|
Category: flavor and fragrance agents
US / EU / FDA / JECFA / FEMA / FLAVIS / Scholar / Patent Information:
Physical Properties:
| Appearance: | brownish orange reddish clear oily liquid (est) |
| Food Chemicals Codex Listed: | No |
| Specific Gravity: | 0.95000 to 0.97500 @ 25.00 °C.
|
| Pounds per Gallon - (est).: | 7.905 to 8.113
|
| Specific Gravity: | 0.95300 to 0.97800 @ 20.00 °C.
|
| Pounds per Gallon - est.: | 7.939 to 8.147
|
| Refractive Index: | 1.50700 to 1.51500 @ 20.00 °C.
|
| Optical Rotation: | -48.00 to -65.00
|
| Boiling Point: | 287.00 °C. @ 760.00 mm Hg
|
| Flash Point: | 190.00 °F. TCC ( 87.78 °C. )
|
| Shelf Life: | 36.00 month(s) or longer if stored properly. |
| Storage: | store in cool, dry place in tightly sealed containers, protected from heat and light. |
| Soluble in: |
| | alcohol | | | fixed oils | | | paraffin oil | | | water, 42.87 mg/L @ 25 °C (est) |
| Insoluble in: |
| | water | | | glycerin |
| Stability: |
| | bath foam | | | cream | | | hair spray | | | lipstick | | | powder | | | shampoo | | | soap |
Organoleptic Properties:
| |
| Odor Type: woody |
| |
| Odor Strength: | medium |
| |
| Substantivity: | 400 hour(s) at 100.00 % |
| |
| | woody woody old wood dry earthy weedy balsamic spicy minty |
Odor Description: at 100.00 %. | woody old wood dry earthy weedy balsamic spicy minty Luebke, William tgsc, (2017) |
| |
| |
| Flavor Type: woody |
| |
| | woody earthy weedy balsamic spicy camphoreous |
Taste Description:
| woody earthy weedy balsamic spicy camphoreous Luebke, William tgsc, (2017) |
| |
| Odor and/or flavor descriptions from others (if found). |
| |
| IFF |
| Patchouli Heart N.3 |
| Odor Description: | Woody patchouli with a clean camphor top note developing into a slightly smoky earth tone and a fruity apple twist |
| Taste Description: | woody earthy weedy balsamic spicy camphoreous |
| |
| IFF |
| Patchouli Oil Indonesia For Life |
| Odor Description: | A very clean and elegant patchouli, woody, earthy, minty, camphor with a liquorice twist |
| Taste Description: | woody earthy weedy balsamic spicy camphoreous |
| |
| IFF |
| Patchouli Oil Redist |
| Odor Description: | Woody warm patchouli profile, with a clean camphor note and an almost floral liquorice impression |
| Taste Description: | woody earthy weedy balsamic spicy camphoreous |
| |
| |
Cosmetic Information:
Suppliers:
| Absolute Cosmetic Essentials |
| Organic Patchouli
|
| Aditi Essentials |
| Patchouli Oil (Pogostemon cabli)
Odor: characteristic Use: On the skin, the Patchouli oil is one of the most active and is a superb tissue regenerator, which helps to stimulate the growth of new skin cells. It is found to be very effective in sorting out rough, cracked and overly dehydrated skin and is used to treat acne, acne, eczema, sores, ulcers, any fungal infections, as well as scalp disorders. |
| Albert Vieille SAS |
| Patchouli Essential oil Indonesia
Odor: characteristic Use: Native to Indonesia, patchouli is an evergreen subshrub that thrives in fertile, shaded soil. It has an upright shape that resembles mint and the two plants are of the same botanical family. The long stems bear large, velvety, oval leaves, which harbor the plant’s fragrance. The name is of Indian origin and is a nod to the peculiar foliage: “patchouli” comes from the Tamil patch which means “green,” and ilai which means “leaf.” The scent of patchouli was discovered in the West in the early 19th century, when it was used to scent cashmere shawls imported from India and Indonesia – the smell was considered proof of the genuine Eastern origin of the goods. It was not until 1844, when the first shipment of patchouli leaves arrived in London, that the sought-after secret of this mysterious fragrance was revealed. Patchouli became the olfactory emblem of the hippie movement of the Sixties, having a sensual, carefree quality. |
| Harvest Calendar |
| Albert Vieille SAS |
| Patchouli heart Essential oil Indonesia
Odor: more powerfully woody and earthy, as well as nobler Use: Patchouli, an evergreen subshrub, is a tropical aromatic plant that thrives in the rich, shady soil of its native land of Indonesia. Along its upright stems are large, velvety green leaves containing the precious fragrance of patchouli. The name even honors the foliage: “patchouli” comes from the Tamil patch which means “green” and ilai which means “leaf.” The essential oil accumulates in the leaves’ secretory glands, principally in the young leaves, meaning that only the more recent above-ground portions of the plant are harvested for extraction, providing better yield during distillation and letting the plants regenerate faster. Patchouli heart is obtained after traditional patchouli essential oil has undergone rectification. This method is used to enrich the extract’s patchoulol content, the molecule responsible for the characteristic patchouli odor. This scent of the heart is therefore more powerfully woody and earthy, as well as nobler. |
| Ambles Nature et Chimie |
| PATCHOULI
|
| Anhui Haibei |
| Patchouli Oil
Odor: Camphoraceous and woody undertones |
| Aromatic and Allied Chemicals |
| Organic Patchouli Oil
|
| Aromatic and Allied Chemicals |
| Patchouli Oil (Indian)
|
| Arora Aromatics |
| Patchouli - 75
Patchoulol 75% |
| Arora Aromatics |
| Patchouli Heart
Patchoulol 60% |
| Arora Aromatics |
| Patchouli Indian
|
| Artiste |
| Patchouli Oil
|
| Associate Allied Chemicals |
| Patchouli Oil Indonesia
|
| About |
| Astral Extracts |
| Patchouli Oil
|
| Augustus Oils |
| Patchouli Aromatherapy Oil
|
| Services |
| Augustus Oils |
| Patchouli Essential Oil
|
| Azelis UK |
| Organic Patchouli Oil Indonesia
|
| Berjé |
| Patchouli Oil Indonesian
|
| Media |
| Berjé |
| Patchouli Oil Organic
|
| Blue Pacific Flavors |
| Patchouli Oil
|
| Bontoux |
| PATCHOULI CRUDE ESSENTIAL OIL
|
| Bontoux |
| PATCHOULI PURECOEUR ESSENTIAL OIL
|
| Bristol Botanicals |
| Patchouli essential oil Pogostemon patchouli
|
| Camden-Grey Essential Oils |
| Patchouli essential oil, Bulk
Odor: characteristic Use: Its diuretic properties are useful in cases of fluid retention and cellulite. Well known to increase libido, considered an aphrodisiac. Relieves effects from insect bites, protects clothes from moths. It is known as a tissue regenerator which helps stimulate regrowth of skin cells and the forming of scar tissue. Heals rough, cracked skin. Useful for treating acne, eczema, fungal infections and scalp disorders including dandruff. Blends well with black pepper, clary sage, frankincense, geranium, lavender and myrrh. |
