halazuchrome B | |
CAS: 18296-44-1 Use(s): natural substances and extractives | |
hamamelitannin | |
CAS: 469-32-9 Use(s): natural substances and extractives | |
harmaline | |
CAS: 304-21-2 Use(s): natural substances and extractives | |
harmaline hydrochloride dihydrate | |
CAS: 6027-98-1 Use(s): natural substances and extractives | |
harmalol | |
CAS: 525-57-5 Use(s): natural substances and extractives | |
harmalol hydrochloride | |
CAS: 6028-07-5 Use(s): information only not used for fragrances or flavors | |
nor | harman |
CAS: 244-63-3 Use(s): information only not used for fragrances or flavors | |
harmine | |
CAS: 442-51-3 Use(s): natural substances and extractives | |
harmol | |
CAS: 487-03-6 Use(s): natural substances and extractives | |
harpagide | |
CAS: 6926-08-5 Use(s): natural substances and extractives | |
harpagoside | |
CAS: 19210-12-9 Use(s): natural substances and extractives | |
hastatoside | |
CAS: 50816-24-5 Use(s): natural substances and extractives | |
hawthorn acetate | |
CAS: 7306-12-9 Use(s): fragrance agents | |
hawthorn carbinol | |
CAS: 536-50-5 FEMA: 3139 JECFA: 805 FLAVIS: 02.080 Use(s): flavor and fragrance agents | |
(R)- | hawthorn carbinol |
CAS: 42070-92-8 Use(s): information only not used for fragrances or flavors | |
(S)- | hawthorn carbinol |
CAS: 51154-54-2 Use(s): information only not used for fragrances or flavors | |
hawthorn ethanol | |
CAS: 1875-89-4 Use(s): fragrance agents | |
hazelnut pyrazine | |
CAS: 18138-04-0 FEMA: 3336 JECFA: 777 FLAVIS: 14.056 Use(s): flavor and fragrance agents | |
alpha- | hederin hydrate |
CAS: 27013-91-8 Use(s): natural substances and extractives | |
hedycaryol | |
CAS: 21657-90-9 Use(s): natural substances and extractives | |
helenalin | |
CAS: 6754-13-8 Use(s): natural substances and extractives | |
heleniamarin | |
CAS: 66607-74-7 Use(s): natural substances and extractives | |
heliangin | |
CAS: 13323-48-3 Use(s): natural substances and extractives | |
heliangolide | |
CAS: 65556-51-6 Use(s): natural substances and extractives | |
heliannone A | |
CAS: 193411-10-8 Use(s): natural substances and extractives | |
heliannuol A | |
CAS: 148054-17-5 Use(s): natural substances and extractives | |
heliannuol B | |
CAS: 161730-07-0 Use(s): natural substances and extractives | |
heliannuol C | |
CAS: 161730-08-1 Use(s): natural substances and extractives | |
heliannuol D | |
CAS: 161730-09-2 Use(s): natural substances and extractives | |
heliannuol E | |
CAS: 241139-49-1 Use(s): natural substances and extractives | |
helianol | |
CAS: 178330-51-3 Use(s): natural substances and extractives | |
iso | helianol |
CAS: 203570-12-1 Use(s): natural substances and extractives | |
helianthoside A | |
CAS: 139164-70-8 Use(s): natural substances and extractives | |
helianthoside B | |
CAS: 29108-67-6 Use(s): natural substances and extractives | |
helianthoside C | |
CAS: 25503-42-8 Use(s): natural substances and extractives | |
heliantriol A1 | |
CAS: 26540-64-7 Use(s): natural substances and extractives | |
heliantriol B1 | |
CAS: 74715-48-3 Use(s): natural substances and extractives | |
heliantriol B2 | |
CAS: 61229-18-3 Use(s): natural substances and extractives | |
heliantriol C | |
CAS: 71876-60-3 Use(s): natural substances and extractives | |
heliantriol F | |
CAS: 71876-59-0 Use(s): natural substances and extractives | |
helianyl octanoate | |
CAS: 290305-83-8 Use(s): natural substances and extractives | |
helichrysetin | |
CAS: 62014-87-3 Use(s): natural substances and extractives | |
helichrysoside | |
CAS: 56343-26-1 Use(s): natural substances and extractives | |
helicin | |
CAS: 618-65-5 Use(s): natural substances and extractives | |
heliespirone A | |
CAS: 202533-71-9 Use(s): natural substances and extractives | |
heliotric acid | |
CAS: 25039-18-3 Use(s): natural substances and extractives | |
heliotrine | |
CAS: 303-33-3 Use(s): natural substances and extractives | |
heliotrine-N-oxide | |
CAS: 6209-65-0 Use(s): natural substances and extractives | |
heliotropic acid | |
CAS: 94-53-1 Use(s): natural substances and extractives | |
heliotropin | |
CAS: 120-57-0 FEMA: 2911 JECFA: 896 FLAVIS: 05.016 Use(s): cosmetic, flavor and fragrance agents | |
heliotropin replacer | |
Use(s): fragrance agents | |
heliotropyl acetate | |
CAS: 326-61-4 FEMA: 2912 JECFA: 894 FLAVIS: 09.220 Use(s): flavor and fragrance agents | |
heliotropyl acetone | |
CAS: 55418-52-5 FEMA: 2701 JECFA: 2048 FLAVIS: 07.031 Use(s): flavor and fragrance agents | |
heliotropyl alcohol | |
CAS: 495-76-1 FLAVIS: 02.205 Use(s): flavor and fragrance agents | |
heliotropyl butane-2,3-diol acetal | |
CAS: 6412-69-7 Use(s): information only not used for fragrances or flavors | |
heliotropyl butyrate | |
CAS: 6890-27-3 Use(s): information only not used for fragrances or flavors | |
heliotropyl isobutyrate | |
CAS: 5461-08-5 FEMA: 2913 JECFA: 895 FLAVIS: 09.430 Use(s): flavor and fragrance agents | |
heliotropyl diethyl acetal | |
CAS: 40527-42-2 Use(s): fragrance agents | |
heliotropyl dimethyl acetal | |
CAS: 59259-90-4 Use(s): fragrance agents | |
heliotropyl formate | |
CAS: 85262-96-0 Use(s): information only not used for fragrances or flavors | |
heliotropyl 2-methyl butyrate | |
CAS: 84604-43-3 Use(s): information only not used for fragrances or flavors | |
heliotropyl phenyl acetate | |
CAS: 5457-86-3 Use(s): information only not used for fragrances or flavors | |
heliotropyl pivalate | |
CAS: 6471-96-1 Use(s): information only not used for fragrances or flavors | |
heliotropyl propionate | |
CAS: 6890-26-2 Use(s): information only not used for fragrances or flavors | |
heliotropyl propylene glycol acetal | |
CAS: 61683-99-6 FEMA: 4622 Use(s): flavor and fragrance agents | |
heliotropyl isovalerate | |
CAS: 84604-42-2 Use(s): information only not used for fragrances or flavors | |
helipyrone | |
CAS: 29902-01-0 Use(s): natural substances and extractives | |
helminthogermacrene | |
CAS: 75023-40-4 Use(s): natural substances and extractives | |
helveticoside | |
CAS: 630-64-8 Use(s): natural substances and extractives | |
hematein | |
CAS: 475-25-2 Use(s): coloring agents | |
hemiariensin | |
CAS: 112448-60-9 Use(s): natural substances and extractives | |
hemimellitene | |
CAS: 526-73-8 Use(s): natural substances and extractives | |
iso | heneicosane |
CAS: 52845-08-6 Use(s): information only not used for fragrances or flavors | |
heneicosanol | |
CAS: 51227-32-8 Use(s): natural substances and extractives | |
11- | heneicosanol |
CAS: 3381-26-8 Use(s): information only not used for fragrances or flavors | |
(Z)-6- | heneicosen-11-one |
CAS: 54844-65-4 Use(s): information only not used for fragrances or flavors | |
(Z)-9- | heneicosene |
CAS: 39836-21-0 Use(s): natural substances and extractives | |
heneicosyl cyclopentane | |
CAS: 6703-82-8 Use(s): natural substances and extractives | |
5- | heneicosyl-1,3-benzenediol |
CAS: 70110-59-7 Use(s): natural substances and extractives | |
henicosane | |
CAS: 629-94-7 Use(s): fragrance agents | |
henicosanoic acid | |
CAS: 2363-71-5 Use(s): natural substances and extractives | |
henicosene | |
CAS: 27400-79-9 Use(s): natural substances and extractives | |
hentriacontane | |
CAS: 630-04-6 Use(s): natural substances and extractives | |
hentriacontane-14,16-dione | |
CAS: 24724-84-3 Use(s): natural substances and extractives | |
16- | hentriacontanol |
CAS: 1070-54-8 Use(s): natural substances and extractives | |
15- | hentriacontanol |
CAS: 27759-56-4 Use(s): natural substances and extractives | |
9- | hentriacontanone |
CAS: 34136-52-2 Use(s): natural substances and extractives | |
1- | hentriacontene |
CAS: 18435-54-6 Use(s): natural substances and extractives | |
heptacosane | |
CAS: 593-49-7 Use(s): natural substances and extractives | |
heptacosane dioic acid | |
CAS: 5638-06-2 Use(s): natural substances and extractives | |
10,12- | heptacosanedione |
CAS: 95605-27-9 Use(s): natural substances and extractives | |
1- | heptacosanol |
CAS: 2004-39-9 Use(s): natural substances and extractives | |
14- | heptacosanol |
CAS: 32116-10-2 Use(s): natural substances and extractives | |
2- | heptacosanone |
CAS: 7796-19-2 Use(s): natural substances and extractives | |
1- | heptacosene |
CAS: 15306-27-1 Use(s): natural substances and extractives | |
(Z,Z)- | heptadeca-1,8,11-triene |
CAS: 56134-03-3 Use(s): natural substances and extractives | |
(Z,Z)-8,11- | heptadecadienal |
CAS: 56797-42-3 Use(s): natural substances and extractives | |
heptadecadiene | |
CAS: 54264-04-9 Use(s): natural substances and extractives | |
1,8- | heptadecadiene-4,6-diyne-3,10-diol |
CAS: 63910-76-9 Use(s): natural substances and extractives | |
heptadecanal | |
CAS: 629-90-3 Use(s): natural substances and extractives | |
heptadecane | |
CAS: 629-78-7 FLAVIS: 01.075 Use(s): fragrance agents | |
1,17- | heptadecanediol |
CAS: 66577-59-1 Use(s): natural substances and extractives | |
2,4- | heptadecanedione |
CAS: 64042-18-8 Use(s): natural substances and extractives | |
heptadecanoic acid | |
CAS: 506-12-7 Use(s): natural substances and extractives | |
1- | heptadecanol |
CAS: 1454-85-9 FLAVIS: 02.154 Use(s): natural substances and extractives | |
2- | heptadecanol |
CAS: 16813-18-6 Use(s): natural substances and extractives | |
3- | heptadecanol |
CAS: 84534-30-5 Use(s): natural substances and extractives | |
4- | heptadecanol |
CAS: 103385-34-8 Use(s): information only not used for fragrances or flavors | |
6- | heptadecanol |
CAS: 112283-13-3 Use(s): information only not used for fragrances or flavors | |
7- | heptadecanol |
CAS: 93658-33-4 Use(s): information only not used for fragrances or flavors | |
8- | heptadecanol |
CAS: 2541-75-5 Use(s): natural substances and extractives | |
9- | heptadecanol |
CAS: 624-08-8 Use(s): natural substances and extractives | |
heptadecanolide | |
CAS: 5637-97-8 Use(s): natural substances and extractives | |
2- | heptadecanone |
CAS: 2922-51-2 FLAVIS: 07.160 Use(s): natural substances and extractives | |
3- | heptadecanone |
CAS: 84534-29-2 Use(s): natural substances and extractives | |
4- | heptadecanone |
CAS: 53685-77-1 Use(s): information only not used for fragrances or flavors | |
6- | heptadecanone |
CAS: 22026-13-7 Use(s): information only not used for fragrances or flavors | |
7- | heptadecanone |
CAS: 6064-42-2 Use(s): information only not used for fragrances or flavors | |
8- | heptadecanone |
CAS: 14476-38-1 Use(s): information only not used for fragrances or flavors | |
9- | heptadecanone |
CAS: 540-08-9 Use(s): natural substances and extractives | |
(Z,Z,Z)-8,11,14- | heptadecatrienal |
CAS: 56797-44-5 Use(s): natural substances and extractives | |
(all-E)-1,7,9- | heptadecatriene-11,13,15-triyne |
CAS: 41688-30-6 Use(s): natural substances and extractives | |
(Z)-8- | heptadecenal |
CAS: 56797-41-2 Use(s): natural substances and extractives | |
1- | heptadecene |
CAS: 6765-39-5 Use(s): natural substances and extractives | |
5- | heptadecene |
CAS: 138472-85-2 Use(s): natural substances and extractives | |
7- | heptadecene |
CAS: 54290-12-9 Use(s): natural substances and extractives | |
8- | heptadecene |
CAS: 2579-04-6 Use(s): natural substances and extractives | |
(Z)-8- | heptadecene |
CAS: 16369-12-3 Use(s): natural substances and extractives | |
(Z)-8- | heptadecene dioic acid |
CAS: 253687-28-4 Use(s): information only not used for fragrances or flavors | |
1- | heptadecene-4,6-diyne-3,9-diol |
CAS: 77084-19-6 Use(s): natural substances and extractives | |
(Z)-9- | heptadecenoic acid |
CAS: 1981-50-6 Use(s): natural substances and extractives | |
5-(12- | heptadecenyl)-1,3-benzenediol |
CAS: 103462-06-2 Use(s): natural substances and extractives | |
3-(10- | heptadecenyl)phenol |
CAS: 111047-33-7 Use(s): natural substances and extractives | |
heptadecyl acetate | |
CAS: 822-20-8 Use(s): natural substances and extractives | |
heptadecyl cyclohexane | |
CAS: 19781-73-8 Use(s): natural substances and extractives | |
2- | heptadecylfuran |
CAS: 208329-97-9 Use(s): natural substances and extractives | |
1- | heptadecyne |
CAS: 26186-00-5 Use(s): natural substances and extractives | |
2,5- | heptadien-1-ol |
CAS: 62237-90-5 Use(s): natural substances and extractives | |
(E,E)-3,5- | heptadien-2-one |
CAS: 18402-90-9 Use(s): natural substances and extractives | |
2,4- | heptadienal |
CAS: 5910-85-0 Use(s): flavoring agents | |
(E,E)-2,4- | heptadienal |
CAS: 4313-03-5 FEMA: 3164 JECFA: 1179 FLAVIS: 05.084 Use(s): flavoring agents | |
(E,Z)-2,4- | heptadienal |
CAS: 4313-02-4 Use(s): natural substances and extractives | |
(Z,E)-2,4- | heptadienal |
CAS: 59121-26-5 Use(s): natural substances and extractives | |
1,5- | heptadiene |
CAS: 1541-23-7 Use(s): natural substances and extractives | |
(E,E)-2,4- | heptadiene |
CAS: 628-72-8 Use(s): natural substances and extractives | |
1,5- | heptadiene-3,4-diol |
CAS: 51945-98-3 Use(s): natural substances and extractives | |
2,4- | heptadienoic acid |
CAS: 17175-86-9 Use(s): information only not used for fragrances or flavors | |
(E,E)-2,4- | heptadienoic acid |
CAS: 65518-46-9 Use(s): natural substances and extractives | |
(E,Z)-2,4- | heptadienoic acid |
CAS: 50915-66-7 Use(s): information only not used for fragrances or flavors | |
(Z,E)-2,4- | heptadienoic acid |
CAS: 600716-76-5 Use(s): information only not used for fragrances or flavors | |
2,6- | heptadienoic acid |
CAS: 38867-17-3 Use(s): natural substances and extractives | |
1,6- | heptadien-4-ol |
CAS: 2883-45-6 Use(s): natural substances and extractives | |
2,4- | heptadien-1-ol |
CAS: 62488-55-5 Use(s): flavoring agents | |
(E,E)-2,4- | heptadien-1-ol |
CAS: 33467-79-7 FEMA: 4127 JECFA: 1784 FLAVIS: 02.153 Use(s): flavoring agents | |
(E,Z)-2,4- | heptadien-1-ol |
CAS: 70979-88-3 Use(s): natural substances and extractives | |
(E,E)-2,5- | heptadien-1-ol |
CAS: 66618-63-1 Use(s): information only not used for fragrances or flavors | |
3,5- | heptadienone |
CAS: 3916-64-1 Use(s): information only not used for fragrances or flavors | |
2,3,3,4,4,5,5- | heptafluoro-1-pentene |
CAS: 1547-26-8 Use(s): indirect food additives: adhesives and components of coatings | |
delta- | heptalactone |
CAS: 3301-90-4 FLAVIS: 10.045 Use(s): flavor and fragrance agents | |
gamma- | heptalactone |
CAS: 105-21-5 FEMA: 2539 JECFA: 225 FLAVIS: 10.020 Use(s): flavor and fragrance agents | |
(R)-gamma- | heptalactone |
CAS: 88270-38-6 Use(s): information only not used for fragrances or flavors | |
(S)-gamma- | heptalactone |
CAS: 31323-51-0 Use(s): information only not used for fragrances or flavors | |
1,3,3,4,5,6,7- | heptamethyl bicyclo(2.2.2)-5-octen-2-one |
Use(s): information only not used for fragrances or flavors | |
1,3,3,4,5,6,8- | heptamethyl bicyclo(2.2.2)-5-octen-2-one |
Use(s): information only not used for fragrances or flavors | |
1,2,3,3,4,5,6- | heptamethyl bicyclo(2.2.2)oct-5-en-2-ol |
CAS: 60362-71-2 Use(s): information only not used for fragrances or flavors | |
1,3,3,4,5,6,7- | heptamethyl(2.2.2)bicyclooct-5-en-2-ol |
Use(s): information only not used for fragrances or flavors | |
1,3,3,4,5,6,8- | heptamethyl(2.2.2)bicyclooct-5-en-2-ol |
Use(s): information only not used for fragrances or flavors | |
heptanal (aldehyde C-7) | |
CAS: 111-71-7 FEMA: 2540 JECFA: 95 FLAVIS: 05.031 Use(s): flavor and fragrance agents | |
heptanal 2,3-butane diol acetal | |
CAS: 6454-22-4 FEMA: 4048 JECFA: 1712 FLAVIS: 06.089 Use(s): flavoring agents | |
heptanal butene-1,4-glycol acetal | |
CAS: 61732-96-5 Use(s): information only not used for fragrances or flavors | |
heptanal cyclic acetal with glycerol | |
CAS: 72854-42-3 FEMA: 2542 FLAVIS: 06.029 Use(s): flavor and fragrance agents | |
heptanal cyclic ethylene acetal | |
CAS: 1708-34-5 Use(s): fragrance agents | |
heptanal cyclic propylene acetal | |
CAS: 4351-10-4 FEMA: 4368 JECFA: 1739 Use(s): flavor and fragrance agents | |
heptanal cyclic trimethylene acetal | |
CAS: 3080-69-1 Use(s): information only not used for fragrances or flavors | |
heptanal diethyl acetal | |
CAS: 688-82-4 FLAVIS: 06.021 Use(s): flavor and fragrance agents | |
heptanal dimethyl acetal | |
CAS: 10032-05-0 FEMA: 2541 JECFA: 947 FLAVIS: 06.028 Use(s): flavor and fragrance agents | |
heptanal glyceryl acetal | |
CAS: 1708-35-6 FEMA: 2542 JECFA: 912 Use(s): flavor and fragrance agents | |
heptane | |
CAS: 142-82-5 Use(s): extraction solvents | |
1,2- | heptane diol |
CAS: 3710-31-4 Use(s): natural substances and extractives | |
2,3- | heptane dione |
CAS: 96-04-8 FEMA: 2543 JECFA: 415 FLAVIS: 07.064 Use(s): flavor and fragrance agents | |
3,4- | heptane dione |
CAS: 13706-89-3 Use(s): information only not used for fragrances or flavors | |
heptane nitrile | |
CAS: 629-08-3 Use(s): natural substances and extractives | |
2- | heptane thiol |
CAS: 628-00-2 FEMA: 4128 JECFA: 1664 FLAVIS: 12.288 Use(s): flavoring agents | |
heptanoic acid | |
CAS: 111-14-8 FEMA: 3348 JECFA: 96 FLAVIS: 08.028 Use(s): flavor and fragrance agents | |
heptanol | |
CAS: 53535-33-4 Use(s): flavor and fragrance agents | |
1- | heptanol |
CAS: 111-70-6 FEMA: 2548 JECFA: 94 FLAVIS: 02.021 Use(s): flavor and fragrance agents | |
2- | heptanol |
CAS: 543-49-7 FEMA: 3288 JECFA: 284 FLAVIS: 02.045 Use(s): flavor and fragrance agents | |
(R)-(-)-2- | heptanol |
CAS: 6033-24-5 Use(s): flavor and fragrance agents | |
(S)-(+)-2- | heptanol |
CAS: 6033-23-4 Use(s): flavor and fragrance agents | |
3- | heptanol |
CAS: 589-82-2 FEMA: 3547 JECFA: 286 FLAVIS: 02.044 Use(s): flavor and fragrance agents | |
(R)-3- | heptanol |
CAS: 62701-49-9 Use(s): information only not used for fragrances or flavors | |
(S)-3- | heptanol |
CAS: 26549-25-7 Use(s): information only not used for fragrances or flavors | |
4- | heptanol |
CAS: 589-55-9 Use(s): information only not used for fragrances or flavors | |
2- | heptanone |
CAS: 110-43-0 FEMA: 2544 JECFA: 283 FLAVIS: 07.002 Use(s): flavor and fragrance agents | |
3- | heptanone |
CAS: 106-35-4 FEMA: 2545 JECFA: 285 FLAVIS: 07.003 Use(s): flavor and fragrance agents | |
4- | heptanone |
CAS: 123-19-3 FEMA: 2546 JECFA: 287 FLAVIS: 07.058 Use(s): flavor and fragrance agents | |
2- | heptanoyl thiophene |
CAS: 30711-40-1 Use(s): natural substances and extractives | |
N-( | heptan-4-yl)benzo(D)(1,3)dioxole-5-carboxamide |
CAS: 745047-51-2 FEMA: 4232 JECFA: 1767 FLAVIS: 16.098 Use(s): flavoring agents | |
heptaphylline | |
CAS: 17750-35-5 Use(s): natural substances and extractives | |
heptatriacontane | |
CAS: 7194-84-5 Use(s): natural substances and extractives | |
heptelidic acid | |
CAS: 57710-57-3 Use(s): natural substances and extractives | |
(Z)-2- | hepten-1-yl acetate |
CAS: 83540-70-9 Use(s): natural substances and extractives | |
(E)-4- | hepten-2-yl salicylate |
CAS: 873888-85-8 Use(s): fragrance agents | |
(Z)-4- | hepten-2-yl salicylate |
CAS: 873888-84-7 Use(s): fragrance agents | |
2- | heptenal |
CAS: 2463-63-0 FLAVIS: 05.070 Use(s): flavor and fragrance agents | |
(E)-2- | heptenal |
CAS: 18829-55-5 FEMA: 3165 JECFA: 1360 FLAVIS: 05.150 Use(s): flavoring agents | |
(Z)-2- | heptenal |
CAS: 57266-86-1 Use(s): natural substances and extractives | |
3- | heptenal |
CAS: 89896-73-1 Use(s): natural substances and extractives | |
(E)-3- | heptenal |
CAS: 21662-20-4 Use(s): natural substances and extractives | |
(Z)-3- | heptenal |
CAS: 21662-18-0 Use(s): natural substances and extractives | |
4- | heptenal |
CAS: 62238-34-0 FEMA: 3289 Use(s): natural substances and extractives | |
(E)-4- | heptenal |
CAS: 929-22-6 FEMA: 3289 Use(s): natural substances and extractives | |
