000 |
| beverages(alcoholic): | - | - |
| breakfast cereal: | - | - |
| cheese: | - | - |
| chewing gum: | 43.00000 | 220.00000 |
| condiments / relishes: | - | - |
| confectionery froastings: | - | - |
| egg products: | - | - |
| fats / oils: | - | - |
| fish products: | - | - |
| frozen dairy: | - | 1.10000 |
| fruit ices: | - | 1.10000 |
| gelatins / puddings: | - | - |
| granulated sugar: | - | - |
| gravies: | - | - |
| hard candy: | - | 6.30000 |
| imitation dairy: | - | - |
| instant coffee / tea: | - | - |
| jams / jellies: | - | - |
| meat products: | - | - |
| milk products: | - | - |
| nut products: | - | - |
| other grains: | - | - |
| poultry: | - | - |
| processed fruits: | - | - |
| processed vegetables: | - | - |
| reconstituted vegetables: | - | - |
| seasonings / flavors: | - | - |
| snack foods: | - | - |
| soft candy: | - | - |
| soups: | - | - |
| sugar substitutes: | - | - |
| sweet sauces: | - | - |
Safety References:
References:
Other Information:
Potential Blenders and core components note
| |
| For Odor |
| No odor group found for these |
| 2- | methyl-3-isobutyl quinoxaline | |
|
| (E)- | sabinene hydrate | FL/FR |
| aldehydic |
| | dodecanal (aldehyde C-12 lauric) | FL/FR |
| amber |
| | amber acetate | FR |
| | amber cyclohexanol | FR |
| | amber oxepin | FR |
| | amber spirolene | FR |
| | ambergris tincture | FL/FR |
| | ambrette seed absolute | FL/FR |
| | ambrette seed oil | FL/FR |
| alpha- | ambrinol | FL/FR |
| | angelica root oil | FL/FR |
| | cistus ladaniferus resinoid | FL/FR |
| | labdanum oil | FL/FR |
| | labdanum oil replacer | FR |
| | labdanum resinoid replacer | FR |
| animal |
| | ambergris tincture replacer | FR |
| | animal carbolactone | FR |
| | costus valerolactone | FR |
| | indole | FL/FR |
| anisic |
| para- | anisaldehyde | FL/FR |
| para- | anisyl phenyl acetate | FL/FR |
| balsamic |
| iso | amyl benzoate | FL/FR |
| | amyris wood oil | FL/FR |
| siam | benzoin absolute | FL/FR |
| sumatra | benzoin absolute | FL/FR |
| | benzoin absolute replacer | FL/FR |
| siam | benzoin resin | FL/FR |
| sumatra | benzoin resinoid | FL/FR |
| siam | benzoin resinoid | FL/FR |
| 1- | benzoyl acetone | FL/FR |
| | benzyl benzoate | FL/FR |
| | benzyl salicylate | FL/FR |
| (E)- | benzyl tiglate | FL/FR |
| dextro,laevo- | borneol | FL/FR |
| dextro,laevo-iso | borneol | FL/FR |
| iso | bornyl acetate | FL/FR |
| laevo- | bornyl acetate | FL/FR |
| iso | bornyl formate | FL/FR |
| iso | bornyl isobutyrate | FL/FR |
| | brachyleana hutchinsii wood oil | FR |
| iso | butyl cinnamate | FL/FR |
| | cinnamyl alcohol | FL/FR |
| | cinnamyl formate | FL/FR |
| | conifer acetate | FR |
| | copaiba balsam oil | FL/FR |
| | ethyl cinnamate | FL/FR |
| dextro- | fenchone | FL/FR |
| | fir balsam absolute | FR |
| | fir needle oil canada | FL/FR |
| | fir needle oil siberia | FL/FR |
| | fir needle oil terpeneless canada | FL/FR |