| Camden-Grey Essential Oils |
| Patchouli essential oil, wildcrafted
|
| Camden-Grey Essential Oils |
| Patchouli essential oil
Odor: characteristic Use: Patchouli provides a strong, earthy, smoky, spicy and musky scent. This EO is said to be antidepressant, antiseptic, aphrodisiac, astringent, deodorant, fungicide and insecticide. May cause loss of appetite. Its odor may be little too persistent for some people. Due to its strong astringent and cicatrisant properties, may be helpful for loose skin, especially after dieting, used in many anti-wrinkle products. |
| Charabot |
| Patchouli fraction oil
100% Pure & Natural, Kosher Odor: Woody, giving a more elegant tone and less earthy than the initial oil |
| Citrus and Allied Essences |
| Oil Patchouli East Indian (free from gurjun balsam)
|
| Market Report |
| Creatingperfume.com |
| Patchouli Essential Oil
|
| De Monchy Aromatics |
| Patchouli Oil Dark
|
| Dongguan Meiherb Biotech |
| Patchouli Leaf Oil
Odor: characteristic Use: Patchouli Leaf Oil is derived from a large evergreen perennial that is a member of the Labiatae family, and a close relative of mint,lavender and sage .Patchouli oil is extracted from the lightly fragrant leaves and the white, violet-marked flowers of the plant. It's a thick, light yellow or brown liquid, with a strong, musky-earthy and slightly sweet aroma, reminiscent of wet soil.For some, the potent fragrance of this oil is an acquired taste. |
| ECSA Chemicals |
| PATCHOULY OIL (DARK)
|
| ECSA TRADE THE MOST UPDATED FINANCIAL PUBLICATION ON THE WORLD OF CHEMISTRY |
| Elixens America |
| Patchouli Essential Oil - Dark Indonesia
100% Pure and Natural |
| Elixens America |
| Patchouli Oil India
Certified Organic |
| Ernesto Ventós |
| ORGANIC PATCHOULI OIL 872 INDESSO
Odor: WOODY, SWEET, BALSAMIC |
| Ernesto Ventós |
| PATCHOULI OIL INDONESIA
Odor: CAMPHORACEOUS AND WOODY UNDERTONES |
| Excellentia International |
| Patchouli Oil Dark
|
| F. P. Aromatics Singapore |
| Patchouli Oil
|
| Fine Fragrances Pvt Ltd |
| Patchouli Heart N.3 LMR
|
| Fine Fragrances Pvt Ltd |
| Patchoulol Sequiterenes
|
| Fleurchem |
| patchouli oil
|
| Frey + Lau |
| Patchouli Oil
Indonesia, China, India |
| Fuzhou Farwell |
| Patchouli Oil
|
| Gem Aromatics |
| Patchouli Oil
|
| George Uhe Company |
| Patchouli Oil
Available from Various Origins |
| Global Essence |
| Patchouli Oil Crude
|
| Global Essence |
| Patchouli Oil Dark
|
| Global Essence |
| Patchouli Oil
|
| Haldin International |
| Patchouli Dark
Odor: woody dry earthy balsamic spicy Use: The plant and oil have a number of claimed health benefits in herbal folklore and its scent is supposed to be relaxing. In Chinese medicine a decoction of the leaves is used with other drugs to treat nausea, vomiting, diarrhoea, colds and headache. In the Philippines an infusion of the leaves is taken to allay painful menstruation.
Pogostemon has a long history of use in Southern Asia and the Far East as incense, body and garment perfume and as a repellent of insects and leeches. Patchouli Oil, steam distilled from Pogostemon cablin leaves, is almost universally used as a fixing agent in perfumery. |
| HDDES Group |
| Patchouli Oil
Organic Odor: characteristic Use: The main process that is used to obtain oil from is the direct steam distillation of dried leaves from Pogostemon cablin and pogostemon patchouli belongs to the family of Lamiaceae in which it has a color orange to brownish- colored viscous liquid possessing a characteristics intensive sweet- herbaceous, aromatic-spicy and woody-balsamic odor and is extensively used in perfumery industry as an intensified ingredient by obtaining woody notes. In addition it uses as a valuable odour component in soaps, and detergents. |
| Hermitage Oils |
| Patchouli Essential Oil (45% Patchoulol)
Odor: characteristic Use: Adam Michael has this to say about Patchouli Essential Oil (45% Patchoulol) “This patchouli essential oil is sourced from the Indonesian province of Aceh, located at the northern end of Sumatra. Produced by steam distilling the leaves, light yellow in colour, of a pourable viscosity and containing 45% patchoulol which is also known as patchouli alcohol and of which is highly prized, being largely responsible for the heart of patchouli oils. The aroma is a refined balance of fresh, humus and cocoa mild notes and this material will find much use in modern floral, chypre, ambery and woody oriental notes. Highly recommended.” |
| Hermitage Oils |
| Patchouli Essential Oil DARK
Odor: characteristic Use: Adam Michael has this to say “This organic patchouli has a very full and complex aroma, warm throughout, rich, fruity, woody, creamy, balsamic, oriental sweet, with wine and dark floral qualities. aromatic qualities throughout I would better associate with aged patchouli – the smell is rich, sweet and exotic but softer, creamy, more tenacious and ultimately more stimulating. |
| IFF |
| Patchouli Heart N.3
Odor: Woody patchouli with a clean camphor top note developing into a slightly smoky earth tone and a fruity apple twist |
| IFF |
| Patchouli Oil Indonesia For Life
Odor: A very clean and elegant patchouli, woody, earthy, minty, camphor with a liquorice twist |
| IFF |
| Patchouli Oil Redist
Odor: Woody warm patchouli profile, with a clean camphor note and an almost floral liquorice impression |
| Indenta Group |
| Patchouli Oil
|
| India Essential Oils |
| Patchouli Oil
|
| Indukern F&F |
| PATCHOULI OIL INDONESIA IRON FREE
Odor: WOODY, SWEET, BALSAMIC |
| Indukern F&F |
| PATCHOULI OIL INDONESIA
Odor: WOODY, SWEET, BALSAMIC |
| Isobionics |
| Patchouli Oil
Odor: musky, earthy, exotic Use: Patchouli Oil is mainly used in fragrances
Isobionics Patchouli Oil is under development |
| Jiangyin Healthway |
| Patchouli oil 45%
|
| New functional food ingredients |
| Jiangyin Healthway |
| Patchouli Oil
|
| John Kellys (London) |
| Patchouli Oil Dark
|
| K.L. Koh Enterprise |
| PATCHOULI OIL
|
| Kanta Enterprises |
| Patchouli Indonesia Oil
|
| Lluch Essence |
| PATCHOULI DARK OIL
|
| Lluch Essence |
| PATCHOULI ORGANIC ESS. OIL
|
| Lluch Essence |
| PATCHOULI SUPER DARK OIL
|
| M&U International |
| Patchouli Oil Dark
|
| M&U International |
| Patchouli Oil, Kosher
|
| Mane |
| Patchouly Essential Oil
