|
Category: flavor and fragrance agents
US / EU / FDA / JECFA / FEMA / FLAVIS / Scholar / Patent Information:
Physical Properties:
| Appearance: | brownish orange reddish clear liquid (est) |
| Food Chemicals Codex Listed: | No |
| Specific Gravity: | 0.95000 to 0.97500 @ 25.00 °C.
|
| Pounds per Gallon - (est).: | 7.905 to 8.113
|
| Specific Gravity: | 0.95300 to 0.97800 @ 20.00 °C.
|
| Pounds per Gallon - est.: | 7.939 to 8.147
|
| Refractive Index: | 1.49900 to 1.51500 @ 20.00 °C.
|
| Optical Rotation: | -48.00 to -65.00
|
| Boiling Point: | 287.00 °C. @ 760.00 mm Hg
|
| Flash Point: | 190.00 °F. TCC ( 87.78 °C. )
|
| Shelf Life: | 36.00 month(s) or longer if stored properly. |
| Soluble in: |
| | alcohol | | | water, 42.87 mg/L @ 25 °C (est) |
| Insoluble in: |
| | water |
Organoleptic Properties:
| |
| Odor Type: woody |
| |
| Odor Strength: | medium |
| |
| Substantivity: | 400 hour(s) at 100.00 % |
| |
| | woody earthy |
Odor Description: at 100.00 %. | woody earthy |
| |
| |
| Flavor Type: woody |
| |
| | patchouli |
Taste Description:
| patchouli |
| |
| Odor and/or flavor descriptions from others (if found). |
| |
| |
Cosmetic Information:
Suppliers:
Safety Information:
| European information : |
| Most important hazard(s): | | Xi - Irritant |
R 36/38 - Irritating to skin and eyes. S 02 - Keep out of the reach of children. S 24/25 - Avoid contact with skin and eyes. S 26 - In case of contact with eyes, rinse immediately with plenty of water and seek medical advice. S 36 - Wear suitable protective clothing.
|
| |
| Hazards identification |
| |
| Classification of the substance or mixture |
| GHS Classification in accordance with 29 CFR 1910 (OSHA HCS) |
| None found. |
| GHS Label elements, including precautionary statements |
| |
| Pictogram | |
| |
| Hazard statement(s) |
| None found. |
| Precautionary statement(s) |
| None found. |
| Oral/Parenteral Toxicity: |
oral-rat LD50 > 5000 mg/kg Food and Chemical Toxicology. Vol. 20, Pg. 791, 1982.
|
| Dermal Toxicity: |
skin-rabbit LD50 > 5000 mg/kg Food and Chemical Toxicology. Vol. 20, Pg. 791, 1982.
|
| Inhalation Toxicity: |
|
Not determined
|
Safety in Use Information:
| Category: | flavor and fragrance agents |
| IFRA Code of Practice Notification of the 49th Amendment to the IFRA Code of Practice |
| Recommendation for patchouli oil china usage levels up to: | | | 10.0000 % in the fragrance concentrate.