(Z)-4- | heptenal diethyl acetal |
CAS: 18492-65-4 FEMA: 3349 JECFA: 949 FLAVIS: 06.037 Use(s): flavor and fragrance agents | |
(Z)-4- | heptenal |
CAS: 6728-31-0 FEMA: 3289 JECFA: 320 FLAVIS: 05.085 Use(s): flavor and fragrance agents | |
4-oxo-2- | heptenal |
CAS: 55764-42-6 Use(s): information only not used for fragrances or flavors | |
4- | heptenal diethyl acetal |
CAS: 1192738-48-9 FEMA: 3349 JECFA: 949 FLAVIS: 06.037 Use(s): flavor and fragrance agents | |
(E)-4- | heptenal diethyl acetal |
CAS: 18492-66-5 JECFA: 949 FLAVIS: 06.037 Use(s): flavor and fragrance agents | |
(E)- | heptene |
CAS: 14686-14-7 Use(s): natural substances and extractives | |
2- | heptene |
CAS: 592-77-8 Use(s): natural substances and extractives | |
(E)-2- | heptene |
CAS: 14686-13-6 Use(s): information only not used for fragrances or flavors | |
(Z)-2- | heptene |
CAS: 6443-92-1 Use(s): information only not used for fragrances or flavors | |
3- | heptene |
CAS: 592-78-9 Use(s): natural substances and extractives | |
2- | heptenoic acid |
CAS: 18999-28-5 FEMA: 3920 FLAVIS: 08.083 Use(s): flavoring agents | |
(E)-2- | heptenoic acid |
CAS: 10352-88-2 FEMA: 3920 JECFA: 1373 FLAVIS: 08.123 Use(s): flavoring agents | |
(Z)-2- | heptenoic acid |
CAS: 1577-31-7 Use(s): natural substances and extractives | |
3- | heptenoic acid |
CAS: 29901-85-7 Use(s): information only not used for fragrances or flavors | |
(E)-3- | heptenoic acid |
CAS: 28163-84-0 Use(s): information only not used for fragrances or flavors | |
(Z)-3- | heptenoic acid |
CAS: 68676-74-4 Use(s): natural substances and extractives | |
4- | heptenoic acid |
CAS: 35194-37-7 Use(s): natural substances and extractives | |
(E)-4- | heptenoic acid |
CAS: 51193-78-3 Use(s): information only not used for fragrances or flavors | |
(Z)-4- | heptenoic acid |
CAS: 41653-95-6 Use(s): natural substances and extractives | |
6- | heptenoic acid |
CAS: 1119-60-4 Use(s): information only not used for fragrances or flavors | |
1- | hepten-4-ol |
CAS: 3521-91-3 Use(s): flavor and fragrance agents | |
2- | hepten-1-ol |
CAS: 22104-77-4 Use(s): flavor and fragrance agents | |
2- | hepten-4-ol |
CAS: 4798-59-8 Use(s): information only not used for fragrances or flavors | |
(E)-2- | hepten-1-ol |
CAS: 33467-76-4 FLAVIS: 02.151 Use(s): flavor and fragrance agents | |
(Z)-2- | hepten-1-ol |
CAS: 55454-22-3 Use(s): flavor and fragrance agents | |
3- | hepten-1-ol |
CAS: 10606-47-0 FLAVIS: 02.152 Use(s): flavoring agents | |
(E)-3- | hepten-1-ol |
CAS: 2108-05-6 Use(s): flavoring agents | |
(Z)-3- | hepten-1-ol |
CAS: 1708-81-2 Use(s): flavor and fragrance agents | |
4- | hepten-1-ol |
CAS: 20851-55-2 Use(s): natural substances and extractives | |
4- | hepten-2-ol |
CAS: 66642-85-1 Use(s): flavoring agents | |
(E)-4- | hepten-1-ol |
CAS: 24469-79-2 Use(s): flavor and fragrance agents | |
(E)-4- | hepten-2-ol |
CAS: 58927-81-4 Use(s): flavor and fragrance agents | |
(Z)-4- | hepten-1-ol |
CAS: 6191-71-5 FEMA: 3841 JECFA: 1280 FLAVIS: 02.249 Use(s): flavor and fragrance agents | |
(Z)-4- | hepten-2-ol |
CAS: 34146-55-9 FLAVIS: 02.255 Use(s): flavoring agents | |
6- | hepten-3-ol |
CAS: 19781-77-2 Use(s): natural substances and extractives | |
1- | hepten-3-ol |
CAS: 4938-52-7 FEMA: 4129 JECFA: 1842 FLAVIS: 02.155 Use(s): flavor and fragrance agents | |
1- | hepten-3-one |
CAS: 2918-13-0 Use(s): natural substances and extractives | |
2- | hepten-4-one |
CAS: 4643-25-8 FEMA: 3399 JECFA: 1126 FLAVIS: 07.104 Use(s): flavoring agents | |
(E)-2- | hepten-4-one |
CAS: 32397-56-1 Use(s): information only not used for fragrances or flavors | |
3- | hepten-2-one |
CAS: 1119-44-4 FEMA: 3400 JECFA: 1127 FLAVIS: 07.105 Use(s): flavor and fragrance agents | |
(E)-3- | hepten-2-one |
CAS: 5609-09-6 Use(s): natural substances and extractives | |
4- | hepten-3-one |
CAS: 762-40-3 Use(s): information only not used for fragrances or flavors | |
(E)-4- | hepten-2-one |
CAS: 24332-22-7 Use(s): natural substances and extractives | |
(E)-4- | hepten-3-one |
CAS: 65113-42-0 Use(s): information only not used for fragrances or flavors | |
(Z)-4- | hepten-2-one |
CAS: 38397-37-4 Use(s): natural substances and extractives | |
5- | hepten-2-one |
CAS: 6714-00-7 Use(s): natural substances and extractives | |
(Z)-5- | hepten-2-one |
CAS: 4535-61-9 Use(s): information only not used for fragrances or flavors | |
6- | hepten-1-yl 2-butenoate |
Use(s): information only not used for fragrances or flavors | |
1- | heptenyl acetate |
CAS: 35468-97-4 Use(s): natural substances and extractives | |
1- | hepten-3-yl acetate |
CAS: 35926-06-8 Use(s): natural substances and extractives | |
2- | hepten-1-yl acetate |
CAS: 1576-79-0 Use(s): information only not used for fragrances or flavors | |
(E)-2- | hepten-1-yl acetate |
CAS: 16939-73-4 FEMA: 4125 JECFA: 1798 FLAVIS: 09.385 Use(s): flavor and fragrance agents | |
3- | heptenyl acetate |
CAS: 34942-91-1 Use(s): natural substances and extractives | |
(E)-3- | hepten-1-yl acetate |
CAS: 1576-77-8 FEMA: 3493 JECFA: 135 FLAVIS: 09.275 Use(s): flavor and fragrance agents | |
(Z)-3- | hepten-1-yl acetate |
CAS: 1576-78-9 Use(s): flavor and fragrance agents | |
(Z)-4- | hepten-2-yl acetate |
CAS: 94088-33-2 FLAVIS: 09.386 Use(s): flavoring agents | |
(E)-3- | hepten-1-yl isobutyrate |
CAS: 207801-32-9 FEMA: 3494 JECFA: 191 FLAVIS: 09.528 Use(s): flavor and fragrance agents | |
3- | heptenyl isobutyrate |
CAS: 67801-45-0 FEMA: 3494 Use(s): flavor and fragrance agents | |
(Z)-4- | hepten-2-yl butyrate |
CAS: 94088-12-7 FLAVIS: 09.880 Use(s): flavoring agents | |
5-(6- | hepten-1-yl)dihydro-2(3H)-furanone |
CAS: 854737-08-9 Use(s): fragrance agents | |
6- | heptenyl isothiocyanate |
CAS: 49776-82-1 Use(s): natural substances and extractives | |
(E)-2- | hepten-1-yl isovalerate |
CAS: 94109-97-4 FEMA: 4126 Use(s): flavor and fragrance agents | |
2- | hepten-1-yl isovalerate |
CAS: 253596-70-2 FEMA: 4126 JECFA: 1799 FLAVIS: 09.303 Use(s): flavor and fragrance agents | |
heptyl acetate | |
CAS: 112-06-1 FEMA: 2547 JECFA: 129 FLAVIS: 09.022 Use(s): flavor and fragrance agents | |
3- | heptyl acetate |
CAS: 5921-83-5 FEMA: 3980 JECFA: 1143 FLAVIS: 09.924 Use(s): flavoring agents | |
iso | heptyl acetate |
CAS: 180348-60-1 FEMA: 4346 Use(s): flavoring agents | |
sec- | heptyl acetate |
CAS: 5921-82-4 FLAVIS: 09.388 Use(s): flavor and fragrance agents | |
heptyl acetoacetate | |
CAS: 42598-96-9 Use(s): information only not used for fragrances or flavors | |
heptyl amine | |
CAS: 111-68-2 Use(s): information only not used for fragrances or flavors | |
heptyl benzoate | |
CAS: 7155-12-6 Use(s): flavor and fragrance agents | |
2- | heptyl benzothiazole |
CAS: 69938-51-8 Use(s): natural substances and extractives | |
heptyl butyrate | |
CAS: 5870-93-9 FEMA: 2549 JECFA: 154 FLAVIS: 09.166 Use(s): flavor and fragrance agents | |
2- | heptyl butyrate |
CAS: 39026-94-3 FEMA: 3981 JECFA: 1144 FLAVIS: 09.923 Use(s): flavor and fragrance agents | |
heptyl isobutyrate | |
CAS: 2349-13-5 FEMA: 2550 JECFA: 190 FLAVIS: 09.420 Use(s): flavor and fragrance agents | |
alpha- | heptyl cinnamaldehyde |
CAS: 20175-19-3 Use(s): information only not used for fragrances or flavors | |
heptyl cinnamate | |
CAS: 10032-08-3 FEMA: 2551 JECFA: 666 FLAVIS: 09.782 Use(s): flavor and fragrance agents | |
heptyl crotonate | |
CAS: 16930-99-7 Use(s): flavoring agents | |
heptyl (E)-crotonate | |
CAS: 83783-78-2 Use(s): flavoring agents | |
(E)-2- | heptyl cyclopropane carboxylic acid |
CAS: 697290-77-0 FEMA: 4130 Use(s): flavoring agents | |
2- | heptyl cyclopropane carboxylic acid |
CAS: 1225070-56-3 FEMA: 4130 JECFA: 1907 Use(s): flavoring agents | |
(Z)-2- | heptyl cyclopropane carboxylic acid |
CAS: 697290-76-9 FLAVIS: 08.131 Use(s): flavoring agents | |
heptyl decanoate | |
CAS: 60160-17-0 Use(s): flavor and fragrance agents | |
3- | heptyl dihydro-5-methyl-2(3H)-furanone |
CAS: 40923-64-6 FEMA: 3350 JECFA: 244 FLAVIS: 10.026 Use(s): flavor and fragrance agents | |
2- | heptyl-4,5-dimethyl thiazole |
CAS: 87262-50-8 Use(s): natural substances and extractives | |
heptyl formate | |
CAS: 112-23-2 FEMA: 2552 JECFA: 121 FLAVIS: 09.074 Use(s): flavor and fragrance agents | |
2- | heptyl furan |
CAS: 3777-71-7 FEMA: 3401 JECFA: 1492 FLAVIS: 13.069 Use(s): flavor and fragrance agents | |
heptyl heptanoate | |
CAS: 624-09-9 FEMA: 4341 JECFA: 1875 Use(s): flavor and fragrance agents | |
heptyl hexanoate | |
CAS: 6976-72-3 FLAVIS: 09.390 Use(s): flavor and fragrance agents | |
sec- | heptyl hexanoate |
CAS: 6624-58-4 FLAVIS: 09.391 Use(s): flavoring agents | |
sec- | heptyl isovalerate |
CAS: 238757-71-6 FLAVIS: 09.304 Use(s): flavoring agents | |
heptyl mercaptan | |
CAS: 1639-09-4 FEMA: 4259 JECFA: 1663 FLAVIS: 12.130 Use(s): flavoring agents | |
heptyl 2-methyl butyrate | |
CAS: 50862-12-9 FLAVIS: 09.387 Use(s): flavoring agents | |
heptyl 2-methyl pentanoate | |
CAS: 6640-74-0 Use(s): natural substances and extractives | |
heptyl 4-methyl pentanoate | |
CAS: 35852-52-9 Use(s): natural substances and extractives | |
heptyl methyl sulfide | |
CAS: 20291-61-6 Use(s): information only not used for fragrances or flavors | |
heptyl nonanoate | |
CAS: 71605-85-1 Use(s): flavor and fragrance agents | |
heptyl octanoate | |
CAS: 4265-97-8 FEMA: 2553 JECFA: 176 FLAVIS: 09.118 Use(s): flavor and fragrance agents | |
heptyl oleate | |
CAS: 42254-63-7 Use(s): information only not used for fragrances or flavors | |
heptyl palmitate | |
CAS: 26718-83-2 Use(s): information only not used for fragrances or flavors | |
heptyl paraben | |
CAS: 1085-12-7 Use(s): inhibit microbiological spoilage | |
2- | heptyl phenol |
CAS: 5284-22-0 Use(s): information only not used for fragrances or flavors | |
4- | heptyl phenol |
CAS: 1987-50-4 Use(s): information only not used for fragrances or flavors | |
heptyl phenyl acetate | |
CAS: 39736-25-9 Use(s): information only not used for fragrances or flavors | |
heptyl propionate | |
CAS: 2216-81-1 Use(s): flavor and fragrance agents | |
2- | heptyl pyridine |
CAS: 20815-27-4 Use(s): information only not used for fragrances or flavors | |
6- | heptyl-alpha-pyrone |
Use(s): natural substances and extractives | |
heptyl resorcinol | |
CAS: 18979-65-2 Use(s): information only not used for fragrances or flavors | |
heptyl salicylate | |
CAS: 6259-77-4 Use(s): flavor and fragrance agents | |
heptyl stearate | |
CAS: 24466-84-0 Use(s): information only not used for fragrances or flavors | |
2- | heptyl tetrahydrofuran |
CAS: 2435-16-7 Use(s): fragrance agents | |
2- | heptyl thiazolidine |
CAS: 706-19-4 Use(s): natural substances and extractives | |
heptyl isothiocyanate | |
CAS: 4426-83-9 Use(s): flavoring agents | |
2- | heptyl thiophene |
CAS: 18794-78-0 Use(s): natural substances and extractives | |
3- | heptyl thiophene |
CAS: 65016-61-7 Use(s): flavoring agents | |
heptyl undecylenate | |
CAS: 68141-27-5 Use(s): cosmetic and fragrance agents | |
heptyl valerate | |
CAS: 5451-80-9 Use(s): fragrance agents | |
heptyl isovalerate | |
CAS: 56423-43-9 FLAVIS: 09.392 Use(s): flavor and fragrance agents | |
N- | heptylaminoundecanoic acid |
CAS: 68564-88-5 Use(s): indirect food additives: adhesives and components of coatings | |
heptylene oxide | |
CAS: 5063-65-0 Use(s): information only not used for fragrances or flavors | |
2- | heptylidene cyclopentanone |
CAS: 39189-74-7 Use(s): fragrance agents | |
heptylidene diacetate | |
CAS: 56438-09-6 Use(s): fragrance agents | |
1- | heptyne |
CAS: 628-71-7 Use(s): natural substances and extractives | |
heraclenin | |
CAS: 2880-49-1 Use(s): natural substances and extractives | |
heraclenol | |
CAS: 31575-93-6 Use(s): natural substances and extractives | |
herbacetin | |
CAS: 527-95-7 Use(s): natural food | |
herbal acetal | |
CAS: 54546-26-8 Use(s): fragrance agents | |
herbal carbonate | |
CAS: 61699-38-5 Use(s): fragrance agents | |
herbal carene | |
CAS: 3608-11-5 Use(s): fragrance agents | |
herbal cyclohexane | |
CAS: 67583-77-1 Use(s): fragrance agents | |
cis- | herbal cyclohexane |
CAS: 24691-15-4 Use(s): fragrance agents | |
trans- | herbal cyclohexane |
CAS: 24691-17-6 Use(s): fragrance agents | |
herbal cyclohexane acetyl anthranilate | |
CAS: 73486-91-6 Use(s): information only not used for fragrances or flavors | |
herbal cyclohexane butyrate | |
CAS: 94200-12-1 Use(s): information only not used for fragrances or flavors | |
herbal cyclohexane dipropylene glycol | |
CAS: 73987-16-3 Use(s): information only not used for fragrances or flavors | |
herbal cyclohexane formate | |
CAS: 24442-68-0 Use(s): information only not used for fragrances or flavors | |
herbal cyclohexane phenyl acetate | |
CAS: 67859-97-6 Use(s): information only not used for fragrances or flavors | |
herbal dioxane | |
CAS: 3583-00-4 Use(s): fragrance agents | |
herbal ethanone | |
CAS: 42370-07-0 Use(s): fragrance agents | |
herbal heptane | |
CAS: 122795-41-9 Use(s): fragrance agents | |
herbal ketone | |
CAS: 67801-33-6 Use(s): fragrance agents | |
herbal norbornane | |
CAS: 66062-78-0 Use(s): fragrance agents | |
herbal pyran | |
CAS: 18871-14-2 Use(s): fragrance agents | |
herbal undecane | |
CAS: 6413-26-9 Use(s): fragrance agents | |
herbal undecanol | |
CAS: 68228-06-8 Use(s): fragrance agents | |
herbal undecanone | |
CAS: 41724-19-0 Use(s): fragrance agents | |
herbanate (Givaudan) | |
CAS: 116126-82-0 Use(s): fragrance agents | |
herbane | |
CAS: 5421-99-8 Use(s): information only not used for fragrances or flavors | |
herbarin | |
CAS: 36379-67-6 Use(s): natural substances and extractives | |
herboxidiene | |
CAS: 142861-00-5 Use(s): information only not used for fragrances or flavors | |
(E)- | herclavine |
CAS: 539-18-4 Use(s): natural substances and extractives | |
hericene A | |
CAS: 157207-54-0 Use(s): natural substances and extractives | |
hericene B | |
CAS: 157207-55-1 Use(s): natural substances and extractives | |
hericene C | |
CAS: 157207-56-2 Use(s): natural substances and extractives | |
hericenone A | |
CAS: 126654-52-2 Use(s): natural substances and extractives | |
hericenone B | |
CAS: 126654-53-3 Use(s): natural substances and extractives | |
hericenone C | |
CAS: 137592-03-1 Use(s): natural substances and extractives | |
hericenone D | |
CAS: 137592-04-2 Use(s): natural substances and extractives | |
hericenone E | |
CAS: 137592-05-3 Use(s): natural substances and extractives | |
hericenone F | |
CAS: 141996-36-3 Use(s): natural substances and extractives | |
hericenone G | |
CAS: 141973-36-6 Use(s): natural substances and extractives | |
hericenone H | |
CAS: 141973-37-7 Use(s): natural substances and extractives | |
hericerin | |
CAS: 140381-53-9 Use(s): natural substances and extractives | |
herierin III | |
CAS: 131123-56-3 Use(s): natural substances and extractives | |
heritonin | |
CAS: 123914-48-7 Use(s): natural substances and extractives | |
hernandulcin | |
CAS: 95602-94-1 Use(s): natural substances and extractives | |
(±)-epi | hernandulcin |
CAS: 95672-95-0 Use(s): natural substances and extractives | |
hesperaline | |
CAS: 15797-38-3 Use(s): natural substances and extractives | |
hesperetin | |
CAS: 520-33-2 JECFA: 2024 FLAVIS: 16.097 Use(s): cosmetic and flavor agents | |
(R,S)- | hesperetin |
CAS: 69097-99-0 FEMA: 4313 Use(s): flavoring agents | |
hesperetin dihydrochalcone | |
CAS: 35400-60-3 FEMA: 4872 Use(s): flavoring agents | |
hesperidin | |
CAS: 520-26-3 Use(s): cosmetic and flavor agents | |
(R)- | hesperidin |
CAS: 369593-42-0 Use(s): natural substances and extractives | |
neo | hesperidin |
CAS: 13241-33-3 Use(s): natural substances and extractives | |
neo | hesperidin dihydrochalcone |
CAS: 20702-77-6 FEMA: 3811 FLAVIS: 16.061 Use(s): cosmetic and flavor agents | |
neo | hesperidose |
CAS: 17074-02-1 Use(s): information only not used for fragrances or flavors | |
neo | hesperidose heptaacetate |
CAS: 19949-47-4 Use(s): information only not used for fragrances or flavors | |
heteroartonin A | |
CAS: 170894-23-2 Use(s): natural substances and extractives | |
heterobetulin | |
CAS: 74715-49-4 Use(s): natural substances and extractives | |
heterodendrin | |
CAS: 66465-22-3 Use(s): natural substances and extractives | |
epi | heterodendrin |
CAS: 57103-47-6 Use(s): natural substances and extractives | |
heteroflavanone A | |
CAS: 151171-28-7 Use(s): natural substances and extractives | |
heteroflavanone B | |
CAS: 151171-29-8 Use(s): natural substances and extractives | |
heteroflavanone C | |
CAS: 156127-36-5 Use(s): natural substances and extractives | |
heteronemin | |
CAS: 62008-04-2 Use(s): natural substances and extractives | |
heterophylliin A | |
CAS: 87687-52-3 Use(s): natural substances and extractives | |
heterophylol | |
CAS: 152841-81-1 Use(s): natural substances and extractives | |
hexacosanal | |
CAS: 26627-85-0 Use(s): natural substances and extractives | |
hexacosane | |
CAS: 630-01-3 Use(s): natural substances and extractives | |
1,26- | hexacosanediol |
CAS: 15541-01-2 Use(s): natural substances and extractives | |
1- | hexacosanol |
CAS: 506-52-5 Use(s): flavor and fragrance agents | |
1- | hexacosene |
CAS: 18835-33-1 Use(s): natural substances and extractives | |
(Z,Z)-11,13- | hexadecadienal |
CAS: 71317-73-2 Use(s): natural substances and extractives | |
7,10- | hexadecadienoic acid |
CAS: 2936-83-6 Use(s): natural substances and extractives | |
(E,E)-10,12- | hexadecadien-1-ol |
CAS: 765-19-5 Use(s): natural substances and extractives | |
(E,Z)-10,12- | hexadecadien-1-ol |
CAS: 1002-94-4 Use(s): natural substances and extractives | |
(Z,E)-10,12- | hexadecadien-1-ol |
CAS: 765-17-3 Use(s): natural substances and extractives | |
(Z,Z)-11,13- | hexadecadien-1-ol |
CAS: 71720-83-7 Use(s): natural substances and extractives | |
(Z,Z)/(Z,E)-7-11- | hexadecadien-1-yl acetate |
CAS: 50933-33-0 Use(s): natural substances and extractives | |
hexadecanal | |
CAS: 629-80-1 FLAVIS: 05.152 Use(s): natural substances and extractives | |
iso | hexadecanal |
CAS: 62028-96-0 Use(s): natural substances and extractives | |
hexadecanal diethyl acetal | |
CAS: 761-60-4 Use(s): information only not used for fragrances or flavors | |
hexadecanal dimethyl acetal | |
CAS: 2791-29-9 Use(s): information only not used for fragrances or flavors | |
hexadecane | |
CAS: 544-76-3 FLAVIS: 01.072 Use(s): fragrance agents | |
hexadecane dioic acid | |
CAS: 505-54-4 Use(s): natural substances and extractives | |
iso | hexadecanoic acid |
CAS: 32844-67-0 Use(s): information only not used for fragrances or flavors | |
3-oxo | hexadecanoic acid glyceride (palm oil glycerides mono- and di- hydrogenated) |
CAS: 91052-71-0 FEMA: 3769 JECFA: 917 FLAVIS: 09.554 Use(s): emulsifiers, flavoring agents | |
3-oxo | hexadecanoic acid glyceride |
CAS: 128331-46-4 Use(s): emulsifiers, flavoring agents | |
hexadecanol | |
CAS: 36653-82-4 FEMA: 2554 JECFA: 114 FLAVIS: 02.009 Use(s): cosmetic, flavor and fragrance agents | |
2- | hexadecanol |
CAS: 14852-31-4 Use(s): flavor and fragrance agents | |
15- | hexadecanolide |
CAS: 69297-56-9 Use(s): natural substances and extractives | |
2- | hexadecanone |
CAS: 18787-63-8 Use(s): natural substances and extractives | |
3- | hexadecanone |
CAS: 18787-64-9 Use(s): natural substances and extractives | |
4- | hexadecanone |
CAS: 18787-65-0 Use(s): information only not used for fragrances or flavors | |
5- | hexadecanone |
CAS: 41903-81-5 Use(s): information only not used for fragrances or flavors | |
6- | hexadecanone |