| | guaiacyl phenyl acetate | FL/FR |
| | guaiyl butyrate | FR |
| | gurjun balsam | FR |
| | hemlock western oil (tsuga heterophylla) canada | FR |
| | juniper berry absolute | FL/FR |
| | juniper berry oil terpeneless | FL/FR |
| | methyl cinnamate | FL/FR |
| | myrrh absolute | FL/FR |
| | myrrh oil | FL/FR |
| | myrrh resinoid | FR |
| | opoponax oil (balsamodendron kafal) | FL/FR |
| 3- | phenyl propyl alcohol | FL/FR |
| | tolu balsam absolute | FL/FR |
| | tolu balsam resinoid | FL/FR |
| berry |
| | raspberry ketone methyl ether | FL/FR |
| bitter |
| | gentian absolute | FL/FR |
| camphoreous |
| | fenchol | FL/FR |
| caramellic |
| | immortelle absolute | FL/FR |
| citrus |
| | bergamot oil | FL/FR |
| 2- | cyclohexyl-4-methyl-1,3-oxathiane | |
| (E+Z)-4,8- | dimethyl-3,7-nonadien-2-yl acetate | FL/FR |
| bitter | orange peel oil | FL/FR |
| coconut |
| gamma- | heptalactone | FL/FR |
| gamma- | nonalactone (aldehyde C-18 (so-called)) | FL/FR |
| earthy |
| | cabralea cangerana root bark oil | FR |
| 2- | ethyl fenchol | FL/FR |
| (-)-alpha- | fenchol | FL/FR |
| 2- | octanone | FL/FR |
| scotch | pine needle oil | FL/FR |
| scotch | pine needle oil estonia | FL/FR |
| scotch | pine needle oil yugoslavia | FL/FR |
| | pogostemon cablin leaf extract | FR |
| floral |
| alpha- | amyl cinnamaldehyde | FL/FR |
| | cananga oil | FL/FR |
| | cyclohexyl ethyl alcohol | FL/FR |
| | dihydro-alpha-ionone | FL/FR |
| | dihydrojasmone | FL/FR |
| | floral pyranol | FR |
| | floral undecenone | FR |
| | heliotropin | FL/FR |
| | heliotropyl acetone | FL/FR |
| alpha- | hexyl cinnamaldehyde | FL/FR |
| | ho leaf oil | FR |
| | hydroxycitronellal | FL/FR |
| iso | jasmone | FL/FR |
| laevo- | linalool | FL/FR |
| | linalool oxide | FL/FR |
| para- | methyl acetophenone | FL/FR |
| | methyl dihydrojasmonate | FL/FR |
| | nerolidol | FL/FR |
| | orris pyridine 25% IPM | FR |
| | orris rhizome absolute (iris pallida) | FL/FR |
| | palmarosa oil | FL/FR |
| | phenethyl alcohol | FL/FR |
| | phenethyl phenyl acetate | FL/FR |
| | phenethyl salicylate | FL/FR |
| | primrose fragrance | FR |
| | rose absolute (rosa centifolia) morocco | FL/FR |
| | rose absolute (rosa damascena) bulgaria | FL/FR |
| | rose carboxylate | FR |
| | tuberose absolute chassis | FL/FR |
| fruity |
| | allyl cinnamate | FL/FR |
| 1-(3,3- | dimethyl bicyclo(2.2.1)hept-2-yl)-2-methyl cyclohex-3-ene carbaldehyde | FR |
| alpha- | ionyl ethyl ether | |
| | valeriana officinalis root extract | FL/FR |
| green |
| iso | amyl formate | FL/FR |
| iso | cyclocitral (IFF) | FL/FR |
| | fern absolute | |
| | galbanum absolute | FL/FR |
| | galbanum oil | FL/FR |
| | galbanum oleoresin | FL/FR |
| | galbanum resinoid | FL/FR |
| | galbascone (IFF) | FR |
| | methyl cyclocitrone (IFF) | FR |
| | oakmoss oil | FR |
| 2- | propenyl-para-cymene | FR |
| | seaweed absolute (fucus vesiculosus et serratus) | FL/FR |
| | valerian rhizome oil CO2 extract china | FL/FR |