Odor: Woody Resinous Earthy Use: Patchouly, meaning green leaf in Tamoul, is a cultivated tropical plant whose leaves can be collected several times a year. The fresh plant, only slightly fragrant, needs to be dried in order to release its odorous molecules. For many centuries, this essence was used to perfume cashmere shawls in order to increase their value. |
| Mentha & Allied Products |
| Patchouli Oil
|
| Moellhausen |
| PATCHOULY EO 30% PA
|
| Moellhausen |
| PATCHOULY EO 32% PA
Odor: woody, warm, balsamic, earth Flavor: herbaceous, aromatic, green, cooked |
| Moellhausen |
| PATCHOULY OIL AROMATHERAPY
|
| Moellhausen |
| PATCHOULY OIL RECTIFIED
|
| Moellhausen |
| PATCHOULY OIL
|
| Natura Aromatik |
| Patchouli Oil
|
| Natural & Essential Oils |
| Patchouli Oil
|
| Noble Molecular Research |
| For experimental / research use only. |
| Patchouli Oil (all Grades)
|
| OQEMA |
| Patchouli Oil Dark
|
| Payand Betrand |
| atchouly Aceh PA 38 Oil Indonesia
|
| Payand Betrand |
| Patchouly Aceh PA 30 Oil Indonesia
|
| Payand Betrand |
| Patchouly Aceh PA 30 redistilled Oil France
|
| Payand Betrand |
| Patchouly Aceh PA 35 Oil Indonesia
|
| Payand Betrand |
| Patchouly Aceh PA 45 concentrated Oil France
|
| Penta International |
| PATCHOULI OIL
|
| PerfumersWorld |
| Patchouli Oil
Odor: old wood woody balsam weedy earthy rich herbaceous woody camphoraceous earthy Use: Blends-well-with - + Geranium +Pine Needle +Acetate Sylvestre +Neroli +Orris +Nitromusks labdanum vetiver sandalwood cedarwood oakmoss clove lavender rose neroli bergamot cassia myrrh opopanax clary sage oriental-type bases. |
| Phoenix Aromas & Essential Oils |
| Patchouli Oil
|
| Plants Power |
| Patchouli Oil Guatemala
Odor: earthy, sweet-herbaceous, woody-balsamic Use: Perfumery- including oriental bases, woody bases, fougeres and chypres. |
| Prinova |
| Patchouli Oil
|
| Prodasynth |
| PATCHOULI OIL, INDONESIA
Odor: CAMPHORACEOUS AND WOODY UNDERTONES |
| PT Mitra Ayu Adi Pratama |
| Patchouli Oil Java (PA 30, Acid 8)
|
| PT Mitra Ayu Adi Pratama |
| Patchouli Oil Sulawesi (PA 30, Acid 10)
|
| PT Mitra Ayu Adi Pratama |
| Patchouli Oil Sumatra (PA 32, Acid 4)
|
| PT. Nabateans Aromatic |
| Patchouli Oil
|
| Quimdis |
| BIO Patchouli Oil Sri Lanka
|
| Quimdis |
| Patchouli Dark Oil Indonesia
|
| R C Treatt & Co Ltd |
| Organic Patchouli Oil
|
| R C Treatt & Co Ltd |
| Patchouli Oil WONF
|
| R C Treatt & Co Ltd |
| Patchouli Oil
|
| Reincke & Fichtner |
| Patchouli Oil organic + NOP
|
| Reincke & Fichtner |
| Patchouli Oil
|
| Robertet |
| Patchouli Ess. oil (for fragrance)
|
| Seasons and Harvest / Crop calendar |
| Robertet |
| Patchouli fraction oil
100% Pure & Natural, Kosher Odor: Woody, giving a more elegant tone and less earthy than the initial oil |
| Robertet |
| PATCHOULI
Pure & Nat |
| Sigma-Aldrich |
| Patchouli oil, Certified organic (NOP)
|
| Certified Food Grade Products |
| Sigma-Aldrich |
| Patchouli oil
|
| Silverline Chemicals |
| Patchouli Oil
|
| SRS Aromatics |
| PATCHOULI HEART NO.3
|
| SRS Aromatics |
| PATCHOULI OIL INDONESIAN IRON FREE
|
| SRS Aromatics |
| PATCHOULI OIL REDISTILLED
|
| Sunaux International |
| Patchouli Oil
|
| Synthite Industries |
| Patchouli Oil
|
| E-books and Brochures |
| Taytonn ASCC |
| Patchouli Oil
Odor: Balsamic, Camphor/ Camphoraceous, Herbal/ Herbaceous, Spicy, Sweet, Woody |
| Taytonn ASCC |
| Patchouly Oil Indonesia Iron Free
|
| Taytonn ASCC |
| Patchouly Oil Indonesia Md
|
| The Good Scents Company |
| patchouli oil
Odor: woody old wood dry earthy weedy balsamic spicy minty |
| The John D. Walsh Company |
| Patchouli Oil, Dark
|
| The Lebermuth Company |
| Patchouli Indonesian Oil
Odor: Camphoraceous, woody |
| Spring/Summer 2022 Fragrance Trends |
| The Lebermuth Company |
| Patchouli Organic Oil
Odor: Woody, balsam, weedy, spicy |
| The Lermond Company |
| PATCHOULI HEART P&N - AV
|
| The Lermond Company |
| PATCHOULI OIL, DARK P&N
|
| The Lermond Company |
| PATCHOULI OIL, ORGANIC 95%
|
| The Lermond Company |
| PATCHOULI OIL, ORGANIC
|
| The Perfumers Apprentice |
| Patchouli - aged 5 years, Organic (J.Steele) Indonesia)
|
| The Perfumers Apprentice |
| Patchouli organic (Indonesia) J.Steele
|
| The Perfumers Apprentice |
| Patchouli
Odor: woody balsam weedy earthy spicy |
| The Perfumery |
| Patchouli Oil, Dark Indonesian
Odor: characteristic Use: This variety of Patchouli oil has a woody, smoky, earthy aroma. It's a good quality Patchouli that is very fresh, our darkest in color, and doesn't break the bank. It blends well with Ylang Ylang, Bergamot, and Frankincense. Patchouli oil is very popular in aromatherapy, as well as a popular additive to soaps and candles. |
| The Perfumery |
| Patchouli oil, Reserve Select, (Dark, Iron Distilled), India
Odor: characteristic Use: This variety of Patchouli oil is our best Patchouli with a high patchouli alcohol content. It's organoleptic profile is much better than typical Indonesian or Chinese Patchouli. Overall, the aroma is very woody, fresh, and characteristic. Patchouli oil is very popular in aromatherapy, as well as a popular additive to soaps and candles. |
| Ultra International |
| Patchouli Oil Dark Indonesia
|
| Crop Calendar |
| Ultra International |
| Patchouli Oil Indonesia
|
| Ungerer & Company |
| Patchouli Oil Amber
|
| Ungerer & Company |
| Patchouli Oil Dark
|
| Ungerer & Company |
| Patchouli Oil Organic
|
| Van Aroma |
| PATCHOULI OIL STANDARD DARK
|
| maps.vanaroma.com |
| Van Aroma |
| PATCHOULI OIL SULAWESI DARK 26%+ PA
|
| Van Aroma |
| PATCHOULI OIL SULAWESI DARK 28%+ PA
|
| Van Aroma |
| PATCHOULI OIL SULAWESI DARK 29%+ PA
|
| Van Aroma |
| PATCHOULI OIL SULAWESI DARK 29%+ PA
|
| Van Aroma |
| PATCHOULI OIL SULAWESI DARK 30%+ PA
|
| Van Aroma |
| PATCHOULI OIL SULAWESI DARK 30%+ PA
|
| Van Aroma |
| PATCHOULI OIL SUMATRA DARK 30%+ PA
|
| Van Aroma |
| PATCHOULI OIL SUMATRA DARK 32%+ PA
|
| Van Aroma |
| PATCHOULI OIL SUMATRA DARK 34+ PA
Odor: Sweet-herbaceous, aromatic-spicy and woody-balsamic |
| Vigon International |
| PATCHOULI DARK 100% PURE
|
| Vigon International |
| Patchouli Oil Dark
|
| Zanos |
| PATCHOULI ACEH
|
Safety Information:
| Preferred SDS: View |
| European information : |
| Most important hazard(s): | | Xi - Irritant |
R 36/38 - Irritating to skin and eyes. S 02 - Keep out of the reach of children. S 24/25 - Avoid contact with skin and eyes. S 26 - In case of contact with eyes, rinse immediately with plenty of water and seek medical advice. S 36 - Wear suitable protective clothing.