CAS: 57661-23-1 Use(s): information only not used for fragrances or flavors | |
7- | hexadecanone |
CAS: 45206-91-5 Use(s): information only not used for fragrances or flavors | |
8- | hexadecanone |
CAS: 18277-02-6 Use(s): information only not used for fragrances or flavors | |
hexadecanophenone | |
CAS: 6697-12-7 Use(s): information only not used for fragrances or flavors | |
N- | hexadecanoylpyrrolidine |
CAS: 70974-48-0 Use(s): natural substances and extractives | |
(Z,Z,Z)-7,10,13- | hexadecatrienal |
CAS: 56797-43-4 Use(s): natural substances and extractives | |
(E)-11- | hexadecenal |
CAS: 57491-33-5 Use(s): natural substances and extractives | |
(E)-2- | hexadecenal |
CAS: 22644-96-8 Use(s): natural substances and extractives | |
(Z)-7- | hexadecenal |
CAS: 56797-40-1 Use(s): natural substances and extractives | |
(Z)-9- | hexadecenal |
CAS: 56219-04-6 Use(s): natural substances and extractives | |
(Z)-11- | hexadecenal |
CAS: 53939-28-9 Use(s): natural substances and extractives | |
hexadecene | |
CAS: 26952-14-7 Use(s): solvents | |
1- | hexadecene |
CAS: 629-73-2 Use(s): natural substances and extractives | |
2- | hexadecene |
CAS: 26741-29-7 Use(s): natural substances and extractives | |
5- | hexadecene |
CAS: 53137-47-6 Use(s): natural substances and extractives | |
7- | hexadecene |
CAS: 18899-19-9 Use(s): natural substances and extractives | |
iso | hexadecene |
CAS: 85909-49-5 Use(s): information only not used for fragrances or flavors | |
(Z)-7- | hexadecene dioic acid |
CAS: 253687-18-2 Use(s): information only not used for fragrances or flavors | |
(E)-2- | hexadecenoic acid |
CAS: 629-56-1 Use(s): information only not used for fragrances or flavors | |
(Z)-2- | hexadecenoic acid |
CAS: 28039-99-8 Use(s): information only not used for fragrances or flavors | |
(E)-3- | hexadecenoic acid |
CAS: 2457-70-7 Use(s): information only not used for fragrances or flavors | |
cis-6- | hexadecenoic acid |
CAS: 17004-51-2 Use(s): emollients, skin conditioning | |
trans-6- | hexadecenoic acid |
CAS: 28290-76-8 Use(s): natural substances and extractives | |
(Z)-7- | hexadecenoic acid |
CAS: 2416-19-5 Use(s): natural substances and extractives | |
(E)-9- | hexadecenoic acid |
CAS: 10030-73-6 Use(s): information only not used for fragrances or flavors | |
(Z)-9- | hexadecenoic acid |
CAS: 373-49-9 Use(s): indirect food additives: adhesives and components of coatings | |
(E)-11- | hexadecenoic acid |
CAS: 2271-34-3 Use(s): natural substances and extractives | |
(Z)-11- | hexadecenoic acid |
CAS: 2416-20-8 Use(s): natural substances and extractives | |
15- | hexadecenoic acid |
CAS: 4675-57-4 Use(s): information only not used for fragrances or flavors | |
(E)-11- | hexadecen-1-ol |
CAS: 61301-56-2 Use(s): information only not used for fragrances or flavors | |
(Z)-11- | hexadecen-1-ol |
CAS: 56683-54-6 Use(s): natural substances and extractives | |
(E)-11- | hexadecen-1-yl acetate |
CAS: 56218-72-5 Use(s): information only not used for fragrances or flavors | |
(Z)-11- | hexadecen-1-yl acetate |
CAS: 34010-21-4 Use(s): natural substances and extractives | |
hexadecyl 5-methyl-2-furoate | |
CAS: 1687726-81-3 Use(s): information only not used for fragrances or flavors | |
hexadecyl ferulate | |
CAS: 64190-80-3 Use(s): natural substances and extractives | |
hexadecyl hexadecenoate | |
CAS: 71788-99-3 Use(s): natural substances and extractives | |
hexadecyl neodecanoate | |
CAS: 67749-11-5 Use(s): information only not used for fragrances or flavors | |
1- | hexadecyne |
CAS: 629-74-3 Use(s): natural substances and extractives | |
1,5- | hexadien-3-ol |
CAS: 924-41-4 Use(s): natural substances and extractives | |
2,4- | hexadienal |
CAS: 80466-34-8 Use(s): flavoring agents | |
(E,E)-2,4- | hexadienal |
CAS: 142-83-6 FEMA: 3429 JECFA: 1175 FLAVIS: 05.057 Use(s): cosmetic and flavor agents | |
(E,Z)-2,4- | hexadienal |
CAS: 53398-76-8 Use(s): natural substances and extractives | |
hexadienal diethyl acetal | |
CAS: 27310-22-1 Use(s): fragrance agents | |
(E)-1,3- | hexadiene |
CAS: 20237-34-7 Use(s): information only not used for fragrances or flavors | |
(Z)-1,3- | hexadiene |
CAS: 14596-92-0 Use(s): natural substances and extractives | |
(E)-1,4- | hexadiene |
CAS: 7319-00-8 Use(s): natural substances and extractives | |
(Z)-1,4- | hexadiene |
CAS: 7318-67-4 Use(s): information only not used for fragrances or flavors | |
2,4- | hexadien-1-ol |
CAS: 111-28-4 FEMA: 3922 JECFA: 1174 FLAVIS: 02.162 Use(s): flavoring agents and cosmetic fragrance agents | |
(E,E)-2,4- | hexadien-1-ol |
CAS: 17102-64-6 Use(s): flavoring agents | |
(E)-2-(3,5- | hexadienyl)-5-methyl furan |
CAS: 5159-44-4 Use(s): information only not used for fragrances or flavors | |
hexadienylidene acetone | |
CAS: 17609-32-4 Use(s): information only not used for fragrances or flavors | |
1,5- | hexadiyne |
CAS: 628-16-0 Use(s): natural substances and extractives | |
2-(2,4- | hexadiynylidene)-1,6-dioxaspiro(4.4)non-3-ene |
CAS: 16863-61-9 Use(s): natural substances and extractives | |
(E)-2-(2,4- | hexadiynylidene)-1,6-dioxaspiro[4.5]dec-3-ene |
CAS: 3306-40-9 Use(s): natural substances and extractives | |
hexafluoropropene | |
CAS: 116-15-4 Use(s): indirect food additives: adhesives and components of coatings | |
2,3,5,6,8,8a- | hexahydro-2,5,5,8a-tetramethyl-7H-1-benzopyran-7-one |
CAS: 20194-67-6 Use(s): natural substances and extractives | |
hexahydro-2',4-dimethylspiro[1,3-dithiolo[4,5-c]furan-2,3'(2'H)-furan] | |
CAS: 38325-26-7 Use(s): information only not used for fragrances or flavors | |
4,4a,5,6,7,8- | hexahydro-4a,8-dimethyl naphthalen-2(3H)-one |
CAS: 4071-63-0 Use(s): information only not used for fragrances or flavors | |
1,2,3,4,5,6- | hexahydro-5-methyl-7H-cyclopenta[b]pyridin-7-one |
CAS: 104704-29-2 Use(s): information only not used for fragrances or flavors | |
1,2,3,4,5,6- | hexahydro-6-methyl-7H-cyclopenta[b]pyridin-7-one |
CAS: 104704-38-3 Use(s): information only not used for fragrances or flavors | |
hexahydro-6,7-dihydroxy-5-(hydroxymethyl)-3-(2-hydroxyphenyl)-2H-pyrano[2,3-d]oxazol-2-one | |
CAS: 396714-67-3 Use(s): natural substances and extractives | |
2,3,4,5,6,7- | hexahydro-7-methylcyclopent[b]azepin-8(1H)-one |
CAS: 97826-66-9 Use(s): information only not used for fragrances or flavors | |
1,2,3,4,5,6- | hexahydro-7H-cyclopenta[b]pyridin-7-one |
CAS: 104704-30-5 Use(s): information only not used for fragrances or flavors | |
hexahydrobenzofuranone | |
CAS: 6051-03-2 Use(s): flavor and fragrance agents | |
hexahydrocoumarin | |
CAS: 700-82-3 Use(s): information only not used for fragrances or flavors | |
2,3,4,5,6,7- | hexahydrocyclopent[b]azepin-8(1H)-one |
CAS: 81978-77-0 Use(s): information only not used for fragrances or flavors | |
3a,4,5,6,7,7a- | hexahydrodimethyl-4,7-methano-1H-inden-5-ol |
CAS: 79771-15-6 Use(s): fragrance agents | |
3',6- | hexahydrodimethyl spiromethanonaphthalene oxirane |
CAS: 41723-98-2 Use(s): fragrance agents | |
hexahydrofarnesol | |
CAS: 6750-34-1 Use(s): flavor and fragrance agents | |
hexahydrofarnesyl acetone | |
CAS: 502-69-2 FLAVIS: 07.205 Use(s): flavor and fragrance agents | |
3a,5,6,7,8,8b- | hexahydro-2,2,6,6,7,8,8-heptamethyl-4H-indeno(4,5-d)-1,3-dioxole |
CAS: 823178-41-2 Use(s): fragrance agents | |
3a,3b,5,6,7,8a- | hexahydro-2,2,3a,3b,7,7-hexamethyl-4H-indeno[1,2-D]-1,3-dioxole |
Use(s): fragrance agents | |
hexahydro-beta-ionone methyl derivative | |
CAS: 69834-09-9 Use(s): information only not used for fragrances or flavors | |
(15Z,9'Z)-7,7',8,8',11,12- | hexahydrolycopene |
CAS: 72746-34-0 Use(s): natural substances and extractives | |
hexahydromethanoinden-5-yl pivalate | |
CAS: 68039-45-2 Use(s): fragrance agents | |
hexahydromethanoinden-5-yl propionate | |
CAS: 67634-24-6 Use(s): fragrance agents | |
((3a,4,5,6,7,7a- | hexahydro-4,7-methano-1H-inden-5(or 6)-yl)oxy) acetaldehyde |
CAS: 94248-38-1 Use(s): fragrance agents | |
hexahydromethanoinden-6-ol | |
CAS: 3385-61-3 Use(s): fragrance agents | |
hexahydromethanoinden-6-yl isopentenol | |
CAS: 126646-06-8 Use(s): fragrance agents | |
((3a,4,5,6,7,7a- | hexahydro-4,7-methano-1H-inden-6-yl)oxy) acetaldehyde |
CAS: 72927-85-6 Use(s): fragrance agents | |
hexahydromethanoindene | |
CAS: 4488-57-7 Use(s): fragrance agents | |
3a,4,5,6,7,7a- | hexahydro-,4,7-methano-1H-indenecarboxaldehyde reaction products with Me Et ketone, acid-isomerized, reduced |
CAS: 727414-17-7 Use(s): fragrance agents | |
hexahydromethanoindene-5-ylidene-2-butanol | |
CAS: 105304-56-1 Use(s): fragrance agents | |
hexahydromethanoindenyl formate | |
CAS: 68683-22-7 Use(s): fragrance agents | |
hexahydromethanoindenyl isobutyrate | |
CAS: 93941-73-2 Use(s): fragrance agents | |
4,4a,6,7,8,8a- | hexahydro-1,4-methanonaphthalen-5(1H)-one |
CAS: 51519-65-4 Use(s): fragrance agents | |
hexahydromethoxymethanoindenes | |
CAS: 27135-90-6 Use(s): fragrance agents | |
3- | hexahydromethyl methylene methanohinden-6-yl acetate |
CAS: 81836-13-7 Use(s): fragrance agents | |
1,2,3,4,5,8- | hexahydronaphthalene |
CAS: 36231-13-7 Use(s): information only not used for fragrances or flavors | |
2,3,4,5,6,7- | hexahydro-1,1,2,3,3-pentamethyl-1H-indene |
CAS: 33704-59-5 Use(s): information only not used for fragrances or flavors | |
5,5a,6,7,8,8a- | hexahydro-6,6,7,8,8-pentamethyl-4H-indeno[5,4-D]isoxazole |
Use(s): information only not used for fragrances or flavors | |
(cis+trans)-6,6a,7,8,9,9a- | hexahydro-7,7,8,9,9-pentamethyl-5H-cyclopenta[H]quinazoline |
Use(s): fragrance agents | |
hexahydrophthalic anhydride | |
CAS: 85-42-7 Use(s): information only not used for fragrances or flavors | |
hexahydrotetramethyl epoxymethanoazulene | |
CAS: 67710-71-8 Use(s): fragrance agents | |
hexahydrotetramethyl methanoazulen-5-yl methyl ketone | |
CAS: 68039-35-0 Use(s): fragrance agents | |
hexahydro-1,1,5,5-tetramethyl-2H-2,4a-methanonaphthalen-6(5H)-one | |
CAS: 67952-58-3 Use(s): information only not used for fragrances or flavors | |
1,2,3,4,5,6- | hexahydro-1,1,5,5-tetramethyl-7H-2,4a-methanonaphthalen-7-one |
CAS: 23747-14-0 Use(s): information only not used for fragrances or flavors | |
1,3,4,5,6,7- | hexahydro-1,1,5,5-tetramethyl-2H-2,4a-methanonaphthalen-7-yl acetate |
CAS: 32213-88-0 Use(s): information only not used for fragrances or flavors | |
1,3,4,5,6,7- | hexahydro-1,1,5,5-tetramethyl-2H-2,4a-methanonaphthalen-7-yl formate |
CAS: 67874-82-2 Use(s): information only not used for fragrances or flavors | |
hexahydrotetramethyl methanonaphthalen-8-one | |
CAS: 29461-13-0 Use(s): fragrance agents | |
(2S)-1,3,4,5,6,7- | hexahydro-1,1,5,5-tetramethyl-2H-2,4a-methanonaphthalene-8-carbaldehyde |
CAS: 61826-54-8 Use(s): information only not used for fragrances or flavors | |
hexahydrotetramethyl methanonaphthalene-8-methanol | |
CAS: 61826-53-7 Use(s): fragrance agents | |
hexahydrotetramethyl methanonaphthalene-8-methyl acetate | |
CAS: 61826-56-0 Use(s): fragrance agents | |
hexahydrotetramethyl methanonaphthalene-8-methyl formate | |
CAS: 61826-52-6 Use(s): fragrance agents | |
hexahydro-1',1',5',5'-tetramethyl-spiro(1,3-dioxolane-2,8'(5'H)-(2H-2,4a)methanonaphthalene) | |
CAS: 154171-76-3 Use(s): fragrance agents | |
1-(1,3,4,5,6,7- | hexahydro-1,1,5,5-tetramethyl-2H-2,4a-methanonaphthalen-8-yl) ethan-1-one |
CAS: 59056-71-2 Use(s): information only not used for fragrances or flavors | |
hexahydrotrimethyl ethanonaphthalen-8-yl methyl ketone | |
CAS: 32388-56-0 Use(s): fragrance agents | |
1-(2,3,3a,4,5,6- | hexahydro-1,1,3-trimethyl-1H-inden-5-yl) ethan-1-one |
CAS: 77628-62-7 Use(s): information only not used for fragrances or flavors | |
3,4- | hexahydroxydiphenoylarabinose |
CAS: 19833-16-0 Use(s): natural substances and extractives | |
3,3',4',5,5',8- | hexahydroxyflavone |
CAS: 90332-28-8 Use(s): natural substances and extractives | |
delta- | hexalactone |
CAS: 823-22-3 FEMA: 3167 JECFA: 224 FLAVIS: 10.010 Use(s): flavor and fragrance agents | |
(R)-delta- | hexalactone |
CAS: 43112-32-9 Use(s): information only not used for fragrances or flavors | |
(S)-delta- | hexalactone |
CAS: 16320-13-1 Use(s): information only not used for fragrances or flavors | |
gamma- | hexalactone |
CAS: 695-06-7 FEMA: 2556 JECFA: 223 FLAVIS: 10.021 Use(s): flavor and fragrance agents | |
(R)-gamma- | hexalactone |
CAS: 63357-95-9 Use(s): information only not used for fragrances or flavors | |
(S)-gamma- | hexalactone |
CAS: 41035-07-8 Use(s): information only not used for fragrances or flavors | |
5,6,7,3',4',5'- | hexamethoxyflavone |
CAS: 29043-07-0 Use(s): natural substances and extractives | |
1,3,3,4,5,6- | hexamethyl bicyclo(2.2.2)oct-5-en-2-one |
Use(s): information only not used for fragrances or flavors | |
2,3,4,5,6,6- | hexamethyl-2,4-cyclohexadien-1-one |
CAS: 3854-96-4 Use(s): information only not used for fragrances or flavors | |
1,3,3,4,5,6- | hexamethyl-2-ethyl bicyclo(2.2.2)-5-octen-2-ol |
Use(s): information only not used for fragrances or flavors | |
1,1,2,3,3,5- | hexamethyl-2,3,3a,4,5,9b-hexahydro-1H-7,9-diazacyclopenta[a]naphthalene |
Use(s): information only not used for fragrances or flavors | |
6-oxa-1,1,2,3,3,8- | hexamethyl-2,3,5,6,7,8-hexahydro-1H-benz(f)indene |
Use(s): information only not used for fragrances or flavors | |
2,6,6,7,8,8- | hexamethyl-5,5a,6,7,8,8a-hexahydro-4H-3-thia-1-aza-as-indacene |
Use(s): information only not used for fragrances or flavors | |
5,7,7,8,10,10- | hexamethyl-5,6,7,8,9,10-hexahydrobenzo[h]quinazoline |
Use(s): information only not used for fragrances or flavors | |
6-oxa-1,1,2,3,3,8- | hexamethyl-2,3,5,6,7,8-hexamethyl-2,3,5,6,7,8-hexahydro-1H-benz[f]indene |
Use(s): information only not used for fragrances or flavors | |
beta,1,1,2,3,3- | hexamethyl indan-5-ethanol |
CAS: 1217-08-9 Use(s): fragrance agents | |
5,7,7,8,10,10- | hexamethyl-5,6,6a,7,8,9,10,10a-octahydrobenzo[h]quinazoline |
Use(s): information only not used for fragrances or flavors | |
(1aR,4S,7aS)-1a,3,3,4,6,6- | hexamethyl-1a,2,3,4,5,6,7,7a-octahydronaphtho[2,3-b]oxirene |
CAS: NF0127 Use(s): fragrance agents | |
1,1,2,3,3,5- | hexamethyl-2,3,4,5-tetrahydro-1H-7,9-diazacyclopenta[a]naphthalene |
Use(s): information only not used for fragrances or flavors | |
2,6,6,7,8,8- | hexamethyl-5,6,7,8-tetrahydro-4H-3-thia-1-aza-as-indacene |
Use(s): information only not used for fragrances or flavors | |
1,3,3,4,5,6- | hexamethyl(2.2.2)bicyclooct-5-en-2-ol |
Use(s): information only not used for fragrances or flavors | |
1,4,5,5,8,9- | hexamethylbicyclo[4.3.0]non-8-en-7-one |
Use(s): information only not used for fragrances or flavors | |
hexamethyldisilazane | |
CAS: 999-97-3 Use(s): indirect food additives: adhesives and components of coatings | |
hexamethylene bis(3,5-di-tert-butyl-4-hydroxyhydrocinnamate) | |
CAS: 35074-77-2 Use(s): indirect food additives: adhesives and components of coatings | |
hexamethylene diamine | |
CAS: 124-09-4 Use(s): indirect food additives: adhesives and components of coatings | |
hexamethylene tetramine | |
CAS: 100-97-0 Use(s): antimicrobial agents | |
1,6- | hexamethylene-bis(3-(3,5-di-tert-butyl-4-hydroxyphenyl)propionamide) |
CAS: 23128-74-7 Use(s): indirect food additives: adhesives and components of coatings | |
hexamethylgossypetin | |
CAS: 7741-47-1 Use(s): natural substances and extractives | |
hexanal (aldehyde C-6) | |
CAS: 66-25-1 FEMA: 2557 JECFA: 92 FLAVIS: 05.008 Use(s): flavor and fragrance agents | |
iso | hexanal |
CAS: 1119-16-0 FLAVIS: 05.166 Use(s): flavoring agents | |
hexanal butane-2,3-diol acetal | |
CAS: 155639-75-1 FEMA: 4384 JECFA: 1737 Use(s): flavoring agents | |
hexanal 1,3-butylene glycol acetal | |
CAS: 5455-66-3 Use(s): information only not used for fragrances or flavors | |
hexanal dibutyl acetal | |
CAS: 93892-07-0 Use(s): fragrance agents | |
hexanal diethyl acetal | |
CAS: 3658-93-3 FLAVIS: 06.023 Use(s): flavor and fragrance agents | |
hexanal dihexyl acetal | |
CAS: 33673-65-3 FEMA: 4370 JECFA: 1738 Use(s): flavor and fragrance agents | |
hexanal diisoamyl acetal | |
CAS: 93892-09-2 Use(s): information only not used for fragrances or flavors | |
hexanal dimethyl acetal | |
CAS: 1599-47-9 FLAVIS: 06.073 Use(s): flavor and fragrance agents | |
hexanal 1,3-dithiane | |
CAS: 21777-32-2 Use(s): information only not used for fragrances or flavors | |
hexanal hexyl isoamyl acetal | |
CAS: 896447-13-5 FEMA: 4369 JECFA: 1735 Use(s): flavor and fragrance agents | |
hexanal octane-1,3-diol acetal | |
CAS: 202188-46-3 FEMA: 4377 JECFA: 1736 Use(s): flavoring agents | |
hexanal propylene glycol acetal | |
CAS: 1599-49-1 FEMA: 3630 JECFA: 928 FLAVIS: 06.094 Use(s): flavor and fragrance agents | |
cis- | hexanal propylene glycol acetal |
CAS: 26563-74-6 FEMA: 3630 Use(s): flavor and fragrance agents | |
trans- | hexanal propylene glycol acetal |
CAS: 26563-75-7 Use(s): natural substances and extractives | |
hexanal sulfided | |
Use(s): flavoring agents | |
hexane | |
CAS: 110-54-3 Use(s): extraction solvents | |
hexane branched and linear | |
CAS: 92112-69-1 Use(s): information only not used for fragrances or flavors | |
(S,S)-2,5- | hexane diol |
CAS: 34338-96-0 Use(s): information only not used for fragrances or flavors | |
1,6- | hexane diol |
CAS: 629-11-8 Use(s): solvents | |
2,5- | hexane diol |
CAS: 2935-44-6 Use(s): solvents | |
2,4- | hexane dione |
CAS: 3002-24-2 Use(s): information only not used for fragrances or flavors | |
3,4- | hexane dione |
CAS: 4437-51-8 FEMA: 3168 JECFA: 413 FLAVIS: 07.077 Use(s): flavor and fragrance agents | |
1,6- | hexane dithiol |
CAS: 1191-43-1 FEMA: 3495 JECFA: 540 FLAVIS: 12.067 Use(s): flavoring agents | |
3,4- | hexane dithiol |
CAS: NF0083 Use(s): information only not used for fragrances or flavors | |
hexane nitrile | |
CAS: 628-73-9 Use(s): fragrance agents | |
1,2,6- | hexane triol |
CAS: 106-69-4 Use(s): cosmetic agents | |
hexanedioic acid, polymer with 1,3-butanediol and 1,2-propanediol, 2-ethylhexyl ester | |
CAS: 73018-26-5 Use(s): indirect food additives: adhesives and components of coatings | |
2(3)- | hexanethiol |
CAS: 1679-06-7 FEMA: 4782 Use(s): flavoring agents | |
hexanoic acid | |
CAS: 142-62-1 FEMA: 2559 JECFA: 93 FLAVIS: 08.009 Use(s): flavor and fragrance agents | |
2-oxo | hexanoic acid |
CAS: 2492-75-3 Use(s): information only not used for fragrances or flavors | |
3-oxo | hexanoic acid glyceride |
CAS: 91052-72-1 FEMA: 3770 JECFA: 910 FLAVIS: 09.555 Use(s): emulsifiers, flavoring agents | |
hexanoic anhydride | |
CAS: 2051-49-2 Use(s): natural substances and extractives | |
hexanol | |
CAS: 111-27-3 FEMA: 2567 JECFA: 91 FLAVIS: 02.005 Use(s): cosmetic, flavor and fragrance agents | |
2- | hexanol |
CAS: 626-93-7 FLAVIS: 02.163 Use(s): flavor and fragrance agents | |
(R)-(-)-2- | hexanol |
CAS: 26549-24-6 Use(s): flavoring agents | |
(S)-(+)-2- | hexanol |
CAS: 52019-78-0 Use(s): flavoring agents | |
3- | hexanol |
CAS: 623-37-0 FEMA: 3351 JECFA: 282 FLAVIS: 02.089 Use(s): flavor and fragrance agents | |
(R)-3- | hexanol |
CAS: 13471-42-6 Use(s): information only not used for fragrances or flavors | |
(S)-3- | hexanol |
CAS: 6210-51-1 Use(s): information only not used for fragrances or flavors | |
3- | hexanone |
CAS: 589-38-8 FEMA: 3290 JECFA: 281 FLAVIS: 07.096 Use(s): flavor and fragrance agents | |
hexanophenone | |
CAS: 942-92-7 Use(s): information only not used for fragrances or flavors | |
hexatetracontane | |
CAS: 7098-24-0 Use(s): information only not used for fragrances or flavors | |
1,2,3,4,5,6- | hexathiepane |
CAS: 17233-71-5 Use(s): natural substances and extractives | |