| | violet leaf absolute | FL/FR |
| hay |
| | hay absolute | FR |
| herbal |
| 1- | allyl-2,2,7,7-tetramethyl cycloheptanol | FR |
| | camphene carbinol | FR |
| | camphene carbinyl acetate | FR |
| | canarium luzonicum gum | FL/FR |
| | cardamom oleoresin | FL/FR |
| | clary sage oil france | FL/FR |
| | clary specialty | FR |
| | dimethyl cyclormol (IFF) | FR |
| | herbal carene | FR |
| 6- | hydroxydihydrotheaspirane (mixture of isomers) | FL/FR |
| abrialis | lavandin oil | FL/FR |
| | lavandin water absolute | FL/FR |
| | lavender absolute bulgaria | FL/FR |
| | nopyl acetate | FR |
| | pine hexanol | FR |
| beta- | pinene | FL/FR |
| laevo-beta- | pinene | FL/FR |
| alpha- | pinene | FL/FR |
| | rosemary absolute | FL/FR |
| | rosemary oil morocco | FL/FR |
| | rosemary oil spain | FL/FR |
| | safranal | FL/FR |
| | valerian rhizome oil | FL/FR |
| | valerian rhizome oil china | FL/FR |
| melon |
| | watermelon ketone | FR |
| minty |
| | methyl salicylate | FL/FR |
| mossy |
| | oakmoss absolute | FL/FR |
| | oakmoss distillates | FL/FR |
| | treemoss absolute | FR |
| | veramoss (IFF) | FR |
| musk |
| | dehydro beta-linalool | FL/FR |
| naphthyl |
| para- | methyl anisole | FL/FR |
| ortho- | methyl anisole | FL/FR |
| nutty |
| 2,3,5,6- | tetramethyl pyrazine | FL/FR |
| oily |
| | mcp acetate | FR |
| phenolic |
| para-alpha- | dimethyl styrene | FL/FR |
| powdery |
| para- | anisyl alcohol | FL/FR |
| | midnight passion fragrance | FR |
| resinous |
| | mastic absolute | FL/FR |
| spicy |
| | benzyl isoeugenol | FL/FR |
| 4- | carvomenthenol | FL/FR |
| beta- | caryophyllene | FL/FR |
| alpha- | caryophyllene alcohol | FL/FR |
| beta- | caryophyllene alcohol | FL/FR |
| | cassia bark oil china | FL/FR |
| | clove bud oil | FL/FR |
| | elettaria cardamomum seed oil | FL/FR |
| | eugenol | FL/FR |
| iso | eugenyl acetate | FL/FR |
| | ginger root oil brazil | FL/FR |
| | ginger root oil china | FL/FR |
| | ginger root oil cochin | FL/FR |
| 2- | methoxy-4-vinyl phenol | FL/FR |
| alpha- | methyl cinnamaldehyde | FL/FR |
| | nutmeg absolute | FL/FR |
| | nutmeg oil | FL/FR |
| | nutmeg oil CO2 extract | FL/FR |
| black | pepper oil | FL/FR |
| | spicy acetoacetate | FL/FR |
| terpenic |
| | cypress leaf oil | FR |
| | elemi resinoid | FL/FR |
| | frankincense oil | FL/FR |
| | frankincense oil CO2 extract | FL/FR |
| | juniperus communis fruit oil | FL/FR |
| | pine needle oil dwarf | FL/FR |
| gamma- | terpinene | FL/FR |
| alpha- | terpineol | FL/FR |
| thujonic |
| | armoise oil | FR |
| tonka |
| | coumarin | FR |
| | tonka bean absolute | FR |
| vanilla |
| | ethyl vanillin | FL/FR |
| | vanilla bean absolute (vanilla planifolia) | FL/FR |
| | vanillyl acetate | FL/FR |
| waxy |
| | decyl acetate | FL/FR |
| 1- | dodecanol | FL/FR |
| | ethyl laurate | FL/FR |
| woody |
| | agarwood oil | FR |
| | amber pentadecane | FR |
| | briar wood fragrance | FR |