|
| |
| Hazards identification |
| |
| Classification of the substance or mixture |
| GHS Classification in accordance with 29 CFR 1910 (OSHA HCS) |
Aspiration hazard (Category 1), H304 Skin corrosion/irritation (Category 3), H316 Chronic aquatic toxicity (Category 2), H411
|
| GHS Label elements, including precautionary statements |
| |
| Pictogram |    |
| |
| Signal word | Warning |
| Hazard statement(s) |
H304 - May be fatal if swallowed and enters airways H316 - Causes mild skin irritation H411 - Toxic to aquatic life with long lasting effects
|
| Precautionary statement(s) |
P273 - Avoid release to the environment. P331 - Do NOT induce vomiting. P391 - Collect spillage. Hazardous to the aquatic environment P301 + P310 - IF SWALLOWED: Immediately call a POISON CENTER or doctor/physician. P405 - Store locked up. P501 - Dispose of contents/ container to an approved waste disposal plant.
|
| Oral/Parenteral Toxicity: |
oral-rat LD50 > 5000 mg/kg Food and Chemical Toxicology. Vol. 20, Pg. 791, 1982.
|
| Dermal Toxicity: |
skin-rabbit LD50 > 5000 mg/kg Food and Chemical Toxicology. Vol. 20, Pg. 791, 1982.
|
| Inhalation Toxicity: |
|
Not determined
|
Safety in Use Information:
| Category: | flavor and fragrance agents |
| RIFM Fragrance Material Safety Assessment: Search |
| IFRA Code of Practice Notification of the 49th Amendment to the IFRA Code of Practice |
| Recommendation for patchouli oil usage levels up to: | | | 10.0000 % in the fragrance concentrate.
|
| |
| Use levels for FEMA GRAS flavoring substances on which the FEMA Expert Panel based its judgments that the substances are generally recognized as safe (GRAS). |
| The Expert Panel also publishes separate extensive reviews of scientific information on all FEMA GRAS flavoring substances and can be found at FEMA Flavor Ingredient Library |
| publication number: 3 |
| Click here to view publication 3 |
| | average usual ppm | average maximum ppm |
| baked goods: | - | 10.00000 |
| beverages(nonalcoholic): | - | 0.88000 |
| beverages(alcoholic): | - | - |
| breakfast cereal: | - | - |
| cheese: | - | - |
| chewing gum: | 43.00000 | 220.00000 |
| condiments / relishes: | - | - |
| confectionery froastings: | - | - |
| egg products: | - | - |
| fats / oils: | - | - |
| fish products: | - | - |
| frozen dairy: | - | 1.10000 |
| fruit ices: | - | 1.10000 |
| gelatins / puddings: | - | - |
| granulated sugar: | - | - |
| gravies: | - | - |
| hard candy: | - | 6.30000 |
| imitation dairy: | - | - |
| instant coffee / tea: | - | - |
| jams / jellies: | - | - |
| meat products: | - | - |
| milk products: | - | - |
| nut products: | - | - |
| other grains: | - | - |
| poultry: | - | - |
| processed fruits: | - | - |
| processed vegetables: | - | - |
| reconstituted vegetables: | - | - |
| seasonings / flavors: | - | - |
| snack foods: | - | - |
| soft candy: | - | - |
| soups: | - | - |
| sugar substitutes: | - | - |
| sweet sauces: | - | - |
Safety References:
References:
Other Information:
Potential Blenders and core components note
| |
| For Odor |
| No odor group found for these |
| 2- | methyl-3-isobutyl quinoxaline | |
|
| (E)- | sabinene hydrate | FL/FR |
| aldehydic |
| | dodecanal (aldehyde C-12 lauric) | FL/FR |
| amber |
| | amber acetate | FR |
| | amber cyclohexanol | FR |
| | amber oxepin | FR |
| | amber spirolene | FR |
| | ambergris tincture | FL/FR |
| | ambrette seed absolute | FL/FR |
| | ambrette seed oil | FL/FR |
| alpha- | ambrinol | FL/FR |
| | angelica root oil | FL/FR |
| | cistus ladaniferus resinoid | FL/FR |
| | labdanum oil | FL/FR |
| | labdanum oil replacer | FR |
| | labdanum resinoid replacer | FR |
| animal |
| | ambergris tincture replacer | FR |
| | animal carbolactone | FR |
| | costus valerolactone | FR |
| | indole | FL/FR |
| anisic |
| para- | anisaldehyde | FL/FR |
| para- | anisyl phenyl acetate | FL/FR |
| balsamic |
| iso | amyl benzoate | FL/FR |
| | amyris wood oil | FL/FR |
| sumatra | benzoin absolute | FL/FR |
| siam | benzoin absolute | FL/FR |
| | benzoin absolute replacer | FL/FR |
| siam | benzoin resin | FL/FR |
| sumatra | benzoin resinoid | FL/FR |
| siam | benzoin resinoid | FL/FR |
| 1- | benzoyl acetone | FL/FR |
| | benzyl benzoate | FL/FR |
| | benzyl salicylate | FL/FR |
| (E)- | benzyl tiglate | FL/FR |
| dextro,laevo-iso | borneol | FL/FR |
| dextro,laevo- | borneol | FL/FR |
| laevo- | bornyl acetate | FL/FR |
| iso | bornyl acetate | FL/FR |
| iso | bornyl formate | FL/FR |
| iso | bornyl isobutyrate | FL/FR |
| | brachyleana hutchinsii wood oil | FR |
| iso | butyl cinnamate | FL/FR |
| | cinnamyl alcohol | FL/FR |
| | cinnamyl formate | FL/FR |
| | conifer acetate | FR |
| | copaiba balsam oil | FL/FR |
| | ethyl cinnamate | FL/FR |
| dextro- | fenchone | FL/FR |
| | fir balsam absolute | FR |
| | fir needle oil canada | FL/FR |
| | fir needle oil siberia | FL/FR |
| | fir needle oil terpeneless canada | FL/FR |
| | guaiacyl phenyl acetate | FL/FR |
| | guaiyl butyrate | FR |
| | gurjun balsam | FR |
| | hemlock western oil (tsuga heterophylla) canada | FR |
| | juniper berry absolute | FL/FR |
| | juniper berry oil terpeneless | FL/FR |
| | methyl cinnamate | FL/FR |
| | myrrh absolute | FL/FR |
| | myrrh oil | FL/FR |
| | myrrh resinoid | FR |
| | opoponax oil (balsamodendron kafal) | FL/FR |
| 3- | phenyl propyl alcohol | FL/FR |
| | tolu balsam absolute | FL/FR |
| | tolu balsam resinoid | FL/FR |
| berry |
| | raspberry ketone methyl ether | FL/FR |
| bitter |
| | gentian absolute | FL/FR |
| camphoreous |
| | fenchol | FL/FR |
| caramellic |
| | immortelle absolute | FL/FR |
| citrus |
| | bergamot oil | FL/FR |
| 2- | cyclohexyl-4-methyl-1,3-oxathiane | |
| (E+Z)-4,8- | dimethyl-3,7-nonadien-2-yl acetate | FL/FR |
| bitter | orange peel oil | FL/FR |
| coconut |
| gamma- | heptalactone | FL/FR |
| gamma- | nonalactone (aldehyde C-18 (so-called)) | FL/FR |
| earthy |