|
| |
| Use levels for FEMA GRAS flavoring substances on which the FEMA Expert Panel based its judgments that the substances are generally recognized as safe (GRAS). |
| The Expert Panel also publishes separate extensive reviews of scientific information on all FEMA GRAS flavoring substances and can be found at FEMA Flavor Ingredient Library |
| publication number: 3 |
| Click here to view publication 3 |
| | average usual ppm | average maximum ppm |
| baked goods: | - | 10.00000 |
| beverages(nonalcoholic): | - | 0.88000 |
| beverages(alcoholic): | - | - |
| breakfast cereal: | - | - |
| cheese: | - | - |
| chewing gum: | 43.00000 | 220.00000 |
| condiments / relishes: | - | - |
| confectionery froastings: | - | - |
| egg products: | - | - |
| fats / oils: | - | - |
| fish products: | - | - |
| frozen dairy: | - | 1.10000 |
| fruit ices: | - | 1.10000 |
| gelatins / puddings: | - | - |
| granulated sugar: | - | - |
| gravies: | - | - |
| hard candy: | - | 6.30000 |
| imitation dairy: | - | - |
| instant coffee / tea: | - | - |
| jams / jellies: | - | - |
| meat products: | - | - |
| milk products: | - | - |
| nut products: | - | - |
| other grains: | - | - |
| poultry: | - | - |
| processed fruits: | - | - |
| processed vegetables: | - | - |
| reconstituted vegetables: | - | - |
| seasonings / flavors: | - | - |
| snack foods: | - | - |
| soft candy: | - | - |
| soups: | - | - |
| sugar substitutes: | - | - |
| sweet sauces: | - | - |
Safety References:
References:
Other Information:
Potential Blenders and core components note
| |
| For Odor |
| No odor group found for these |
| (E)- | sabinene hydrate | FL/FR |
| aldehydic |
| | dodecanal (aldehyde C-12 lauric) | FL/FR |
| amber |
| | amber oxepin | FR |
| | ambrette seed oil | FL/FR |
| | angelica root oil | FL/FR |
| | cistus ladaniferus resinoid | FL/FR |
| animal |
| | animal carbolactone | FR |
| | costus valerolactone | FR |
| | indole | FL/FR |
| anisic |
| para- | anisaldehyde | FL/FR |
| para- | anisyl phenyl acetate | FL/FR |
| balsamic |
| iso | amyl benzoate | FL/FR |
| | amyris wood oil | FL/FR |
| siam | benzoin absolute | FL/FR |
| siam | benzoin resinoid | FL/FR |
| 1- | benzoyl acetone | FL/FR |
| | benzyl benzoate | FL/FR |
| | benzyl salicylate | FL/FR |
| dextro,laevo- | borneol | FL/FR |
| iso | bornyl acetate | FL/FR |
| laevo- | bornyl acetate | FL/FR |
| iso | bornyl formate | FL/FR |
| iso | bornyl isobutyrate | FL/FR |
| | brachyleana hutchinsii wood oil | FR |
| iso | butyl cinnamate | FL/FR |
| | cinnamyl alcohol | FL/FR |
| | conifer acetate | FR |
| | ethyl cinnamate | FL/FR |
| dextro- | fenchone | FL/FR |
| | fir balsam absolute | FR |
| | fir needle oil canada | FL/FR |
| | fir needle oil siberia | FL/FR |
| | fir needle oil terpeneless canada | FL/FR |
| | guaiacyl phenyl acetate | FL/FR |
| | guaiyl butyrate | FR |
| | gurjun balsam | FR |
| | hemlock western oil (tsuga heterophylla) canada | FR |
| | juniper berry absolute | FL/FR |
| | methyl cinnamate | FL/FR |
| | myrrh absolute | FL/FR |
| | myrrh oil | FL/FR |
| | myrrh resinoid | FR |
| | opoponax oil (balsamodendron kafal) | FL/FR |
| 3- | phenyl propyl alcohol | FL/FR |
| | tolu balsam absolute | FL/FR |
| | tolu balsam resinoid | FL/FR |
| berry |
| | raspberry ketone methyl ether | FL/FR |
| camphoreous |
| | fenchol | FL/FR |