| para-tert- | butyl cyclohexanone | FR |
| | cadinene | FL/FR |
| | calarene epoxide | |
| beta- | caryophyllene alcohol acetate | FL/FR |
| atlas | cedarwood absolute | FR |
| atlas | cedarwood oil | FR |
| | cedarwood oil alcohols | FL/FR |
| | cedrela wood oil | FR |
| alpha- | cedrene epoxide | FR |
| | cedrenyl acetate | FR |
| | cedrol methyl ether | FR |
| | cedryl methyl ether | FR |
| | cistus ladaniferus gum | FR |
| | cistus twig/leaf oil | FL/FR |
| | cistus twig/leaf oil molecular distilled | FL/FR |
| | copaiba balsam | FL/FR |
| | cyperus root oil (cyperus scariosus) | FR |
| | cypriol oil (cyperus scariosus) | FR |
| 2- | decalinyl formate | FR |
| | dihydro-beta-ionone | FL/FR |
| | dogwood fragrance | FR |
| | dogwood specialty | FR |
| | frankincense gum | FL/FR |
| | frankincense oil replacer | FR |
| | germacrene B | |
| | guaiacwood oil | FL/FR |
| | guaiene | FL/FR |
| alpha- | guaiene | FL/FR |
| | gurjun balsam oil | FR |
| alpha- | gurjunene | FR |
| 1,2,3,3,4,5,6- | heptamethyl bicyclo(2.2.2)oct-5-en-2-ol | |
| | herbal norbornane | FR |
| 5,5a,6,7,8,8a- | hexahydro-6,6,7,8,8-pentamethyl-4H-indeno[5,4-D]isoxazole | |
| | hinoki root oil | FR |
| (1R,4S,5S,9R)-1- | hydroxy-1,4,7,7,9-pentamethyl spiro(4.5)decan-2-one | |
| 8- | hydroxy-5-isopropyl-8-methyl-non-6-en-2-one | |
| 4- | hydroxybenzaldehyde | FL/FR |
| | labdanum concrete | FR |
| | labdanum ethanone | FR |
| iso | longifolene ketone | FR |
| | louro brasileiro wood oil | FR |
| | manevoro oil | FR |
| para- | menth-3-en-1-ol | FL/FR |
| | methyl cedryl ketone | FL/FR |
| delta- | methyl ionone | FL/FR |
| | methyl vetivate | FR |
| 2- | methyl-1-(5',5',6'-trimethyl bicyclo(2.2.1)hept-2'-yl) propan-2-ol | FR |
| | moss naphthaleneol | FR |
| | octahydro-3(or 2),4-dimethyl-4,7-methanoinden-5-ol | |
| | olibanum specialty | FR |
| | orris hexanone | FR |
| | patchouli absolute | FR |
| | patchouli alcohol | FR |
| | patchouli essence | FL/FR |
| | patchouli ethanol | FR |
| | patchouli ethanone | FR |
| | patchouli extract acetylated | FR |
| | patchouli fractions | FR |
| | patchouli fragrance | FR |
| | patchouli hexanol | FR |
| | patchouli leaf water | FR |
| | patchouli oil | FL/FR |
| terpeneless | patchouli oil | FL/FR |
| | patchouli oil china | FL/FR |
| | patchouli oil CO2 extract | FL/FR |
| | patchouli oil decolorized | FL/FR |
| | patchouli oil replacer | FR |
| | patchouli residues | FR |
| | patchouli specialty | FR |
| | patchouli woody amber fragrance | FR |
| | pinacol | FR |
| | pogostemon cablin leaf oil | FR |
| | sabinene | FL/FR |
| | sandalwood oil | FL/FR |
| | sandalwood oil west australia (santalum spicatum) | FR |
| | santall | FR |
| | santalyl butyrate | FL/FR |
| | spruce needle oil canada | FL/FR |
| alpha- | terpinene | FL/FR |
| beta- | terpineol | FL/FR |
| 2,6,10,10- | tetramethyl-1-oxa-spiro[4.5]dec-3-ene-6-ol | |
| | thuja occidentalis leaf oil | FL/FR |