| | cabralea cangerana root bark oil | FR |
| 2- | ethyl fenchol | FL/FR |
| (-)-alpha- | fenchol | FL/FR |
| 2- | octanone | FL/FR |
| scotch | pine needle oil | FL/FR |
| scotch | pine needle oil estonia | FL/FR |
| scotch | pine needle oil yugoslavia | FL/FR |
| | pogostemon cablin leaf extract | FR |
| floral |
| alpha- | amyl cinnamaldehyde | FL/FR |
| | cyclohexyl ethyl alcohol | FL/FR |
| | dihydro-alpha-ionone | FL/FR |
| | dihydrojasmone | FL/FR |
| | floral pyranol | FR |
| | floral undecenone | FR |
| | heliotropin | FL/FR |
| | heliotropyl acetone | FL/FR |
| alpha- | hexyl cinnamaldehyde | FL/FR |
| | ho leaf oil | FR |
| | hydroxycitronellal | FL/FR |
| iso | jasmone | FL/FR |
| | lavender absolute replacer | FR |
| | lavender oil | FL/FR |
| | lavender oil replacer | FR |
| laevo- | linalool | FL/FR |
| | linalool oxide | FL/FR |
| para- | methyl acetophenone | FL/FR |
| | methyl dihydrojasmonate | FL/FR |
| | nerolidol | FL/FR |
| | orris pyridine 25% IPM | FR |
| | orris rhizome absolute (iris pallida) | FL/FR |
| | palmarosa oil | FL/FR |
| | phenethyl alcohol | FL/FR |
| | phenethyl phenyl acetate | FL/FR |
| | phenethyl salicylate | FL/FR |
| | primrose fragrance | FR |
| | rose absolute (rosa centifolia) morocco | FL/FR |
| | rose absolute (rosa damascena) bulgaria | FL/FR |
| | rose carboxylate | FR |
| | tuberose absolute chassis | FL/FR |
| fruity |
| | allyl cinnamate | FL/FR |
| 1-(3,3- | dimethyl bicyclo(2.2.1)hept-2-yl)-2-methyl cyclohex-3-ene carbaldehyde | FR |
| alpha- | ionyl ethyl ether | |
| | valeriana officinalis root extract | FL/FR |
| green |
| iso | amyl formate | FL/FR |
| iso | cyclocitral (IFF) | FL/FR |
| | fern absolute | |
| | galbanum absolute | FL/FR |
| | galbanum oil | FL/FR |
| | galbanum oleoresin | FL/FR |
| | galbanum resinoid | FL/FR |
| | galbascone (IFF) | FR |
| | methyl cyclocitrone (IFF) | FR |
| | oakmoss oil | FR |
| 2- | propenyl-para-cymene | FR |
| | seaweed absolute (fucus vesiculosus et serratus) | FL/FR |
| | valerian rhizome oil CO2 extract china | FL/FR |
| | violet leaf absolute | FL/FR |
| hay |
| | hay absolute | FR |
| herbal |
| 1- | allyl-2,2,7,7-tetramethyl cycloheptanol | FR |
| | camphene carbinol | FR |
| | camphene carbinyl acetate | FR |
| | canarium luzonicum gum | FL/FR |
| | clary sage oil france | FL/FR |
| | clary specialty | FR |
| | dimethyl cyclormol (IFF) | FR |
| | herbal carene | FR |
| 6- | hydroxydihydrotheaspirane (mixture of isomers) | FL/FR |
| abrialis | lavandin oil | FL/FR |
| | lavandin water absolute | FL/FR |
| | lavender absolute bulgaria | FL/FR |
| | lavender absolute france | FL/FR |
| | lavender fragrance | FR |
| | lavender specialty | FR |
| | nopyl acetate | FR |
| | pine hexanol | FR |
| beta- | pinene | FL/FR |
| laevo-beta- | pinene | FL/FR |
| alpha- | pinene | FL/FR |
| | rosemary absolute | FL/FR |
| | rosemary oil morocco | FL/FR |
| | rosemary oil spain | FL/FR |
| | safranal | FL/FR |
| | valerian rhizome oil | FL/FR |
| | valerian rhizome oil china | FL/FR |
| melon |
| | watermelon ketone | FR |
| minty |
| | methyl salicylate | FL/FR |
| mossy |
| | oakmoss absolute | FL/FR |
| | oakmoss distillates | FL/FR |
| | treemoss absolute | FR |
| | veramoss (IFF) | FR |
| musk |
| | dehydro beta-linalool | FL/FR |
| naphthyl |
| para- | methyl anisole | FL/FR |
| ortho- | methyl anisole | FL/FR |
| nutty |
| 2,3,5,6- | tetramethyl pyrazine | FL/FR |
| oily |
| | mcp acetate | FR |
| phenolic |
| para-alpha- | dimethyl styrene | FL/FR |
| powdery |
| para- | anisyl alcohol | FL/FR |
| | midnight passion fragrance | FR |
| resinous |
| | mastic absolute | FL/FR |
| spicy |
| | benzyl isoeugenol | FL/FR |
| 4- | carvomenthenol | FL/FR |
| beta- | caryophyllene | FL/FR |
| alpha- | caryophyllene alcohol | FL/FR |
| beta- | caryophyllene alcohol | FL/FR |
| | cassia bark oil china | FL/FR |
| | clove bud oil | FL/FR |
| | elettaria cardamomum seed oil | FL/FR |
| | eugenol | FL/FR |
| iso | eugenyl acetate | FL/FR |
| | ginger root oil brazil | FL/FR |
| | ginger root oil china | FL/FR |
| | ginger root oil cochin | FL/FR |
| 2- | methoxy-4-vinyl phenol | FL/FR |
| alpha- | methyl cinnamaldehyde | FL/FR |
| | nutmeg absolute | FL/FR |
| | nutmeg oil | FL/FR |
| | nutmeg oil CO2 extract | FL/FR |
| black | pepper oil | FL/FR |
| | spicy acetoacetate | FL/FR |
| terpenic |
| | cypress leaf oil | FR |
| | elemi resinoid | FL/FR |
| | frankincense oil | FL/FR |
| | juniperus communis fruit oil | FL/FR |
| | pine needle oil dwarf | FL/FR |
| gamma- | terpinene | FL/FR |
| alpha- | terpineol | FL/FR |
| thujonic |
| | armoise oil | FR |
| tonka |
| | coumarin | FR |
| | tonka bean absolute | FR |
| vanilla |
| | ethyl vanillin | FL/FR |
| | vanilla bean absolute (vanilla planifolia) | FL/FR |
| | vanillyl acetate | FL/FR |
| waxy |
| | decyl acetate | FL/FR |
| 1- | dodecanol | FL/FR |
| | ethyl laurate | FL/FR |
| woody |
| | agarwood oil | FR |
| | amber pentadecane | FR |
| | briar wood fragrance | FR |
| para-tert- | butyl cyclohexanone | FR |
| | cadinene | FL/FR |
| | calarene epoxide | |
| beta- | caryophyllene alcohol acetate | FL/FR |
| atlas | cedarwood absolute | FR |
| atlas | cedarwood oil | FR |
| | cedarwood oil alcohols | FL/FR |
| | cedrela wood oil | FR |
| alpha- | cedrene epoxide | FR |
| | cedrenyl acetate | FR |
| | cedrol methyl ether | FR |
| | cedryl methyl ether | FR |
| | cistus ladaniferus gum | FR |
| | cistus twig/leaf oil | FL/FR |
| | copaiba balsam | FL/FR |
| | cyperus root oil (cyperus scariosus) | FR |
| | cypriol oil (cyperus scariosus) | FR |
| 2- | decalinyl formate | FR |
| | dihydro-beta-ionone | FL/FR |
| | dogwood fragrance | FR |
| | dogwood specialty | FR |
| | germacrene B | |
| | guaiacwood oil | FL/FR |
| alpha- | guaiene | FL/FR |
| | guaiene | FL/FR |
| | gurjun balsam oil | FR |
| alpha- | gurjunene | FR |
| 1,2,3,3,4,5,6- | heptamethyl bicyclo(2.2.2)oct-5-en-2-ol | |