| laevo- | fenchone | FL/FR |
| caramellic |
| | immortelle absolute | FL/FR |
| citrus |
| | bergamot oil | FL/FR |
| (E+Z)-4,8- | dimethyl-3,7-nonadien-2-yl acetate | FL/FR |
| coconut |
| gamma- | heptalactone | FL/FR |
| gamma- | nonalactone (aldehyde C-18 (so-called)) | FL/FR |
| earthy |
| 2- | ethyl fenchol | FL/FR |
| (-)-alpha- | fenchol | FL/FR |
| | pogostemon cablin leaf extract | FR |
| floral |
| alpha- | amyl cinnamaldehyde | FL/FR |
| | bois de rose oil terpeneless | FL/FR |
| | cyclohexyl ethyl alcohol | FL/FR |
| | dihydro-alpha-ionone | FL/FR |
| | dihydrojasmone | FL/FR |
| | floral pyranol | FR |
| | heliotropin | FL/FR |
| | heliotropyl acetone | FL/FR |
| alpha- | hexyl cinnamaldehyde | FL/FR |
| | ho leaf oil | FR |
| | hydroxycitronellal | FL/FR |
| laevo- | linalool | FL/FR |
| | linalool oxide | FL/FR |
| para- | methyl acetophenone | FL/FR |
| | methyl dihydrojasmonate | FL/FR |
| | nerolidol | FL/FR |
| | orris pyridine 25% IPM | FR |
| | orris rhizome absolute (iris pallida) | FL/FR |
| | palmarosa oil | FL/FR |
| | phenethyl alcohol | FL/FR |
| | phenethyl phenyl acetate | FL/FR |
| | phenethyl salicylate | FL/FR |
| | rose absolute (rosa centifolia) morocco | FL/FR |
| | rose absolute (rosa damascena) bulgaria | FL/FR |
| | rose carboxylate | FR |
| green |
| iso | cyclocitral (IFF) | FL/FR |
| | fern absolute | |
| | galbanum absolute | FL/FR |
| | galbanum oil | FL/FR |
| | galbanum oleoresin | FL/FR |
| | galbanum resinoid | FL/FR |
| | lawsonia inermis leaf oil CO2 extract | FR |
| | oakmoss oil | FR |
| | valerian rhizome oil CO2 extract china | FL/FR |
| | violet leaf absolute | FL/FR |
| hay |
| | hay absolute | FR |
| herbal |
| 1- | allyl-2,2,7,7-tetramethyl cycloheptanol | FR |
| | arnica flower absolute | FR |
| | camphene carbinol | FR |
| | camphene carbinyl acetate | FR |
| | canarium luzonicum gum | FL/FR |
| | clary sage oil france | FL/FR |
| | dimethyl cyclormol (IFF) | FR |
| | guava leaf oil cuba | FR |
| 6- | hydroxydihydrotheaspirane (mixture of isomers) | FL/FR |
| abrialis | lavandin oil | FL/FR |
| | lavender absolute bulgaria | FL/FR |
| | nopyl acetate | FR |
| | pine hexanol | FR |
| alpha- | pinene | FL/FR |
| | rosemary absolute | FL/FR |
| | rosemary oil morocco | FL/FR |
| | rosemary oil spain | FL/FR |
| | valerian rhizome oil | FL/FR |
| | valerian rhizome oil china | FL/FR |
| melon |
| | watermelon ketone | FR |
| minty |
| | methyl salicylate | FL/FR |
| mossy |
| | oakmoss absolute | FL/FR |
| naphthyl |
| para- | methyl anisole | FL/FR |
| oily |
| | mcp acetate | FR |
| powdery |
| para- | anisyl alcohol | FL/FR |
| spicy |
| | benzyl isoeugenol | FL/FR |
| 4- | carvomenthenol | FL/FR |
| alpha- | caryophyllene alcohol | FL/FR |
| beta- | caryophyllene alcohol | FL/FR |
| | cassia bark oil china | FL/FR |
| | clove bud oil | FL/FR |
| | elettaria cardamomum seed oil | FL/FR |
| | eugenol | FL/FR |
| iso | eugenyl acetate | FL/FR |
| | ginger root oil brazil | FL/FR |
| | ginger root oil china | FL/FR |
| | ginger root oil cochin | FL/FR |
| alpha- | methyl cinnamaldehyde | FL/FR |
| | nutmeg absolute | FL/FR |
| | nutmeg oil | FL/FR |
| black | pepper oil | FL/FR |
| terpenic |
| | cypress leaf oil | FR |
| | elemi resinoid | FL/FR |
| | frankincense oil | FL/FR |
| | juniperus communis fruit oil | FL/FR |
