|
Category: flavor and fragrance agents
US / EU / FDA / JECFA / FEMA / FLAVIS / Scholar / Patent Information:
Physical Properties:
| Food Chemicals Codex Listed: | No |
| Shelf Life: | 24.00 month(s) or longer if stored properly. |
| Storage: | store in cool, dry place in tightly sealed containers, protected from heat and light. |
| Soluble in: |
| | alcohol |
| Insoluble in: |
| | water |
Organoleptic Properties:
| |
| Odor Type: woody |
| |
| | woody earthy spicy |
Odor Description: at 100.00 %. | woody earthy |
| |
| |
| Flavor Type: woody |
| |
| | patchouli |
Taste Description:
| patchouli |
| |
| Odor and/or flavor descriptions from others (if found). |
| |
| IFF |
| Healingwood |
| Odor Description: | The very heart of patchouli. Powerful woody, reminiscent of a humid cellar and moldy cork |
| Taste Description: | patchouli |
| |
| |
Cosmetic Information:
Suppliers:
Safety Information:
| |
| Hazards identification |
| |
| Classification of the substance or mixture |
| GHS Classification in accordance with 29 CFR 1910 (OSHA HCS) |
| None found. |
| GHS Label elements, including precautionary statements |
| |
| Pictogram | |
| |
| Hazard statement(s) |
| None found. |
| Precautionary statement(s) |
| None found. |
| Oral/Parenteral Toxicity: |
|
Not determined
|
| Dermal Toxicity: |
|
Not determined
|
| Inhalation Toxicity: |
|
Not determined
|
Safety in Use Information:
Safety References:
| EPA Substance Registry Services (TSCA): | 73049-67-9 |
| EPA ACToR: | Toxicology Data |
| EPA Substance Registry Services (SRS): | Registry |
| National Institute of Allergy and Infectious Diseases: | Data |
| | pogostemon cablin oil terpeneless |
| Chemidplus: | 0073049679 |
References:
| | pogostemon cablin oil terpeneless |
| Canada Domestic Sub. List: | 73049-67-9 |
| Pubchem (sid): | 135280607 |
Other Information:
Potential Blenders and core components note
| |
| For Odor |
| anise |
| | fennel fragrance | FR |
| balsamic |
| iso | bornyl formate | FL/FR |
| iso | bornyl isobutyrate | FL/FR |
| | copaiba balsam oil | FL/FR |
| dextro- | fenchone | FL/FR |
| | fir needle oil siberia | FL/FR |
| | gurjun balsam | FR |
| camphoreous |
| | fenchol | FL/FR |
| laevo- | fenchone | FL/FR |
| citrus |
| (E+Z)-4,8- | dimethyl-3,7-nonadien-2-yl acetate | FL/FR |
| earthy |
| 2- | ethyl fenchol | FL/FR |
| 3- | octen-2-one | FL/FR |
| | orris specialty | FR |
| | patchouli cyclohexanol | FR |
| | pogostemon cablin leaf extract | FR |
| floral |
| | bois de rose oil terpeneless | FL/FR |
| | geranium dihydropyran | FR |
| | orris fragrance | FR |
| | orris rhizome absolute replacer | FR |
| | ylang ylang flower oil III | FL/FR |
| green |
| iso | cyclocitral (IFF) | FL/FR |
| | decahydrocyclododecaoxazole | FR |
| | galbanum absolute | FL/FR |
| | lawsonia inermis leaf oil CO2 extract | FR |
| | oakmoss oil | FR |
| herbal |
| 1- | allyl-2,2,7,7-tetramethyl cycloheptanol | FR |
| | arnica flower absolute | FR |
| | camphene carbinol | FR |
| | camphene carbinyl acetate | FR |
| | chrysanthemum fragrance | FR |
| | dimethyl cyclormol (IFF) | FR |
| | fir needle oil replacer | FR |
| | guava leaf oil cuba | FR |
| | pine hexanol | FR |
| | rain forest specialty | FR |
| mossy |
| | oakmoss absolute color reduced | FL/FR |
| oily |
| | mcp acetate | FR |
| pine |
| | cypress oil replacer | FR |
| spicy |
| 4- | carvomenthenol | FL/FR |
| beta- | caryophyllene alcohol | FL/FR |
| alpha- | caryophyllene alcohol | FL/FR |
| | ginger oleoresin | FL/FR |
| | ginger root oil china | FL/FR |
| terpenic |
| | angelica seed oil | FL/FR |
| tropical |
| | patchwood | FR |
| woody |
| | briar wood fragrance | FR |
| para-tert- | butyl cyclohexanone | FR |
| | cadinene | FL/FR |
| | calarene epoxide | |
| alpha- | cedrene epoxide | FR |
| | cyperus root oil (cyperus scariosus) | FR |
| | cypriol oil (cyperus scariosus) | FR |
| | dihydro-beta-ionone | FL/FR |
| | dihydro-gamma-ionone | FL/FR |
| 3(or 2),4- | dimethyl-5-vinyl octahydro-4,7-methanoinden-5-ol | |
| | dogwood fragrance | FR |
| | dogwood specialty | FR |
| | dryopteris filix-mas oleoresin | FR |
| | germacrene B | |
| | gurjun balsam oil | FR |
| 1,2,3,3,4,5,6- | heptamethyl bicyclo(2.2.2)oct-5-en-2-ol | |