| | herbal norbornane | FR |
| 5,5a,6,7,8,8a- | hexahydro-6,6,7,8,8-pentamethyl-4H-indeno[5,4-D]isoxazole | |
| | hinoki root oil | FR |
| (1R,4S,5S,9R)-1- | hydroxy-1,4,7,7,9-pentamethyl spiro(4.5)decan-2-one | |
| 8- | hydroxy-5-isopropyl-8-methyl-non-6-en-2-one | |
| 4- | hydroxybenzaldehyde | FL/FR |
| | labdanum concrete | FR |
| | labdanum ethanone | FR |
| iso | longifolene ketone | FR |
| | louro brasileiro wood oil | FR |
| | manevoro oil | FR |
| para- | menth-3-en-1-ol | FL/FR |
| | methyl cedryl ketone | FL/FR |
| delta- | methyl ionone | FL/FR |
| | methyl vetivate | FR |
| 2- | methyl-1-(5',5',6'-trimethyl bicyclo(2.2.1)hept-2'-yl) propan-2-ol | FR |
| | moss naphthaleneol | FR |
| | octahydro-3(or 2),4-dimethyl-4,7-methanoinden-5-ol | |
| | orris hexanone | FR |
| | patchouli absolute | FR |
| | patchouli alcohol | FR |
| | patchouli essence | FL/FR |
| | patchouli ethanol | FR |
| | patchouli ethanone | FR |
| | patchouli extract acetylated | FR |
| | patchouli fractions | FR |
| | patchouli fragrance | FR |
| | patchouli hexanol | FR |
| | patchouli leaf water | FR |
| terpeneless | patchouli oil | FL/FR |
| | patchouli oil china | FL/FR |
| | patchouli oil CO2 extract | FL/FR |
| | patchouli oil decolorized | FL/FR |
| | patchouli oil molecular distilled | FL/FR |
| | patchouli oil replacer | FR |
| | patchouli residues | FR |
| | patchouli specialty | FR |
| | patchouli woody amber fragrance | FR |
| | pinacol | FR |
| | pogostemon cablin leaf oil | FR |
| | sabinene | FL/FR |
| | sandalwood oil | FL/FR |
| | sandalwood oil west australia (santalum spicatum) | FR |
| | santall | FR |
| | santalyl butyrate | FL/FR |
| | spruce needle oil canada | FL/FR |
| alpha- | terpinene | FL/FR |
| beta- | terpineol | FL/FR |
| 2,6,10,10- | tetramethyl-1-oxa-spiro[4.5]dec-3-ene-6-ol | |
| | thujopsis dolabrata wood oil | FR |
| | tobacarol (IFF) | FR |
| 3(or 2),4,5- | trimethyl octahydro-4,7-methanoinden-5-ol | FR |
| | vetiver oil haiti | FL/FR |
| | vetiverol | FL/FR |
| | woody dodecane | FR |
| | woody epoxide | FR |
| | woody ether | FR |
| | woody propanol | FR |
| |
| For Flavor |
| |
| No flavor group found for these |
| | allyl cinnamate | FL/FR |
| | ambergris tincture | FL/FR |
| 1- | benzoyl acetone | FL/FR |
| dextro,laevo- | borneol | FL/FR |
| delta- | cadinene | FL |
| | calarene epoxide | |
| beta- | caryophyllene alcohol | FL/FR |
| alpha- | caryophyllene alcohol | FL/FR |
| beta- | caryophyllene alcohol acetate | FL/FR |
| | cedarwood oil alcohols | FL/FR |
| | cistus ladaniferus resinoid | FL/FR |
| 2- | cyclohexyl-4-methyl-1,3-oxathiane | |
| | dehydro beta-linalool | FL/FR |
| (E+Z)-4,8- | dimethyl-3,7-nonadien-2-yl acetate | FL/FR |
| | fern absolute | |
| | fir needle oil canada | FL/FR |
| | gentian absolute | FL/FR |
| | germacrene B | |
| alpha- | guaiene | FL/FR |
| 1,2,3,3,4,5,6- | heptamethyl bicyclo(2.2.2)oct-5-en-2-ol | |
| 5,5a,6,7,8,8a- | hexahydro-6,6,7,8,8-pentamethyl-4H-indeno[5,4-D]isoxazole | |
| (1R,4S,5S,9R)-1- | hydroxy-1,4,7,7,9-pentamethyl spiro(4.5)decan-2-one | |
| 8- | hydroxy-5-isopropyl-8-methyl-non-6-en-2-one | |
| alpha- | ionyl ethyl ether | |
| para- | menth-3-en-1-ol | FL/FR |
| delta- | methyl ionone | FL/FR |
| | octahydro-3(or 2),4-dimethyl-4,7-methanoinden-5-ol | |
| scotch | pine needle oil | FL/FR |
| scotch | pine needle oil estonia | FL/FR |
| scotch | pine needle oil yugoslavia | FL/FR |
| laevo-beta- | pinene | FL/FR |
| (E)- | sabinene hydrate | FL/FR |
| | santalyl butyrate | FL/FR |
| | seaweed absolute (fucus vesiculosus et serratus) | FL/FR |
| beta- | terpineol | FL/FR |
| 2,6,10,10- | tetramethyl-1-oxa-spiro[4.5]dec-3-ene-6-ol | |
| amber |
| | ambrette seed oil | FL/FR |
| alpha- | ambrinol | FL/FR |
| | labdanum oil | FL/FR |
| animal |
| | indole | FL/FR |
| anisic |
| para- | anisyl phenyl acetate | FL/FR |
| balsamic |
| | benzoin absolute replacer | FL/FR |
| siam | benzoin resin | FL/FR |
| siam | benzoin resinoid | FL/FR |
| sumatra | benzoin resinoid | FL/FR |
| | benzyl benzoate | FL/FR |
| | benzyl salicylate | FL/FR |
| (E)- | benzyl tiglate | FL/FR |
| laevo- | bornyl acetate | FL/FR |
| iso | bornyl isobutyrate | FL/FR |
| iso | butyl cinnamate | FL/FR |
| | copaiba balsam oil | FL/FR |
| | ethyl cinnamate | FL/FR |
| | fir needle oil siberia | FL/FR |
| | fir needle oil terpeneless canada | FL/FR |
| | juniper berry absolute | FL/FR |
| | myrrh absolute | FL/FR |
| | myrrh oil | FL/FR |
| | opoponax oil (balsamodendron kafal) | FL/FR |
| | peru balsam | FL |
| | tolu balsam absolute | FL/FR |
| | tolu balsam resinoid | FL/FR |
| berry |
| | dihydro-alpha-ionone | FL/FR |
| | heliotropyl acetone | FL/FR |
| | raspberry ketone methyl ether | FL/FR |
| bitter |
| 2- | methyl-3-isobutyl quinoxaline | |
| camphoreous |
| dextro,laevo-iso | borneol | FL/FR |
| | fenchol | FL/FR |
| (-)-alpha- | fenchol | FL/FR |
| 6- | hydroxydihydrotheaspirane (mixture of isomers) | FL/FR |
| ortho- | methyl anisole | FL/FR |
| cherry |
| | heliotropin | FL/FR |
| citrus |
| | bergamot oil | FL/FR |
| laevo- | linalool | FL/FR |
| bitter | orange peel oil | FL/FR |
| alpha- | terpineol | FL/FR |
| coconut |
| gamma- | nonalactone (aldehyde C-18 (so-called)) | FL/FR |
| cooling |
| 4- | carvomenthenol | FL/FR |
| dextro- | fenchone | FL/FR |
| creamy |
| para- | anisaldehyde | FL/FR |
| 4- | hydroxybenzaldehyde | FL/FR |
| para- | methyl acetophenone | FL/FR |
| dairy |
| 2- | octanone | FL/FR |
| earthy |
| 2- | ethyl fenchol | FL/FR |
| floral |
| | dihydrojasmone | FL/FR |
| | methyl dihydrojasmonate | FL/FR |
| | phenethyl alcohol | FL/FR |
| | rose absolute (rosa centifolia) morocco | FL/FR |
| | rose absolute (rosa damascena) bulgaria | FL/FR |
| | tuberose absolute chassis | FL/FR |
| fruity |
| iso | amyl benzoate | FL/FR |
| para- | anisyl alcohol | FL/FR |
| | cherry guarana flavor | FL |
| | valerian rhizome oil | FL/FR |