| | thujopsis dolabrata wood oil | FR |
| | tobacarol (IFF) | FR |
| 3(or 2),4,5- | trimethyl octahydro-4,7-methanoinden-5-ol | FR |
| | vetiver oil haiti | FL/FR |
| | vetiverol | FL/FR |
| | woody dodecane | FR |
| | woody epoxide | FR |
| | woody ether | FR |
| | woody propanol | FR |
| |
| For Flavor |
| |
| No flavor group found for these |
| | allyl cinnamate | FL/FR |
| | ambergris tincture | FL/FR |
| 1- | benzoyl acetone | FL/FR |
| dextro,laevo- | borneol | FL/FR |
| delta- | cadinene | FL |
| | calarene epoxide | |
| beta- | caryophyllene alcohol | FL/FR |
| alpha- | caryophyllene alcohol | FL/FR |
| beta- | caryophyllene alcohol acetate | FL/FR |
| | cedarwood oil alcohols | FL/FR |
| | cistus ladaniferus resinoid | FL/FR |
| 2- | cyclohexyl-4-methyl-1,3-oxathiane | |
| | dehydro beta-linalool | FL/FR |
| (E+Z)-4,8- | dimethyl-3,7-nonadien-2-yl acetate | FL/FR |
| | fern absolute | |
| | fir needle oil canada | FL/FR |
| | gentian absolute | FL/FR |
| | germacrene B | |
| alpha- | guaiene | FL/FR |
| 1,2,3,3,4,5,6- | heptamethyl bicyclo(2.2.2)oct-5-en-2-ol | |
| 5,5a,6,7,8,8a- | hexahydro-6,6,7,8,8-pentamethyl-4H-indeno[5,4-D]isoxazole | |
| (1R,4S,5S,9R)-1- | hydroxy-1,4,7,7,9-pentamethyl spiro(4.5)decan-2-one | |
| 8- | hydroxy-5-isopropyl-8-methyl-non-6-en-2-one | |
| alpha- | ionyl ethyl ether | |
| para- | menth-3-en-1-ol | FL/FR |
| delta- | methyl ionone | FL/FR |
| | octahydro-3(or 2),4-dimethyl-4,7-methanoinden-5-ol | |
| scotch | pine needle oil | FL/FR |
| scotch | pine needle oil estonia | FL/FR |
| scotch | pine needle oil yugoslavia | FL/FR |
| laevo-beta- | pinene | FL/FR |
| (E)- | sabinene hydrate | FL/FR |
| | santalyl butyrate | FL/FR |
| | seaweed absolute (fucus vesiculosus et serratus) | FL/FR |
| beta- | terpineol | FL/FR |
| 2,6,10,10- | tetramethyl-1-oxa-spiro[4.5]dec-3-ene-6-ol | |
| amber |
| | ambrette seed oil | FL/FR |
| alpha- | ambrinol | FL/FR |
| | labdanum oil | FL/FR |
| animal |
| | indole | FL/FR |
| anisic |
| para- | anisyl phenyl acetate | FL/FR |
| balsamic |
| | benzoin absolute replacer | FL/FR |
| siam | benzoin resin | FL/FR |
| sumatra | benzoin resinoid | FL/FR |
| siam | benzoin resinoid | FL/FR |
| | benzyl benzoate | FL/FR |
| | benzyl salicylate | FL/FR |
| (E)- | benzyl tiglate | FL/FR |
| laevo- | bornyl acetate | FL/FR |
| iso | bornyl isobutyrate | FL/FR |
| iso | butyl cinnamate | FL/FR |
| | copaiba balsam oil | FL/FR |
| | ethyl cinnamate | FL/FR |
| | fir needle oil siberia | FL/FR |
| | fir needle oil terpeneless canada | FL/FR |
| | juniper berry absolute | FL/FR |
| | myrrh absolute | FL/FR |
| | myrrh oil | FL/FR |
| | opoponax oil (balsamodendron kafal) | FL/FR |
| | peru balsam | FL |
| | tolu balsam absolute | FL/FR |
| | tolu balsam resinoid | FL/FR |
| berry |
| | dihydro-alpha-ionone | FL/FR |
| | heliotropyl acetone | FL/FR |
| | raspberry ketone methyl ether | FL/FR |
| bitter |