| | herbal norbornane | FR |
| 5,5a,6,7,8,8a- | hexahydro-6,6,7,8,8-pentamethyl-4H-indeno[5,4-D]isoxazole | |
| (1R,4S,5S,9R)-1- | hydroxy-1,4,7,7,9-pentamethyl spiro(4.5)decan-2-one | |
| iso | longifolene ketone | FR |
| | manevoro oil | FR |
| delta- | methyl ionone | FL/FR |
| 2- | methyl-1-(5',5',6'-trimethyl bicyclo(2.2.1)hept-2'-yl) propan-2-ol | FR |
| | moss naphthaleneol | FR |
| | octahydro-3(or 2),4-dimethyl-4,7-methanoinden-5-ol | |
| | octahydro-3(or 2),4-dimethyl-4,7-methanoinden-5-one | |
| | orris hexanone | FR |
| | patchouli absolute | FR |
| | patchouli alcohol | FR |
| | patchouli essence | FL/FR |
| | patchouli ethanol | FR |
| | patchouli extract acetylated | FR |
| | patchouli fractions | FR |
| | patchouli fragrance | FR |
| | patchouli hexanol | FR |
| | patchouli leaf water | FR |
| | patchouli oil | FL/FR |
| | patchouli oil china | FL/FR |
| | patchouli oil CO2 extract | FL/FR |
| | patchouli oil decolorized | FL/FR |
| | patchouli oil molecular distilled | FL/FR |
| | patchouli oil replacer | FR |
| | patchouli residues | FR |
| | patchouli specialty | FR |
| | patchouli woody amber fragrance | FR |
| | pelargonium radula oil | FR |
| | pinacol | FR |
| | pogostemon cablin leaf oil | FR |
| beta- | terpineol | FL/FR |
| 2,6,10,10- | tetramethyl-1-oxa-spiro[4.5]dec-3-ene-6-ol | |
| 3(or 2),4,5- | trimethyl octahydro-4,7-methanoinden-5-ol | FR |
| 3(or 2),4,5- | trimethyl-3a,4,5,6,7,7a-hexahydro-4,7-methanoinden-5-ol | |
| 1,3,5,7- | undecatetraene | FL/FR |
| | vetiver oil CO2 extract | FL/FR |
| | vetiver oil fractions | FR |
| | vetiver oil haiti | FL/FR |
| | vetiver oil haiti MD | FL/FR |
| | vetiveria zizanioides root oil | FL/FR |
| | woody dodecane | FR |
| | woody epoxide | FR |
| | woody ether | FR |
| |
| For Flavor |
| |
| No flavor group found for these |
| | calarene epoxide | |
| beta- | caryophyllene alcohol | FL/FR |
| alpha- | caryophyllene alcohol | FL/FR |
| | dihydro-gamma-ionone | FL/FR |
| (E+Z)-4,8- | dimethyl-3,7-nonadien-2-yl acetate | FL/FR |
| 3(or 2),4- | dimethyl-5-vinyl octahydro-4,7-methanoinden-5-ol | |
| | germacrene B | |
| 1,2,3,3,4,5,6- | heptamethyl bicyclo(2.2.2)oct-5-en-2-ol | |
| 5,5a,6,7,8,8a- | hexahydro-6,6,7,8,8-pentamethyl-4H-indeno[5,4-D]isoxazole | |
| (1R,4S,5S,9R)-1- | hydroxy-1,4,7,7,9-pentamethyl spiro(4.5)decan-2-one | |
| delta- | methyl ionone | FL/FR |
| | octahydro-3(or 2),4-dimethyl-4,7-methanoinden-5-ol | |
| | octahydro-3(or 2),4-dimethyl-4,7-methanoinden-5-one | |
| 3- | propyl pyridine | FL |
| beta- | terpineol | FL/FR |
| 2,6,10,10- | tetramethyl-1-oxa-spiro[4.5]dec-3-ene-6-ol | |
| 3(or 2),4,5- | trimethyl-3a,4,5,6,7,7a-hexahydro-4,7-methanoinden-5-ol | |
| 1,3,5,7- | undecatetraene | FL/FR |
| | vitispirane | FL |
| amber |
| | angelica seed oil | FL/FR |
| balsamic |
| iso | bornyl isobutyrate | FL/FR |
| | copaiba balsam oil | FL/FR |
| | fir needle oil siberia | FL/FR |
| camphoreous |
| | fenchol | FL/FR |
| laevo- | fenchone | FL/FR |
| cooling |
| 4- | carvomenthenol | FL/FR |
| dextro- | fenchone | FL/FR |
| creamy |
| 3- | octen-2-one | FL/FR |
| earthy |
| 2- | ethyl fenchol | FL/FR |
| floral |
| | bois de rose oil terpeneless | FL/FR |
| | ylang ylang flower oil III | FL/FR |
| green |
| iso | cyclocitral (IFF) | FL/FR |
| | galbanum absolute | FL/FR |
| herbal |
| | oregano oleoresin | FL |
| mossy |
| | oakmoss absolute color reduced | FL/FR |
| spicy |
| | ginger oleoresin | FL/FR |
| | ginger root oil china | FL/FR |
| | turmeric oleoresin | FL |
| woody |
| iso | bornyl formate | FL/FR |
| | cadinene | FL/FR |
| | dihydro-beta-ionone | FL/FR |
| | patchouli essence | FL/FR |
| | patchouli oil | FL/FR |
| | patchouli oil china | FL/FR |
| | patchouli oil CO2 extract | FL/FR |
| | patchouli oil decolorized | FL/FR |
| | patchouli oil molecular distilled | FL/FR |
| | vetiver oil CO2 extract | FL/FR |
| | vetiver oil haiti | FL/FR |
| | vetiver oil haiti MD | FL/FR |
| | vetiveria zizanioides root oil | FL/FR |
| |
Potential Uses:
Occurrence (nature, food, other): note
Synonyms:
| | healing wood (IFF) | | | healingwood (IFF) | | | patchouli oil terpeneless | | | pogostemon cablin oil terpeneless | | | pogostemon patchouli oil terpeneless |
Articles:
|