| | valerian rhizome oil china | FL/FR |
| | valerian rhizome oil CO2 extract china | FL/FR |
| | valeriana officinalis root extract | FL/FR |
| grassy |
| | palmarosa oil | FL/FR |
| green |
| iso | amyl formate | FL/FR |
| | angelica root oil | FL/FR |
| | canarium luzonicum gum | FL/FR |
| | cinnamyl alcohol | FL/FR |
| iso | cyclocitral (IFF) | FL/FR |
| | cyclohexyl ethyl alcohol | FL/FR |
| | elemi resinoid | FL/FR |
| | galbanum absolute | FL/FR |
| | galbanum oil | FL/FR |
| | galbanum oleoresin | FL/FR |
| | galbanum resinoid | FL/FR |
| | immortelle absolute | FL/FR |
| iso | jasmone | FL/FR |
| | linalool oxide | FL/FR |
| | nerolidol | FL/FR |
| | oakmoss absolute | FL/FR |
| | violet leaf absolute | FL/FR |
| herbal |
| | clary sage oil france | FL/FR |
| abrialis | lavandin oil | FL/FR |
| | lavandin water absolute | FL/FR |
| | lavender absolute bulgaria | FL/FR |
| | lavender absolute france | FL/FR |
| | lavender oil | FL/FR |
| | rosemary absolute | FL/FR |
| | rosemary oil morocco | FL/FR |
| | rosemary oil spain | FL/FR |
| honey |
| | phenethyl phenyl acetate | FL/FR |
| lactonic |
| gamma- | heptalactone | FL/FR |
| medicinal, |
| | phenethyl salicylate | FL/FR |
| minty |
| | methyl salicylate | FL/FR |
| mossy |
| | oakmoss distillates | FL/FR |
| naphthyl |
| para- | methyl anisole | FL/FR |
| nutty |
| 2,3,5,6- | tetramethyl pyrazine | FL/FR |
| orris |
| | costus root oil | FL |
| phenolic |
| | guaiacyl phenyl acetate | FL/FR |
| 2- | hydroxyisophorone | FL |
| pine |
| | pine needle oil dwarf | FL/FR |
| beta- | pinene | FL/FR |
| resinous |
| | mastic absolute | FL/FR |
| soapy |
| | dodecanal (aldehyde C-12 lauric) | FL/FR |
| 1- | dodecanol | FL/FR |
| spicy |
| sumatra | benzoin absolute | FL/FR |
| siam | benzoin absolute | FL/FR |
| | benzyl isoeugenol | FL/FR |
| beta- | caryophyllene | FL/FR |
| | cassia bark oil china | FL/FR |
| | cinnamyl formate | FL/FR |
| | clove bud oil | FL/FR |
| para-alpha- | dimethyl styrene | FL/FR |
| | elettaria cardamomum seed oil | FL/FR |
| | eugenol | FL/FR |
| iso | eugenyl acetate | FL/FR |
| | galanga flavor | FL |
| | galangal root oleoresin | FL |
| | ginger root oil brazil | FL/FR |
| | ginger root oil china | FL/FR |
| | ginger root oil cochin | FL/FR |
| 2- | methoxy-4-vinyl phenol | FL/FR |
| alpha- | methyl cinnamaldehyde | FL/FR |
| | methyl cinnamate | FL/FR |
| | nutmeg absolute | FL/FR |
| | nutmeg oil | FL/FR |
| | nutmeg oil CO2 extract | FL/FR |
| black | pepper oil | FL/FR |
| 3- | phenyl propyl alcohol | FL/FR |
| | spicy acetoacetate | FL/FR |
| | turmeric oleoresin | FL |
| sweet |
| | orris rhizome absolute (iris pallida) | FL/FR |
| terpenic |
| | juniperus communis fruit oil | FL/FR |
| gamma- | terpinene | FL/FR |
| alpha- | terpinene | FL/FR |
| tropical |
| alpha- | amyl cinnamaldehyde | FL/FR |
| vanilla |
| | ethyl vanillin | FL/FR |
| | vanilla bean absolute (vanilla planifolia) | FL/FR |
| | vanillyl acetate | FL/FR |
| waxy |
| | decyl acetate | FL/FR |
| | ethyl laurate | FL/FR |
| alpha- | hexyl cinnamaldehyde | FL/FR |
| | hydroxycitronellal | FL/FR |
| woody |
| | ambrette seed absolute | FL/FR |
| | amyris wood oil | FL/FR |
| iso | bornyl acetate | FL/FR |
| iso | bornyl formate | FL/FR |
| | cadinene | FL/FR |
| | cistus twig/leaf oil | FL/FR |
| | copaiba balsam | FL/FR |
| | dihydro-beta-ionone | FL/FR |
| | frankincense oil | FL/FR |
| | guaiacwood oil | FL/FR |
| | guaiene | FL/FR |
| | juniper berry oil terpeneless | FL/FR |
| | methyl cedryl ketone | FL/FR |
| | patchouli essence | FL/FR |
| terpeneless | patchouli oil | FL/FR |
| | patchouli oil china | FL/FR |
| | patchouli oil CO2 extract | FL/FR |
| | patchouli oil decolorized | FL/FR |
| | patchouli oil molecular distilled | FL/FR |
| alpha- | pinene | FL/FR |
| | sabinene | FL/FR |
| | safranal | FL/FR |
| | sandalwood oil | FL/FR |
| | spruce needle oil canada | FL/FR |
| | vetiver oil haiti | FL/FR |
| | vetiverol | FL/FR |
| | yerba mate concentrate | FL |
| |
Potential Uses:
Occurrence (nature, food, other): note
Synonyms:
| | patchouli crude essential oil | | | patchouli ess nat 01 | | | patchouli ess. oil (for fragrance) (Robertet) | | | patchouli essential oil crude | | | patchouli fraction oil | | | patchouli heart | | | patchouli heart indonesia (Robertet) | | | patchouli heart n.3 (IFF) | | | patchouli indo EO | | | patchouli oil | | | patchouli oil amber | | | patchouli oil dark | | | patchouli oil indonesia | | | patchouli oil indonesia / papua new guinea organic | | | patchouli oil indonesia iron free | | | patchouli oil indonesian | | | patchouli oil organic | | | patchouli oil redist | | | patchouli oil, dark | | | patchouli purecoeur essential oil | | | patchouly EO | | | pogostemon cablin oil | | | pogostemon patchouli oil | | | tilam wangi oil | | | volatile oil obtained from the leaves of the patchouli, pogostemon cablin, labiatae |
Articles:
| PubMed: | A pharmacokinetic study of patchouli alcohol after a single oral administration of patchouli alcohol or patchouli oil in rats. |
| PubMed: | Synergistic effect of fragrant herbs in Japanese scent sachets. |
| PubMed: | Progressive regulation of sesquiterpene biosynthesis in Arabidopsis and Patchouli (Pogostemon cablin) by the miR156-targeted SPL transcription factors. |
| PubMed: | A multiresidue method for simultaneous determination of 44 organophosphorous pesticides in Pogostemon cablin and related products using modified QuEChERS sample preparation procedure and GC-FPD. |
| PubMed: | In vitro and in vivo antibacterial activity of Pogostone. |
| PubMed: | Progressive Regulation of Sesquiterpene Biosynthesis in Arabidopsis and Patchouli (Pogostemon cablin) by the miR156-Targeted SPL Transcription Factors. |
| PubMed: | Prevention of UV radiation-induced cutaneous photoaging in mice by topical administration of patchouli oil. |