| | pine needle oil dwarf | FL/FR |
| gamma- | terpinene | FL/FR |
| alpha- | terpineol | FL/FR |
| thujonic |
| | armoise oil | FR |
| tonka |
| | coumarin | FR |
| | tonka bean absolute | FR |
| tropical |
| | patchwood | FR |
| vanilla |
| | ethyl vanillin | FL/FR |
| | vanilla bean absolute (vanilla planifolia) | FL/FR |
| | vanillyl acetate | FL/FR |
| waxy |
| | decyl acetate | FL/FR |
| 1- | dodecanol | FL/FR |
| | ethyl laurate | FL/FR |
| woody |
| para-tert- | butyl cyclohexanone | FR |
| | calarene epoxide | |
| alpha- | cedrene epoxide | FR |
| | cedryl methyl ether | FR |
| | cistus twig/leaf oil | FL/FR |
| | copaiba balsam | FL/FR |
| | cyperus root oil (cyperus scariosus) | FR |
| | cypriol oil (cyperus scariosus) | FR |
| | dihydro-beta-ionone | FL/FR |
| | dihydro-gamma-ionone | FL/FR |
| 3(or 2),4- | dimethyl-5-vinyl octahydro-4,7-methanoinden-5-ol | |
| | dryopteris filix-mas oleoresin | FR |
| | germacrene B | |
| | guaiacwood oil | FL/FR |
| alpha- | guaiene | FL/FR |
| | gurjun balsam oil | FR |
| alpha- | gurjunene | FR |
| 1,2,3,3,4,5,6- | heptamethyl bicyclo(2.2.2)oct-5-en-2-ol | |
| | herbal norbornane | FR |
| 5,5a,6,7,8,8a- | hexahydro-6,6,7,8,8-pentamethyl-4H-indeno[5,4-D]isoxazole | |
| (1R,4S,5S,9R)-1- | hydroxy-1,4,7,7,9-pentamethyl spiro(4.5)decan-2-one | |
| 4- | hydroxybenzaldehyde | FL/FR |
| iso | longifolene ketone | FR |
| | manevoro oil | FR |
| | methyl cedryl ketone | FL/FR |
| delta- | methyl ionone | FL/FR |
| 2- | methyl-1-(5',5',6'-trimethyl bicyclo(2.2.1)hept-2'-yl) propan-2-ol | FR |
| | moss naphthaleneol | FR |
| | octahydro-3(or 2),4-dimethyl-4,7-methanoinden-5-ol | |
| | octahydro-3(or 2),4-dimethyl-4,7-methanoinden-5-one | |
| | orris hexanone | FR |
| | patchouli absolute | FR |
| | patchouli alcohol | FR |
| | patchouli essence | FL/FR |
| | patchouli ethanol | FR |
| | patchouli ethanone | FR |
| | patchouli extract acetylated | FR |
| | patchouli fractions | FR |
| | patchouli fragrance | FR |
| | patchouli hexanol | FR |
| | patchouli leaf water | FR |
| terpeneless | patchouli oil | FL/FR |
| | patchouli oil | FL/FR |
| | patchouli oil CO2 extract | FL/FR |
| | patchouli oil decolorized | FL/FR |
| | patchouli oil molecular distilled | FL/FR |
| | patchouli oil replacer | FR |
| | patchouli residues | FR |
| | patchouli specialty | FR |
| | patchouli woody amber fragrance | FR |
| | pelargonium radula oil | FR |
| | pinacol | FR |
| | pogostemon cablin leaf oil | FR |
| | sabinene | FL/FR |
| | sandalwood oil | FL/FR |
| | sandalwood oil west australia (santalum spicatum) | FR |
| | santall | FR |
| | santalyl butyrate | FL/FR |
| | spruce needle oil canada | FL/FR |
| alpha- | terpinene | FL/FR |
| beta- | terpineol | FL/FR |
| 2,6,10,10- | tetramethyl-1-oxa-spiro[4.5]dec-3-ene-6-ol | |
| | tobacarol (IFF) | FR |
| 3(or 2),4,5- | trimethyl octahydro-4,7-methanoinden-5-ol | FR |
| 3(or 2),4,5- | trimethyl-3a,4,5,6,7,7a-hexahydro-4,7-methanoinden-5-ol | |
| 1,3,5,7- | undecatetraene | FL/FR |
| | vetiver oil CO2 extract | FL/FR |
| | vetiver oil fractions | FR |
| | vetiver oil haiti | FL/FR |
| | vetiveria zizanioides root oil | FL/FR |
| | vetiverol | FL/FR |
| | woody dodecane | FR |
| | woody epoxide | FR |
| | woody ether | FR |
| |
| For Flavor |
| |
| No flavor group found for these |
| 1- | benzoyl acetone | FL/FR |