1,2,3,5,6,8- | hexathionane |
CAS: 103439-80-1 Use(s): natural substances and extractives | |
1,2,4,5,7,8- | hexathionane |
CAS: 81531-38-6 Use(s): natural substances and extractives | |
hexatriacontane | |
CAS: 630-06-8 Use(s): natural substances and extractives | |
2- | hexenal |
CAS: 505-57-7 FEMA: 2560 FLAVIS: 05.189 Use(s): flavoring agents | |
(E)-2- | hexenal |
CAS: 85761-70-2 Use(s): flavoring agents | |
(E)-2- | hexenal |
CAS: 6728-26-3 FEMA: 2560 JECFA: 1353 FLAVIS: 05.073 Use(s): flavor and fragrance agents | |
(Z)-2- | hexenal |
CAS: 16635-54-4 Use(s): flavoring agents | |
3- | hexenal |
CAS: 4440-65-7 JECFA: 1271 FLAVIS: 05.192 Use(s): flavor and fragrance agents | |
(E)-3- | hexenal |
CAS: 69112-21-6 Use(s): flavoring agents | |
(Z)-3- | hexenal |
CAS: 6789-80-6 FEMA: 2561 JECFA: 316 FLAVIS: 05.075 Use(s): flavor and fragrance agents | |
4- | hexenal |
CAS: 2100-19-8 Use(s): natural substances and extractives | |
(E)-4- | hexenal |
CAS: 25166-87-4 FEMA: 4046 JECFA: 1622 FLAVIS: 05.224 Use(s): flavoring agents | |
(E)-4-oxo-2- | hexenal |
CAS: 2492-43-5 Use(s): natural substances and extractives | |
(Z)-4- | hexenal |
CAS: 4634-89-3 FEMA: 3496 JECFA: 319 FLAVIS: 05.113 Use(s): flavoring agents | |
5- | hexenal |
CAS: 764-59-0 Use(s): natural substances and extractives | |
2- | hexenal diethyl acetal |
CAS: 54306-00-2 FLAVIS: 06.031 Use(s): flavoring agents | |
(E)-2- | hexenal diethyl acetal |
CAS: 67746-30-9 FEMA: 4047 JECFA: 1383 Use(s): flavoring agents | |
(Z)-2- | hexenal diethyl acetal |
CAS: NF0177 Use(s): information only not used for fragrances or flavors | |
(E)-3- | hexenal diethyl acetal |
CAS: NF0178 Use(s): information only not used for fragrances or flavors | |
(Z)-3- | hexenal diethyl acetal |
CAS: 73545-18-3 FLAVIS: 06.063 Use(s): flavor and fragrance agents | |
(E)-2- | hexenal dimethyl acetal |
CAS: 18318-83-7 FEMA: 4098 JECFA: 1728 FLAVIS: 06.072 Use(s): flavoring agents | |
(Z)-3- | hexenal dimethyl acetal |
CAS: 55444-65-0 Use(s): information only not used for fragrances or flavors | |
(E)-2- | hexenal glyceryl acetal |
CAS: 214220-85-6 FEMA: 4273 JECFA: 1800 Use(s): flavoring agents | |
(Z)-2- | hexenal glyceryl acetal |
CAS: 897630-96-5 FEMA: 4273 Use(s): flavoring agents | |
(E)-2- | hexenal propylene glycol acetal |
CAS: 94089-21-1 FEMA: 4272 JECFA: 1801 Use(s): flavor and fragrance agents | |
1- | hexene |
CAS: 592-41-6 Use(s): solvents | |
(E)-2- | hexene |
CAS: 4050-45-7 Use(s): information only not used for fragrances or flavors | |
(Z)-2- | hexene |
CAS: 7688-21-3 Use(s): information only not used for fragrances or flavors | |
(Z+E)-2- | hexene |
CAS: 592-43-8 Use(s): information only not used for fragrances or flavors | |
(E)-3- | hexene |
CAS: 13269-52-8 Use(s): information only not used for fragrances or flavors | |
(Z)-3- | hexene |
CAS: 7642-09-3 Use(s): information only not used for fragrances or flavors | |
(Z+E)-3- | hexene |
CAS: 592-47-2 Use(s): information only not used for fragrances or flavors | |
2- | hexene dioic acid |
CAS: 4440-68-0 Use(s): information only not used for fragrances or flavors | |
3- | hexene-2,5-dione |
CAS: 4436-75-3 Use(s): information only not used for fragrances or flavors | |
cis-3- | hexene-2,5-dione |
CAS: 17559-81-8 Use(s): information only not used for fragrances or flavors | |
trans-3- | hexene-2,5-dione |
CAS: 820-69-9 Use(s): information only not used for fragrances or flavors | |
5- | hexene nitrile |
CAS: 5048-19-1 Use(s): natural substances and extractives | |
3- | hexene, 1,1',1''-(ethylidyne tris(oxy)) tris-, (3Z,3'Z,3''Z)- |
CAS: 215305-10-5 Use(s): fragrance agents | |
hexenoic acid | |
CAS: 1289-40-3 Use(s): information only not used for fragrances or flavors | |
2- | hexenoic acid |
CAS: 1191-04-4 FLAVIS: 08.119 Use(s): flavoring agents | |
(E)-2- | hexenoic acid |
CAS: 13419-69-7 FEMA: 3169 JECFA: 1361 FLAVIS: 08.054 Use(s): flavoring agents | |
(Z)-2- | hexenoic acid |
CAS: 1577-28-2 Use(s): natural substances and extractives | |
3- | hexenoic acid |
CAS: 4219-24-3 FEMA: 3170 JECFA: 317 FLAVIS: 08.050 Use(s): flavoring agents | |
(E)-3- | hexenoic acid |
CAS: 1577-18-0 FEMA: 3170 Use(s): flavoring agents | |
(Z)-3- | hexenoic acid |
CAS: 1775-43-5 FEMA: 4493 JECFA: 2181 Use(s): flavoring agents | |
4- | hexenoic acid |
CAS: 35194-36-6 Use(s): natural substances and extractives | |
(E)-4- | hexenoic acid |
CAS: 1577-20-4 Use(s): natural substances and extractives | |
(Z)-4- | hexenoic acid |
CAS: 13855-41-9 Use(s): natural substances and extractives | |
5- | hexenoic acid |
CAS: 1577-22-6 Use(s): natural substances and extractives | |
(R)-1- | hexen-3-ol |
CAS: 139164-92-4 Use(s): information only not used for fragrances or flavors | |
(S)-1- | hexen-3-ol |
CAS: 4798-44-1 Use(s): natural substances and extractives | |
2- | hexen-1-ol |
CAS: 2305-21-7 FEMA: 2562 JECFA: 1354 FLAVIS: 02.020 Use(s): flavor and fragrance agents | |
(E)-2- | hexen-1-ol |
CAS: 928-95-0 FEMA: 2562 FLAVIS: 02.157 Use(s): flavor and fragrance agents | |
(Z)-2- | hexen-1-ol |
CAS: 928-94-9 FEMA: 3924 JECFA: 1374 FLAVIS: 02.156 Use(s): flavor and fragrance agents | |
3- | hexen-1-ol |
CAS: 544-12-7 FLAVIS: 02.159 Use(s): flavor and fragrance agents | |
(E)-3- | hexen-1-ol |
CAS: 928-97-2 FEMA: 4356 JECFA: 1621 Use(s): flavor and fragrance agents | |
(Z)-3- | hexen-1-ol |
CAS: 928-96-1 FEMA: 2563 JECFA: 315 FLAVIS: 02.056 Use(s): flavor and fragrance agents | |
4- | hexenol |
CAS: 6126-50-7 FEMA: 3430 JECFA: 318 FLAVIS: 02.074 Use(s): flavor and fragrance agents | |
(E)-4- | hexen-1-ol |
CAS: 928-92-7 FLAVIS: 02.161 Use(s): natural substances and extractives | |
(Z)-4- | hexen-1-ol |
CAS: 928-91-6 FEMA: 3430 FLAVIS: 02.160 Use(s): flavor and fragrance agents | |
5- | hexenol |
CAS: 821-41-0 FEMA: 4351 JECFA: 1623 Use(s): flavoring agents | |
5- | hexen-2-ol |
CAS: 626-94-8 Use(s): natural substances and extractives | |
5- | hexen-3-ol |
CAS: 688-99-3 Use(s): information only not used for fragrances or flavors | |
(R)-5- | hexen-2-ol |
CAS: 17397-29-4 Use(s): information only not used for fragrances or flavors | |
(S)-5- | hexen-2-ol |
CAS: 17397-24-9 Use(s): information only not used for fragrances or flavors | |
1- | hexen-3-ol |
CAS: 4798-44-1 FEMA: 3608 JECFA: 1151 FLAVIS: 02.104 Use(s): flavor and fragrance agents | |
2- | hexen-4-olide |
CAS: 2407-43-4 FLAVIS: 10.046 Use(s): flavoring agents | |
1- | hexen-3-one |
CAS: 1629-60-3 FLAVIS: 07.161 Use(s): flavoring agents | |
3- | hexen-2-one |
CAS: 763-93-9 Use(s): natural substances and extractives | |
(E)-3- | hexen-2-one |
CAS: 4376-23-2 Use(s): natural substances and extractives | |
4- | hexen-3-one |
CAS: 2497-21-4 FEMA: 3352 JECFA: 1125 FLAVIS: 07.048 Use(s): flavoring agents | |
4- | hexen-2-one |
CAS: 25659-22-7 Use(s): information only not used for fragrances or flavors | |
(E)-4- | hexen-3-one |
CAS: 50396-87-7 Use(s): flavoring agents | |
(Z)-4- | hexen-3-one |
CAS: 50396-96-8 Use(s): flavoring agents | |
5- | hexen-3-one |
CAS: 24253-30-3 Use(s): information only not used for fragrances or flavors | |
(Z)-3- | hexenyl 3-hydroxybutanoate |
CAS: 85762-21-6 Use(s): natural substances and extractives | |
1- | hexenyl acetate |
CAS: 32797-50-5 Use(s): fragrance agents | |
2- | hexenyl acetate |
CAS: 10094-40-3 Use(s): flavor and fragrance agents | |
(E)-2- | hexen-1-yl acetate |
CAS: 2497-18-9 FEMA: 2564 JECFA: 1355 FLAVIS: 09.394 Use(s): flavor and fragrance agents | |
(Z)-2- | hexen-1-yl acetate |
CAS: 56922-75-9 Use(s): natural substances and extractives | |
3- | hexenyl acetate |
CAS: 1708-82-3 Use(s): flavor and fragrance agents | |
(E)-3- | hexen-1-yl acetate |
CAS: 3681-82-1 FEMA: 4413 JECFA: 2180 FLAVIS: 09.928 Use(s): flavor and fragrance agents | |
(Z)-3- | hexen-1-yl acetate |
CAS: 3681-71-8 FEMA: 3171 JECFA: 134 FLAVIS: 09.197 Use(s): flavor and fragrance agents | |
(E)-4- | hexen-1-yl acetate |
CAS: 42125-17-7 FLAVIS: 09.572 Use(s): flavoring agents | |
(Z)-4- | hexen-1-yl acetate |
CAS: 42125-34-8 FLAVIS: 09.572 Use(s): flavoring agents | |
5- | hexenyl acetate |
CAS: 5048-26-0 Use(s): natural substances and extractives | |
1- | hexen-3-yl acetate |
CAS: 35926-04-6 Use(s): flavoring agents | |
3- | hexenyl acetoacetate |
CAS: 72928-36-0 Use(s): information only not used for fragrances or flavors | |
(Z)-3- | hexen-1-yl acetoacetate |
CAS: 84434-20-8 FEMA: 4489 JECFA: 1974 Use(s): flavor and fragrance agents | |
(Z)-3- | hexen-1-yl acetyl anthranilate |
CAS: 94333-66-1 Use(s): information only not used for fragrances or flavors | |
(Z)-3- | hexen-1-yl angelate |
CAS: 84060-80-0 Use(s): fragrance agents | |
(Z)-3- | hexen-1-yl anisate |
CAS: 121432-33-5 FLAVIS: 09.560 Use(s): flavor and fragrance agents | |
(E)-3- | hexen-1-yl anthranilate |
CAS: NF0173 Use(s): information only not used for fragrances or flavors | |
(Z)-3- | hexen-1-yl anthranilate |
CAS: 65405-76-7 FEMA: 3925 JECFA: 1538 FLAVIS: 09.561 Use(s): flavor and fragrance agents | |
3- | hexenyl benzoate |
CAS: 72200-74-9 Use(s): information only not used for fragrances or flavors | |
(E)-3- | hexen-1-yl benzoate |
CAS: 76841-70-8 Use(s): flavor and fragrance agents | |
(Z)-3- | hexen-1-yl benzoate |
CAS: 25152-85-6 FEMA: 3688 JECFA: 858 FLAVIS: 09.806 Use(s): flavor and fragrance agents | |
(E)-2- | hexen-1-yl butyrate |
CAS: 53398-83-7 FEMA: 3926 JECFA: 1375 FLAVIS: 09.396 Use(s): flavor and fragrance agents | |
(E)-2- | hexen-1-yl isobutyrate |
CAS: NF007 Use(s): flavoring agents | |
(Z)-2- | hexen-1-yl butyrate |
CAS: 56922-77-1 Use(s): natural substances and extractives | |
3- | hexenyl butyrate |
CAS: 2142-93-0 Use(s): information only not used for fragrances or flavors | |
(E)-3- | hexen-1-yl butyrate |
CAS: 53398-84-8 Use(s): flavor and fragrance agents | |
(E)-3- | hexen-1-yl isobutyrate |
CAS: 84682-20-2 Use(s): flavor and fragrance agents | |
(Z)-3- | hexen-1-yl butyrate |
CAS: 16491-36-4 FEMA: 3402 JECFA: 157 FLAVIS: 09.270 Use(s): flavor and fragrance agents | |
(Z)-3- | hexen-1-yl isobutyrate |
CAS: 41519-23-7 FEMA: 3929 JECFA: 1275 FLAVIS: 09.563 Use(s): flavor and fragrance agents | |
3- | hexenyl isobutyrate |
CAS: 57859-47-9 Use(s): natural substances and extractives | |
(E)-4- | hexen-1-yl butyrate |
CAS: 809271-90-7 Use(s): information only not used for fragrances or flavors | |
(Z)-4- | hexen-1-yl butyrate |
CAS: 69727-41-9 Use(s): natural substances and extractives | |
5- | hexenyl butyrate |
CAS: 108058-75-9 Use(s): natural substances and extractives | |
(Z)-3- | hexen-1-yl cinnamate |
CAS: 68133-75-5 Use(s): fragrance agents | |
(E)-3- | hexen-1-yl crotonate |
CAS: 68938-58-9 Use(s): flavoring agents | |
(Z)-3- | hexen-1-yl (E)-crotonate |
CAS: 65405-80-3 FEMA: 3982 JECFA: 1276 FLAVIS: 09.566 Use(s): flavor and fragrance agents | |
(Z)-1-(3- | hexen-1-yl) cyclohexan-1-ol |
CAS: 93963-11-2 Use(s): information only not used for fragrances or flavors | |
(Z)-3- | hexen-1-yl 2-oxocyclopentane carboxylate |
CAS: 94087-84-0 Use(s): information only not used for fragrances or flavors | |
hexenyl cyclopentanone | |
CAS: 34687-46-2 Use(s): fragrance agents | |
3- | hexenyl cyclopentanone |
CAS: 68133-74-4 Use(s): fragrance agents | |
2- | hexenyl cyclopentanyl acetate |
CAS: 149982-46-7 Use(s): fragrance agents | |
(Z)-3- | hexen-1-yl-2-cyclopenten-1-one |
CAS: 53253-09-1 Use(s): fragrance agents | |
(E)-3- | hexen-1-yl (Z,Z)-2,4-decadienoate |
CAS: 94109-96-3 Use(s): information only not used for fragrances or flavors | |
(E)-3- | hexen-1-yl decanoate |
CAS: NF0172 Use(s): information only not used for fragrances or flavors | |
(Z)-3- | hexen-1-yl decanoate |
CAS: 85554-69-4 FLAVIS: 09.567 Use(s): flavor and fragrance agents | |
(E)-5-(3- | hexen-1-yl) dihydrofuran-2(3H)-one |
CAS: 97416-87-0 Use(s): information only not used for fragrances or flavors | |
(E)-3- | hexen-1-yl dihydro-5-methyl furan-2(3H)-one |
CAS: 14252-84-7 Use(s): information only not used for fragrances or flavors | |
(E)-3- | hexen-1-yl 2-ethyl butyrate |
CAS: NF0176 Use(s): information only not used for fragrances or flavors | |
(Z)-3- | hexen-1-yl 2-ethyl butyrate |
CAS: 94071-12-2 Use(s): flavor and fragrance agents | |
3- | hexenyl 2-ethyl butyrate |
CAS: 233666-04-1 FLAVIS: 09.884 Use(s): flavor and fragrance agents | |
(E)-2- | hexen-1-yl formate |
CAS: 53398-78-0 FEMA: 3927 JECFA: 1376 FLAVIS: 09.397 Use(s): flavor and fragrance agents | |
3- | hexenyl formate |
CAS: 2315-09-5 JECFA: 1272 FLAVIS: 09.846 Use(s): flavor and fragrance agents | |
(E)-3- | hexen-1-yl formate |
CAS: 56922-80-6 FLAVIS: 09.562 Use(s): flavoring agents | |
(Z)-3- | hexen-1-yl formate |
CAS: 33467-73-1 FEMA: 3353 JECFA: 123 FLAVIS: 09.240 Use(s): flavor and fragrance agents | |
(E)-2- | hexen-1-yl heptanoate |
CAS: 125680-98-0 Use(s): information only not used for fragrances or flavors | |
(E)-3- | hexen-1-yl heptanoate |
CAS: NF0171 Use(s): information only not used for fragrances or flavors | |
(Z)-3- | hexen-1-yl heptanoate |
CAS: 61444-39-1 FLAVIS: 09.575 Use(s): flavor and fragrance agents | |
(Z)-3- | hexen-1-yl heptine carbonate |
CAS: 68698-58-8 Use(s): information only not used for fragrances or flavors | |
2- | hexenyl hexanoate |
CAS: 10448-24-5 Use(s): natural substances and extractives | |
(E)-2- | hexen-1-yl hexanoate |
CAS: 53398-86-0 FEMA: 3983 JECFA: 1381 FLAVIS: 09.398 Use(s): flavor and fragrance agents | |
(Z)-2- | hexen-1-yl hexanoate |
CAS: 56922-79-3 Use(s): natural substances and extractives | |
3- | hexenyl hexanoate |
CAS: 84434-19-5 Use(s): information only not used for fragrances or flavors | |
(E)-3- | hexen-1-yl hexanoate |
CAS: 56922-82-8 FLAVIS: 09.855 Use(s): flavor and fragrance agents | |
(Z)-3- | hexen-1-yl hexanoate |
CAS: 31501-11-8 FEMA: 3403 JECFA: 165 FLAVIS: 09.271 Use(s): flavor and fragrance agents | |
(E)-4- | hexen-1-yl hexanoate |
CAS: NF0170 Use(s): natural substances and extractives | |
(Z)-4- | hexen-1-yl hexanoate |
CAS: 88552-98-1 Use(s): natural substances and extractives | |
5- | hexenyl hexanoate |
CAS: 108058-81-7 Use(s): natural substances and extractives | |
(E)-3- | hexen-1-yl (E)-3-hexenoate |
CAS: 61444-37-9 Use(s): information only not used for fragrances or flavors | |
(E)-3- | hexen-1-yl (Z)-3-hexenoate |
CAS: 53398-88-2 Use(s): information only not used for fragrances or flavors | |
(Z)-3- | hexen-1-yl (E)-2-hexenoate |
CAS: 53398-87-1 FEMA: 3928 JECFA: 1279 FLAVIS: 09.568 Use(s): flavor and fragrance agents | |
(Z)-3- | hexen-1-yl (E)-3-hexenoate |
CAS: 74638-19-0 Use(s): information only not used for fragrances or flavors | |
(Z)-3- | hexen-1-yl (Z)-3-hexenoate |
CAS: 61444-38-0 FEMA: 3689 JECFA: 336 FLAVIS: 09.291 Use(s): flavor and fragrance agents | |
(Z)-3- | hexen-1-yl 5-hexenoate |
CAS: 106917-24-2 Use(s): natural substances and extractives | |
5- | hexenyl 5-hexenoate |
CAS: 77131-17-0 Use(s): natural substances and extractives | |
(Z)-2- | hexen-1-yl isobutyrate |
CAS: NF0169 Use(s): information only not used for fragrances or flavors | |
(Z)-2- | hexen-1-yl isovalerate |
CAS: 54675-77-3 Use(s): natural substances and extractives | |
(E)-3- | hexen-1-yl isovalerate |
CAS: 88296-26-8 Use(s): natural substances and extractives | |
(E)-2- | hexen-1-yl lactate |
CAS: 85554-71-8 Use(s): information only not used for fragrances or flavors | |
(Z)-2- | hexen-1-yl lactate |
CAS: 102832-13-3 Use(s): information only not used for fragrances or flavors | |
(E)-3- | hexen-1-yl lactate |
CAS: NF0167 Use(s): information only not used for fragrances or flavors | |
(Z)-3- | hexen-1-yl lactate |
CAS: 61931-81-5 FEMA: 3690 JECFA: 934 FLAVIS: 09.545 Use(s): flavor and fragrance agents | |
(E)-3- | hexen-1-yl levulinate |
CAS: NF0166 Use(s): information only not used for fragrances or flavors | |
(Z)-3- | hexen-1-yl levulinate |
CAS: 85554-70-7 Use(s): flavoring agents | |
(E)-2- | hexen-1-yl 2-methyl butyrate |
CAS: 94089-01-7 FEMA: 4274 JECFA: 1797 Use(s): flavor and fragrance agents | |
(Z)-2- | hexen-1-yl 2-methyl butyrate |
CAS: NF0174 Use(s): information only not used for fragrances or flavors | |
(E)-3- | hexen-1-yl 2-methyl butyrate |
CAS: NF0175 Use(s): information only not used for fragrances or flavors | |
(Z)-3- | hexen-1-yl 2-methyl butyrate |
CAS: 53398-85-9 FEMA: 3497 FLAVIS: 09.854 Use(s): flavor and fragrance agents | |
3- | hexenyl 2-methyl butyrate |
CAS: 10094-41-4 FEMA: 3497 JECFA: 211 FLAVIS: 09.506 Use(s): flavor and fragrance agents | |
(Z)-3- | hexen-1-yl methyl carbonate |
CAS: 67633-96-9 FLAVIS: 09.838 Use(s): flavor and fragrance agents | |
(E)-3- | hexenyl methyl ether |
CAS: 121441-40-5 Use(s): fragrance agents | |
(Z)-3- | hexenyl methyl ether |
CAS: 70220-06-3 Use(s): fragrance agents | |
(Z)-2-(3- | hexen-1-yl)-5-methyl furan |
CAS: 4868-20-6 Use(s): information only not used for fragrances or flavors | |
(Z)-3- | hexen-1-yl 2-methyl-2-pentenoate |
CAS: 76649-17-7 Use(s): fragrance agents | |
(E)-3- | hexen-1-yl nicotinate |
CAS: NF0165 Use(s): information only not used for fragrances or flavors | |
(Z)-3- | hexen-1-yl nicotinate |
CAS: 85098-91-5 Use(s): information only not used for fragrances or flavors | |
(Z)-3- | hexen-1-yl nonanoate |
CAS: 88191-46-2 Use(s): natural substances and extractives | |
(E)-2- | hexen-1-yl octanoate |
CAS: 85554-72-9 FEMA: 4135 JECFA: 1796 FLAVIS: 09.841 Use(s): flavor and fragrance agents | |
(E)-3- | hexen-1-yl octanoate |
CAS: 87619-90-7 Use(s): information only not used for fragrances or flavors | |
(Z)-3- | hexen-1-yl octanoate |
CAS: 61444-41-5 FLAVIS: 09.569 Use(s): flavor and fragrance agents | |
(Z)-3- | hexen-1-yl octine carbonate |
CAS: 68480-29-5 Use(s): information only not used for fragrances or flavors | |
(Z)-3- | hexen-1-yl oxyacetaldehyde |
CAS: 68133-72-2 Use(s): fragrance agents | |
(E)-2-(3- | hexen-1-yl oxy)-1,3-dioxolane |
CAS: 93919-13-2 Use(s): information only not used for fragrances or flavors | |
(Z)-2-(3- | hexen-1-yl oxy) ethanol |
CAS: 94088-27-4 Use(s): information only not used for fragrances or flavors | |
(Z)-2-(3- | hexenyl oxy)-3-methyl pyrazine |
CAS: 94159-29-2 Use(s): information only not used for fragrances or flavors | |
hexen-1-yl oxypropane nitrile | |
CAS: 142653-61-0 Use(s): fragrance agents | |
(Z)-2-(3- | hexen-1-yl oxy) tetrahydro-2H-pyran |
CAS: 90879-06-4 Use(s): information only not used for fragrances or flavors | |
3- | hexenyl palmitate |
CAS: 233666-03-0 FLAVIS: 09.885 Use(s): flavoring agents | |
(Z)-3- | hexen-1-yl palmitate |
CAS: 117210-57-8 Use(s): natural substances and extractives | |
2- | hexenyl phenyl acetate |
CAS: 71605-86-2 Use(s): information only not used for fragrances or flavors | |
(E)-2- | hexen-1-yl phenyl acetate |
CAS: 68133-78-8 FLAVIS: 09.400 Use(s): flavor and fragrance agents | |
(E)-3- | hexen-1-yl phenyl acetate |
CAS: 1824720-88-8 Use(s): information only not used for fragrances or flavors | |
(Z)-3- | hexen-1-yl phenyl acetate |
CAS: 42436-07-7 FEMA: 3633 JECFA: 1016 FLAVIS: 09.805 Use(s): flavor and fragrance agents | |
(E)-3- | hexen-1-yl pivalate |
CAS: 653002-72-3 Use(s): information only not used for fragrances or flavors | |
(Z)-3- | hexen-1-yl pivalate |
CAS: 84604-59-1 Use(s): information only not used for fragrances or flavors | |
(E)-2- | hexen-1-yl propionate |
CAS: 53398-80-4 FEMA: 3932 JECFA: 1378 FLAVIS: 09.395 Use(s): flavor and fragrance agents | |
(Z)-2- | hexen-1-yl propionate |
CAS: 56922-76-0 Use(s): information only not used for fragrances or flavors | |
(E)-3- | hexen-1-yl propionate |
CAS: 53398-81-5 Use(s): flavor and fragrance agents | |