| 2- | methyl-3-isobutyl quinoxaline | |
| camphoreous |
| dextro,laevo-iso | borneol | FL/FR |
| (-)-alpha- | fenchol | FL/FR |
| | fenchol | FL/FR |
| 6- | hydroxydihydrotheaspirane (mixture of isomers) | FL/FR |
| ortho- | methyl anisole | FL/FR |
| cherry |
| | heliotropin | FL/FR |
| citrus |
| | bergamot oil | FL/FR |
| laevo- | linalool | FL/FR |
| bitter | orange peel oil | FL/FR |
| alpha- | terpineol | FL/FR |
| coconut |
| gamma- | nonalactone (aldehyde C-18 (so-called)) | FL/FR |
| cooling |
| 4- | carvomenthenol | FL/FR |
| dextro- | fenchone | FL/FR |
| creamy |
| para- | anisaldehyde | FL/FR |
| 4- | hydroxybenzaldehyde | FL/FR |
| para- | methyl acetophenone | FL/FR |
| dairy |
| 2- | octanone | FL/FR |
| earthy |
| 2- | ethyl fenchol | FL/FR |
| floral |
| | cananga oil | FL/FR |
| | dihydrojasmone | FL/FR |
| | methyl dihydrojasmonate | FL/FR |
| | phenethyl alcohol | FL/FR |
| | rose absolute (rosa centifolia) morocco | FL/FR |
| | rose absolute (rosa damascena) bulgaria | FL/FR |
| | tuberose absolute chassis | FL/FR |
| fruity |
| iso | amyl benzoate | FL/FR |
| para- | anisyl alcohol | FL/FR |
| | cherry guarana flavor | FL |
| | valerian rhizome oil | FL/FR |
| | valerian rhizome oil china | FL/FR |
| | valerian rhizome oil CO2 extract china | FL/FR |
| | valeriana officinalis root extract | FL/FR |
| grassy |
| | palmarosa oil | FL/FR |
| green |
| iso | amyl formate | FL/FR |
| | angelica root oil | FL/FR |
| | canarium luzonicum gum | FL/FR |
| | cinnamyl alcohol | FL/FR |
| iso | cyclocitral (IFF) | FL/FR |
| | cyclohexyl ethyl alcohol | FL/FR |
| | elemi resinoid | FL/FR |
| | galbanum absolute | FL/FR |
| | galbanum oil | FL/FR |
| | galbanum oleoresin | FL/FR |
| | galbanum resinoid | FL/FR |
| | immortelle absolute | FL/FR |
| iso | jasmone | FL/FR |
| | linalool oxide | FL/FR |
| | nerolidol | FL/FR |
| | oakmoss absolute | FL/FR |
| | violet leaf absolute | FL/FR |
| herbal |
| | cardamom oleoresin | FL/FR |
| | clary sage oil france | FL/FR |
| abrialis | lavandin oil | FL/FR |
| | lavandin water absolute | FL/FR |
| | lavender absolute bulgaria | FL/FR |
| | rosemary absolute | FL/FR |
| | rosemary oil morocco | FL/FR |
| | rosemary oil spain | FL/FR |
| honey |
| | phenethyl phenyl acetate | FL/FR |
| lactonic |
| gamma- | heptalactone | FL/FR |
| medicinal, |
| | phenethyl salicylate | FL/FR |
| minty |
| | methyl salicylate | FL/FR |
| mossy |
| | oakmoss distillates | FL/FR |
| naphthyl |
| para- | methyl anisole | FL/FR |
| nutty |
| 2,3,5,6- | tetramethyl pyrazine | FL/FR |
| orris |
| | costus root oil | FL |
| phenolic |
| | guaiacyl phenyl acetate | FL/FR |
| 2- | hydroxyisophorone | FL |
| pine |
| | pine needle oil dwarf | FL/FR |
| beta- | pinene | FL/FR |
| resinous |
| | mastic absolute | FL/FR |
| soapy |
| | dodecanal (aldehyde C-12 lauric) | FL/FR |
| 1- | dodecanol | FL/FR |
| spicy |
| siam | benzoin absolute | FL/FR |