| dextro,laevo- | borneol | FL/FR |
| | calarene epoxide | |
| alpha- | caryophyllene alcohol | FL/FR |
| beta- | caryophyllene alcohol | FL/FR |
| | cistus ladaniferus resinoid | FL/FR |
| | dihydro-gamma-ionone | FL/FR |
| (E+Z)-4,8- | dimethyl-3,7-nonadien-2-yl acetate | FL/FR |
| 3(or 2),4- | dimethyl-5-vinyl octahydro-4,7-methanoinden-5-ol | |
| | fern absolute | |
| | fir needle oil canada | FL/FR |
| | germacrene B | |
| alpha- | guaiene | FL/FR |
| 1,2,3,3,4,5,6- | heptamethyl bicyclo(2.2.2)oct-5-en-2-ol | |
| 5,5a,6,7,8,8a- | hexahydro-6,6,7,8,8-pentamethyl-4H-indeno[5,4-D]isoxazole | |
| (1R,4S,5S,9R)-1- | hydroxy-1,4,7,7,9-pentamethyl spiro(4.5)decan-2-one | |
| delta- | methyl ionone | FL/FR |
| | octahydro-3(or 2),4-dimethyl-4,7-methanoinden-5-ol | |
| | octahydro-3(or 2),4-dimethyl-4,7-methanoinden-5-one | |
| 3- | propyl pyridine | FL |
| (E)- | sabinene hydrate | FL/FR |
| | santalyl butyrate | FL/FR |
| beta- | terpineol | FL/FR |
| 2,6,10,10- | tetramethyl-1-oxa-spiro[4.5]dec-3-ene-6-ol | |
| 3(or 2),4,5- | trimethyl-3a,4,5,6,7,7a-hexahydro-4,7-methanoinden-5-ol | |
| 1,3,5,7- | undecatetraene | FL/FR |
| | vitispirane | FL |
| amber |
| | ambrette seed oil | FL/FR |
| animal |
| | indole | FL/FR |
| anisic |
| para- | anisyl phenyl acetate | FL/FR |
| balsamic |
| siam | benzoin resinoid | FL/FR |
| | benzyl benzoate | FL/FR |
| | benzyl salicylate | FL/FR |
| laevo- | bornyl acetate | FL/FR |
| iso | bornyl isobutyrate | FL/FR |
| iso | butyl cinnamate | FL/FR |
| | ethyl cinnamate | FL/FR |
| | fir needle oil siberia | FL/FR |
| | fir needle oil terpeneless canada | FL/FR |
| | juniper berry absolute | FL/FR |
| | myrrh absolute | FL/FR |
| | myrrh oil | FL/FR |
| | opoponax oil (balsamodendron kafal) | FL/FR |
| | peru balsam | FL |
| | tolu balsam absolute | FL/FR |
| | tolu balsam resinoid | FL/FR |
| berry |
| | dihydro-alpha-ionone | FL/FR |
| | heliotropyl acetone | FL/FR |
| | raspberry ketone methyl ether | FL/FR |
| camphoreous |
| | fenchol | FL/FR |
| (-)-alpha- | fenchol | FL/FR |
| laevo- | fenchone | FL/FR |
| 6- | hydroxydihydrotheaspirane (mixture of isomers) | FL/FR |
| cherry |
| | heliotropin | FL/FR |
| citrus |
| | bergamot oil | FL/FR |
| laevo- | linalool | FL/FR |
| alpha- | terpineol | FL/FR |
| coconut |
| gamma- | nonalactone (aldehyde C-18 (so-called)) | FL/FR |
| cooling |
| 4- | carvomenthenol | FL/FR |
| dextro- | fenchone | FL/FR |
| creamy |
| para- | anisaldehyde | FL/FR |
| 4- | hydroxybenzaldehyde | FL/FR |
| para- | methyl acetophenone | FL/FR |
| earthy |
| 2- | ethyl fenchol | FL/FR |
| floral |
| | bois de rose oil terpeneless | FL/FR |
| | dihydrojasmone | FL/FR |
| | methyl dihydrojasmonate | FL/FR |
| | phenethyl alcohol | FL/FR |
| | rose absolute (rosa centifolia) morocco | FL/FR |
| | rose absolute (rosa damascena) bulgaria | FL/FR |
| fruity |
| iso | amyl benzoate | FL/FR |
| para- | anisyl alcohol | FL/FR |
| | valerian rhizome oil | FL/FR |
| | valerian rhizome oil china | FL/FR |
| | valerian rhizome oil CO2 extract china | FL/FR |
| grassy |
| | palmarosa oil | FL/FR |
| green |
| | angelica root oil | FL/FR |
| | canarium luzonicum gum | FL/FR |
| | cinnamyl alcohol | FL/FR |
| iso | cyclocitral (IFF) | FL/FR |
| | cyclohexyl ethyl alcohol | FL/FR |
| | elemi resinoid | FL/FR |
| | galbanum absolute | FL/FR |