(Z)-3- | hexen-1-yl propionate |
CAS: 33467-74-2 FEMA: 3933 JECFA: 1274 FLAVIS: 09.564 Use(s): flavor and fragrance agents | |
(E)-4- | hexen-1-yl propionate |
CAS: 33467-75-3 Use(s): information only not used for fragrances or flavors | |
(E)-3- | hexen-1-yl pyruvate |
CAS: NF031 Use(s): information only not used for fragrances or flavors | |
(Z)-3- | hexen-1-yl pyruvate |
CAS: 68133-76-6 FEMA: 3934 JECFA: 1846 FLAVIS: 09.565 Use(s): flavor and fragrance agents | |
(E)-2- | hexen-1-yl salicylate |
CAS: 68133-77-7 Use(s): fragrance agents | |
(E)-3- | hexen-1-yl salicylate |
CAS: 68141-22-0 Use(s): information only not used for fragrances or flavors | |
(Z)-3- | hexen-1-yl salicylate |
CAS: 65405-77-8 FEMA: 4750 FLAVIS: 09.570 Use(s): flavor and fragrance agents | |
(Z)-3- | hexen-1-yl senecioate |
CAS: 65416-28-6 Use(s): flavoring agents | |
N- | hexenyl succinic anhydride |
CAS: 10500-34-2 Use(s): information only not used for fragrances or flavors | |
5- | hexenyl isothiocyanate |
CAS: 49776-81-0 FEMA: 4421 JECFA: 1894 Use(s): flavoring agents | |
2-(5- | hexenyl thio) ethanol |
CAS: 82010-85-3 Use(s): information only not used for fragrances or flavors | |
(Z)-3- | hexen-1-yl tiglate |
CAS: 67883-79-8 FEMA: 3931 JECFA: 1277 FLAVIS: 09.559 Use(s): flavor and fragrance agents | |
(E)-2- | hexen-1-yl valerate |
CAS: 56922-74-8 FEMA: 3935 JECFA: 1379 Use(s): flavor and fragrance agents | |
(E)-2- | hexen-1-yl isovalerate |
CAS: 68698-59-9 FEMA: 3930 JECFA: 1377 FLAVIS: 09.399 Use(s): flavor and fragrance agents | |
(E)-3- | hexen-1-yl valerate |
CAS: 56922-81-7 Use(s): flavor and fragrance agents | |
(Z)-3- | hexen-1-yl valerate |
CAS: 35852-46-1 FEMA: 3936 JECFA: 1278 FLAVIS: 09.571 Use(s): flavor and fragrance agents | |
(Z)-3- | hexen-1-yl isovalerate |
CAS: 35154-45-1 FEMA: 3498 Use(s): flavor and fragrance agents | |
(E)-4- | hexen-1-yl valerate |
CAS: 903552-55-6 Use(s): information only not used for fragrances or flavors | |
3- | hexenyl isovalerate |
CAS: 10032-11-8 FEMA: 3498 JECFA: 202 FLAVIS: 09.505 Use(s): flavor and fragrance agents | |
hexoxyacetaldehyde dimethyl acetal | |
CAS: 17597-95-4 Use(s): fragrance agents | |
2- | hexoxyacetaldehyde dipropylene glycol acetal |
CAS: 71832-77-4 Use(s): information only not used for fragrances or flavors | |
hexoxyethyl pivalate | |
CAS: 68757-58-4 Use(s): information only not used for fragrances or flavors | |
2- | hexoxy-5-pentyl tetrahydrofuran |
CAS: 78054-02-1 Use(s): natural substances and extractives | |
N- | hexyl acetamide |
CAS: 7501-79-3 Use(s): natural substances and extractives | |
hexyl acetate | |
CAS: 142-92-7 FEMA: 2565 JECFA: 128 FLAVIS: 09.006 Use(s): flavor and fragrance agents | |
2- | hexyl acetate |
CAS: 5953-49-1 Use(s): flavoring agents | |
hexyl acetoacetate | |
CAS: 13562-84-0 Use(s): information only not used for fragrances or flavors | |
2- | hexyl-4-acetoxytetrahydrofuran |
CAS: 10039-39-1 FEMA: 2566 JECFA: 1440 Use(s): flavoring agents | |
hexyl acrylate | |
CAS: 2499-95-8 Use(s): information only not used for fragrances or flavors | |
sec- | hexyl alcohol |
CAS: 97-95-0 FLAVIS: 02.043 Use(s): flavor and fragrance agents | |
1- | hexyl allyl formate |
CAS: 84681-89-0 Use(s): information only not used for fragrances or flavors | |
hexyl amine | |
CAS: 111-26-2 FEMA: 4243 JECFA: 1588 FLAVIS: 11.016 Use(s): flavoring agents | |
hexyl ortho-anisate | |
CAS: 71605-88-4 Use(s): information only not used for fragrances or flavors | |
hexyl para-anisate | |
CAS: 71607-26-6 Use(s): information only not used for fragrances or flavors | |
hexyl anthranilate | |
CAS: 18189-05-4 Use(s): flavor and fragrance agents | |
4- | hexyl benzaldehyde |
CAS: 49763-69-1 Use(s): information only not used for fragrances or flavors | |
hexyl benzoate | |
CAS: 6789-88-4 FEMA: 3691 JECFA: 854 FLAVIS: 09.768 Use(s): flavor and fragrance agents | |
4- | hexyl benzoic acid |
CAS: 21643-38-9 Use(s): information only not used for fragrances or flavors | |
2- | hexyl benzothiazole |
CAS: 65718-88-9 Use(s): natural substances and extractives | |
hexyl butyrate | |
CAS: 2639-63-6 FEMA: 2568 JECFA: 153 FLAVIS: 09.045 Use(s): flavor and fragrance agents | |
2- | hexyl butyrate |
CAS: 6963-52-6 Use(s): natural substances and extractives | |
hexyl isobutyrate | |
CAS: 2349-07-7 FEMA: 3172 JECFA: 189 FLAVIS: 09.478 Use(s): flavor and fragrance agents | |
hexyl carbitol | |
CAS: 112-59-4 Use(s): information only not used for fragrances or flavors | |
hexyl carbonate tetrahydrofurfuryl lactate | |
CAS: 64058-40-8 Use(s): information only not used for fragrances or flavors | |
(E)-alpha- | hexyl cinnamaldehyde |
CAS: 165184-98-5 FEMA: 2569 Use(s): flavor and fragrance agents | |
(Z)-alpha- | hexyl cinnamaldehyde |
CAS: 101-86-0 Use(s): flavor and fragrance agents | |
alpha- | hexyl cinnamaldehyde |
CAS: 101-86-0 FEMA: 2569 JECFA: 686 FLAVIS: 05.041 Use(s): flavor and fragrance agents | |
alpha- | hexyl cinnamaldehyde diethyl acetal |
CAS: 67845-59-4 Use(s): fragrance agents | |
alpha- | hexyl cinnamaldehyde dimethyl acetal |
CAS: 29896-45-5 Use(s): fragrance agents | |
hexyl cinnamate | |
CAS: 3488-00-4 Use(s): fragrance agents | |
6- | hexyl-meta-cresol |
CAS: 39236-85-6 Use(s): information only not used for fragrances or flavors | |
(E)- | hexyl crotonate |
CAS: 1617-25-0 FLAVIS: 09.578 Use(s): flavoring agents | |
hexyl cyclohexane | |
CAS: 4292-75-5 Use(s): natural substances and extractives | |
hexyl cyclohexane carboxylate | |
CAS: 27948-10-3 Use(s): information only not used for fragrances or flavors | |
hexyl cyclopentane | |
CAS: 4457-00-5 Use(s): natural substances and extractives | |
1- | hexyl cyclopentene |
CAS: 4291-99-0 Use(s): natural substances and extractives | |
hexyl (E,Z)-2,4-decadienoate | |
CAS: 28380-11-2 Use(s): natural substances and extractives | |
hexyl decanoate | |
CAS: 10448-26-7 FEMA: 4342 JECFA: 1874 Use(s): flavor and fragrance agents | |
2- | hexyl decan-1-ol |
CAS: 2425-77-6 Use(s): cosmetic agents | |
2- | hexyl-2-decenal |
CAS: 13893-39-5 FEMA: 4786 Use(s): flavoring agents | |
2- | hexyl decyl isononanoate |
CAS: 93843-29-9 Use(s): information only not used for fragrances or flavors | |
2- | hexyl decyl octanoate |
CAS: 93777-70-9 Use(s): information only not used for fragrances or flavors | |
hexyl dihydrocinnamate | |
CAS: 220766-75-6 Use(s): natural substances and extractives | |
5- | hexyl dihydromethyl furan-2(3H)-one |
CAS: 93980-90-6 Use(s): information only not used for fragrances or flavors | |
2- | hexyl-4,5-dimethyl oxazole |
CAS: 20662-87-7 Use(s): natural substances and extractives | |
4- | hexyl-2,5-dimethyl oxazole |
CAS: 20662-86-6 Use(s): natural substances and extractives | |
5- | hexyl-2,4-dimethyl oxazole |
CAS: 20662-85-5 Use(s): information only not used for fragrances or flavors | |
2- | hexyl-4,5-dimethyl thiazole |
CAS: 87262-49-5 Use(s): natural substances and extractives | |
2- | hexyl-1,3-dioxane |
CAS: 6290-20-6 Use(s): information only not used for fragrances or flavors | |
4- | hexyl-1,3-dioxane |
CAS: 2244-85-1 Use(s): information only not used for fragrances or flavors | |
hexyl docosanoate | |
CAS: 26720-37-6 Use(s): natural substances and extractives | |
hexyl (Z)-13-docosenoate | |
CAS: 19773-56-9 Use(s): information only not used for fragrances or flavors | |
hexyl 2-ethyl hexanoate | |
CAS: 20748-87-2 Use(s): information only not used for fragrances or flavors | |
hexyl ethylidene aminobenzoate | |
CAS: 72968-69-5 Use(s): fragrance agents | |
hexyl formate | |
CAS: 629-33-4 FEMA: 2570 JECFA: 120 FLAVIS: 09.161 Use(s): flavor and fragrance agents | |
2- | hexyl furan |
CAS: 3777-70-6 Use(s): natural substances and extractives | |
hexyl 2-furoate | |
CAS: 39251-86-0 FEMA: 2571 JECFA: 749 FLAVIS: 13.005 Use(s): flavor and fragrance agents | |
hexyl heptanoate | |
CAS: 1119-06-8 FEMA: 4337 JECFA: 1872 Use(s): flavor and fragrance agents | |
hexyl hexanoate | |
CAS: 6378-65-0 FEMA: 2572 JECFA: 164 FLAVIS: 09.066 Use(s): flavor and fragrance agents | |
hexyl 2-hexenoate | |
CAS: 16930-97-5 Use(s): information only not used for fragrances or flavors | |
hexyl 3-hexenoate | |
CAS: 41599-57-9 Use(s): information only not used for fragrances or flavors | |
hexyl 5-hexenoate | |
CAS: 106917-23-1 Use(s): natural substances and extractives | |
hexyl (E)-2-hexenoate | |
CAS: 33855-57-1 FEMA: 3692 JECFA: 1810 FLAVIS: 09.292 Use(s): flavoring agents | |
hexyl (Z)-3-hexenoate | |
CAS: 89352-68-1 Use(s): natural substances and extractives | |
hexyl 4-hydroxybenzoate | |
CAS: 1083-27-8 Use(s): information only not used for fragrances or flavors | |
hexyl 3-hydroxybutanoate | |
CAS: 87128-51-6 Use(s): natural substances and extractives | |
2- | hexyl-5-hydroxy-1,3-dioxane |
CAS: 1708-36-7 FLAVIS: 06.102 Use(s): flavor and fragrance agents | |
cis-2- | hexyl-5-hydroxy-1,3-dioxane |
CAS: 18445-22-2 Use(s): information only not used for fragrances or flavors | |
trans-2- | hexyl-5-hydroxy-1,3-dioxane |
CAS: 18550-94-2 Use(s): information only not used for fragrances or flavors | |
hexyl (R)-12-hydroxyoleate | |
CAS: 6030-14-4 Use(s): information only not used for fragrances or flavors | |
hexyl isononanoate | |
CAS: 84878-29-5 Use(s): information only not used for fragrances or flavors | |
hexyl isooctanoate | |
CAS: 84878-24-0 Use(s): information only not used for fragrances or flavors | |
2- | hexyl-5 or 6-keto-1,4-dioxane |
CAS: 65504-97-4 FEMA: 2574 JECFA: 1486 Use(s): flavoring agents | |
hexyl lactate | |
CAS: 20279-51-0 FLAVIS: 09.580 Use(s): flavor and fragrance agents | |
hexyl laurate | |
CAS: 34316-64-8 FLAVIS: 09.579 Use(s): flavor and fragrance agents | |
hexyl levulinate | |
CAS: 24431-34-3 Use(s): information only not used for fragrances or flavors | |
hexyl mandelate | |
CAS: 5431-31-2 Use(s): information only not used for fragrances or flavors | |
hexyl mercaptan | |
CAS: 111-31-9 FEMA: 3842 JECFA: 518 FLAVIS: 12.132 Use(s): flavoring agents | |
hexyl 3-mercaptobutanoate | |
CAS: 796857-79-9 FEMA: 4136 JECFA: 1704 FLAVIS: 12.292 Use(s): flavoring agents | |
hexyl methanesulfinate | |
Use(s): information only not used for fragrances or flavors | |
2-iso | hexyl-3-methoxypyrazine |
CAS: 68844-95-1 Use(s): fragrance agents | |
hexyl 2-methyl butyrate | |
CAS: 10032-15-2 FEMA: 3499 JECFA: 208 FLAVIS: 09.507 Use(s): flavor and fragrance agents | |
2- | hexyl-5-methyl furan |
CAS: 5312-82-3 Use(s): information only not used for fragrances or flavors | |
2- | hexyl-5-methyl-3(2H)-furanone |
CAS: 33922-66-6 Use(s): natural substances and extractives | |
hexyl 2-methyl-3-pentenoate | |
CAS: 85508-08-3 FEMA: 3693 Use(s): flavor and fragrance agents | |
hexyl (E)-2-methyl-3-pentenoate | |
CAS: 58625-95-9 FEMA: 3693 JECFA: 352 FLAVIS: 09.546 Use(s): flavor and fragrance agents | |
hexyl 2-methyl-4-pentenoate | |
CAS: 58031-03-1 FEMA: 3693 Use(s): flavor and fragrance agents | |
5- | hexyl-2-methyl pyridine |
CAS: 710-40-7 Use(s): fragrance agents | |
2- | hexyl-2-methyl thiazolidine |
CAS: 702-87-4 Use(s): natural substances and extractives | |
2- | hexyl-2-methyl-1,3-dioxolane |
CAS: 937-94-0 Use(s): information only not used for fragrances or flavors | |
hexyl 2-methyl-2-pentenoate | |
Use(s): information only not used for fragrances or flavors | |
hexyl myristate | |
CAS: 42231-99-2 FLAVIS: 09.582 Use(s): flavor and fragrance agents | |
hexyl nicotinate | |
CAS: 23597-82-2 Use(s): cosmetic agents | |
hexyl nonanoate | |
CAS: 6561-39-3 FEMA: 4339 JECFA: 1873 Use(s): flavor and fragrance agents | |
2- | hexyl nonanoic acid |
CAS: 37165-63-2 Use(s): information only not used for fragrances or flavors | |
hexyl octanoate | |
CAS: 1117-55-1 FEMA: 2575 JECFA: 175 FLAVIS: 09.113 Use(s): flavor and fragrance agents | |
2- | hexyl octanoic acid |
CAS: 60948-91-6 Use(s): cosmetic agents | |
hexyl 7-octenoate | |
CAS: 108058-84-0 Use(s): natural substances and extractives | |
hexyl (E)-2-octenoate | |
CAS: 85554-64-9 Use(s): flavor and fragrance agents | |
2- | hexyl octyl cyclopentane |
CAS: 55044-77-4 Use(s): natural substances and extractives | |
hexyl (Z)-oleate | |
CAS: 20290-84-0 FLAVIS: 09.865 Use(s): cosmetic and fragrance agents | |
hexyl oxyacetonitrile | |
CAS: 66912-24-1 Use(s): information only not used for fragrances or flavors | |
3' | hexyl oxyacetophenone |
CAS: 37062-71-8 Use(s): natural substances and extractives | |
hexyl palmitate | |
CAS: 42232-25-7 Use(s): information only not used for fragrances or flavors | |
8- | hexyl pentadecane |
CAS: 13475-75-7 Use(s): natural substances and extractives | |
hexyl phenyl acetate | |
CAS: 5421-17-0 FEMA: 3457 JECFA: 1015 FLAVIS: 09.804 Use(s): flavor and fragrance agents | |
hexyl pivalate | |
CAS: 5434-57-1 Use(s): fragrance agents | |
hexyl propionate | |
CAS: 2445-76-3 FEMA: 2576 JECFA: 144 FLAVIS: 09.139 Use(s): flavor and fragrance agents | |
2- | hexyl pyrazine |
CAS: 28217-91-6 Use(s): information only not used for fragrances or flavors | |
2- | hexyl pyridine |
CAS: 1129-69-7 FLAVIS: 14.117 Use(s): flavoring agents | |
3- | hexyl pyridine |
CAS: 6311-92-8 Use(s): flavoring agents | |
4- | hexyl pyridine |
CAS: 27876-24-0 Use(s): information only not used for fragrances or flavors | |
4- | hexyl resorcinol |
CAS: 136-77-6 Use(s): antioxidants | |
hexyl salicylate | |
CAS: 6259-76-3 FLAVIS: 09.581 Use(s): flavor and fragrance agents | |
hexyl senecioate | |
CAS: 17627-41-7 Use(s): natural substances and extractives | |
1- | hexyl senecioate |
CAS: 16931-10-5 Use(s): natural substances and extractives | |
hexyl stearate | |
CAS: 3460-37-5 Use(s): information only not used for fragrances or flavors | |
hexyl sulfide | |
CAS: 6294-31-1 Use(s): information only not used for fragrances or flavors | |
hexyl thiocyanate | |
CAS: 6803-40-3 Use(s): information only not used for fragrances or flavors | |
hexyl isothiocyanate | |
CAS: 4404-45-9 FEMA: 4422 JECFA: 1895 Use(s): flavoring agents | |
2-( | hexyl thio)-3-methyl pyrazine |
CAS: 73972-65-3 Use(s): information only not used for fragrances or flavors | |
2- | hexyl thiophene |
CAS: 18794-77-9 FEMA: 4137 JECFA: 1764 FLAVIS: 15.076 Use(s): flavoring agents | |
hexyl tiglate | |
CAS: 16930-96-4 Use(s): flavor and fragrance agents | |
hexyl (E)-tiglate | |
CAS: 19089-92-0 FEMA: 3354 JECFA: 1807 FLAVIS: 09.266 Use(s): flavor and fragrance agents | |
hexyl (Z)-tiglate | |
CAS: 65652-33-7 Use(s): flavor and fragrance agents | |
2- | hexyl-2-undecenal |
CAS: 24823-56-1 Use(s): information only not used for fragrances or flavors | |
hexyl valerate | |
CAS: 1117-59-5 FLAVIS: 09.583 Use(s): flavor and fragrance agents | |
hexyl isovalerate | |
CAS: 10032-13-0 FEMA: 3500 JECFA: 199 FLAVIS: 09.529 Use(s): flavor and fragrance agents | |
hexyl vanillate | |
CAS: 84375-71-3 Use(s): information only not used for fragrances or flavors | |
hexyl vanillate-2-ethoxybenzoic acid | |
CAS: 126294-32-4 Use(s): information only not used for fragrances or flavors | |
hexyl vinyl carbinyl acetate | |
CAS: 31795-37-6 Use(s): fragrance agents | |
2- | hexyl-5-[2-(4-hydroxy-3-methoxyphenyl)ethyl]furan |
CAS: 143114-91-4 Use(s): natural substances and extractives | |
hexyldecyl laurate | |
CAS: 34362-27-1 Use(s): emollients, skin conditioning | |
hexyldecyl palmitate | |
CAS: 69275-02-1 Use(s): cosmetic ingredient for skin conditioning | |
hexylene glycol | |
CAS: 107-41-5 Use(s): cosmetic ingredient for skin and hair care | |
(R)- | hexylene glycol |
CAS: 99210-90-9 Use(s): information only not used for fragrances or flavors | |
(S)- | hexylene glycol |
CAS: 99113-75-4 Use(s): information only not used for fragrances or flavors | |
hexylene glycol diacetate | |
CAS: 1637-24-7 Use(s): information only not used for fragrances or flavors | |
hexylene oxide | |
CAS: 1436-34-6 Use(s): information only not used for fragrances or flavors | |
2- | hexylidene cyclohexan-1-one |
CAS: 16429-07-5 Use(s): fragrance agents | |
2- | hexylidene cyclopentanone |
CAS: 17373-89-6 FEMA: 2573 JECFA: 1106 FLAVIS: 07.034 Use(s): flavor and fragrance agents | |
5- | hexyltetrahydro-2-furanoctanoic acid |
CAS: 61781-98-4 Use(s): information only not used for fragrances or flavors | |
heyderiol | |
CAS: 96447-67-5 Use(s): natural substances and extractives | |
hibaene | |
CAS: 2359-73-1 Use(s): natural substances and extractives | |
iso | hibaene |
CAS: 5975-53-1 Use(s): natural substances and extractives | |
2,4- | himachaladiene |
CAS: NF0181 Use(s): natural substances and extractives | |
alpha- | himachalene |
CAS: 3853-83-6 Use(s): natural substances and extractives | |
ar- | himachalene |
CAS: 76739-27-0 Use(s): natural substances and extractives | |
beta- | himachalene |
CAS: 1461-03-6 Use(s): natural substances and extractives | |
gamma- | himachalene |
CAS: 53111-25-4 Use(s): natural substances and extractives | |
oxido | himachalene |
CAS: 64825-84-9 Use(s): natural substances and extractives | |
beta- | himachalene oxide |
CAS: NF0468 Use(s): natural substances and extractives | |
himachalol | |
CAS: 1891-45-8 Use(s): natural substances and extractives | |
allo- | himachalol |
CAS: 19435-77-9 Use(s): natural substances and extractives | |
beta- | himachalol |
CAS: NF0183 Use(s): natural substances and extractives | |
hinesene | |
CAS: NF0126 Use(s): natural substances and extractives | |
hinokiflavone | |
CAS: 19202-36-9 Use(s): natural substances and extractives | |
hinokiol | |
CAS: 564-73-8 Use(s): natural substances and extractives | |
hinokione | |
CAS: 472-37-7 Use(s): natural substances and extractives | |
hinokiresinol | |
CAS: 17676-24-3 Use(s): natural substances and extractives | |
(Z)- | hinokiresinol |
CAS: 79056-22-7 Use(s): natural substances and extractives | |
hirudin | |
CAS: 113274-56-9 Use(s): natural substances and extractives | |
(R)- | hispaglabridin A |
CAS: 68978-03-0 Use(s): natural substances and extractives | |
(R)- | hispaglabridin B |
CAS: 68978-02-9 Use(s): natural substances and extractives | |
hispolone | |
CAS: 173933-40-9 Use(s): natural substances and extractives | |
histamine | |
CAS: 51-45-6 Use(s): natural substances and extractives | |
dextro- | histidine |
CAS: 351-50-8 Use(s): natural substances and extractives | |
laevo- | histidine |
CAS: 71-00-1 FEMA: 3694 JECFA: 1431 FLAVIS: 17.008 Use(s): special dietary and nutritional additives | |
laevo- | histidine hydrochloride monohydrate |
CAS: 5934-29-2 Use(s): flavoring agents | |
hoduloside III | |
CAS: 146503-30-2 Use(s): natural substances and extractives | |
hoduloside IV | |
CAS: 146445-91-2 Use(s): natural substances and extractives | |
hoduloside IX | |
CAS: 154971-13-8 Use(s): natural substances and extractives | |
hoduloside V | |
CAS: 146445-92-3 Use(s): natural substances and extractives | |
hoduloside VI | |
CAS: 154971-10-5 Use(s): natural substances and extractives | |
hoduloside VII | |
CAS: 154971-11-6 Use(s): natural substances and extractives | |
hoduloside VIII | |
CAS: 154971-12-7 Use(s): natural substances and extractives | |
hoduloside X | |
CAS: 154971-14-9 Use(s): natural substances and extractives | |
holocalin | |
CAS: 41753-54-2 Use(s): natural substances and extractives | |
honokiol | |
CAS: 35354-74-6 Use(s): natural substances and extractives | |
honyucitrin | |
CAS: 114542-44-8 Use(s): natural substances and extractives | |
honyudisin | |
CAS: 114542-45-9 Use(s): natural substances and extractives | |
honyumine | |
CAS: 100595-86-6 Use(s): natural substances and extractives | |
hop ether | |
CAS: 19901-95-2 Use(s): natural substances and extractives | |
