|
Category: flavor and fragrance agents
US / EU / FDA / JECFA / FEMA / FLAVIS / Scholar / Patent Information:
Physical Properties:
| Food Chemicals Codex Listed: | No |
Organoleptic Properties:
| |
| Odor Type: woody |
| |
| Odor Strength: | medium |
| |
| | patchouli |
Odor Description:
at 100.00 %. | patchouli |
| |
| |
| Flavor Type: woody |
| |
| | patchouli |
Taste Description:
| patchouli |
| |
| Odor and/or flavor descriptions from others (if found). |
| |
| |
Cosmetic Information:
Suppliers:
Safety Information:
| |
| Hazards identification |
| |
| Classification of the substance or mixture |
| GHS Classification in accordance with 29 CFR 1910 (OSHA HCS) |
| None found. |
| GHS Label elements, including precautionary statements |
| |
| Pictogram | |
| |
| Hazard statement(s) |
| None found. |
| Precautionary statement(s) |
| None found. |
| Oral/Parenteral Toxicity: |
|
Not determined
|
| Dermal Toxicity: |
|
Not determined
|
| Inhalation Toxicity: |
|
Not determined
|
Safety in Use Information:
Safety References:
References:
Other Information:
| Export Tariff Code: | 3301.29.6000 |
| Wikipedia: | View |
Potential Blenders and core components note
| |
| For Odor |
| balsamic |
| | gurjun balsam | FR |
| earthy |
| 2- | ethyl fenchol | FL/FR |
| | pogostemon cablin leaf extract | FR |
| herbal |
| 1- | allyl-2,2,7,7-tetramethyl cycloheptanol | FR |
| | camphene carbinol | FR |
| | camphene carbinyl acetate | FR |
| | dimethyl cyclormol (IFF) | FR |
| | pine hexanol | FR |
| oily |
| | mcp acetate | FR |
| woody |
| para-tert- | butyl cyclohexanone | FR |
| | calarene epoxide | |
| alpha- | cedrene epoxide | FR |
| | cypriol oil (cyperus scariosus) | FR |
| | gurjun balsam oil | FR |
| 1,2,3,3,4,5,6- | heptamethyl bicyclo(2.2.2)oct-5-en-2-ol | |
| | herbal norbornane | FR |
| 5,5a,6,7,8,8a- | hexahydro-6,6,7,8,8-pentamethyl-4H-indeno[5,4-D]isoxazole | |
| (1R,4S,5S,9R)-1- | hydroxy-1,4,7,7,9-pentamethyl spiro(4.5)decan-2-one | |
| iso | longifolene ketone | FR |
| | manevoro oil | FR |
| delta- | methyl ionone | FL/FR |
| 2- | methyl-1-(5',5',6'-trimethyl bicyclo(2.2.1)hept-2'-yl) propan-2-ol | FR |
| | moss naphthaleneol | FR |
| | octahydro-3(or 2),4-dimethyl-4,7-methanoinden-5-ol | |
| | patchouli absolute | FR |
| | patchouli alcohol | FR |
| | patchouli ethanol | FR |
| | patchouli extract acetylated | FR |
| | patchouli fractions | FR |
| | patchouli fragrance | FR |
| | patchouli hexanol | FR |
| | patchouli leaf water | FR |
| terpeneless | patchouli oil | FL/FR |
| | patchouli oil | FL/FR |
| | patchouli oil china | FL/FR |
| | patchouli oil CO2 extract | FL/FR |
| | patchouli oil decolorized | FL/FR |
| | patchouli oil molecular distilled | FL/FR |
| | patchouli oil replacer | FR |
| | patchouli residues | FR |
| | patchouli specialty | FR |
| | patchouli woody amber fragrance | FR |
| | pinacol | FR |
| | pogostemon cablin leaf oil | FR |
| 2,6,10,10- | tetramethyl-1-oxa-spiro[4.5]dec-3-ene-6-ol | |
| 3(or 2),4,5- | trimethyl octahydro-4,7-methanoinden-5-ol | FR |
| | woody dodecane | FR |
| | woody epoxide | FR |
| | woody ether | FR |
| |
| For Flavor |
| |
| No flavor group found for these |
| | calarene epoxide | |
| 1,2,3,3,4,5,6- | heptamethyl bicyclo(2.2.2)oct-5-en-2-ol | |
| 5,5a,6,7,8,8a- | hexahydro-6,6,7,8,8-pentamethyl-4H-indeno[5,4-D]isoxazole | |
| (1R,4S,5S,9R)-1- | hydroxy-1,4,7,7,9-pentamethyl spiro(4.5)decan-2-one | |
| delta- | methyl ionone | FL/FR |
| | octahydro-3(or 2),4-dimethyl-4,7-methanoinden-5-ol | |
| 2,6,10,10- | tetramethyl-1-oxa-spiro[4.5]dec-3-ene-6-ol | |
| earthy |
| 2- | ethyl fenchol | FL/FR |
| woody |
| | patchouli oil | FL/FR |
| terpeneless | patchouli oil | FL/FR |
| | patchouli oil china | FL/FR |
| | patchouli oil CO2 extract | FL/FR |
| | patchouli oil decolorized | FL/FR |
| | patchouli oil molecular distilled | FL/FR |
| |
Potential Uses:
Occurrence (nature, food, other): noteSynonyms:
| | pogostemon patchouli essence |
Articles:
|