| | galbanum oil | FL/FR |
| | galbanum oleoresin | FL/FR |
| | galbanum resinoid | FL/FR |
| | immortelle absolute | FL/FR |
| | linalool oxide | FL/FR |
| | nerolidol | FL/FR |
| | oakmoss absolute | FL/FR |
| | violet leaf absolute | FL/FR |
| herbal |
| | clary sage oil france | FL/FR |
| abrialis | lavandin oil | FL/FR |
| | lavender absolute bulgaria | FL/FR |
| | rosemary absolute | FL/FR |
| | rosemary oil morocco | FL/FR |
| | rosemary oil spain | FL/FR |
| honey |
| | phenethyl phenyl acetate | FL/FR |
| lactonic |
| gamma- | heptalactone | FL/FR |
| medicinal, |
| | phenethyl salicylate | FL/FR |
| minty |
| | methyl salicylate | FL/FR |
| naphthyl |
| para- | methyl anisole | FL/FR |
| orris |
| | costus root oil | FL |
| phenolic |
| | guaiacyl phenyl acetate | FL/FR |
| pine |
| | pine needle oil dwarf | FL/FR |
| soapy |
| | dodecanal (aldehyde C-12 lauric) | FL/FR |
| 1- | dodecanol | FL/FR |
| spicy |
| siam | benzoin absolute | FL/FR |
| | benzyl isoeugenol | FL/FR |
| | cassia bark oil china | FL/FR |
| | clove bud oil | FL/FR |
| | elettaria cardamomum seed oil | FL/FR |
| | eugenol | FL/FR |
| iso | eugenyl acetate | FL/FR |
| | galangal root oleoresin | FL |
| | ginger root oil brazil | FL/FR |
| | ginger root oil china | FL/FR |
| | ginger root oil cochin | FL/FR |
| alpha- | methyl cinnamaldehyde | FL/FR |
| | methyl cinnamate | FL/FR |
| | nutmeg absolute | FL/FR |
| | nutmeg oil | FL/FR |
| black | pepper oil | FL/FR |
| 3- | phenyl propyl alcohol | FL/FR |
| | turmeric oleoresin | FL |
| sweet |
| | orris rhizome absolute (iris pallida) | FL/FR |
| terpenic |
| | juniperus communis fruit oil | FL/FR |
| alpha- | terpinene | FL/FR |
| gamma- | terpinene | FL/FR |
| tropical |
| alpha- | amyl cinnamaldehyde | FL/FR |
| vanilla |
| | ethyl vanillin | FL/FR |
| | vanilla bean absolute (vanilla planifolia) | FL/FR |
| | vanillyl acetate | FL/FR |
| waxy |
| | decyl acetate | FL/FR |
| | ethyl laurate | FL/FR |
| alpha- | hexyl cinnamaldehyde | FL/FR |
| | hydroxycitronellal | FL/FR |
| woody |
| | amyris wood oil | FL/FR |
| iso | bornyl acetate | FL/FR |
| iso | bornyl formate | FL/FR |
| | cistus twig/leaf oil | FL/FR |
| | copaiba balsam | FL/FR |
| | dihydro-beta-ionone | FL/FR |
| | frankincense oil | FL/FR |
| | guaiacwood oil | FL/FR |
| | methyl cedryl ketone | FL/FR |
| | patchouli essence | FL/FR |
| terpeneless | patchouli oil | FL/FR |
| | patchouli oil | FL/FR |
| | patchouli oil CO2 extract | FL/FR |
| | patchouli oil decolorized | FL/FR |
| | patchouli oil molecular distilled | FL/FR |
| alpha- | pinene | FL/FR |
| | sabinene | FL/FR |
| | sandalwood oil | FL/FR |
| | spruce needle oil canada | FL/FR |
| | vetiver oil CO2 extract | FL/FR |
| | vetiver oil haiti | FL/FR |
| | vetiveria zizanioides root oil | FL/FR |
| | vetiverol | FL/FR |
| |
Potential Uses:
Occurrence (nature, food, other): note
Synonyms:
| | patchouli oil china | | | pogostemon cablin oil china | | | pogostemon patchouli oil china | | | volatile oil obtained from the leaves of the patchouli, pogostemon cablin, labiatae china |
Articles:
| PubMed: | A pharmacokinetic study of patchouli alcohol after a single oral administration of patchouli alcohol or patchouli oil in rats. |
| PubMed: | Synergistic effect of fragrant herbs in Japanese scent sachets. |