hops beta acids | |
Use(s): antimicrobial agents | |
hordatine A | |
CAS: 7073-64-5 Use(s): natural substances and extractives | |
hordatine B | |
CAS: 10502-21-3 Use(s): natural substances and extractives | |
hordenine | |
CAS: 539-15-1 Use(s): cosmetic ingredient for skin protecting | |
hotrienol | |
CAS: 20053-88-7 JECFA: 1154 Use(s): flavor and fragrance agents | |
hovenidulcigenin A | |
CAS: 171499-81-3 Use(s): natural substances and extractives | |
hovenidulcigenin B | |
CAS: 182173-50-8 Use(s): natural substances and extractives | |
hovenidulcioside A1 | |
CAS: 171499-79-9 Use(s): natural substances and extractives | |
hovenidulcioside A2 | |
CAS: 171499-80-2 Use(s): natural substances and extractives | |
hovenidulcioside B1 | |
CAS: 174902-16-0 Use(s): natural substances and extractives | |
hovenidulcioside B2 | |
CAS: 174902-17-1 Use(s): natural substances and extractives | |
hovenine A | |
CAS: 52309-78-1 Use(s): natural substances and extractives | |
hovenitin I | |
CAS: 71106-82-6 Use(s): natural substances and extractives | |
hovenolactone | |
CAS: 85206-97-9 Use(s): natural substances and extractives | |
hovenoside D | |
CAS: 68144-22-9 Use(s): natural substances and extractives | |
huajiaosimuline | |
CAS: 155416-21-0 Use(s): natural substances and extractives | |
hulupone | |
CAS: 468-62-2 Use(s): natural substances and extractives | |
iso | humbertiol A |
CAS: NF0186 Use(s): natural substances and extractives | |
iso | humbertiol B |
CAS: NF0184 Use(s): natural substances and extractives | |
iso | humbertiol C |
CAS: NF0187 Use(s): natural substances and extractives | |
iso | humbertiol D |
CAS: NF0185 Use(s): natural substances and extractives | |
huminol M | |
CAS: 84681-92-5 Use(s): fragrance agents | |
humuladienone | |
CAS: 24405-90-1 Use(s): natural substances and extractives | |
(1E,6E)-gamma- | humulene |
CAS: 26259-79-0 Use(s): natural substances and extractives | |
alpha- | humulene |
CAS: 6753-98-6 FLAVIS: 01.043 Use(s): flavoring agents | |
beta- | humulene |
CAS: 116-04-1 Use(s): natural substances and extractives | |
iso | humulene |
CAS: NF0188 Use(s): natural substances and extractives | |
humulene diepoxide | |
CAS: 11066-50-5 Use(s): natural substances and extractives | |
humulene diepoxide A | |
CAS: 118899-63-1 Use(s): natural substances and extractives | |
humulene epoxide III | |
CAS: 21624-36-2 Use(s): natural substances and extractives | |
humulene oxide I | |
CAS: 19888-33-6 Use(s): natural substances and extractives | |
humulene oxide II | |
CAS: 19888-34-7 Use(s): natural substances and extractives | |
humulene-1,2-epoxide | |
CAS: NF0331 Use(s): natural substances and extractives | |
humulene-8-hydroperoxide | |
CAS: 228565-88-6 Use(s): natural substances and extractives | |
humulenol | |
CAS: 19888-01-8 Use(s): natural substances and extractives | |
humulenol II | |
CAS: 19888-00-7 Use(s): natural substances and extractives | |
humulenone II | |
CAS: 19888-05-2 Use(s): natural substances and extractives | |
humulinic acid | |
CAS: 520-40-1 Use(s): natural substances and extractives | |
humulinic acid A | |
CAS: 24184-12-1 Use(s): natural substances and extractives | |
humulinic acid B | |
CAS: 26892-78-4 Use(s): natural substances and extractives | |
humulinone | |
CAS: 981-03-3 Use(s): natural substances and extractives | |
iso | humulinone A |
CAS: 83680-60-8 Use(s): natural substances and extractives | |
humulol | |
CAS: 24405-58-1 Use(s): natural substances and extractives | |
(R)- | humulon |
CAS: 26472-41-3 Use(s): natural substances and extractives | |
alpha- | humulone |
CAS: 23510-81-8 Use(s): natural substances and extractives | |
iso | humulone |
CAS: 25522-96-7 Use(s): natural substances and extractives | |
huntite | |
CAS: 19569-21-2 Use(s): indirect food additives: adhesives and components of coatings | |
hyacinth acetals | |
CAS: 29895-73-6 FEMA: 2877 JECFA: 1004 FLAVIS: 06.007 Use(s): flavor and fragrance agents | |
1,3- | hyacinth acetal |
CAS: 4740-79-8 Use(s): fragrance agents | |
1,2- | hyacinth acetal |
CAS: 5694-72-4 Use(s): fragrance agents | |
hyacinth butanal | |
CAS: 16251-77-7 Use(s): fragrance agents | |
hyacinth ether | |
CAS: 80858-47-5 Use(s): fragrance agents | |
hyaluronic acid | |
CAS: 9004-61-9 Use(s): nutrient adjuncts, dietary supplements, nutrient agents | |
hydnocarpin | |
CAS: 51419-48-8 Use(s): natural substances and extractives | |
neo | hydnocarpin |
CAS: 71417-57-7 Use(s): natural substances and extractives | |
hydnowightin | |
CAS: 71392-06-8 Use(s): natural substances and extractives | |
hydrangenol | |
CAS: 480-47-7 Use(s): natural substances and extractives | |
hydratopyrrhoxanthinol | |
CAS: 120416-68-4 Use(s): natural substances and extractives | |
alpha- | hydro-omega-hydroxy poly(ocyethylene) poly(oxypropylene) poly(oxyethylene) (15 mole minimum) blocked copolymer, low erucic acid rapeseed oil |
CAS: 977174-28-9 Use(s): antifoaming (or defoaming) agents | |
hydroabietyl alcohol | |
CAS: 26266-77-3 Use(s): information only not used for fragrances or flavors | |
meso- | hydrobenzoin |
CAS: 579-43-1 Use(s): information only not used for fragrances or flavors | |
hydrocarbon oils | |
CAS: 8020-83-5 Use(s): solvents | |
hydrocellulose | |
CAS: 9034-34-8 Use(s): information only not used for fragrances or flavors | |
hydrochlorofluorocarbon 22 | |
CAS: 75-45-6 Use(s): propellants, aerating agents, and gas | |
hydrocinnamoin | |
CAS: 4403-20-7 Use(s): information only not used for fragrances or flavors | |
hydrocotarnine hydrobromide | |
CAS: 5985-00-2 Use(s): information only not used for fragrances or flavors | |
hydrocyanic acid | |
CAS: 74-90-8 Use(s): natural substances and extractives | |
hydrofluorocarbon 152A | |
CAS: 75-37-6 Use(s): propellants, aerating agents, and gas | |
hydrogen pentyl disulfide | |
CAS: 86849-52-7 Use(s): natural substances and extractives | |
hydrogen sulfide | |
CAS: 7783-06-4 FEMA: 3779 FLAVIS: 16.007 Use(s): sanitizing agents for food processing equipment | |
hydrojasmal | |
CAS: 68411-59-6 Use(s): fragrance agents | |
hydroquinine | |
CAS: 522-66-7 Use(s): natural substances and extractives | |
para- | hydroquinone |
CAS: 123-31-9 FLAVIS: 04.083 Use(s): stabilizing agents | |
hydroquinone diacetate | |
CAS: 1205-91-0 Use(s): information only not used for fragrances or flavors | |
hydrorobinetin | |
CAS: 4382-33-6 Use(s): natural substances and extractives | |
7- | hydroxcoumarin |
CAS: 93-35-6 Use(s): natural substances and extractives | |
hydroxocobalamin | |
CAS: 13422-51-0 Use(s): special dietary and nutritional additives | |
3- | hydroxy-1-(4-hydroxyphenyl)-1-propanone |
CAS: 53170-93-7 Use(s): natural substances and extractives | |
8- | hydroxy-1-methoxy-3-methylanthraquinone |
CAS: 67116-22-7 Use(s): natural substances and extractives | |
(E)-13- | hydroxy-10-oxo-11-octadecenoic acid |
CAS: 28979-44-4 Use(s): natural substances and extractives | |
16- | hydroxy-10-oxohexadecanoic acid |
CAS: 53833-25-3 Use(s): natural substances and extractives | |
8alpha-8- | hydroxy-12-oxo-13-abieten-18-oic acid |
CAS: 130252-62-9 Use(s): natural substances and extractives | |
18- | hydroxy-16-tritriacontanone |
CAS: 97191-42-9 Use(s): natural substances and extractives | |
ent-17- | hydroxy-16b-kauran-19-al |
CAS: 41756-43-8 Use(s): natural substances and extractives | |
4'- | hydroxy-2-biphenylcarboxylic acid |
CAS: 67526-82-3 Use(s): natural substances and extractives | |
(E)-9- | hydroxy-2-decenoic acid |
CAS: 1422-28-2 Use(s): natural substances and extractives | |
7- | hydroxy-2-methylisoflavone |
CAS: 2859-88-3 Use(s): natural substances and extractives | |
6- | hydroxy-2-naphthalenecarboxylic acid |
CAS: 16712-64-4 Use(s): indirect food additives: adhesives and components of coatings | |
cis-4- | hydroxy-2-nonenal |
CAS: 18286-49-2 Use(s): natural substances and extractives | |
(±)-3- | hydroxy-2-pentanone |
CAS: 118712-30-4 Use(s): information only not used for fragrances or flavors | |
4- | hydroxy-2-pentenal |
CAS: 16931-17-2 Use(s): information only not used for fragrances or flavors | |
L-cis-5- | hydroxy-2-piperidinecarboxylic acid |
CAS: 63088-78-8 Use(s): natural substances and extractives | |
L-trans-5- | hydroxy-2-piperidinecarboxylic acid |
CAS: 50439-45-7 Use(s): natural substances and extractives | |
5- | hydroxy-2,3-dimethyl-1,4-naphthoquinone |
CAS: 80596-51-6 Use(s): natural substances and extractives | |
1alpha-1- | hydroxy-2,4(18),11(13)-eudesmatrien-12-oic acid |
CAS: 135594-81-9 Use(s): natural substances and extractives | |
7- | hydroxy-2,5-dimethyl-4H-1-benzopyran-4-one |
CAS: 38412-47-4 Use(s): natural substances and extractives | |
7- | hydroxy-2',3',4'-trimethoxyisoflavan |
CAS: 136027-12-8 Use(s): natural substances and extractives | |
2- | hydroxy-22-methyltetracosanoic acid |
CAS: 52900-16-0 Use(s): natural substances and extractives | |
4- | hydroxy-2H-1-benzopyran-2-one |
CAS: 3690-05-9 Use(s): natural substances and extractives | |
ax-4''- | hydroxy-3-'-methoxymaysin |
CAS: 169132-06-3 Use(s): natural substances and extractives | |
4- | hydroxy-3-(16-methylheptadecyl)-2H-pyran-2-one |
CAS: 203300-23-6 Use(s): natural substances and extractives | |
7- | hydroxy-3-(3-hydroxy-4-methoxybenzyl)-5-methoxy-4-chromanone |
CAS: 107585-73-9 Use(s): natural substances and extractives | |
5- | hydroxy-3-(4-hydroxybenzyl)-7,8-dimethoxy-4-chromanone |
CAS: 93078-82-1 Use(s): natural substances and extractives | |
2- | hydroxy-3-(4-methoxyphenyl)propanoic acid |
CAS: 28030-15-1 Use(s): natural substances and extractives | |
8- | hydroxy-3-methoxy-1-methylanthraquinone-2-carboxylic acid |
CAS: 176327-86-9 Use(s): natural substances and extractives | |
10- | hydroxy-3-methoxy-1,3,5,7-cadinatetraen-9-one |
CAS: 72843-51-7 Use(s): natural substances and extractives | |
3-(4- | hydroxy-3-methoxyphenyl)-1,2-propanediol |
CAS: 220006-74-6 Use(s): natural substances and extractives | |
7-(4- | hydroxy-3-methoxyphenyl)-5-methoxy-1-phenyl-3-heptanone |
CAS: 83161-95-9 Use(s): natural substances and extractives | |
1-(4- | hydroxy-3-methoxyphenyl)-7-phenyl-3,5-heptanedione |
CAS: 83161-94-8 Use(s): natural substances and extractives | |
2-[2-(4- | hydroxy-3-methoxyphenyl)ethyl]-5-octylfuran |
CAS: 143114-92-5 Use(s): natural substances and extractives | |
3- | methyl salicylaldehyde |
CAS: 824-42-0 Use(s): natural substances and extractives | |
1- | hydroxy-3-octanone |
CAS: 7786-52-9 Use(s): information only not used for fragrances or flavors | |
4- | hydroxy-3-phenyl coumarin |
CAS: 1786-05-6 Use(s): natural substances and extractives | |
7- | hydroxy-3,3',4',5,6,8-hexamethoxyflavone |
CAS: 185678-89-1 Use(s): natural substances and extractives | |
5- | hydroxy-3,3',4',6,7,8-hexamethoxyflavone |
CAS: 1176-88-1 Use(s): natural substances and extractives | |
2-[2- | hydroxy-3,5-bis(1,1-dimethylbenzyl)phenyl]benzotriazole |
CAS: 70321-86-7 Use(s): indirect food additives: adhesives and components of coatings | |
2-(1-(2- | hydroxy-3,5-di-tert-pentyl phenyl)ethyl)-4,6-di-tert-pentyl phenyl acrylate |
CAS: 123968-25-2 Use(s): indirect food additives: adhesives and components of coatings | |
(S-(R*,R*))-1-(4- | hydroxy-3,5-dimethoxyphenyl)-7-(4-hydroxy-3-methoxyphenyl)-3,5-heptanediol |
CAS: 145888-84-2 Use(s): natural substances and extractives | |
2-(2'- | hydroxy-3,5'-di-tert-butylphenyl)-5-chlorobenzotriazole |
CAS: 3864-99-1 Use(s): indirect food additives: adhesives and components of coatings | |
4- | hydroxy-3,6-dimethyl-2H-pyran-2-one |
CAS: 5192-62-1 Use(s): natural substances and extractives | |
1- | hydroxy-3,6,7-trimethoxy-2,8-diprenylxanthone |
CAS: 15404-76-9 Use(s): natural substances and extractives | |
5-(6- | hydroxy-3,7-dimethyl-2,7-octadienyloxy)-7-methoxycoumarin |
CAS: 40520-59-0 Use(s): natural substances and extractives | |
7- | hydroxy-3',4',5,6-tetramethoxyflavone |
CAS: 40983-99-1 Use(s): natural substances and extractives | |
7- | hydroxy-3',4',5,6,8-pentamethoxyflavone |
CAS: 149402-88-0 Use(s): natural substances and extractives | |
2'- | hydroxy-3',4',5',7,8-pentamethoxyflavan |
CAS: 133342-92-4 Use(s): natural substances and extractives | |
5- | hydroxy-3',4',7,8-tetramethoxyflavone |
CAS: 13003-74-2 Use(s): natural substances and extractives | |
4'- | hydroxy-3',5,6,7,8-pentamethoxyflavone |
CAS: 34810-62-3 Use(s): natural substances and extractives | |
(R)-5- | hydroxy-4-(4´-hydroxy-3´-methoxyphenyl)-7-methylchroman-2-one |
CAS: 1793064-68-2 FEMA: 4834 Use(s): flavoring agents | |
6- | hydroxy-4-methoxy-3-(3-methyl-2-butenyl)-2-(2-phenylethenyl)benzoic acid |
CAS: 87402-83-3 Use(s): natural substances and extractives | |
1-(3- | hydroxy-4-methoxyphenyl)-1,2-ethanediol |
CAS: 213466-88-7 Use(s): natural substances and extractives | |
2- | hydroxy-4-n-hexyloxybenzophenone |
CAS: 3293-97-8 Use(s): indirect food additives: adhesives and components of coatings | |
6- | hydroxy-4,6-dimethyl-3-hepten-2-one |
CAS: 83348-17-8 Use(s): natural substances and extractives | |
3'- | hydroxy-4',5,6,7,8-pentamethoxyflavone |
CAS: 112448-39-2 Use(s): natural substances and extractives | |
3'- | hydroxy-4',5',7,8-tetramethoxyflavone |
CAS: 133342-98-0 Use(s): natural substances and extractives | |
2- | hydroxy-5-methyl benzaldehyde |
CAS: 613-84-3 Use(s): information only not used for fragrances or flavors | |
4- | hydroxy-5-methyl-3(2H)-thiophenone |
CAS: 26494-09-7 Use(s): information only not used for fragrances or flavors | |
4'- | Hydroxy-5,6,7,8-tetramethoxyflavone |
CAS: 36950-98-8 Use(s): natural substances and extractives | |
2- | hydroxy-6-(8,11,14-pentadecatrienyl)benzoic acid |
CAS: 103904-73-0 Use(s): natural substances and extractives | |
7- | hydroxy-6-methoxy-alpha-pyrufuran |
CAS: 167278-45-7 Use(s): natural substances and extractives | |
4- | hydroxy-6-methyl-3-(1-oxobutyl)-2H-pyran-2-one |
CAS: 22073-85-4 Use(s): natural substances and extractives | |
28- | hydroxy-6-methyl-5-tritriacontanone |
CAS: 239091-54-4 Use(s): natural substances and extractives | |
5- | hydroxy-7-(4-hydroxy-3-methoxyphenyl)-1-phenyl-3-heptanone |
CAS: 79559-61-8 Use(s): natural substances and extractives | |
5- | hydroxy-7-(4-hydroxyphenyl)-1-phenyl-3-heptanone |
CAS: 83161-96-0 Use(s): natural substances and extractives | |
5- | hydroxy-7-methoxy-2-tritriacontyl-4H-1-benzopyran-4-one |
CAS: 144049-68-3 Use(s): natural substances and extractives | |
5- | hydroxy-7-methoxy-6-methylflavone |
CAS: 55969-57-8 Use(s): natural substances and extractives | |
28- | hydroxy-7-octacosanone |
CAS: 138416-85-0 Use(s): natural substances and extractives | |
4-(3- | hydroxy-7-phenyl-6-heptenyl)-1,2-benzenediol |
CAS: 158697-56-4 Use(s): natural substances and extractives | |
5- | hydroxy-7,8-dimethoxyflavonol |
CAS: 22399-73-1 Use(s): natural substances and extractives | |
(E)-10- | hydroxy-8-decenoic acid |
CAS: 106541-97-3 Use(s): natural substances and extractives | |
4- | hydroxy-8-methoxy-2H-furo[2,3-h]-1-benzopyran-2-one |
CAS: 196503-96-5 Use(s): natural substances and extractives | |
13- | hydroxy-9-methoxy-10-oxo-11-octadecenoic acid |
CAS: 150147-08-3 Use(s): natural substances and extractives | |
11- | hydroxy-9-tridecenoic acid |
CAS: 105798-56-9 Use(s): natural substances and extractives | |
6- | hydroxy-alpha-pyrufuran |
CAS: 167278-43-5 Use(s): natural substances and extractives | |
hydroxy-alpha-sanshool | |
CAS: 83883-10-7 Use(s): natural substances and extractives | |
4- | hydroxy-beta-ionol |
CAS: 27185-80-4 Use(s): natural substances and extractives | |
9-[1- | hydroxy-ethyl]-4-methyl-tricyclo[6.2.1.0.sup.2,7 ]undec-4-ene |
Use(s): information only not used for fragrances or flavors | |
hydroxy-gamma-sanshool | |
CAS: 78886-66-5 Use(s): natural substances and extractives | |
2- | hydroxyacetaldehyde |
CAS: 141-46-8 Use(s): natural substances and extractives | |
2'- | hydroxyacetophenone |
CAS: 118-93-4 FEMA: 3548 JECFA: 727 FLAVIS: 07.124 Use(s): flavor and fragrance agents | |
3'- | hydroxyacetophenone |
CAS: 121-71-1 Use(s): natural substances and extractives | |
4'- | hydroxyacetophenone |
CAS: 99-93-4 FEMA: 4330 JECFA: 2040 FLAVIS: 07.243 Use(s): cosmetic and flavor agents | |
omega- | hydroxyacetophenone |
CAS: 582-24-1 Use(s): natural substances and extractives | |
hydroxyachillin | |
CAS: 10180-88-8 Use(s): natural substances and extractives | |
1- | hydroxyacorenone |
CAS: 185154-98-7 Use(s): natural substances and extractives | |
2- | hydroxyacorenone |
CAS: 185154-94-3 Use(s): natural substances and extractives | |
2- | hydroxyalantolactone |
CAS: 68776-45-4 Use(s): natural substances and extractives | |
1beta- | hydroxyalantolactone |
CAS: 68776-47-6 Use(s): natural substances and extractives | |
hydroxyambran | |
CAS: 118562-73-5 Use(s): fragrance agents | |
11-beta- | hydroxyandrosterone |
CAS: 57-61-4 Use(s): information only not used for fragrances or flavors | |
hydroxyanigorufone | |
CAS: 56252-02-9 Use(s): natural substances and extractives | |
butylated | hydroxyanisole |
CAS: 25013-16-5 FEMA: 2183 Use(s): antioxidants and preservatives for fragrance and flavor | |
3- | hydroxyanthranilic acid |
CAS: 548-93-6 Use(s): natural substances and extractives | |
1alpha- | hydroxyarbusculin A |
CAS: 50301-94-5 Use(s): natural substances and extractives | |
9- | hydroxyasimicinone |
CAS: 255900-36-8 Use(s): natural substances and extractives | |
3- | hydroxyaspartic acid |
CAS: 1860-87-3 Use(s): natural substances and extractives | |
2- | hydroxybenzaldehyde |
CAS: 90-02-8 FEMA: 3004 JECFA: 897 FLAVIS: 05.055 Use(s): flavor and fragrance agents | |
3- | hydroxybenzaldehyde |
CAS: 100-83-4 Use(s): information only not used for fragrances or flavors | |
4- | hydroxybenzaldehyde |
CAS: 123-08-0 FEMA: 3984 JECFA: 956 FLAVIS: 05.047 Use(s): flavor and fragrance agents | |
2- | hydroxybenzenepropanoic acid |
CAS: 495-78-3 Use(s): natural substances and extractives | |
2- | hydroxybenzothiazole |
CAS: 934-34-9 Use(s): natural substances and extractives | |
2- | hydroxybenzyl alcohol |
CAS: 90-01-7 Use(s): natural substances and extractives | |
3- | hydroxybenzyl alcohol |
CAS: 620-24-6 Use(s): natural substances and extractives | |
4- | hydroxybenzyl alcohol |
CAS: 623-05-2 FEMA: 3987 JECFA: 955 FLAVIS: 02.165 Use(s): flavor and fragrance agents | |
4- | hydroxybenzyl amine |
CAS: 696-60-6 Use(s): natural substances and extractives | |
4- | hydroxybenzyl cyanide |
CAS: 14191-95-8 Use(s): natural substances and extractives | |
4- | hydroxybenzyl ethyl ether |
CAS: 57726-26-8 FLAVIS: 04.091 Use(s): flavoring agents | |
4- | hydroxybenzyl isothiocyanate |
CAS: 2086-86-4 Use(s): natural substances and extractives | |
12- | hydroxy-E-gamma-bisabolene |
CAS: 99112-26-2 Use(s): natural substances and extractives | |
3- | hydroxy-2-oxobutanoic acid |
CAS: 1944-42-9 Use(s): information only not used for fragrances or flavors | |
1- | hydroxy-2-butanone |
CAS: 5077-67-8 FEMA: 3173 JECFA: 1717 FLAVIS: 07.090 Use(s): flavor and fragrance agents | |
4- | hydroxy-2-butanone |
CAS: 590-90-9 Use(s): natural substances and extractives | |
1-(2- | hydroxy-4-isobutoxyphenyl)-3-(pyridin-2-yl)propan-1-one |
CAS: 1190230-47-7 FEMA: 4722 JECFA: 2159 Use(s): flavoring agents | |
(R)-3- | hydroxybutyl (R)-3-hydroxybutyrate |
Use(s): food additive | |
2- | hydroxybutyric acid |
CAS: 565-70-8 Use(s): natural substances and extractives | |
3- | hydroxybutyric acid |
CAS: 300-85-6 Use(s): natural substances and extractives | |
14- | hydroxy-delta-cadinene |
CAS: 153408-92-5 Use(s): natural substances and extractives | |