| sumatra | benzoin absolute | FL/FR |
| | benzyl isoeugenol | FL/FR |
| beta- | caryophyllene | FL/FR |
| | cassia bark oil china | FL/FR |
| | cinnamyl formate | FL/FR |
| | clove bud oil | FL/FR |
| para-alpha- | dimethyl styrene | FL/FR |
| | elettaria cardamomum seed oil | FL/FR |
| | eugenol | FL/FR |
| iso | eugenyl acetate | FL/FR |
| | galanga flavor | FL |
| | galangal root oleoresin | FL |
| | ginger root oil brazil | FL/FR |
| | ginger root oil china | FL/FR |
| | ginger root oil cochin | FL/FR |
| 2- | methoxy-4-vinyl phenol | FL/FR |
| alpha- | methyl cinnamaldehyde | FL/FR |
| | methyl cinnamate | FL/FR |
| | nutmeg absolute | FL/FR |
| | nutmeg oil | FL/FR |
| | nutmeg oil CO2 extract | FL/FR |
| black | pepper oil | FL/FR |
| 3- | phenyl propyl alcohol | FL/FR |
| | spicy acetoacetate | FL/FR |
| | turmeric oleoresin | FL |
| sweet |
| | orris rhizome absolute (iris pallida) | FL/FR |
| terpenic |
| | juniperus communis fruit oil | FL/FR |
| gamma- | terpinene | FL/FR |
| alpha- | terpinene | FL/FR |
| tropical |
| alpha- | amyl cinnamaldehyde | FL/FR |
| vanilla |
| | ethyl vanillin | FL/FR |
| | vanilla bean absolute (vanilla planifolia) | FL/FR |
| | vanillyl acetate | FL/FR |
| waxy |
| | decyl acetate | FL/FR |
| | ethyl laurate | FL/FR |
| alpha- | hexyl cinnamaldehyde | FL/FR |
| | hydroxycitronellal | FL/FR |
| woody |
| | ambrette seed absolute | FL/FR |
| | amyris wood oil | FL/FR |
| iso | bornyl acetate | FL/FR |
| iso | bornyl formate | FL/FR |
| | cadinene | FL/FR |
| | cistus twig/leaf oil | FL/FR |
| | cistus twig/leaf oil molecular distilled | FL/FR |
| | copaiba balsam | FL/FR |
| | dihydro-beta-ionone | FL/FR |
| | frankincense gum | FL/FR |
| | frankincense oil | FL/FR |
| | frankincense oil CO2 extract | FL/FR |
| | guaiacwood oil | FL/FR |
| | guaiene | FL/FR |
| | juniper berry oil terpeneless | FL/FR |
| | methyl cedryl ketone | FL/FR |
| | patchouli essence | FL/FR |
| | patchouli oil | FL/FR |
| terpeneless | patchouli oil | FL/FR |
| | patchouli oil china | FL/FR |
| | patchouli oil CO2 extract | FL/FR |
| | patchouli oil decolorized | FL/FR |
| alpha- | pinene | FL/FR |
| | sabinene | FL/FR |
| | safranal | FL/FR |
| | sandalwood oil | FL/FR |
| | spruce needle oil canada | FL/FR |
| | thuja occidentalis leaf oil | FL/FR |
| | vetiver oil haiti | FL/FR |
| | vetiverol | FL/FR |
| | yerba mate concentrate | FL |
| |
Potential Uses:
Occurrence (nature, food, other): note
Synonyms:
| | patchouli essential oil MD | | | patchouli indo molecular EO | | | patchouli MD essential oil | | | patchouli oil decolourised M.D. | | | patchouli oil indonesia MD | | | patchouli oil m/d | | | patchouli oil MD | | | patchouli oil molecular distilled | | | patchouly EO sumatra MD | | | patchouly oil MD colorless | | | pogostemon cablin oil molecular distilled | | | pogostemon patchouli oil molecular distilled | | | tilam wangi oil molecular distilled |
Articles:
|