| PubMed: | Progressive regulation of sesquiterpene biosynthesis in Arabidopsis and Patchouli (Pogostemon cablin) by the miR156-targeted SPL transcription factors. |
| PubMed: | A multiresidue method for simultaneous determination of 44 organophosphorous pesticides in Pogostemon cablin and related products using modified QuEChERS sample preparation procedure and GC-FPD. |
| PubMed: | In vitro and in vivo antibacterial activity of Pogostone. |
| PubMed: | Progressive Regulation of Sesquiterpene Biosynthesis in Arabidopsis and Patchouli (Pogostemon cablin) by the miR156-Targeted SPL Transcription Factors. |
| PubMed: | Prevention of UV radiation-induced cutaneous photoaging in mice by topical administration of patchouli oil. |
| PubMed: | Characterisation of the metabolism of pogostone in vitro and in vivo using liquid chromatography with mass spectrometry. |
| PubMed: | Expression, purification and activity assay of a patchoulol synthase cDNA variant fused to thioredoxin in Escherichia coli. |
| PubMed: | Evaluation of the antibacterial activity of patchouli oil. |
| PubMed: | Antimicrobial and Herbal Drug Resistance in Enteric Bacteria Isolated from Faecal Droppings of Common House Lizard/Gecko (Hemidactylus frenatus). |
| PubMed: | Development and structure of internal glands and external glandular trichomes in Pogostemon cablin. |
| PubMed: | Screening of some essential oils against Trichosporon species. |
| PubMed: | Insecticidal activity of pogostone against Spodoptera litura and Spodoptera exigua (Lepidoptera: Noctuidae). |
| PubMed: | Antifungal effect of Allium tuberosum, Cinnamomum cassia, and Pogostemon cablin essential oils and their components against population of Aspergillus species. |
| PubMed: | Insecticidal and repellence activity of the essential oil of Pogostemon cablin against urban ants species. |
| PubMed: | Study on the grafting of chitosan-gelatin microcapsules onto cotton fabrics and its antibacterial effect. |
| PubMed: | Patchouli alcohol, an essential oil of Pogostemon cablin, exhibits anti-tumorigenic activity in human colorectal cancer cells. |
| PubMed: | Virtual screening of compounds from the patchouli oil of Pogostemon herba for COX-1 inhibition. |
| PubMed: | [Extraction and analysis of the essential oil in Pogostemon cablin by enzymatic hydrolysis and inhibitory activity against Hela cell proliferation]. |
| PubMed: | Quantitative and physical evaluation of patchouli essential oils obtained from different sources of Pogostemon cablin. |
| PubMed: | Secondary metabolites and antioxidant capacities of Waldheimia glabra (Decne.) Regel from Nepal. |
| PubMed: | Technology for efficient and successful delivery of vermicompost colonized bioinoculants in Pogostemon cablin (patchouli) Benth. |
| PubMed: | Selective separation of patchouli alcohol from the essential oil of Cablin potchouli by inclusion crystalline method. |
| PubMed: | Acaricidal activity of DHEMH, derived from patchouli oil, against house dust mite, Dermatophagoides farinae. |
| PubMed: | Chemical constituents, antioxidant and antimocrobial activity of essential oil of Pogostemon paniculatus (Willd.). |
| PubMed: | Experimental study on anti-inflammatory activity of a TCM recipe consisting of the supercritical fluid CO2 extract of Chrysanthemum indicum, Patchouli Oil and Zedoary Turmeric Oil in vivo. |