10- | hydroxycalamene-8,9-epoxide |
CAS: NF0469 Use(s): natural substances and extractives | |
5- | hydroxycalamenene |
CAS: 95908-33-1 Use(s): natural substances and extractives | |
hydroxycapric acid | |
CAS: 5393-81-7 Use(s): cosmetic agents | |
3- | hydroxycarbofuran angelate |
CAS: 79189-81-4 Use(s): information only not used for fragrances or flavors | |
5- | hydroxycarvone |
CAS: 56423-48-4 Use(s): natural substances and extractives | |
6- | hydroxycarvone |
CAS: 51200-86-3 FEMA: 4523 JECFA: 2244 Use(s): flavor and fragrance agents | |
(R)-6- | hydroxycarvone |
CAS: NF0091 Use(s): information only not used for fragrances or flavors | |
9- | hydroxycarvone |
CAS: 151910-94-0 Use(s): information only not used for fragrances or flavors | |
6- | hydroxycarvotanacetone |
CAS: 131486-99-2 Use(s): natural substances and extractives | |
8- | hydroxycarvotanacetone |
CAS: 7712-46-1 Use(s): natural substances and extractives | |
14- | hydroxy-9-epi-(E)-caryophyllene |
CAS: 79768-25-5 Use(s): natural substances and extractives | |
14- | hydroxy-9-epi-beta-caryophyllene |
CAS: NF0192 Use(s): natural substances and extractives | |
14- | hydroxy-beta-caryophyllene |
CAS: NF0193 Use(s): natural substances and extractives | |
14- | hydroxycaryophyllene oxide |
CAS: 73510-14-2 Use(s): natural substances and extractives | |
5'- | hydroxycastavinol |
CAS: 183607-17-2 Use(s): natural substances and extractives | |
2- | hydroxychalcone |
CAS: 644-78-0 Use(s): natural substances and extractives | |
2'- | hydroxychalcone |
CAS: 1214-47-7 Use(s): natural substances and extractives | |
4- | hydroxychalcone |
CAS: 20426-12-4 Use(s): natural substances and extractives | |
4'- | hydroxychalcone |
CAS: 2657-25-2 Use(s): natural substances and extractives | |
2- | hydroxychavicol |
CAS: 1126-61-0 Use(s): natural substances and extractives | |
1'- | hydroxychavicol acetate |
CAS: 101135-02-8 Use(s): natural substances and extractives | |
exo-2- | hydroxycineole |
CAS: 18679-48-6 Use(s): natural substances and extractives | |
2- | hydroxycinnamaldehyde |
CAS: 3541-42-2 Use(s): natural substances and extractives | |
2- | hydroxycinnamaldehyde acetate |
CAS: 33538-94-2 Use(s): information only not used for fragrances or flavors | |
(E)-meta- | hydroxycinnamic acid |
CAS: 14755-02-3 Use(s): natural substances and extractives | |
(Z)-ortho- | hydroxycinnamic acid |
CAS: 495-79-4 Use(s): natural substances and extractives | |
(E)-para- | hydroxycinnamic acid |
CAS: 501-98-4 Use(s): natural substances and extractives | |
(Z)-para- | hydroxycinnamic acid |
CAS: 4501-31-9 Use(s): natural substances and extractives | |
hydroxycitronellal | |
CAS: 107-75-5 FEMA: 2583 JECFA: 611 FLAVIS: 05.012 Use(s): flavor and fragrance agents | |
(R)- | hydroxycitronellal |
CAS: 34212-48-1 Use(s): flavor and fragrance agents | |
(S)- | hydroxycitronellal |
CAS: 34212-53-8 Use(s): flavor and fragrance agents | |
hydroxycitronellal / skatole schiff's base | |
CAS: 68585-09-1 Use(s): fragrance agents | |
hydroxycitronellal diethyl acetal | |
CAS: 7779-94-4 FEMA: 2584 JECFA: 613 FLAVIS: 06.010 Use(s): flavor and fragrance agents | |
hydroxycitronellal diisotridecyl acetal | |
CAS: 67923-85-7 Use(s): fragrance agents | |
hydroxycitronellal dimethyl acetal | |
CAS: 141-92-4 FEMA: 2585 JECFA: 612 FLAVIS: 06.011 Use(s): flavor and fragrance agents | |
hydroxycitronellal distillation residue distillates | |
CAS: 68909-04-6 Use(s): fragrance agents | |
hydroxycitronellal / indole schiff's base | |
CAS: 68527-79-7 Use(s): fragrance agents | |
hydroxycitronellal / methyl anthranilate schiff's base | |
CAS: 89-43-0 Use(s): flavor and fragrance agents | |
hydroxycitronellal nitrile | |
CAS: 68797-68-2 Use(s): fragrance agents | |
hydroxycitronellal propylene glycol acetal | |
CAS: 93804-64-9 FEMA: 4485 JECFA: 1975 Use(s): flavor and fragrance agents | |
hydroxycitronellal replacer | |
Use(s): fragrance agents | |
hydroxycitronellal residue | |
CAS: 72968-30-0 Use(s): fragrance agents | |
hydroxycitronellol | |
CAS: 107-74-4 FEMA: 2586 JECFA: 610 FLAVIS: 02.047 Use(s): flavor and fragrance agents | |
3- | hydroxycoumarin |
CAS: 939-19-5 Use(s): natural substances and extractives | |
4- | hydroxycoumarin |
CAS: 1076-38-6 Use(s): natural substances and extractives | |
6- | hydroxycoumarin |
CAS: 6093-68-1 Use(s): natural substances and extractives | |
7- | hydroxy-6,11-cyclofarnes-3(15)-en-2-one |
CAS: 145631-62-5 Use(s): natural substances and extractives | |
2- | hydroxy-1-cyclohexanone |
CAS: 533-60-8 Use(s): information only not used for fragrances or flavors | |
3- | hydroxycyclohexanone |
CAS: 823-19-8 Use(s): information only not used for fragrances or flavors | |
2- | hydroxy-2-cyclohexenone |
CAS: 10316-66-2 FEMA: 3458 JECFA: 424 FLAVIS: 07.119 Use(s): flavoring agents | |
hydroxycyclohexyl methyl ketone | |
CAS: 1123-27-9 Use(s): fragrance agents | |
2- | hydroxycyclohexyl octanoate |
CAS: 70092-44-3 Use(s): information only not used for fragrances or flavors | |
2- | hydroxy-2-cyclopenten-1-one |
CAS: 10493-98-8 Use(s): natural substances and extractives | |
3- | hydroxy-2-cyclopentenone |
CAS: 5870-62-2 Use(s): natural substances and extractives | |
4- | hydroxy-2-cyclopentenone |
CAS: 59995-49-2 Use(s): natural substances and extractives | |
3- | hydroxy-beta-damascone |
CAS: 56915-02-7 Use(s): natural substances and extractives | |
trans- | hydroxydavanone |
CAS: 73395-08-1 Use(s): natural substances and extractives | |
3- | hydroxydecane dioic acid |
CAS: 68812-93-1 Use(s): natural substances and extractives | |
3- | hydroxydecanoic acid |
CAS: 14292-26-3 Use(s): natural substances and extractives | |
4- | hydroxydecanoic acid |
CAS: 17369-51-6 Use(s): natural substances and extractives | |
5- | hydroxydecanoic acid |
CAS: 624-00-0 Use(s): information only not used for fragrances or flavors | |
9- | hydroxydecanoic acid |
CAS: 1422-27-1 Use(s): natural substances and extractives | |
6- | hydroxy-5-decanone |
CAS: 6540-98-3 Use(s): information only not used for fragrances or flavors | |
10- | hydroxydecenoic acid |
CAS: 765-01-5 Use(s): cosmetic agents | |
(E)-10- | hydroxy-2-decenoic acid |
CAS: 14113-05-4 Use(s): natural substances and extractives | |
5- | hydroxy-7-decenoic acid lactone |
CAS: 100428-67-9 Use(s): natural substances and extractives | |
4'- | hydroxydehydrokawain |
CAS: 39986-86-2 Use(s): natural substances and extractives | |
4- | hydroxyderricin |
CAS: 55912-03-3 Use(s): natural substances and extractives | |
18- | hydroxydesoxycorticosterone |
CAS: 379-68-0 Use(s): information only not used for fragrances or flavors | |
hydroxydestruxin B | |
CAS: 250250-96-5 Use(s): natural substances and extractives | |
3- | hydroxydihydro-2(3H)-furanone |
CAS: 19444-84-9 Use(s): information only not used for fragrances or flavors | |
4alpha- | hydroxydihydroagarofuran |
CAS: NF0470 Use(s): natural substances and extractives | |
hydroxydihydrobovolide | |
CAS: 6067-11-4 Use(s): natural substances and extractives | |
3- | hydroxy-2,3-dihydrofarnesal |
CAS: 152040-72-7 Use(s): information only not used for fragrances or flavors | |
3'- | hydroxydihydroformononetin |
CAS: 67492-31-3 Use(s): natural substances and extractives | |
4- | hydroxy-7,8-dihydro-beta-ionone |
Use(s): natural substances and extractives | |
hydroxydihydromaltol | |
CAS: 28564-83-2 Use(s): natural substances and extractives | |
13- | hydroxydihydromelleolide |
CAS: 130396-92-8 Use(s): natural substances and extractives | |
(2R,5S,6S)-6- | hydroxydihydrotheaspirane |
CAS: 57967-68-7 FEMA: 3549 FLAVIS: 13.076 Use(s): flavor and fragrance agents | |
6- | hydroxydihydrotheaspirane (mixture of isomers) |
CAS: 65620-50-0 FEMA: 3549 JECFA: 1648 FLAVIS: 13.076 Use(s): flavor and fragrance agents | |
6- | hydroxydihydrotheaspirane |
CAS: 53398-90-6 Use(s): flavoring agents | |
(2R,5R,6R)-6- | hydroxydihydrotheaspirane |
CAS: 57967-70-1 Use(s): information only not used for fragrances or flavors | |
(2R,5R,6S)-6- | hydroxydihydrotheaspirane |
CAS: 57967-71-2 Use(s): information only not used for fragrances or flavors | |
(2R,5S,6R)-6- | hydroxydihydrotheaspirane |
CAS: 57967-69-8 Use(s): information only not used for fragrances or flavors | |
hydroxydimethyl cyclopentenone | |
CAS: 21835-00-7 Use(s): fragrance agents | |
2- | hydroxy-3,5-dimethyl-2-cyclopenten-1-one |
CAS: 21834-98-0 Use(s): information only not used for fragrances or flavors | |
6- | hydroxy-2,6-dimethyl-2,7-octadien-4-one |
CAS: 64661-54-7 Use(s): natural substances and extractives | |
(1R,4S)-1- | hydroxy-1,4-dimethyl spiro(4.6)undecan-2-one |
CAS: NF0139 Use(s): information only not used for fragrances or flavors | |
4- | hydroxy-2,5-dimethyl thiophen-3(2H)-one |
CAS: 26494-10-0 FLAVIS: 15.077 Use(s): information only not used for fragrances or flavors | |
3- | hydroxydodecanoic acid |
CAS: 1883-13-2 Use(s): information only not used for fragrances or flavors | |
11- | hydroxydodecanoic acid |
CAS: 32459-66-8 Use(s): natural substances and extractives | |
12- | hydroxydodecanoic acid |
CAS: 505-95-3 Use(s): natural substances and extractives | |
cis-12a- | hydroxydolineone |
CAS: 28617-71-2 Use(s): natural substances and extractives | |
omega- | hydroxyemodin |
CAS: 481-73-2 Use(s): natural substances and extractives | |
1- | hydroxyepiacorone |
CAS: 185154-96-5 Use(s): natural substances and extractives | |
12alpha- | hydroxyerosone |
CAS: 66322-32-5 Use(s): natural substances and extractives | |
22alpha- | hydroxyerythrodiol |
CAS: 20475-26-7 Use(s): natural substances and extractives | |
1'- | hydroxyestragole |
CAS: 51410-44-7 Use(s): natural substances and extractives | |
1,3-bis(2- | hydroxyethoxy)benzene |
CAS: 102-40-9 Use(s): indirect food additives: adhesives and components of coatings | |
2- | hydroxyethyl acrylate |
CAS: 818-61-1 Use(s): indirect food additives: adhesives and components of coatings | |
2- | hydroxyethyl-beta-cyclodextrin |
CAS: 98513-20-3 Use(s): information only not used for fragrances or flavors | |
N-(2- | hydroxyethyl)-2,3-dimethyl-2-isopropyl butanamide |
CAS: 883215-02-9 FEMA: 4602 JECFA: 2010 Use(s): flavor enhancers | |
N-(2- | hydroxyethyl) (E,Z)-2,6-dodecadienamide |
Use(s): information only not used for fragrances or flavors | |
2- | hydroxyethyl methacrylate |
CAS: 868-77-9 Use(s): film forming agents | |
5-(1- | hydroxyethyl)-4-methyl thiazole |
CAS: 45657-12-3 Use(s): information only not used for fragrances or flavors | |
9-[1- | hydroxy-ethyl]-5-methyl-tricyclo[6.2.1.0.sup.2,7 ]undec-4-ene |
Use(s): information only not used for fragrances or flavors | |
2- | hydroxyethyl phenoxyacetate |
CAS: 1984-60-7 Use(s): fragrance agents | |
2- | hydroxyethyl thioacetate |
CAS: 5512-65-2 Use(s): information only not used for fragrances or flavors | |
hydroxyethyl urea | |
CAS: 2078-71-9 Use(s): information only not used for fragrances or flavors | |
2-(2- | hydroxyethyl) pyridine |
CAS: 103-74-2 Use(s): information only not used for fragrances or flavors | |
bis(2- | hydroxyethyl)-2-hydroxypropyl-3-(dodecyloxy)methylammonium chloride |
CAS: 6200-40-4 Use(s): indirect food additives: adhesives and components of coatings | |
6-(1- | hydroxyethyl)-2,2-dimethyl-2H-1-benzopyran |
CAS: 71822-00-9 Use(s): natural substances and extractives | |
1-(2- | hydroxyethyl)-4-hydroxy-2,2,6,6-tetramethyl piperidine-succinic acid, dimethyl ester, copolymer |
CAS: 65447-77-0 Use(s): indirect food additives: adhesives and components of coatings | |
2- | hydroxyflavanone |
CAS: 17348-76-4 Use(s): natural substances and extractives | |
4- | hydroxyflavanone |
CAS: 6515-37-3 Use(s): natural substances and extractives | |
(±)-6- | hydroxyflavanone |
CAS: 4250-77-5 Use(s): natural substances and extractives | |
7- | hydroxyflavanone |
CAS: 6515-36-2 Use(s): natural substances and extractives | |
3- | hydroxyflavone |
CAS: 577-85-5 Use(s): information only not used for fragrances or flavors | |
5- | hydroxyflavone |
CAS: 491-78-1 Use(s): natural substances and extractives | |
6- | hydroxyflavone |
CAS: 6665-83-4 Use(s): natural substances and extractives | |
7- | hydroxyflavone |
CAS: 6665-86-7 Use(s): natural substances and extractives | |
7- | hydroxyflavonol |
CAS: 492-00-2 Use(s): natural substances and extractives | |
4- | hydroxy-9-fluorenone |
CAS: 1986-00-1 Use(s): natural substances and extractives | |
8- | hydroxygalangin |
CAS: 74693-69-9 Use(s): information only not used for fragrances or flavors | |
8- | hydroxygenistein |
CAS: 13539-27-0 Use(s): natural substances and extractives | |
3- | hydroxyglabrol |
CAS: 74148-41-7 Use(s): natural substances and extractives | |
24- | hydroxyglabrolide |
CAS: 98063-18-4 Use(s): natural substances and extractives | |
18alpha- | hydroxyglycyrrhetic acid |
CAS: 17991-67-2 Use(s): natural substances and extractives | |
14- | hydroxyguai-1,3,5,9,11-pentaene stearate |
CAS: 52898-98-3 Use(s): natural substances and extractives | |
2- | hydroxyguaia-1(10),11-dien-15-oic acid |
CAS: NF0471 Use(s): natural substances and extractives | |
2- | hydroxyheptanoic acid |
CAS: 636-69-1 Use(s): information only not used for fragrances or flavors | |
3- | hydroxyheptanoic acid |
CAS: 17587-29-0 Use(s): natural substances and extractives | |
1- | hydroxy-2-heptanone |
CAS: 17046-01-4 Use(s): information only not used for fragrances or flavors | |
7- | hydroxyheptaphylline |
CAS: 170663-15-7 Use(s): natural substances and extractives | |
2- | hydroxyhexacosanoic acid |
CAS: 14176-13-7 Use(s): natural substances and extractives | |
(R)-2- | hydroxyhexadecanoic acid |
CAS: 16452-51-0 Use(s): information only not used for fragrances or flavors | |
2- | hydroxyhexadecanoic acid |
CAS: 764-67-0 Use(s): information only not used for fragrances or flavors | |
3- | hydroxyhexadecanoic acid |
CAS: 2398-34-7 Use(s): natural substances and extractives | |
16- | hydroxyhexadecanoic acid |
CAS: 506-13-8 Use(s): natural substances and extractives | |
(1R,4R)-1- | hydroxy-1,4,7,7,9,9-hexamethyl spiro(4.5)decan-2-one |
CAS: NF0140 Use(s): information only not used for fragrances or flavors | |
2- | hydroxyhexanal |
CAS: 41472-84-8 Use(s): information only not used for fragrances or flavors | |
3- | hydroxyhexanal |
CAS: 96013-98-8 Use(s): information only not used for fragrances or flavors | |
4- | hydroxyhexanal |
CAS: 109710-36-3 Use(s): information only not used for fragrances or flavors | |
3- | hydroxyhexanoic acid |
CAS: 10191-24-9 Use(s): information only not used for fragrances or flavors | |
4- | hydroxyhexanoic acid |
CAS: 13532-38-2 Use(s): information only not used for fragrances or flavors | |
5- | hydroxyhexanoic acid |
CAS: 185956-02-9 Use(s): information only not used for fragrances or flavors | |
6- | hydroxyhexanoic acid |
CAS: 1191-25-9 Use(s): natural substances and extractives | |
4- | hydroxy-3-hexanone |
CAS: 4984-85-4 FLAVIS: 07.167 Use(s): flavoring agents | |
4- | hydroxyhexenal |
CAS: 17427-08-6 Use(s): natural substances and extractives | |
2- | hydroxyhippuric acid |
CAS: 487-54-7 Use(s): natural substances and extractives | |
14- | hydroxy-alpha-humulene |
CAS: 75678-90-9 Use(s): natural substances and extractives | |
7- | hydroxy-6-hydromelodienone |
CAS: 135626-21-0 Use(s): natural substances and extractives | |
4- | hydroxy-2-(hydroxymethyl)-5-methyl furan-3-one |
CAS: 17678-20-5 Use(s): information only not used for fragrances or flavors | |
8- | hydroxyhyperforin 8,1-hemiacetal |
CAS: 262857-89-6 Use(s): natural substances and extractives | |
3- | hydroxy-beta-ionone |
CAS: NF0194 Use(s): natural substances and extractives | |
3- | hydroxy-gamma-ionone |
CAS: 116296-75-4 Use(s): natural substances and extractives | |
2- | hydroxyisobutyric acid |
CAS: 594-61-6 Use(s): cosmetic agents | |
1- | hydroxyisocarvomenthol |
CAS: 33669-76-0 Use(s): natural substances and extractives | |
7- | hydroxyisoflavone |
CAS: 13057-72-2 Use(s): natural substances and extractives | |
21- | hydroxyisoglabrolide |
CAS: 18184-25-3 Use(s): natural substances and extractives | |
hydroxyisolongifolaldehyde | |
CAS: 83454-04-0 Use(s): information only not used for fragrances or flavors | |
2- | hydroxyisophorone |
CAS: 4883-60-7 FEMA: 3459 JECFA: 426 FLAVIS: 07.120 Use(s): flavoring agents | |
2- | hydroxyisovaleric acid |
CAS: 4026-18-0 Use(s): natural substances and extractives | |
4- | hydroxyisovaleric acid |
CAS: 77220-86-1 Use(s): information only not used for fragrances or flavors | |
beta- | hydroxyisovaleryl shikonin |
CAS: 7415-78-3 Use(s): natural substances and extractives | |
9- | hydroxyladanifer-10-one(9(10(1))-abeo-9-hydroxyaromadendran-10-one) |
CAS: NF0472 Use(s): natural substances and extractives | |
15- | hydroxyleptocarpin |
CAS: 121541-07-9 Use(s): natural substances and extractives | |
8- | hydroxylinalool |
CAS: 64142-78-5 Use(s): flavor and fragrance agents | |
(E)-8- | hydroxylinalool |
CAS: 75991-61-6 Use(s): natural substances and extractives | |
(Z)-8- | hydroxylinalool |
CAS: 103619-06-3 Use(s): natural substances and extractives | |
5- | hydroxymaltol |
CAS: 1073-96-7 Use(s): natural substances and extractives | |
16- | hydroxy-13-manoyl oxide |
CAS: 122757-60-2 Use(s): natural substances and extractives | |
10- | hydroxy-1,8-para-menthadiene |
CAS: 15766-66-2 Use(s): cosmetic fragrance agents and aromatic raw materials | |
8- | hydroxy-para-menthan-3-one |
CAS: 3304-24-3 Use(s): natural substances and extractives | |
2- | hydroxy-5-methoxyacetophenone |
CAS: 705-15-7 Use(s): information only not used for fragrances or flavors | |
2- | hydroxy-6-methoxyacetophenone |
CAS: 703-23-1 Use(s): natural substances and extractives | |
4- | hydroxy-2-methoxybenzaldehyde |
CAS: 18278-34-7 Use(s): natural substances and extractives | |
4- | hydroxy-3-methoxybenzene propanol |
CAS: 2305-13-7 Use(s): natural substances and extractives | |
7- | hydroxy-8-methoxycoumarin |
CAS: 485-90-5 Use(s): natural substances and extractives | |
4-(4- | hydroxy-3-methoxyphenyl) butan-2-ol |
CAS: 39728-80-8 Use(s): natural substances and extractives | |
3-(4- | hydroxy-3-methoxyphenyl) propionaldehyde |
CAS: 80638-48-8 FLAVIS: 05.156 Use(s): flavoring agents | |
1-(2- | hydroxy-4-methoxyphenyl)-3-(pyridin-2-yl)propan-1-one |
CAS: 1190229-37-8 FEMA: 4723 JECFA: 2160 Use(s): flavoring agents | |
4- | hydroxy-2-methyl acetophenone |
CAS: 875-59-2 Use(s): natural substances and extractives | |
4- | hydroxy-3-methyl acetophenone |
CAS: 876-02-8 Use(s): natural substances and extractives | |
2-( | hydroxymethyl) anthraquinone |
CAS: 17241-59-7 Use(s): natural substances and extractives | |
4- | hydroxy-3-methyl benzaldehyde |
CAS: 15174-69-3 Use(s): flavoring agents | |
4-( | hydroxymethyl) benzoic acid |
CAS: 3006-96-0 Use(s): natural substances and extractives | |
4- | hydroxy-3-methyl-2-butanone |
CAS: 3393-64-4 Use(s): natural substances and extractives | |
2- | hydroxy-4-methyl-2-buten-4,1-olide |
Use(s): information only not used for fragrances or flavors | |
(±)-2- | hydroxy-3-methyl butyric acid |
CAS: 600-37-3 Use(s): natural substances and extractives | |
hydroxymethyl cellulose | |
CAS: 37353-59-6 Use(s): indirect food additives: adhesives and components of coatings | |
4- | hydroxy-6-methyl coumarin |
CAS: 13252-83-0 Use(s): natural substances and extractives | |
7- | hydroxy-4-methyl coumarin |
CAS: 90-33-5 Use(s): natural substances and extractives | |
4- | hydroxy-4-methyl-2-cyclohexen-1-one |
CAS: 70150-56-0 Use(s): natural substances and extractives | |
3-(4- | hydroxy-4-methyl cyclohexyl) butanal |