| PubMed: | Characterisation of the metabolism of pogostone in vitro and in vivo using liquid chromatography with mass spectrometry. |
| PubMed: | Expression, purification and activity assay of a patchoulol synthase cDNA variant fused to thioredoxin in Escherichia coli. |
| PubMed: | Evaluation of the antibacterial activity of patchouli oil. |
| PubMed: | Antimicrobial and Herbal Drug Resistance in Enteric Bacteria Isolated from Faecal Droppings of Common House Lizard/Gecko (Hemidactylus frenatus). |
| PubMed: | Development and structure of internal glands and external glandular trichomes in Pogostemon cablin. |
| PubMed: | Screening of some essential oils against Trichosporon species. |
| PubMed: | Insecticidal activity of pogostone against Spodoptera litura and Spodoptera exigua (Lepidoptera: Noctuidae). |
| PubMed: | Antifungal effect of Allium tuberosum, Cinnamomum cassia, and Pogostemon cablin essential oils and their components against population of Aspergillus species. |
| PubMed: | Insecticidal and repellence activity of the essential oil of Pogostemon cablin against urban ants species. |
| PubMed: | Study on the grafting of chitosan-gelatin microcapsules onto cotton fabrics and its antibacterial effect. |
| PubMed: | Patchouli alcohol, an essential oil of Pogostemon cablin, exhibits anti-tumorigenic activity in human colorectal cancer cells. |
| PubMed: | Virtual screening of compounds from the patchouli oil of Pogostemon herba for COX-1 inhibition. |
| PubMed: | [Extraction and analysis of the essential oil in Pogostemon cablin by enzymatic hydrolysis and inhibitory activity against Hela cell proliferation]. |
| PubMed: | Quantitative and physical evaluation of patchouli essential oils obtained from different sources of Pogostemon cablin. |
| PubMed: | Secondary metabolites and antioxidant capacities of Waldheimia glabra (Decne.) Regel from Nepal. |
| PubMed: | Technology for efficient and successful delivery of vermicompost colonized bioinoculants in Pogostemon cablin (patchouli) Benth. |
| PubMed: | Selective separation of patchouli alcohol from the essential oil of Cablin potchouli by inclusion crystalline method. |
| PubMed: | Acaricidal activity of DHEMH, derived from patchouli oil, against house dust mite, Dermatophagoides farinae. |
| PubMed: | Chemical constituents, antioxidant and antimocrobial activity of essential oil of Pogostemon paniculatus (Willd.). |
| PubMed: | Experimental study on anti-inflammatory activity of a TCM recipe consisting of the supercritical fluid CO2 extract of Chrysanthemum indicum, Patchouli Oil and Zedoary Turmeric Oil in vivo. |
| PubMed: | Volatile oil composition of Pogostemon heyneanus and comparison of its composition with patchouli oil. |
| PubMed: | [Identification method with significant specificity of volatile oil of Pogostemon cablin]. |
| PubMed: | Evaluation of the toxicity of 17 essential oils against Choristoneura rosaceana (Lepidoptera: Tortricidae) and Trichoplusia ni (Lepidoptera: Noctuidae). |
| PubMed: | Novel silicon-based patchouli odorants of the trialkyl(1-hydroxy-1-methylethyl)silane type: design, synthesis, and olfactory properties. |
| PubMed: | [Protective effect of Pogostemon cablin on membrane fluidity of intestinal epithelia cell in ischemia/ reperfusion rats after ischemia/reperfusion]. |
| PubMed: | [Effect of atractylodes rhizome oil and other volatile oils on percutaneous absorption of baicalin]. |
| PubMed: | Insecticidal properties of several essential oils on the house fly (Musca domestica L.). |
| PubMed: | Alpha-bulnesene, a PAF inhibitor isolated from the essential oil of Pogostemon cablin. |
| PubMed: | The diverse sesquiterpene profile of patchouli, Pogostemon cablin, is correlated with a limited number of sesquiterpene synthases. |
| PubMed: | GC-MS fingerprint of Pogostemon cablin in China. |
| PubMed: | Comparative repellency of 38 essential oils against mosquito bites. |
| PubMed: | Determination of patchoulic alcohol in Herba Pogostemonis by GC-MS-MS. |
| PubMed: | [Investigation on the influential factors of the volatile oil and main constituent content in Pogostemon cablin]. |
| PubMed: | [Study on purification technology of patchouly oil with molecular distillation]. |
| PubMed: | [Pharmacokinetics of patchouli alcohol and patchouli alcohol in patchouli oil after iv administrated to rats]. |
| PubMed: | Application of comprehensive two-dimensional gas chromatography-time-of-flight mass spectrometry in the analysis of volatile oil of traditional Chinese medicines. |
| PubMed: | Toxicity and repellency of patchouli oil and patchouli alcohol against Formosan subterranean termites Coptotermes formosanus Shiraki (Isoptera: Rhinotermitidae). |
| PubMed: | [Anti-Candida albicans activity of essential oils including Lemongrass (Cymbopogon citratus) oil and its component, citral]. |
| PubMed: | [Two chemotypes of Pogostemon cablin and influence of region of cultivation and harvesting time on volatile oil composition]. |
| PubMed: | [Constituents analysis on volatile oil of Pogostemon cablin from different collection time cultivated in Hainan]. |
| PubMed: | [DNA profiling of Pogostemon cablin chemotypes differing in essential oil composition]. |
| PubMed: | [GC-MS analysis of volatile oil of Herba Pogostemonis collected from Leizhou county]. |
| PubMed: | [GC-MS analysis of volatile oil of herba Pogostemonis collected from Gaoyao county]. |
| PubMed: | Effects of fragrance inhalation on sympathetic activity in normal adults. |
| PubMed: | Production of patchouli mild mosaic virus resistant patchouli plants by genetic engineering of coat protein precursor gene. |
| PubMed: | Regeneration of patchouli (Pogostemon cablin Benth.) plants from leaf and node callus, and evaluation after growth in the field. |
| PubMed: | Biosynthesis of the sesquiterpene patchoulol from farnesyl pyrophosphate in leaf extracts of Pogostemon cablin (patchouli): mechanistic considerations. |
|