| PubMed: | Volatile oil composition of Pogostemon heyneanus and comparison of its composition with patchouli oil. |
| PubMed: | [Identification method with significant specificity of volatile oil of Pogostemon cablin]. |
| PubMed: | Evaluation of the toxicity of 17 essential oils against Choristoneura rosaceana (Lepidoptera: Tortricidae) and Trichoplusia ni (Lepidoptera: Noctuidae). |
| PubMed: | Novel silicon-based patchouli odorants of the trialkyl(1-hydroxy-1-methylethyl)silane type: design, synthesis, and olfactory properties. |
| PubMed: | [Protective effect of Pogostemon cablin on membrane fluidity of intestinal epithelia cell in ischemia/ reperfusion rats after ischemia/reperfusion]. |
| PubMed: | [Effect of atractylodes rhizome oil and other volatile oils on percutaneous absorption of baicalin]. |
| PubMed: | Insecticidal properties of several essential oils on the house fly (Musca domestica L.). |
| PubMed: | Alpha-bulnesene, a PAF inhibitor isolated from the essential oil of Pogostemon cablin. |
| PubMed: | The diverse sesquiterpene profile of patchouli, Pogostemon cablin, is correlated with a limited number of sesquiterpene synthases. |
| PubMed: | GC-MS fingerprint of Pogostemon cablin in China. |
| PubMed: | Comparative repellency of 38 essential oils against mosquito bites. |
| PubMed: | Determination of patchoulic alcohol in Herba Pogostemonis by GC-MS-MS. |
| PubMed: | [Investigation on the influential factors of the volatile oil and main constituent content in Pogostemon cablin]. |
| PubMed: | [Study on purification technology of patchouly oil with molecular distillation]. |
| PubMed: | [Pharmacokinetics of patchouli alcohol and patchouli alcohol in patchouli oil after iv administrated to rats]. |
| PubMed: | Application of comprehensive two-dimensional gas chromatography-time-of-flight mass spectrometry in the analysis of volatile oil of traditional Chinese medicines. |
| PubMed: | Toxicity and repellency of patchouli oil and patchouli alcohol against Formosan subterranean termites Coptotermes formosanus Shiraki (Isoptera: Rhinotermitidae). |
| PubMed: | [Anti-Candida albicans activity of essential oils including Lemongrass (Cymbopogon citratus) oil and its component, citral]. |
| PubMed: | [Two chemotypes of Pogostemon cablin and influence of region of cultivation and harvesting time on volatile oil composition]. |
| PubMed: | [Constituents analysis on volatile oil of Pogostemon cablin from different collection time cultivated in Hainan]. |
| PubMed: | [DNA profiling of Pogostemon cablin chemotypes differing in essential oil composition]. |
| PubMed: | [GC-MS analysis of volatile oil of Herba Pogostemonis collected from Leizhou county]. |
| PubMed: | [GC-MS analysis of volatile oil of herba Pogostemonis collected from Gaoyao county]. |
| PubMed: | Effects of fragrance inhalation on sympathetic activity in normal adults. |
| PubMed: | Production of patchouli mild mosaic virus resistant patchouli plants by genetic engineering of coat protein precursor gene. |
| PubMed: | Regeneration of patchouli (Pogostemon cablin Benth.) plants from leaf and node callus, and evaluation after growth in the field. |
| PubMed: | Biosynthesis of the sesquiterpene patchoulol from farnesyl pyrophosphate in leaf extracts of Pogostemon cablin (patchouli): mechanistic considerations. |
|