CAS: NF0042 Use(s): fragrance agents | |
1-(2- | hydroxy-4-methyl cyclohexyl) ethanone |
CAS: 917750-72-2 FEMA: 4742 Use(s): flavoring agents | |
2- | hydroxy-5-methyl-2-cyclopenten-1-one |
CAS: 3250-08-6 Use(s): natural substances and extractives | |
3- | hydroxy-2-methyl-2-cyclopentenone |
CAS: 5870-63-3 Use(s): natural substances and extractives | |
cis-5- | hydroxy-2-methyl-1,3-dioxane |
CAS: 3674-23-5 Use(s): natural substances and extractives | |
trans-5- | hydroxy-2-methyl-1,3-dioxane |
CAS: 3674-24-6 Use(s): natural substances and extractives | |
2- | hydroxy-3-methyl-4-ethyl-2-buten-4,1-olide |
Use(s): information only not used for fragrances or flavors | |
2- | hydroxy-3-methyl-4-ethyl-4-carboxy-2-buten-4,1-olide |
Use(s): information only not used for fragrances or flavors | |
1'- | hydroxymethyl eugenol |
CAS: 31706-95-3 Use(s): natural substances and extractives | |
7- | hydroxy-5-methyl flavone |
CAS: 15235-99-1 Use(s): natural substances and extractives | |
5- | hydroxymethyl furfural |
CAS: 67-47-0 FLAVIS: 13.139 Use(s): flavoring agents | |
2- | hydroxy-5-methyl-3-hexanone |
CAS: 246511-74-0 FEMA: 3989 Use(s): flavoring agents | |
3- | hydroxy-5-methyl-2-hexanone |
CAS: 163038-04-8 FEMA: 3989 FLAVIS: 07.260 Use(s): flavoring agents | |
3(2)- | hydroxy-5-methyl-2(3)-hexanone |
CAS: 163038-04-8 FEMA: 3989 JECFA: 2034 Use(s): flavoring agents | |
4- | hydroxy-5-methyl-2-hexanone |
CAS: 38836-21-4 Use(s): natural substances and extractives | |
hydroxymethyl hexyl ethyl ketone | |
CAS: 59191-78-5 FEMA: 3292 JECFA: 1839 FLAVIS: 07.097 Use(s): flavor and fragrance agents | |
hydroxymethyl longifolene | |
CAS: 5989-05-9 Use(s): fragrance agents | |
hydroxymethyl isolongifolene 50% in dpg | |
CAS: 59056-64-3 Use(s): fragrance agents | |
2-( | hydroxymethyl) menthol |
CAS: 51210-01-6 Use(s): information only not used for fragrances or flavors | |
2- | hydroxymethyl-6-methyl-pyridine |
CAS: 1122-71-0 Use(s): information only not used for fragrances or flavors | |
1- | hydroxy-4-methyl-2-pentanone |
CAS: 68113-55-3 FEMA: 4463 JECFA: 1952 Use(s): flavoring agents | |
butylated | hydroxymethyl phenol |
CAS: 88-26-6 Use(s): antioxidants and stabilizers | |
3-(2- | hydroxy-4-methylphenyl)-2-butanone |
CAS: 83810-64-4 Use(s): natural substances and extractives | |
2-(2- | hydroxy-4-methyl phenyl)-3-pentanone |
CAS: 86843-15-4 Use(s): natural substances and extractives | |
2- | hydroxy-2-methyl propionaldehyde |
CAS: 20818-81-9 Use(s): information only not used for fragrances or flavors | |
2- | hydroxymethyl pyrazine |
CAS: 6705-33-5 Use(s): information only not used for fragrances or flavors | |
2- | hydroxy-5-methyl pyrazine |
CAS: 20721-17-9 Use(s): information only not used for fragrances or flavors | |
3- | hydroxy-2-methyl pyridine |
CAS: 1121-25-1 Use(s): natural substances and extractives | |
5- | hydroxy-2-methyl pyridine |
CAS: 1121-78-4 Use(s): natural substances and extractives | |
2- | hydroxy-3-methyl quinoline |
CAS: 2721-59-7 Use(s): natural substances and extractives | |
hydroxymethyl reductic acid | |
CAS: 123529-38-4 Use(s): information only not used for fragrances or flavors | |
1-(3- | hydroxy-5-methyl-2-thienyl) ethanone |
CAS: 133860-42-1 FEMA: 4142 JECFA: 1750 Use(s): flavoring agents | |
4- | hydroxy-3-(methylthio)butanoic acid lactone |
CAS: 40587-54-0 Use(s): information only not used for fragrances or flavors | |
3- | hydroxy-2-methyl valeric acid |
CAS: 28892-73-1 Use(s): information only not used for fragrances or flavors | |
(±)-4- | hydroxy-6-methyl-2-heptanone |
CAS: 57548-36-4 FEMA: 4784 Use(s): flavoring agents | |
4- | hydroxy-6-methyl-2-pyrone |
CAS: 675-10-5 Use(s): information only not used for fragrances or flavors | |
(S)-5- | hydroxymethyl-2(5H)-furanone |
CAS: 78508-96-0 Use(s): natural substances and extractives | |
4- | hydroxymethyl-pyridine |
CAS: 586-95-8 Use(s): information only not used for fragrances or flavors | |
N-( | hydroxymethyl) acryl amide |
CAS: 924-42-5 Use(s): indirect food additives: adhesives and components of coatings | |
2,2-bis( | hydroxymethyl) propionic acid |
CAS: 4767-03-7 Use(s): indirect food additives: adhesives and components of coatings | |
2-( | hydroxymethyl)benzoic acid |
CAS: 612-20-4 Use(s): natural substances and extractives | |
hydroxymethylene tanshinquinone | |
CAS: 83145-47-5 Use(s): natural substances and extractives | |
3- | hydroxymugineic acid |
CAS: 74235-23-7 Use(s): natural substances and extractives | |
14- | hydroxy-alpha-muurolene |
CAS: 135118-51-3 Use(s): natural substances and extractives | |
alpha- | hydroxymyristic acid |
CAS: 2507-55-3 Use(s): natural substances and extractives | |
beta- | hydroxymyristic acid |
CAS: 1961-72-4 Use(s): natural substances and extractives | |
2- | hydroxynaringenin |
CAS: 58124-18-8 Use(s): natural substances and extractives | |
3- | hydroxynonanoic acid |
CAS: 40165-87-5 Use(s): information only not used for fragrances or flavors | |
(R)-3- | hydroxynonanoic acid |
CAS: 33796-87-1 Use(s): information only not used for fragrances or flavors | |
(S)-3- | hydroxynonanoic acid |
CAS: 45023-83-4 Use(s): information only not used for fragrances or flavors | |
hydroxynonanone | |
CAS: 67801-46-1 Use(s): fragrance agents | |
p- | hydroxynonanophenone |
CAS: 14392-69-9 Use(s): natural substances and extractives | |
4- | hydroxynonenal |
CAS: 29343-52-0 Use(s): natural substances and extractives | |
7- | hydroxynorbornadiene |
CAS: 822-80-0 Use(s): natural substances and extractives | |
12- | hydroxy-9-octadecanoic acid |
CAS: 7431-95-0 Use(s): natural substances and extractives | |
(E)-12- | hydroxy-9-octadecenoic acid |
CAS: 82188-83-8 Use(s): information only not used for fragrances or flavors | |
18- | hydroxy-9-octadecenoic acid |
CAS: 3329-38-2 Use(s): natural substances and extractives | |
3- | hydroxyoctanoic acid |
CAS: 14292-27-4 Use(s): natural substances and extractives | |
4- | hydroxyoctanoic acid |
CAS: NF0195 Use(s): information only not used for fragrances or flavors | |
5- | hydroxyoctanoic acid |
CAS: 29671-57-6 Use(s): information only not used for fragrances or flavors | |
6- | hydroxyoctanoic acid |
CAS: 64165-18-0 Use(s): information only not used for fragrances or flavors | |
7- | hydroxyoctanoic acid |
CAS: 17173-14-7 Use(s): information only not used for fragrances or flavors | |
8- | hydroxyoctanoic acid |
CAS: 764-89-6 Use(s): information only not used for fragrances or flavors | |
3- | hydroxy-2-octanone |
CAS: 37160-77-3 FEMA: 4139 JECFA: 2035 FLAVIS: 07.238 Use(s): flavoring agents | |
3- | hydroxyoctyl propionate |
CAS: 53554-42-0 Use(s): information only not used for fragrances or flavors | |
(+)-12a- | hydroxypachyrrhizone |
CAS: 28768-44-7 Use(s): natural substances and extractives | |
hydroxypelenolide | |
CAS: 17909-94-3 Use(s): natural substances and extractives | |
(1R,4S,5S,9R)-1- | hydroxy-1,4,7,7,9-pentamethyl spiro(4.5)decan-2-one |
CAS: NF0138 Use(s): information only not used for fragrances or flavors | |
5- | hydroxypentan-2-one |
CAS: 1071-73-4 Use(s): information only not used for fragrances or flavors | |
4- | hydroxypentanal |
CAS: 44601-24-3 Use(s): information only not used for fragrances or flavors | |
5- | hydroxypentanal |
CAS: 4221-03-8 Use(s): information only not used for fragrances or flavors | |
(R)-3- | hydroxypentane nitrile |
CAS: 198561-27-2 Use(s): information only not used for fragrances or flavors | |
2- | hydroxypentanoic acid |
CAS: 617-31-2 Use(s): natural substances and extractives | |
(S)-2- | hydroxypentanoic acid |
CAS: 41014-93-1 Use(s): information only not used for fragrances or flavors | |
3- | hydroxypentanoic acid |
CAS: 10237-77-1 Use(s): information only not used for fragrances or flavors | |
4- | hydroxypentanoic acid |
CAS: 13532-37-1 Use(s): information only not used for fragrances or flavors | |
5- | hydroxypentanoic acid |
CAS: 13392-69-3 Use(s): information only not used for fragrances or flavors | |
4- | hydroxy-2-pentanone |
CAS: 4161-60-8 Use(s): natural substances and extractives | |
3- | hydroxy-3-penten-2-one |
CAS: 52704-36-6 Use(s): natural substances and extractives | |
3- | hydroxy-4-pentene nitrile |
CAS: 27451-36-1 Use(s): natural substances and extractives | |
2- | hydroxy-5-pentyl tetrahydrofuran |
CAS: 78053-99-3 Use(s): natural substances and extractives | |
hydroxypeucedanin | |
CAS: 2643-85-8 Use(s): natural substances and extractives | |
2- | hydroxyphenethyl alcohol |
CAS: 7768-28-7 Use(s): natural substances and extractives | |
3- | hydroxyphenethyl alcohol |
CAS: 13398-94-2 Use(s): information only not used for fragrances or flavors | |
4- | hydroxyphenethyl alcohol |
CAS: 501-94-0 FLAVIS: 02.166 Use(s): flavoring agents | |
p- | hydroxyphenethyl trans-ferulate |
CAS: 84873-15-4 Use(s): natural substances and extractives | |
2- | hydroxyphenyl acetic acid |
CAS: 614-75-5 Use(s): natural substances and extractives | |
3- | hydroxyphenyl acetic acid |
CAS: 621-37-4 Use(s): information only not used for fragrances or flavors | |
3- | hydroxy-4-phenyl-2-butanone |
CAS: 5355-63-5 FEMA: 4052 JECFA: 2041 FLAVIS: 07.242 Use(s): flavoring agents | |
2-(4- | hydroxyphenyl) ethyl acetate |
CAS: 58556-55-1 Use(s): natural substances and extractives | |
2- | hydroxy-6-oxo-6-phenyl hexa-2,4-dienoate |
CAS: 50480-67-6 Use(s): natural substances and extractives | |
4- | hydroxyphenyl lactic acid |
CAS: 306-23-0 Use(s): information only not used for fragrances or flavors | |
3-(4- | hydroxyphenyl)-1-propanol |
CAS: 10210-17-0 Use(s): natural substances and extractives | |
3-(4- | hydroxyphenyl) propyl acetate |
CAS: 80373-18-8 Use(s): natural substances and extractives | |
1-(2- | hydroxyphenyl)-3-(pyridin-4-yl)propan-1-one |
CAS: 1186004-10-3 FEMA: 4721 JECFA: 2158 Use(s): sweeteners, flavor enhancers | |
bis(4- | hydroxyphenyl) methane |
CAS: 620-92-8 Use(s): indirect food additives: adhesives and components of coatings | |
7-(4- | hydroxyphenyl)-1-phenyl-4-hepten-3-one |
CAS: 100667-52-5 Use(s): natural substances and extractives | |
(E)-3-(4- | hydroxyphenyl)-2-propenal |
CAS: 2538-87-6 Use(s): natural substances and extractives | |
(-)-(E)-1-(4- | hydroxyphenyl)-7-phenyl-6-hepten-3-ol |
CAS: 158697-54-2 Use(s): natural substances and extractives | |
1,1,1-tris(4- | hydroxyphenyl)ethane |
CAS: 27955-94-8 Use(s): indirect food additives: adhesives and components of coatings | |
2,2' bis( | hydroxyphenyl)methane |
CAS: 2467-02-9 Use(s): indirect food additives: adhesives and components of coatings | |
2,4' bis( | hydroxyphenyl)methane |
CAS: 1333-03-0 Use(s): indirect food additives: adhesives and components of coatings | |
bis( | hydroxyphenyl)methane |
CAS: 1333-16-0 Use(s): indirect food additives: adhesives and components of coatings | |
2,2-bis(4- | hydroxyphenyl)propane bis(phthalic anhydride) |
CAS: 38103-06-9 Use(s): indirect food additives: adhesives and components of coatings | |
4- | hydroxyphthalide |
CAS: 13161-32-5 Use(s): natural substances and extractives | |
23- | hydroxyphysalolactone |
CAS: 118194-16-4 Use(s): natural substances and extractives | |
8- | hydroxypinoresinol |
CAS: 81426-17-7 Use(s): natural substances and extractives | |
4- | hydroxypiperitone |
CAS: 41853-05-8 Use(s): natural substances and extractives | |
hydroxyproline | |
CAS: 51-35-4 Use(s): special dietary and nutritional additives | |
4- | hydroxyproline |
CAS: 6912-67-0 Use(s): information only not used for fragrances or flavors | |
(±)-4- | hydroxyproline |
CAS: 36901-87-8 Use(s): flavoring agents | |
(R)-4- | hydroxyproline |
CAS: 36901-86-7 Use(s): information only not used for fragrances or flavors | |
(S)-4- | hydroxyproline |
CAS: 18610-59-8 Use(s): information only not used for fragrances or flavors | |
cis-4- | hydroxy-dextro-proline |
CAS: 2584-71-6 Use(s): information only not used for fragrances or flavors | |
2- | hydroxypropanal acetate |
CAS: 22094-23-1 Use(s): natural substances and extractives | |
2- | hydroxypropiophenone |
CAS: 610-99-1 Use(s): information only not used for fragrances or flavors | |
4- | hydroxypropiophenone |
CAS: 70-70-2 Use(s): information only not used for fragrances or flavors | |
beta- | hydroxypropiovanillone |
CAS: 2196-18-1 Use(s): natural substances and extractives | |
2- | hydroxypropyl acrylate |
CAS: 999-61-1 Use(s): indirect food additives: adhesives and components of coatings | |
hydroxypropyl cellulose | |
CAS: 9004-64-2 Use(s): multipurpose additives, foam promoter, mouthfeel, stabilizer | |
starch food modified: | hydroxypropyl distarch glycerol |
CAS: 59419-60-2 Use(s): food starch-modified | |
starch food modified: | hydroxypropyl distarch phosphate |
CAS: 53124-00-8 Use(s): food starch-modified | |
2- | hydroxypropyl 2-ethyl hexanoate |
CAS: 58921-10-1 Use(s): natural substances and extractives | |
2- | hydroxypropyl heptanoate |
CAS: 7249-54-9 Use(s): cosmetic agents | |
4- | hydroxy-3-propyl-2-hexanone |
CAS: 134332-15-3 Use(s): natural substances and extractives | |
hydroxypropyl methyl cellulose | |
CAS: 9004-65-3 Use(s): multipurpose additives | |
2- | hydroxy-3-(isopropyl)-6-methyl-2-cyclohexen-1-one |
CAS: 54783-36-7 Use(s): information only not used for fragrances or flavors | |
4- | hydroxy-6-isopropyl-3-methyl-2-cyclohexen-1-one |
CAS: 141978-04-3 Use(s): information only not used for fragrances or flavors | |
8- | hydroxy-5-isopropyl-8-methyl-non-6-en-2-one |
Use(s): information only not used for fragrances or flavors | |
8- | hydroxy-5-isopropyl-nonan-2-one |
CAS: NF0242 Use(s): information only not used for fragrances or flavors | |
8- | hydroxy-5-isopropyl-non-6-en-2-one |
Use(s): information only not used for fragrances or flavors | |
starch food modified: | hydroxypropyl starch |
CAS: 9049-76-7 Use(s): food starch-modified | |
starch food modified: oxidized | hydroxypropyl starch |
CAS: 68412-86-2 Use(s): food starch-modified | |
5- | hydroxypyrazinoic acid |
CAS: 34604-60-9 Use(s): information only not used for fragrances or flavors | |
3- | hydroxypyridine |
CAS: 109-00-2 Use(s): information only not used for fragrances or flavors | |
4- | hydroxypyridine |
CAS: 626-64-2 Use(s): information only not used for fragrances or flavors | |
3- | hydroxy-2-pyrone |
CAS: 496-64-0 Use(s): natural substances and extractives | |
hydroxypyruvaldehyde | |
CAS: 997-10-4 Use(s): natural substances and extractives | |
3- | hydroxypyruvic acid |
CAS: 1113-60-6 FEMA: 3843 JECFA: 635 FLAVIS: 08.086 Use(s): flavoring agents | |
4- | hydroxyquinoline |
CAS: 611-36-9 Use(s): information only not used for fragrances or flavors | |
4- | hydroxyresveratrol |
CAS: 331443-00-6 Use(s): cosmetic agents | |
4- | hydroxysafranal |
CAS: 35692-94-5 Use(s): natural substances and extractives | |
1'- | hydroxysafrole |
CAS: 5208-87-7 Use(s): natural substances and extractives | |
3'- | hydroxysafrole |
CAS: 63785-57-9 Use(s): natural substances and extractives | |
6- | hydroxysandoricin |
CAS: 133585-56-5 Use(s): natural substances and extractives | |
3- | hydroxysclareol |
CAS: 132796-57-7 Use(s): natural substances and extractives | |
18- | hydroxysclareol |
CAS: 86248-66-0 Use(s): information only not used for fragrances or flavors | |
12- | hydroxysecophenol |
CAS: 79683-94-6 Use(s): natural substances and extractives | |
9- | hydroxyselina-4,11-dien-14-oic acid |
CAS: 92911-82-5 Use(s): natural substances and extractives | |
6- | hydroxyshogaol |
CAS: 143114-93-6 Use(s): natural substances and extractives | |
hydroxyspheroidene | |
CAS: 1191-20-4 Use(s): natural substances and extractives | |
12- | hydroxystearic acid |
CAS: 106-14-9 Use(s): cosmetic agents | |
8- | hydroxysubspinosin |
CAS: 80557-10-4 Use(s): natural substances and extractives | |
hydroxytanshinone | |
CAS: 18887-18-8 Use(s): natural substances and extractives | |
9- | hydroxy-gamma-tetradecalactone |
CAS: 122629-53-2 Use(s): natural substances and extractives | |
11- | hydroxytetradecanoic acid |
CAS: 2034-56-2 Use(s): natural substances and extractives | |
3- | hydroxytetrahydrofuran |
CAS: 453-20-3 Use(s): information only not used for fragrances or flavors | |
2- | hydroxythiophenol |
CAS: 1121-24-0 Use(s): information only not used for fragrances or flavors | |
3- | hydroxythiophenol |
CAS: 40248-84-8 Use(s): information only not used for fragrances or flavors | |
4- | hydroxythiophenol |
CAS: 637-89-8 Use(s): information only not used for fragrances or flavors | |
butylated | hydroxytoluene |
CAS: 128-37-0 FEMA: 2184 Use(s): antioxidants and preservatives for fragrance and flavor | |
4- | hydroxy-3,5,6-trimethyl-4-(3-oxo-1-butenyl)-2-cyclohexen-1-one |
CAS: 77846-84-5 Use(s): natural substances and extractives | |
4- | hydroxy-3,5,5-trimethyl-4-(3-oxo-1-butynyl)-2-cyclohexen-1-one |
CAS: 120853-12-5 Use(s): information only not used for fragrances or flavors | |
4- | hydroxy-2,6,6-trimethyl cyclohex-2-en-1-one |
CAS: 19620-37-2 Use(s): information only not used for fragrances or flavors | |
4- | hydroxy-2,6,6-trimethyl-3-oxo-1,4-cyclohexadiene carbaldehyde |
CAS: 35692-95-6 Use(s): natural substances and extractives | |
2- | hydroxy-4,4,6-trimethyl-2,5-cyclohexadien-1-one |
CAS: 28750-52-9 Use(s): natural substances and extractives | |
4- | hydroxy-2,2,6-trimethyl cyclohexanone |
CAS: 20548-02-1 Use(s): information only not used for fragrances or flavors | |
3- | hydroxy-2,6,6-trimethyl-4-oxo-2-cyclohexene carbaldehyde |
CAS: 33399-08-5 Use(s): natural substances and extractives | |
2- | hydroxy-3,5,5-trimethyl-2-cyclohexene-1,4-dione |
CAS: 35692-98-9 Use(s): natural substances and extractives | |
2- | hydroxy-3,4,4-trimethyl-2-cyclopentenone |
CAS: 86702-81-0 Use(s): information only not used for fragrances or flavors | |
2- | hydroxy-3,4,5-trimethyl-2-cyclopenten-1-one |
CAS: 109682-87-3 Use(s): flavor and fragrance agents | |
2- | hydroxy-3,5,5-trimethyl-2-cyclopenten-1-one |
CAS: 53263-56-2 Use(s): natural substances and extractives | |
cis-2- | hydroxy-3,4,5-trimethyl-2-cyclopenten-1-one |
CAS: 125476-24-6 Use(s): information only not used for fragrances or flavors | |
trans-2- | hydroxy-3,4,5-trimethyl-2-cyclopenten-1-one |
CAS: 125476-23-5 Use(s): information only not used for fragrances or flavors | |
hydroxy-2,2,4-trimethyl pentyl isobutyrate | |
CAS: 93951-35-0 Use(s): information only not used for fragrances or flavors | |
10- | hydroxy-3,6,10-trimethyl-3-undecen-2-one |
CAS: 68141-19-5 Use(s): fragrance agents | |
6- | hydroxytropinone |
CAS: 5932-53-6 Use(s): natural substances and extractives | |
5- | hydroxytryptophan |
CAS: 56-69-9 Use(s): food additive | |
hydroxytyrosol | |
CAS: 10597-60-1 Use(s): cosmetic ingredient for skin conditioning | |
11- | hydroxyundecanoic acid |
CAS: 3669-80-5 Use(s): information only not used for fragrances or flavors | |
hydroxyvalerenic acid | |
CAS: 1619-16-5 Use(s): natural substances and extractives | |
5- | hydroxyvanillin |
CAS: 3934-87-0 Use(s): information only not used for fragrances or flavors | |
1- | hydroxyxanthone |
CAS: 719-41-5 Use(s): natural substances and extractives | |
hyenanchin | |
CAS: 3484-46-6 Use(s): natural substances and extractives | |
hymenolane | |
CAS: 62121-29-3 Use(s): natural substances and extractives | |
alpha- | hymentherene |
CAS: 6876-07-9 Use(s): natural substances and extractives | |
hyperoside | |
CAS: 482-36-0 Use(s): food additive | |
hypophyllanthin | |
CAS: 33676-00-5 Use(s): information only not used for fragrances or flavors | |
hypoxanthine | |
CAS: 68-94-0 Use(s): natural substances and extractives |